Answer:
2.99 M
Explanation:
In order to solve this problem we need to keep in mind the definition of molarity:
Molarity = moles of solute / liters of solutionIn order to calculate the moles of solute, we convert 125.6 g of NaF into moles using its molar mass:
125.6 g NaF ÷ 42 g/mol = 2.99 mol NaFAs the volume is already given, we can proceed to calculate the molarity:
Molarity = 2.99 mol / 1.00 L = 2.99 MThe decomposition of potassium chlorate (KClO3) is used as a source of oxygen in the laboratory. How much potassium chlorate is needed to produce 19.4 mol of oxygen?
Answer: 6.47 moles of (KClO3) will be needed
Explanation:
There are 3 atoms of oxygen in each potassium chlorate molecule.
divide the desired number of moles of oxygen by three and you have your answer.
Which type of macromolecule carries genetic information from parents to
their children?
A. Nucleic acids
B. Carbohydrates
C. Proteins
D. Lipids
Answer: Its A nucleic acids
Explanation:
Nucleic acids, and DNA in particular, are key macromolecules for the continuity of life. DNA bears the hereditary information that's passed on from parents to children, providing instructions for how (and when) to make the many proteins needed to build and maintain functioning cells, tissues, and organisms.
Nucleic acids carry genetic information from parents to their children.
What are Nucleic acids?Nucleic acids are biopolymers, macromolecules, essential to all known forms of life.[1] They are composed of nucleotides, which are the monomers made of three components: a 5-carbon sugar, a phosphate group and a nitrogenous base. The two main classes of nucleic acids are deoxyribonucleic acid (DNA) and ribonucleic acid (RNA). If the sugar is ribose, the polymer is RNA; if the sugar is the ribose derivative deoxyribose, the polymer is DNA.
Nucleic acids are naturally occurring chemical compounds that serve as the primary information-carrying molecules in cells and make up the genetic material. Nucleic acids are found in abundance in all living things, where they create, encode, and then store information of every living cell of every life-form on Earth. In turn, they function to transmit and express that information inside and outside the cell nucleus to the interior operations of the cell and ultimately to the next generation of each living organism. The encoded information is contained and conveyed via the nucleic acid sequence, which provides the 'ladder-step' ordering of nucleotides within the molecules of RNA and DNA. They play an especially important role in directing protein synthesis.
Learn more about Nucleic acids
https://brainly.com/question/2488520
#SPJ2
Please help me do this
The total mass of the balloon and its content is 1521.17 g, the number of moles of CO₂ in the balloon is 34.15 mol, and the number of CO₂ molecules in the balloon is 2.06 x 10²⁵ molecules.
a) The molar mass of CO₂ is 44.01 g/mol. To find the total mass of the balloon and its content, we need to add the mass of the balloon (20g) to the mass of the CO₂ inside the balloon.
Mass of CO₂ = number of moles of CO₂ x molar mass of CO₂
Since the balloon is at STP (standard temperature and pressure), we can use the molar volume of a gas at STP (22.4 L/mol) to find the number of moles of CO₂ in the balloon:
Volume of CO₂ = Volume of balloon = 765 L (at STP)
Number of moles of CO₂ = volume of CO₂ / molar volume of a gas at STP
= 765 L / 22.4 L/mol
= 34.15 mol
Mass of CO₂ = 34.15 mol x 44.01 g/mol
= 1501.17 g
Total mass of balloon and its content = 20 g + 1501.17 g
= 1521.17 g
b) Number of moles of CO₂ in the balloon is 34.15 mol
c) To find the number of CO₂ molecules in the balloon, we need to use Avogadro's number (6.02 x 10²³ molecules/mol).
Number of CO₂ molecules = number of moles of CO₂ x Avogadro's number
= 34.15 mol x 6.02 x 10²³ molecules/mol
= 2.06 x 10²⁵ molecules
To know more about the Mass, here
https://brainly.com/question/22104139
#SPJ1
if two magnets are placed on a table, which statement describes a situation with the most attraction between the two magnets
The north pole of one magnet is near the South pole of the other magnet.
