A cube of aluminum measures 3 cm on each side and weighs 81 g. What is its density? (HINT: find the volume of the block first)

D=

M=

V=

Answers

Answer 1

Answer:

27

Explanation: volume-3 times 6=18 /mass- 81 times 6= 486....  486 divided by 18 = 27.... a cube has 6 sides.

Answer 2
The density of the aluminum is 3 g/cm³

The density of a substance is simply defined as the mass of the subtance per unit volume of the substance.

\(Density = \frac{Mass }{Volume }\)

To obtain the density of the aluminum, we'll begin by calculating the volume of the aluminum. This can be obtained as follow:

From the question given above, each side of the aluminum cube measures 3 cm. Thus,

Length (L) = 3 cm

Width (W) = 3 cm

Height (H) = 3 cm

Volume = Length × Width × Height

Volume = 3 × 3 × 3

Volume = 27 cm³

Therefore, the volume of the aluminum is 27 cm³

Finally, we shall determine the density of the aluminum. This can be obtained as follow:

Mass = 81 g

Volume = 27 cm³

Density =?

\(Density = \frac{Mass }{Volume }\\\\Density = \frac{81}{27}\)

Density = 3 g/cm³

Therefore, the density of the aluminum is 3 g/cm³

Learn more: https://brainly.com/question/19239648


Related Questions

25 points awarded to best answer, keep in mind it is a CER

25 points awarded to best answer, keep in mind it is a CER

Answers

Answer:

only god knows

Explanation:

what structural features do cyanide and thiamine have in common that makes them capable of catalyzing the benzoin condensation

Answers

Answer:

Cyanide and thiamine do not possess specific structural features that enable them to directly catalyze the benzoin condensation reaction. However, they can participate in the catalytic process indirectly by forming complexes with other compounds or enzymes.

1. Cyanide: Cyanide ions (CN-) can act as a nucleophile, attacking the carbonyl group of aldehydes or ketones. This nucleophilic attack forms a cyanohydrin intermediate, which can undergo subsequent reactions to produce various compounds. In the benzoin condensation, cyanide can react with benzaldehyde to form a cyanohydrin, which can then undergo self-condensation to yield the benzoin product.

2. Thiamine: Thiamine, also known as vitamin B1, is not directly involved in catalyzing the benzoin condensation. However, thiamine pyrophosphate (TPP), the active form of thiamine in enzymatic reactions, can play a role. TPP is a cofactor found in enzymes called transketolases. Transketolases facilitate the transfer of two-carbon units between ketose and aldose sugars. While this is different from the benzoin condensation, the presence of TPP in the enzyme active site allows it to facilitate certain carbon-carbon bond-forming reactions.

Explanation:

It's worth noting that these examples describe the indirect involvement of cyanide and thiamine in facilitating reactions related to the benzoin condensation. Other catalysts, such as base compounds (e.g., sodium hydroxide) or other thiamine derivatives, may be used more commonly for direct catalysis of the benzoin condensation.

decomposition of hydrogen peroxide produce water and oxygen . calculate the volume of O2 formed from the decomposition of 150 mL of 0.02M hydrogen peroxide at stp​

Answers

Explanation:

2H2O2 => 2H2O + O2

Moles of hydrogen peroxide = 0.150dm³ * (0.02mol/dm³) = 0.003mol .

Moles of oxygen = 0.0015mol.

Volume of oxygen = 0.0015mol * (22.4dm³/mol) = 0.0336dm³.

A gas has a volume of 50.0 mL at a temperature of 10.0 K and a pressure of 760. kPa. What will be the new volume when the temperature is changed to 20.0 K and the pressure is changed to 380. kPa?

Answers

When the temperature changes to 20.0 K and the pressure changes to 380 kPa, the new volume will be approximately 0.2 L (200.0 mL).

To solve this problem using the gas laws, we need to use the Ideal Gas Law. This law states that the product of the pressure and the volume of a gas is proportional to the absolute temperature.

