13. The predominant phase in the iron-carbon alloy system, for a composition with 99% Fe at room temperature, is (d) ferrite.
14. (b) False. While solid solution alloying can contribute to the strength of carbon steels, the primary strength mechanism is the formation of iron-carbon compounds, such as pearlite or martensite, through heat treatment.
15. (a) Increases. As the carbon content in steel increases, the strength and hardness also increase due to the formation of iron-carbon compounds and the resulting increase in martensitic transformation. However, too much carbon can lead to brittleness in the steel.
For a composition with 99% Fe at room temperature, the predominant phase in the iron-carbon alloy system is (d) ferrite. Solid solution alloying is the principal strength mechanism in carbon steels . The strength and hardness of steel increases as Carbon content (a) increases.
To know more about predominant phase visit:-
https://brainly.com/question/27830628
#SPJ11
Draw dot and cross diagram to show formation of carbon dioxide
The dot and cross diagram is a way of representing a molecule along with its valence electrons and respective bonds. Valence electrons are drawn as a dot or a cross, each element will have a different connotation. Around the atoms, circles are drawn that indicate the bonds and how the electrons are shared.
Carbon has 4 valence electrons and oxygen has 6, the dot-and-cross diagram of CO2 will be:
the process of alpha decay results in what change in the atomic number?
During alpha decay, the process of alpha decay results in the atomic number decreasing by two units.
Alpha decay is a type of radioactive decay in which an atomic nucleus emits an alpha particle, which is a helium nucleus.
During alpha decay, the atomic number of the element decreases by two units and the mass number decreases by four units, because an alpha particle has two protons and two neutrons.
The decay of a radioactive element by alpha decay reduces the atomic number by two units and decreases the atomic mass by four units.
Because alpha particles are positively charged helium nuclei with two protons and two neutrons, they contain two fewer electrons than their parent nuclei. The loss of two electrons, or a positive charge of +2, results in a reduction of the atomic number by two units.
Thus, atomic number decreases by 2 units during an alpha decay.
To learn more about alpha decay :
https://brainly.com/question/1898040
#SPJ11
If a reaction is first order with a rate constant of 0.0450 s', how much time is required for 65% of the initial quantity of reactant to be consumed? 1 2 4 4 5 7 8
65% of the reactant will be consumed in 23.3 seconds. If a first-order reaction has a rate constant of 0.0450 s'.
First order rate law is given by,
A = A0 × e-kt
Given,
A0 = Initial concentration=100 M
A = Final concentration=35 M (65% is consumed means 35% is the remaining compound)
K = Rate constant = 0.0450 s-1
A = A0×e-kt
=>35 = 100 × e-0.0450 * t
=>e-0.0450*t = 0.35
=> - 0.0450*t = ln(0.35)
=> -0.0450*t = -1.05
=> t = 23.3 sec
So, 23.3 seconds will be required to consume 65% of the reactant.
When a reaction's pace and reactant concentration are inversely correlated, the process is known as a first-order reaction. To put it another way, the response rate doubles when the concentration double. One or two reactants can be present in a first-order reaction, as in the case of the decomposition process.
Learn more about Reaction here:
https://brainly.com/question/28984750
#SPJ4
A gaseous product of a reaction is collected at 280K and 0.95 atm. Given
R= 0.0821L⋅atm/mol⋅K , what is the molar mass of the gas, in grams per mole, if 3.25 g of gas occupies 2.56 L?