The ends of a magnet are called its poles. One end is called the north pole, the other is called the south pole. If you line up two magnets so that the south pole of one faces the north pole of the other, the magnets will pull toward each other.
Consider this reaction: HCO3− + H2S → H2CO3 + HS− Which is the Bronsted-Lowry base? H2S HCO3- HS– H2CO3
Answer:
hco3
Explanation: bc i said so
A 25.00 g sample of hydrated sodium carbonate, NaCO3 • H2O, is heated to drive off the water. After heating, 9.257 g of anhydrous NaCO3 remains. What is the value of "n" in the hydrate formula?
Value of "n" in the hydrate formula Na₂CO₃.nH₂O is 0.874, or approximately 7/8. The formula for the hydrated compound is Na₂CO₃.7/8H₂O.
What is hydrate ?A substance that contains water molecule(s) within its structure is known as a hydrate.
As , mass of water lost = Mass of hydrated sample - Mass of anhydrous sample.
So, Mass of water lost = 25.00 g - 9.257 g
Mass of water lost = 15.743 g
As, moles of water lost = (Mass of water lost) / (Molar mass of water)
So moles of water lost = 15.743 g / 18.015 g/mol
moles of water lost = 0.874 mol
0.874 mol H₂O / 1 mol Na₂CO₃ = n / 1
n = 0.874 mol H₂O/ 1 mol Na₂CO₃
n = 0.874
Therefore, value of "n" in the hydrate formula Na₂CO₃.nH₂O is 0.874, or approximately 7/8. The formula for the hydrated compound is Na₂CO₃.7/8H₂O
To know more about hydrate formula, refer
https://brainly.com/question/29405555
#SPJ1
The half reaction with a more positive standard reduction potential will
The half reaction with a more positive standard reduction potential will proceed spontaneously in a redox reaction
The half reaction with a more positive standard reduction potential will undergo reduction when compared to the half reaction with a more negative standard reduction potential.
Oxidation-reduction reactions, often known as redox reactions, are a set of chemical reactions that involve electron transfer between reactants. In a redox reaction, one reactant is oxidized, losing electrons, while the other reactant is reduced, gaining electrons.
The oxidation half-reaction is the process of losing electrons and increasing the oxidation number, whereas the reduction half-reaction is the process of gaining electrons and decreasing the oxidation number. The total reaction is referred to as the redox reaction.
Half-reaction:Half-reaction refers to the two parts of an oxidation-reduction reaction that happen separately. A half-reaction must always be either an oxidation reaction or a reduction reaction. It also describes the movement of electrons and hydrogen ions in an equation.
Know more about redox reaction here:
https://brainly.com/question/21851295
#SPJ8
A chemist titrates of a benzoic acid solution with solution at . Calculate the pH at equivalence. The of benzoic acid is .
pH and pOH Formulas
Concentration Formulas
pH = -log[H30)
[H30*) = 10-PH
pOH = -log(OH)
[OH] = 10-POH
pH + POH = 14.00
[H3O+][0] = 1.0 10-14
What is the hydronium (H30*) concentration of a solution with a pH of 3.60?
A 2.5 x 10^M
B 3.0 x 10-M
C 4.0 x 10M
D.
45* 10-11M
Answer:
A. 2.5 x 10^M
Explanation:
H+=10^-pH
- Hope that helps! Please let me know if you need further explanation.
Answer:
A. 2.5 x 10^M
Explanation:
i took the test and i got it correct (edmentum)
Lakes, rivers, or springs can form when:
A) limestone dissolves
B) groundwater reaches the surface
C) sand, silt, and clay are deposited
D) rain water seeps into the ground
Answer:
D.) rain water seeps into the ground
Explanation:
Obviously?
How many people were considered undernourished in Latin America and the Caribbean in 2018?