The equation of the Ideal Gas Law is the following:

\(\boxed{\large\displaystyle\text{$\begin{gathered}\sf \bf{\dfrac{P_1V_1}{T_1}=\frac{P_2V_2}{T_2} } \end{gathered}$} }\)

Where:

P₁ = initial pressure = 760 kPaV₁ = initial volume = 50.0 mL = 0.050 LT₁ = initial temperature = 10.0 KP₂ = Final pressure = 380 kPaT₂ = final temperature = 20.0 KV₂ = Final volume = ?

We clear for V₂:

\(\boxed{\large\displaystyle\text{$\begin{gathered}\sf \bf{V_2=\frac{P_1V_1T_2}{P_2T_1 } } \end{gathered}$} }\)

Where:

P₁ = initial pressure V₁ = initial volumeT₁ = initial temperatureP₂ = Final pressureT₂ = final temperatureV₂ = Final volume

Substituting the known values:

\(\boxed{\large\displaystyle\text{$\begin{gathered}\sf \bf{V_2=\frac{760\not{kPa}\times0.050 \ L\times20.0\not{k} }{ 380\not{kPa}\times10.0\not{k} } } \end{gathered}$} }\)

\(\boxed{\large\displaystyle\text{$\begin{gathered}\sf \bf{V_2=\frac{760 \ L}{3800 } } \end{gathered}$} }\)

\(\boxed{\boxed{\large\displaystyle\text{$\begin{gathered}\sf \bf{V_2\approx0.2 \ Liters} \end{gathered}$} }}\)

When the temperature changes to 20.0 K and the pressure changes to 380 kPa, the new volume will be approximately 0.2 L (200.0 mL).

What would the final freezing point of water be if 3 mol of
sugar were added to 1 kg of water (Kx = 1.86°C/(mol/kg)
for water and i = 1 for sugar)?
A. -1.86°C
B. -5.58°C
C. -0.62°C
Ο Ο
D. +5.58°C
SUBMIT

Answers

Answer:

B. -5.58°C.

Explanation:

Hello!

In this case, since the freezing point depression is computed as follows:

\(\Delta T_f=-i*m*Kf\)

Whereas i=1 as the van't Hoff's factor of sugar (nonionizing solute), m=3mol/1kg=3mol/kg as the molality and Kf=1.86 °C/(mol/kg) as the freezing point depression constant for water. In such a way, we plug in to obtain:

\(\Delta T_f=-1*3\frac{mol}{kg} *1.86\frac{\°C}{mol/kg} \\\\\Delta T_f=-5.58\°C\)

Now, since the freezing point of pure water is 0°C, we infer that freezing point of such solution is:

B. -5.58°C.

Best regards!

In which of the following, are all the elements non-metals?

A. Na, Mg, O, N
B. C, Si, Ge, As
C. Fe, Ni, Cr, O
D. He, Ne, Ar, Kr
E. Ca, Ba, Sr, S

Answers

Answer:

The answer is D

Explanation:

Non metals are:

Hydrogen (H)

Sulphur (S)

Phosphorus (P)

Carbon (C)

Fluorine (F)

Oxygen (O)

Nitrogen (N)

Chlorine (Cl)

Bromine (Br)

Helium (He)

Argon (Ar)

Iodine (I)

Neon (Ne)

Krypton (Kr)

Radon (Rn)

Selenium (Se)

Xenon (Xe)

In a synthesis reaction, the elements Fe and S might react to form which of the following?

A. H20

B. FeS

C. Na and Cl

D. All of the above

Answers

Answer:

THE ANSWER IS A

Explanation:

In a synthesis reaction, the elements Fe and S might react to form FeS.

Given :

The elements Fe and S might react to form a product,

To find:

The product of the synthesis reaction.

Solution:

The synthesis reaction is a type of chemical reaction in which two more different substances are combined together to give a single product,

When iron (Fe) and sulfur react the product will be formed will have both iron atoms and sulfur atoms.

\(Fe+S \rightarrow FeS\)

In a synthesis reaction, the elements Fe and S might react to form FeS.

Learn more about synthesis reaction here:

brainly.com/question/16987748?referrer=searchResults

brainly.com/question/8692058?referrer=searchResults

What is the oxidation state of N in NaNOz?