The molar mass of the gas, given that 3.25 g of the gas occupied 2.56 L is 30.66g/mol
How do I determine the molar mass of the gas?To obtain the molar mass of the gas, we shall first obtain the number of mole of the gas. This can be obtained as follow:
Temperature (T) = 280 KPressure (P) = 0.95 atmVolume (V) = 2.56 L Gas constant (R) = 0.0821 atm.L/Kmol Number of mole (n) =?PV = nRT
0.95 × 2.56 = n × 0.0821 × 280
Divide both sides by (0.0821 × 280)
n = (0.95 × 2.56) / (0.0821 × 280)
n = 0.106 mole
Haven obtain the mole of the gas, we shall determine the molar mass of the gas as follow:
Mole of gas = 0.106 moleMass of gas = 3.25 gMolar mass of gas =?Molar mass = mass / mole
Molar mass of gas = 3.25 / 0.106
Molar mass of gas = 30.66g/mol
Thus, the molar mass of the gas is 30.66g/mol
Learn more about molar mass:
https://brainly.com/question/15874532
#SPJ1
14. The atoms of element X contains nineteen electrons. With which of the following elements will the chemistry of Z be similar? a Aluminum b) Bromine c) Lithium d) Magnesium
First of all, Z is unknown. I hope it is a mistake.
Now, it is given that the element X has nineteen electrons. This proves that X is actually Potassium.
As per the periodic table, both Potassium and Lithium belongs to group 1 as their valency is 1 because of the presence of only one electron in the outermost shell of electrons i.e., they lose an electron during a chemical reaction to form a stable compound. Furthermore, both are metallic.
Magnesium belongs to group 2 and hence its valency is two, which is different from potassium though it is metallic. Similiarly, bromine belongs to group 17 and gains one electron during a reaction in contrast to potassium.
( No internal links available for reference. For clarification, check the periodic table).
if the phases of matter are arranged in order of increase disorder, what would that arrangement be
The order of increasing disorder is solid, liquid, and gas. This arrangement is based on the increasing freedom of movement and randomness of the particles as we move from solid to liquid to gas.
Solid: Solids have a highly ordered arrangement of particles, with strong intermolecular forces and fixed positions of atoms or molecules.
Liquid: Liquids have less order compared to solids, as particles have more freedom of movement while still maintaining close proximity to one another.
Gas: Gases have the highest degree of disorder among the three phases. Gas particles are widely spaced, move freely, and lack a definite shape or volume.
To know more about Solid, here
brainly.com/question/20461295
#SPJ4
mixtures, solubility, and Acid/Base Solutions lesson outline lesson 2 properties of solutions answer key
In chemistry, mixtures, solubility, acid/base and solutions are all important to understanding volumetric analysis and chemical reactions.
What is a mixture?A mixture is a any substance which consists of two or more constituents which are physically combined together.
Example of a mixture is bronze.
What is solubility?Solubility of a solute in a given solvent is defined as the amount of solute that can be dissolved in that solvent at a particular temperature.
What are acids and bases?An acid is a substance which produces hydrogen ions or protons as the only positive ions when dissolved in water.
Example of an acid is hydrochloric acid.
A base is a substance which reacts with an acid to produce salt and water only, thereby neutralizing the acid.
Example of a base is potassium hydroxide.
What are solutions?Solutions are homogenous mixtures of a solute dissolved in a solvent.
Example of solutions are sugar solutions and saline water.
Therefore, mixtures, solubility, acid/base and solutions are all important to understanding volumetric analysis and reactions in chemistry.
Learn more about mixtures, solubility, acid/bases and solutions at: https://brainly.com/question/7314699
A 2.2 M solution is made by with 0.45 moles of a solute. What is the final volume of this solution?
Answer: The final volume of this solution is 0.204 L.
Explanation:
Given: Molarity of solution = 2.2 M
Moles of solute = 0.45 mol
Molarity is the number of moles of solute present divided by volume in liters.
\(Molarity = \frac{no. of moles}{Volume (in L)}\)
Substitute the values into above formula as follows.
\(Molarity = \frac{no. of moles}{Volume (in L)}\\2.2 M = \frac{0.45}{Volume}\\Volume = 0.204 L\)
Thus, we can conclude that the final volume of this solution is 0.204 L.