Question 4 options:
513.9 million
2.6 million
821.6 million
42.5 million
Formation of a copper(1) ion from a neutral copper atom
Please find the equation to form copper (I) ion from neutral copper (Cu) below:
The periodic table's 29th element, copper, has an electrical configuration of \([Ar]3d^{10} 4s^{1}\)An oxidation reaction occurs when an atom loses an electron to generate a positive ion.Here, to generate a positive ion, copper must lose one electron. The following equation describes how neutral copper atoms can produce copper (I) ions: \(Cu\) → \(Cu^{+} + 1e^{-}\)Oxidation is also the increase in the oxidation states of an atom or ion or atoms in a molecule. A redox reaction is a type of chemical reaction in which there is a transfer of electrons from an atom or ion to another resulting in a change in oxidation states of the substances involved. The reducing agent in the reaction is undergoes oxidation by losing electrons while the oxidizing agent is reduced that is it gains electrons at the end of the reaction. The atom or ion from which electron is lost is said to be oxidized while the other atom or ion involved in the reaction is reduced.Hence, the correct equation is mentioned above.
Learn more about oxidation here:
brainly.com/question/16976470
#SPJ9
write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
PLS HELP I WILL GIVE BRAINLIEST
Answer:
The answer has to be A, greater force of attraction than the gas, only
Explanation:
I really hope this helps! Have a good day and good luck!
10 grams of compound J is found to have a mass ratio of 8:2 of lithium (Li): Hydrogen (H). How many grams
of hydrogen would found in 42.0 grams of compound J?
Answer:
Mass of hydrogen in 42 gram of J = 8.4
Explanation:
Given:
Amount of compound J = 10 gram
Mass ratio[lithium (Li): Hydrogen (H)] = 8:2
Find:
Mass of hydrogen in 42 gram of J
Computation:
Mass of hydrogen in 10 gram of J = [2 / 10] 10
Mass of hydrogen in 10 gram of J = 2 gram
Mass of hydrogen in 42 gram of J = [2 / 10] 42
Mass of hydrogen in 42 gram of J = 8.4
A student mixes 50 mal of 1.00M Ba(OH)2 with 88.7 mL of 0.475M H2SO4.
A) calculate the mass of BaSO4 formed
B) calculate the pH of the mixed solution
Answer:
A. 9.83g
B. 13.06
Explanation:
A) To calculate the mass of BaSO4 formed, you need to first write the balanced equation for the reaction:
Ba(OH)2 + H2SO4 -> BaSO4 + 2H2O
Then, you need to find the limiting reactant, which is the one that runs out first and determines how much product is formed. You can do this by converting the volumes and concentrations of the solutions to moles and comparing them with the stoichiometric coefficients.
50 mL of 1.00 M Ba(OH)2 = 0.050 L x 1.00 mol/L = 0.050 mol Ba(OH)2 88.7 mL of 0.475 M H2SO4 = 0.0887 L x 0.475 mol/L = 0.0421 mol H2SO4
According to the equation, 1 mol of Ba(OH)2 reacts with 1 mol of H2SO4, so Ba(OH)2 is in excess and H2SO4 is the limiting reactant.
Next, you need to use the mole ratio between the limiting reactant and the product to find how many moles of BaSO4 are formed:
0.0421 mol H2SO4 x (1 mol BaSO4 / 1 mol H2SO4) = 0.0421 mol BaSO4
Finally, you need to multiply the moles of BaSO4 by its molar mass to get its mass:
0.0421 mol BaSO4 x 233.39 g/mol = 9.83 g BaSO4
So, the mass of BaSO4 formed is 9.83 g.
B) To calculate the pH of the mixed solution, you need to first find the concentration of OH- ions that remain after the reaction. You can do this by subtracting the moles of OH- that reacted with H+ from the initial moles of OH- and dividing by the total volume of the solution.