What is the oxidation state of N in NaNOz?

Answers

The oxidation state of nitrogen (N) in NaNO3 is +5. option B

To determine the oxidation state of nitrogen (N) in sodium nitrate (NaNO3), we need to assign oxidation numbers to each element in the compound.

In NaNO3, we know that the sodium ion (Na+) has a +1 oxidation state because it is an alkali metal. Oxygen (O) typically has an oxidation state of -2 in compounds, and there are three oxygen atoms in NaNO3. Since the compound is neutral, the sum of the oxidation states must be zero.

Let's assume that the oxidation state of nitrogen is x. Therefore, we can set up the equation:

(+1) + x + (-2) * 3 = 0

Simplifying the equation:

+1 + x - 6 = 0

x - 5 = 0

x = +5

Therefore, the oxidation state of nitrogen (N) in NaNO3 is +5.

The oxidation state of an element indicates the number of electrons it has gained or lost in a compound. In this case, the nitrogen atom in NaNO3 has gained five electrons to achieve a stable oxidation state of +5.

It is important to note that oxidation states are formal charges and do not necessarily represent the actual distribution of electrons in a compound. They are assigned based on a set of rules and can be useful in understanding the reactivity and behavior of elements in chemical reactions.

Option B

For more such questions on oxidation state visit:

https://brainly.com/question/25551544

#SPJ8

Using the following equation, determine whether the changes listed below will cause a shift in equilibrium to shift forward, reverse, or no shift at all.
A open parentheses a q close parentheses italic space plus space B open parentheses s close parentheses italic space rightwards harpoon over leftwards harpoon space straight C open parentheses straight s close parentheses space plus space straight D open parentheses aq close parentheses space plus space straight E open parentheses aq close parenthesesA(aq) + B (s) → D(aq) + E(aq)
Addition of A?
Addition of B?
Removal of C?
Removal of D?
Addition of E?
Removal of A?

Answers

The number of moles of A will decrease. This causes a decrease in pressure which will lead to a shift in equilibrium towards reactants.

Addition of A: The addition of A will cause the equilibrium to shift forward. This is because A is added to the reactants side, so the number of moles of A will increase. This causes an increase in pressure which will lead to a shift in equilibrium toward products. Addition of B: The addition of B will cause the equilibrium to reverse. This is because B is added to the product side, so the number of moles of B will increase. This causes an increase in pressure which will lead to a shift in equilibrium towards reactants. Removal of C: The removal of C will cause no shift in equilibrium. This is because C is removed from the reactants side, but the number of moles of C will remain unchanged. Removal of D: The removal of D will cause no shift in equilibrium. This is because D is removed from the product side, but the number of moles of D will remain unchanged.

Addition of E: The addition of E will cause the equilibrium to shift forward. This is because E is added to the product side, so the number of moles of E will increase. This causes an increase in pressure which will lead to a shift in equilibrium toward products. Removal of A: The removal of A will cause the equilibrium to reverse. This is because A is removed from the reactant's side.

To learn more about Equilibrium ;

https://brainly.com/question/19340344

#SPJ11

Which statement best explains why mass is not conserved in a nuclear change?

Some of the products have less mass than the reactants.

Some of the reactants are not used.

Some of the atoms are lost in the reaction.

Some of the matter is converted to energy.

Answers

The statement that best explains why mass is not conserved in a nuclear change is that; "some of the matter is converted to energy".

In a nuclear reaction, mass is converted to energy. This is the energy that is given out when a new nuclide is formed during a nuclear reaction.

Generally, the scheme of a nuclear reaction is; Parent nucleus + Bombarding particle -------> Daughter nuclei + product particles + energy. This energy is obtained when mass is lost from left toi right in the reaction.

Hence, the correct answer is; some of the matter is converted to energy".

Learn more: https://brainly.com/question/13440572

Answer:

Unit 4 Lesson 2:

Energy Release Quick Check

1. 138

2. The conversion of an atom of one element into a different element through nuclear changes.

3. A nuclear equation is balanced according to mass number. A chemical equation is balanced according to the total mass before and after the change.