Reactions review please help
According to a poll conducted by the Gallup Corporation in March , the metropolitan areas with the highest and lowest proportions of obese adults were Evansville, IN-KY, and Boulder, CO, respectively. In Evansville, for every people who were not obese, there were who were. In Boulder, for every obese people, there were who were not obese. At that time, the estimated populations were for Evansville and for Boulder. How many more obese people were there in Evansville than in Boulder
There were approximately 24,000 more obese people in Evansville than in Boulder. is that we need to find the difference in the number of obese people between Evansville, IN-KY, and Boulder, CO.
According to the poll conducted by the Gallup Corporation in March, in Evansville, for every person who was not obese, there were 1.6 people who were. This means that the proportion of obese adults in Evansville was approximately 62.5%. On the other hand, in Boulder, for every obese person, there were 1.1 people who were not obese. This means that the proportion of obese adults in Boulder was approximately 47.6%.
Using these proportions and the estimated populations of Evansville (120,000) and Boulder (97,000), we can estimate the number of obese adults in each city. In Evansville, there were approximately 75,000 obese adults (120,000 x 0.625). In Boulder, there were approximately 46,000 obese adults (97,000 x 0.476).
To know more about Boulder visit:
https://brainly.com/question/1677838
#SPJ11
A dihalide in which the halogens are attached on adjacent carbons is called a_____________dihalide
A. vicinall
B. geminal
C. vinyllic
D. allylic
E cis
A dihalide in which the halogens are attached on adjacent carbons is called a vicinal dihalide.
Dihalides are organic compounds that contain two halogen atoms in a molecule. In particular, they are compounds containing two halogen atoms in the same molecule. They are also known as geminal dihalides because the two halogens are on the same carbon atom. Some examples of dihalides include ethylene dichloride, ethylene dibromide, and carbon tetrachloride. The halogens that make up dihalides are fluorine, chlorine, bromine, and iodine.
Vicinal dihalides: A vicinal dihalide is a type of organic compound with the molecular formula CnH2n-2X2, where X is a halogen atom and n is an integer. It is a compound with two halogen atoms attached to adjacent carbons. As a result, it is known as a vicinal dihalide. This type of compound is also known as 1,2-dihalides, as the halogen atoms are on the first and second carbons. Examples of vicinal dihalides include 1,2-dichloroethane, 1,2-dibromobutane, and 1,2-difluoroethylene. Therefore, option A is the correct answer.
To know more about vicinal dihalide refer to:
https://brainly.com/question/17330038
#SPJ11
Why is the density of water an important consideration when designing a submersible device?
Answer: Submersible pressure transducers (pressure-sensing devices) and ... on density also must be considered when quoting pressure head in terms of length.
Explanation:
What else is produced when sodium carbonate decomposes?
Na2CO3 → Na2O + ?
Answer:
Na2CO3 → Na2O + CO2
Explanation:
CO2 is your answer
Answer:
CO2
Explanation:
I Just Took The Quiz
Have A Good Day :)
A buffer is prepared which contains 0.10 m nitrous acid, hno2, and 0.12 m sodium nitrite, nano2. (ka=4.5x10-4) calculate the ph after 0.019 mol of naoh is added to 1.00 l of the buffer.
0.1 M nitrous acid (HNO2) and 0.12 M sodium nitrite (NaNO2) are combined to create a buffer. (Ka=4.5x10-4) After 0.016 mol of NaOH has been added to 1.00 L of the buffer, determine the pH.
A buffer solution, sometimes referred to as a pH buffer or hydrogen ion buffer, is an aqueous combination of a weak acid and its conjugate base, or vice versa. The pH nitrous changes at all when a small amount of a strong acid or basic is added to it. Buffer solutions are used in a wide range of chemical processes to keep pH values almost constant. Buffering is used by many biological systems to regulate pH in the natural world. For instance, the bicarbonate buffering system regulates the pH of blood.