The initial moles of OH- are equal to the moles of Ba(OH)2:
0.050 mol Ba(OH)2 x (2 mol OH- / 1 mol Ba(OH)2) = 0.100 mol OH-
The moles of OH- that reacted with H+ are equal to the moles of H2SO4:
0.0421 mol H2SO4 x (2 mol H+ / 1 mol H2SO4) = 0.0842 mol H+
The remaining moles of OH- are:
0.100 mol OH- - 0.0842 mol H+ = 0.0158 mol OH-
The total volume of the solution is:
50 mL + 88.7 mL = 138.7 mL = 0.1387 L
The concentration of OH- is:
0.0158 mol OH- / 0.1387 L = 0.114 M
Next, you need to use the relationship between pH and pOH to find the pH:
pOH = -log[OH-] = -log(0.114) = 0.94 pH + pOH = 14 pH = 14 - pOH = 14 - 0.94 = 13.06
So, the pH of the mixed solution is 13.06.
F. How many moles of gas would be present in a gas trapped within a 0.300 L vessel at 15.0°C at
a pressure of 157.6 kPa?
This problem is providing the volume, temperature and pressure of a gas and asks for the number of moles at such conditions, which turns out to be 0.0160 mol.
Ideal gasesIn chemistry, we study ideal gases, which are assumed to be perfectly spherical and with no relevant neither attractions nor repulsions among molecules, with the widely-known ideal gas equation relating volume, temperature, pressure and moles as follows:
\(PV=nRT\)
Thus, knowing it is in a 0.300-L vessel at 15.0 °C and 157.6 kPa, one can solve for n in the previous equation to get:
\(n=\frac{PV}{RT}\)
And plug in by making sure the pressure is in atmospheres and the temperature in kelvins:
\(n=\frac{157.6kPa*\frac{1atm}{101.325kPa}*0.300L}{(0.08206\frac{atm*L}{mol*K})*(15.0+273.15)K}\\\\n=0.0160mol\)
Learn more about ideal gases: brainly.com/question/8711877
Given the following equation: Mg + 2HCI → MgCl₂ + H₂
How many moles of H₂ can be produced by reacting 2 moles
of HCI?
Taking into account the reaction stoichiometry, 1 mole of H₂ can be produced by reacting 2 moles of HCI.
Reaction stoichiometryIn first place, the balanced reaction is:
Mg + 2 HCl → MgCl₂ + H₂
By reaction stoichiometry (that is, the relationship between the amount of reagents and products in a chemical reaction), the following amounts of moles of each compound participate in the reaction:
Mg: 1 moleHCl: 2 molesMgCl₂: 1 moleH₂: 1 moleMoles of H₂ producedBy reaction stoichiometry 2 moles of HCl form 1 mole of H₂.
Learn more about the reaction stoichiometry:
brainly.com/question/24741074
brainly.com/question/24653699
#SPJ1
To make a solution for an experiment, Gunther needs to add 40 g of a solute to 100 g of water. When making the solution at room temperature, he could only add 34 grams before the solute settled out.
What could he do to dissolve the remaining 6 grams of the solute?
Answer:
B. Heat the solution, dissolve the solute, and let the solution cool verifying nothing settled out.
Explanation:
To dissolve more solute, the solution has been heated at a high temperature, and the cooling has been observed to verify proper dissolution.
The solubility of the compound has been the ability of the solvent to dissolve the solute molecules. For the solution formation, the intermolecular forces between the solute molecules have been broken in order to sustain the interaction between the solute and the solvent molecules,
The interaction between solute and solvent molecules results in the dissolution of the solute in the solvent.
When Gunther dissolves the 34 grams, of solute, the energy of the solvent molecules has been enough to break the solute interactions and dissolve the solute molecules.
However, in order to dissolve more molecules, the solvent molecules are provided with the energy that has been able to increase the kinetic energy of the solvent for the dissolution of more solute.
The kinetic energy of the solvent has been increased with the increase in the temperature, thereby adding to the more dissolution of the solute.
Thus, to dissolve more solute in the solvent, the solution has been heated at a high temperature, and the cooling has been observed to verify the absence of precipitate thereby proper dissolution.
For more information about the dissolution of solute into solvent, refer to the link:
https://brainly.com/question/14281527
Calculating equilibrium concentrations when the net reaction proceeds forward
Consider mixture B, which will cause the net reaction to proceed forward.
Concentration (M)initial:change:equilibrium:[XY]0.500−x0.500−xnet→⇌[X]0.100+x0.100+x+[Y]0.100+x0.100+x
The change in concentration, x, is negative for the reactants because they are consumed and positive for the products because they are produced.
Based on a Kc value of 0.140 and the given data table, what are the equilibrium concentrations of XY, X, and Y, respectively?
We must utilize the reaction's equilibrium equation to determine the equilibrium concentrations:
Kc = [X][Y]/[XY]
replacing the specified values:
0.140 = (0.100+x)(0.100+x)/(0.500-x)
Expanding and condensing:
0.14 = (0.01 + 0.2x + x^2)/(0.5 - x)
0.07 - 0.14x = x^2 + 0.2x + 0.01
Changing the order and applying the quadratic formula to find x
x^2 + 0.34x - 0.06 = 0
x = 0.193 or -0.533
X cannot be negative because it denotes a change in concentration. Consequently, x = 0.193 M.
It is now possible to determine the equilibrium concentrations:
[XY] = 0.500 - x = 0.307 M
[X] = [Y] = 0.100 + x = 0.293 M
Therefore, the equilibrium concentrations of XY, X, and Y are 0.307 M, 0.293 M, and 0.293 M, respectively.
Learn more about equilibrium concentrations, here:
https://brainly.com/question/16645766
#SPJ1
Consider the structure of capsaicin, the active ingredient in pepper spray. How many polar bonds are present in the molecular structure
The structure of capsaicin is shown in the image attached. There are four polar bonds in capsaicin.
What is capsaicin?Capsaicin is an organic molecule found in pepper spray. It is the major active ingredient used in the making of pepper spray. The structure of the molecule have been shown in the image attached to tis answer.
We can see that there are four polar bonds in the molecule. Note that polar bonds are bonds between two atoms that have a wide difference in electronegativity values.
Learn more about polar bonds. https://brainly.com/question/24775418
Collision theory states that as molecules or ions bump into each other, a reaction will only occur if the collision has the correct amount of energy and impact is at the right angle and location. Describe how collision theory helps predict how temperature, pressure, and concentration impact reaction rates. Question 5 of 11 Collision theory states that as molecules or ions bump into each other, a reaction will only occur if the collision has the correct amount of energy and impact is at the right angle and location. Describe how collision theory helps predict how temperature, pressure, and concentration impact reaction rates. As temperature increases, the number of collisions _______ and the energy of the collisions _______.
Answer: As temperature increases, the number of collisions increases and the energy of the collisions increases.
Explanation:
According to collision theory, for a reaction to take place it is necessary to have collisions between the reacting species or atoms.
A collision will only be effective if species coming together have a certain minimum value of internal energy equal to the activation energy of the reaction.
More is the number of collisions taking place in a chemical reaction more will be the kinetic energy of its molecules. As kinetic energy is the energy acquired due to motion of atoms or a substance.
Also, collisions increases with increase in temperature as:
\(K.E = \frac{3}{2}kT\)
Kinetic energy is directly proportional to temperature. So, more is the temperature more will be energy of molecules.
Thus, we can conclude that as temperature increases, the number of collisions increases and the energy of the collisions increases.
The owner of Grizzly Tea Shack is thinking about adding iced tea to the menu. He
thinks he can do this with minimal effort by adding ice cubes to cups of hot tea.
He decides to measure how changing the number of ice cubes in a glass of
freshly brewed tea affects its cooling rate.
To begin, the owner varies the number of ice cubes, x, he puts in glasses of
freshly brewed tea. He then checks the temperature (in Celsius), y, of each glass
after 10 minutes.
Ice cubes Temperature after 10 minutes (in degrees Celsius)
2
17
3
5
6
6
20
10
11
15
Round your answers to the nearest thousandth.
Answer: 5,266
Explanation:
5,266
What is the total amount of heat released in kilojoules when 112.0 g water at 50.0∘C cools to form ice at −45.0∘C? Use the following values for calculations, as needed.