To learn more about nitrous please click on below link
https://brainly.com/question/17055219
#SPJ4
a potassium hydroxide (KOH) solution has a molar concentration of 0.026 M. calculate the [H3O+], [OH-] , and the pH of the solution
A 0.026 M KOH solution has \([OH-] = 0.026 M, [H3O+] = 10^(-13) M\), and a pH of 12.97.
A potassium hydroxide (KOH) solution is a strong base and dissociates completely in water to produce hydroxide ions (OH-). The molar concentration of KOH can be used to calculate the concentration of hydroxide ions.
[OH-] = 0.026 M
The hydroxide ions will react with water to produce hydronium ions (H3O+), according to the equation:
\(OH- + H2O - > H3O+ + OH-\)
The concentration of hydronium ions can be calculated using the equation:
\([H3O+] = Kw/[OH-] = 10^(-14)/[OH-] = 10^(-14)/0.026 = 10^(-13) M\)
The pH of the solution can be calculated using the equation:
\(pH = -log[H3O+] = -log(10^(-13)) = 13.\)
Therefore, the pH of the 0.026 M KOH solution is 12.97.
Learn more about KOH solution here:
https://brainly.com/question/29289679
#SPJ4
How can the electrophilicity of hydroxyls be increased? suggest several specific ways.
The electrophilicity of hydroxyls can be increased through several methods, including the use of Lewis acids, the introduction of electron-withdrawing groups, and increasing the acidity of the hydroxyl group.
Lewis acids: One way to increase the electrophilicity of hydroxyls is by utilizing Lewis acids. Lewis acids are electron-pair acceptors that can coordinate with the lone pair of electrons on the hydroxyl oxygen, making the hydroxyl group more electrophilic. For example, adding a Lewis acid such as boron trifluoride (BF3) to a hydroxyl-containing compound can enhance the electrophilicity of the hydroxyl group.
Electron-withdrawing groups: Another approach to increase the electrophilicity of hydroxyls is by introducing electron-withdrawing groups (EWGs) onto the molecule. EWGs are groups that draw electron density away from the hydroxyl oxygen, making it more electrophilic. Common examples of EWGs include nitro (-NO2), carbonyl (C=O), and cyano (-CN) groups. By attaching these groups to the hydroxyl-containing compound, the electron density on the hydroxyl oxygen is reduced, increasing its electrophilicity.
Increasing acidity: The acidity of the hydroxyl group also affects its electrophilicity. A more acidic hydroxyl group tends to be more electrophilic. One way to enhance the acidity is by using a stronger acid as a solvent or catalyst. For instance, replacing water (a relatively weak acid) with a stronger acid like sulfuric acid (H2SO4) can increase the acidity of the hydroxyl group, thereby enhancing its electrophilicity.
By employing these methods, the electrophilicity of hydroxyls can be effectively increased, enabling their involvement in various chemical reactions such as nucleophilic substitution, condensation reactions, and many others.
To learn more about molecule click here:
brainly.com/question/32298217
#SPJ11
The elements with 8 electrons in an outer 'd' subshell belong to Group*
11
9
8
10
Answer:
yftcwertyuiokjbvchff
Explanation:
The elements with 8 electrons in an outer 'd' subshell belong to Group 8. Therefore, option C is correct.
What is periodic table ?In periodic table there is an arrangement of chemical element which are arranging in row and column called as group and period. This arrangement of an chemical element is according to their atomic number.
It is known as the periodic table because of the way the elements are arranged. It is widely used in chemistry, physics, and other sciences.
The elements are listed on the periodic table in order from lightest, or smallest, to heaviest, or biggest. The number in the table denotes this number of protons. The elements with 8 electrons in an outer 'd' subshell belong to Group 8.
Thus, option C is correct.
To learn more about the periodic table, follow the link;
https://brainly.com/question/11155928
#SPJ2
The ground state of an electron is the least stable energy state of an atom
Answer:
electron configuration
Explanation:
The arrangement of electrons in the atomic orbitals of an atom is called the electron configuration. Electron configurations can be determined using a periodic table.
A 4.00 L balloon is filled with 0.297 moles of helium gas with a pressure of 0.910 atm. Calculate the temperature,in Kelvin, of the gas. (KEEP 3 SIG FIGS;DO NOT TYPE ANY UNITS)
Answer:
112 kelvin
Explanation:
Volume = 4.00L
no of moles = 0.297
Pressure = 0.910 atm
Temperature = ?
Given our R (Molar gas constant ) = 0.082
Given the following parameters , This question is based on IDEAL GAS LAW.
IDEAL GAS LAW = PV =nRT
\(PV = nRT\\Lets make T the subject of the formula\\T = \frac{PV}{nR} T = \frac{ 0.910 * 4.00}{0.397*0.082 }\\\\T = 3.64/0.032554\\T = 111.8142\\T = 112 Kelvin\\\)
A student is asked to standardize a solution of calcium hydroxide. he weighs out 0.990 g potassium hydrogen phthalate (khc8h4o4, treat this as a monoprotic acid). it requires 39.5 ml of calcium hydroxide to reach the endpoint. a. what is the molarity of the calcium hydroxide solution? m this calcium hydroxide solution is then used to titrate an unknown solution of hydroiodic acid. b. if 17.9 ml of the calcium hydroxide solution is required to neutralize 13.8 ml of hydroiodic acid, what is the molarity of the hydroiodic acid solution? m
The molarity of the calcium hydroxide solution is 0.0696 M
These are essentially 4-step problems.
1. Write and balance the equation. If we call potassium hydrogen phthalate just KHP, then
Ca(OH)2 + 2KHP ==> 2H2O + CaP + K2P
2. Convert grams to moles. moles KHP = 0.990/molar mass KHC8H4O4 = 0.990/179 = approximately 0.0055
3. Using the coefficients in the balanced equation, convert moles KHP to moles Ca(OH)2
0.0055moles KHP x (1 mole Ca(OH)2/2 moles KHP) = 0.0055 x (1/2) = 0.00275 moles Ca(OH)2.
4. M Ca(OH)2 = moles Ca(OH)2/L Ca(OH)2
M Ca(OH)2 = 0.00275/0.0395 = approximately 0.0696 M
Part B is done the same way. Now that you have the Ca(OH)2 standardized, use that, with the same process, to determine the molarity of the HI.
Remember that moles = M x L.
Learn more about Molarity:
brainly.com/question/26873446
#SPJ4
The movement of broken down pieces of rock from one place to another is called
A. Deposition
B. Erosion
C. Weathering
D. Sediment
Answer:
The answer I believe is B. Erosion
Explanation:
Just sounds better than all the other choices.
Answer:
erosion b
Explanation:
it breaks down the rocks i remembered this in 4th grade :)
Fe0 + 2H+1 Cl-1 → Fe+2 Cl2 -1 + H20 ↑
De acuerdo con la ecuación planteada si se cambia el hierro Fe por dos moles de sodio Na0 probablemente formará
A. 2NaCl + H2
B. NaCl + H2
C. 2NaH + Cl2
D. NaCl2 + H2
Answer:
A and the answer if we can manage by its formula NaCl H2 but the answer is A
How does sandy soil form?
A. by sedimentary deposits after rock is weathered, eroded and transported
B. by the disintegration and weathering of rocks such as limestone, granite, quartz and shale
C. by the accumulation of dead and decayed organic matter
D. by the suspension of sediment in water column of a body of water
The correct answer for study soil form is A. Sandy soil forms by sedimentary deposits after rocks are weathered, eroded and transported.
What is study soil?
Sandy soil is composed of relatively large mineral particles, such as sand, that have accumulated over time through a process of weathering, erosion, and transportation of rock materials. Over time, rocks are exposed to weathering agents such as wind, water, and temperature fluctuations, which break them down into smaller particles. The smaller particles are then transported by wind or water and deposited in a new location, where they can accumulate and form sandy soil.