Properties of Water−−−−−−−−−−−−−−−−−−Specific Heats(∘C)gas=1.84 J/g∘Cliquid=4.184 J/g∘Csolid=2.09 J/g∘C
Heat of VaporizationΔHvap=40.7 kJ/molHeat of FusionΔHfus=6.01 kJ/mol
Answer:
Q = 44.5 kJ
Explanation:
Given that,
Mass of water, m = 112 g
Water at 50.0°C cools to form ice at −45.0°C
We need to find the total amount of heat released. The formula for heat released is given by :
\(Q=mc\Delta T\)
c is the specific heat of water, c = 4.184 J/g°C
So,
\(Q=112\times 4.184 \times (-45-50)\\\\Q=-44517.76\ J\)
or
Q = -44.5 kJ
So, 44.5 kJ of heat is released.
Which of the following is an example of a mixture?
A.
calcium
B.
the atmosphere
C.
carbon dioxide
D.
water
Answer:
B. the atmosphere
Explanation:
hope it helps
How does Dr. Hayes' and Dr. Malaska’s research differ? Why are both research projects important?
Answer:
Answer: What can experiments in a lab tell us about substances on Titan? Experiments in a lab can tell us that the lake did not evaporate in 2007 because the molecular attraction was a lot stronger, then it got weaker overtime.
How does Dr. Hayes' and Dr. Malaska’s research differ? Why are both research projects important? Their research differs because they were both talking about different things, Hayes was talking about how many lakes there were, while Malaska's was doing more hands on stuff like experiments. Both are important because we need to learn how the lakes formed, but we also need to do hands on experiments.
Explanation:
Please I need help thank you
Answer:
its sodium hydroxide
Explanation:
Which of the following elements would you expect to have the greatest electron affinity? He, K, Co, S, Cl
The electron affinity of the given elements in question is Cl>S>Co>K>He, in the order of highest to lowest.
What is electron affinity?
When an electron is added to a neutral atom to create a negative ion, the energy of the atom changes (in kJ/mole). This is how electron affinity is defined. Or, the probability that a neutral atom will capture an electron.
The electron affinity decreases when we go left to right in the periodic table. But, there is a exception that the nobel gases has extremely low electron affinity. Among the given elements He is nobel gas so it has very low electron affinity and for the other elements we will check which element is located in left most position in periodic table that element has the highest electron affinity.
To know more about electron affinity, go to link
https://brainly.com/question/16995072
#SPJ9
Which one of the following will reduce vehicular NOx emissions?
A) washing the car
B) rolling down the windows instead of using the AC
C) keeping the car well tuned
D) pumping gas at night
Keeping the car well tuned with regular servicing helps to reduce the emission of oxides of nitrogen gas to the atmosphere. Hence, option B is correct.
What is NOₓ ?NOₓ is a representation of oxides of nitrogen gas. Nitrogen gas reacts with atmospheric oxygen produces NO, NO₂ etc. all are causing atmospheric pollution and other serious issues such as acid rain, global warming, ozone layer depletion etc.
Thus, it is very important to reduce the emission of oxides of nitrogen. Vehicles and industries are the main sources of NOₓ emission. Evolving these gas directly to air caused serious consequences.
Keeping the vehicles maintained regularly with ensuring that no gas leakage or over expulsion is there. Hence, option C is helpful to reduce the emission of this gas.
Find more on NOₓ:
https://brainly.com/question/30356019
#SPJ1
Which statement accurately describes a potential danger of radiation?
-Any amount of radiation exposure is dangerous.
-Higher amounts of radiation will always lead to death.
-Medium levels of radiation exposure will do little harm.
-Even small amounts of radiation over a prolonged period of time can be dangerous.
Answer:
Even small amounts of radiation over a prolonged period of time can be dangerous.
Explanation:
We all get exposed to radiation, such as through x-rays, and it's fine as one off experiences. However, if you're constantly dealing with radiation without any sort of protection, no matter how small the amount is, it could potentially lead to consequences like cancer. This is due to the fact that radiation can alter our genes