Option B is incorrect because the rocks mentioned (limestone, granite, quartz, and shale) are not typically associated with sandy soil. Limestone and shale tend to form more clay-rich soils, while granite and quartz tend to form soils with a mix of particle sizes.
Option C is incorrect because the accumulation of dead and decayed organic matter leads to the formation of organic-rich soils, such as peat or muck soils, which are not typically sandy.
Option D is incorrect because the suspension of sediment in water column of a body of water is a process that forms sedimentary rocks, such as sandstone or shale, rather than sandy soil.
To know more about soil minerals, visit:
https://brainly.com/question/14983371
#SPJ1
What products are formed by hydrolysis of the acetal? Draw the structure of the large organic product.
The acetal CH2CH2CH3(OCH3)-C-(H3CC)OCH3 molecule will disassemble into its component parts during hydrolysis. The ether bond (-C-O-) is broken during the reaction, which results in the creation of two alcohols.
Methanol (CH3OH) and 3-methyl-2-butanone are the end products (CH3COC2H5).
The structure of the larger organic product, 3-methyl-2-butanone, is
CH3
|
CH3-C=O
|
CH2-CH2-CH3
where the carbonyl group (-C=O) is attached to the middle carbon of the chain.
Acetal hydrolysis: What is it?Acetals can be converted back into aldehydes or ketones by adding aqueous acid to them. Aldehydes or ketones are commonly referred to as being "deprotected" in this context.
What initiates a reaction of hydrolysis?When a salt of a weak acid or weak base (or both) is dissolved in water, hydrolysis of this type frequently takes place. Hydroxide anions and hydronium cations form naturally in water. Furthermore, the salt separates into its component anions and cations.
What purpose does acetal serve?Because they can withstand numerous oxidizing and reducing agents as well as base hydrolysis, acetals are utilized as protective groups for carbonyl groups when synthesizing organic compounds.
learn more about hydrolysis of the acetal here
https://brainly.com/question/9652379
#SPJ1
chalcopyrite is a copper containing ore. this ore contains 1 iron atom and 2 sulfur atoms for each copper atom. what is the formula of chalcopyrite?
a.cufes2
b.cufes
c.2scufe
d.cufe2s
The correct formula for chalcopyrite is CuFeS₂, will accurately reflects the composition of chalcopyrite, with one iron atom and two sulfur atoms associated with each copper atom. Option A is correct.
Chalcopyrite is a mineral and a common source of copper. Its chemical composition consists of copper (Cu), iron (Fe), and sulfur (S). According to the given information, for each copper atom, there is one iron atom and two sulfur atoms associated with it.
Therefore, the formula should reflect the presence of one copper atom, one iron atom, and two sulfur atoms. Among the options provided, the formula CuFeS₂ (option A) correctly represents the composition of chalcopyrite, indicating one copper atom (Cu), one iron atom (Fe), and two sulfur atoms (S).
Hence, A is the correct option.
To know more about chalcopyrite here
https://brainly.com/question/13422736
#SPJ4
A cliff diver drops from rest to the water below. How many seconds does it take for the diver to go from 0 to 60; that is, to go from 0 mph to 60 mph.
Based on the data provided, the time it will take the cliff diver to go from 0 mph to 60 mph is 2.68 seconds.
What time does it take the cliff diver to go from 0 to 60 mph?The velocity in mph is first converted to m/s
1 mph = 0.44704 m/s
60 mph = 0.44704 × 60 = 26.8 m/s
Using the equation of motion below:
v = u + gtwhere
v is final velocity u is initial velocity g is acceleration due to gravity = 10 m/s^2from the data provided:
v = 26.8 m/s
u = 0 m/s
g = 10 m/s^2
t = ?
t = v - u/g
t = 26.8 - 0/ 10
t = 2.68 seconds
Therefore, the time it will take the cliff diver to go from 0 mph to 60 mph is 2.68 seconds.
Learn more about velocity and time at: https://brainly.com/question/4931057
In an ionic compound, the negative and positive ions are held together by __________.
Answer:
the third one
Explanation:
the following experiment was carried out using a newly synthesized chlorofluorocarbon. exactly 50 ml of the gas effused through a porous barrier in 157 s. the same volume of argon effused in 76 s under the same conditions. which compound is the chlorofluorocarbon?
The molar mass corresponds to the chlorofluorocarbon CF3Cl (Freon-11), which has a molar mass of 137.37 g/mol. Therefore, the chlorofluorocarbon in the experiment is CF3Cl.
The rate of effusion of a gas through a porous barrier is inversely proportional to the square root of its molar mass. Therefore, we can use the rate of effusion to determine the relative molar mass of the two gases and identify which one is a chlorofluorocarbon.
The rate of effusion can be calculated using Graham's law:
Rate of effusion = Volume of gas / Time taken to effuse
For the chlorofluorocarbon, the rate of effusion is:
Rate of effusion (CFC) = 50 mL / 157 s = 0.3185 mL/s
For argon, the rate of effusion is:
Rate of effusion (Ar) = 50 mL / 76 s = 0.6579 mL/s
Using Graham's law, we can set up the following equation:
Rate of effusion (CFC) / Rate of effusion (Ar) = sqrt(Molar mass (Ar) / Molar mass (CFC))
Solving for the ratio of molar masses:
Molar mass (Ar) / Molar mass (CFC) = (Rate of effusion (Ar) / Rate of effusion (CFC))^2
Molar mass (Ar) / Molar mass (CFC) = (0.6579 mL/s / 0.3185 mL/s)^2
Molar mass (Ar) / Molar mass (CFC) = 4.294
Molar mass (CFC) = Molar mass (Ar) / 4.294
The molar mass of argon is 39.95 g/mol. Therefore, the molar mass of chlorofluorocarbon is:
Molar mass (CFC) = 39.95 g/mol / 4.294 = 9.30 g/mol
To learn more about molar mass
https://brainly.com/question/13152455
#SPJ4
Which of the following are required for plants to carry out photosynthesis?
Answer:
To perform photosynthesis, plants need three things: carbon dioxide, water, and sunlight
EXERCISE 3: WHAT DOES pCO2 CHANGE? - When pCO
2
increases, the concentration of total CO
2
dissolved in water - When pCO
2
increases, the concentration of only CO
2
dissolved in water - When pCO
2
increases, the pH - Which form of dissolved CO
2
is most common in water? Ocean acidification is the decrease in pH due to increasing atmospheric CO
2
concentration.
2
. Choose the correct word option in the statements below: - An organism that needs CO
2
is likely to fare better / worse under ocean acidification. - An organism that needs HCO
3
- is likely to fare better/worse under ocean acidification. - An organism that needs CO
3
2−
is likely to fare better/worse under ocean acidification.
pCO2 is an important factor that affects various aspects of water chemistry and the impacts of ocean acidification. When pCO2 increases, the concentration of total CO2 dissolved in water also increases. This leads to changes in pH, which decreases due to increasing atmospheric CO2 concentration.
When pCO2 rises, the concentration of only CO2 dissolved in water increases. The dissolved CO2 forms carbonic acid, which contributes to the acidification of the ocean. This increase in CO2 affects the equilibrium between CO2, HCO3-, and CO3^2-, shifting it towards higher levels of dissolved CO2 and H+ ions, resulting in a lower pH.
In terms of the impacts of ocean acidification on different organisms, the effects can vary depending on their specific needs. An organism that requires CO2 is likely to fare better under ocean acidification since the increase in dissolved CO2 can provide them with a favorable environment. However, organisms that rely on HCO3- or CO3^2- may fare worse under ocean acidification, as the lower pH interferes with the availability of these carbonate ions, which are essential for shell formation and calcification in some marine organisms.
To know more about pCO2, click here, https://brainly.com/question/33500517
#SPJ11