4. 82

5. Some of the matter is converted to energy.

Please give me Brainliest. You're Welcome

Give the structures of the free‑radical intermediates in the peroxide‑initiated reaction of HBr
with the following alkene. Include all lone‑pair electrons and unpaired electrons. Hint: the radicals do not coexist in the same mechanistic step.

Answers

The peroxide addition would yield a product that is different from the antiperoxide addition

What is the structure?

Markovnikov's rule states that when a protic acid HX is added to an alkene, the acid hydrogen (H) forms a bond with the carbon atom that has the greatest number of hydrogen atoms, while the halide (X) group forms a bond with the carbon atom that has the fewest hydrogen atoms.

This can be summed up with the phrases "the rich get richer" and "the poor get poorer" in terms of hydrogen. This fundamental principle of alkene chemistry aids in predicting the results of addition reactions.

Learn more about alkene:https://brainly.com/question/17017195

#SPJ1

Give the structures of the freeradical intermediates in the peroxideinitiated reaction of HBr with the

How many molecules are in 650.0 g Mg(OH)₂ ?

Answers

Answer:

6.711 × 10²⁴ molecules Mg(OH)₂

General Formulas and Concepts:

Chemistry - Atomic Structure

Reading a Periodic TableUsing Dimensional AnalysisAvogadro's Number - 6.022 × 10²³ atoms, molecules, formula units, etc.

Explanation:

Step 1: Define

650.0 g Mg(OH)₂

Step 2: Define conversions

Avogadro's Number

Molar Mass of Mg - 24.31 g/mol

Molar Mass of O - 16.00 g/mol

Molar Mass of H - 1.01 g/mol

Molar Mass of Mg(OH)₂ - 24.31 + 2(16.00) + 2(1.01) = 58.33 g/mol

Step 3: Convert

\(650.0 \ g \ Mg(OH)_2(\frac{1 \ mol \ Mg(OH)_2}{58.33 \ g \ Mg(OH)_2} )(\frac{6.022 \cdot 10^{23} \ molecules \ Mg(OH)_2}{1 \ mol \ Mg(OH)_2} )\)

= 6.71061 × 10²⁴ molecules Mg(OH)₂

Step 4: Check

We are given 4 sig figs. Follow sig fig rules.

6.71061 × 10²⁴ molecules Mg(OH)₂ ≈ 6.711 × 10²⁴ molecules Mg(OH)₂

How do you know the correct number of significant figures to include in an answer?

Answers

Answer:

Explanation:

  1 Non-zero digits are always significant.

  2 Any zeros between two significant digits are significant.

  3 A final zero or trailing zeros in the decimal portion ONLY are significant.

6. How many moles are in 8.30 x 1023 molecules of CO₂?
a.
b.
C.
d.
1.37
2.8
55.5
100

Answers

the answer should be 1.38 molecules

Which mixture would be best to use as a wash for removal of the alkylcatechol from skin exposed to poison ivy?water and baking soda (sodium bicarbonate)soap, water, and baking soda (sodium bicarbonate)dilute vinegar or lemon juicesoap and water

Answers

The question is incomplete. Here is hte complete question.

The components of poison ivy and poison oak that produce the characteristic itchy rash are cathecols substituted with long-chain alkyl groups. The image is attached.

If you were exposed to poison ivy, which of the treatments below would you apply to the affected area? Justify your choice.

(a) Wash the area with cold water.

(b) Wash the area with dilute vinegar or lemon juice.

(c) Wash the area with sopa and water.

(d) Wash the area with soap, water and baking soda (sodium bicarbonate)

Answer: (d) Wash the area with soap, water and baking soda.

Explanation: Alkyl is hydrophobic, which means it doesn't "mix" with water. To make it more soluble in water, soap helps to dissolve the chemical compound. As shown in the image, alkylcathecol is mildly alkaline. Baking soda is a salt that also helps dissolve it by ionizing with the -OH group, which makes it more soluble.

Although lemon juice and vinegar are acids, they are weak acids and so, won't have a strong effect on the alkylcathecol.

As said before, alkyl is hydrophobic, so plain water won't affect in any way the cathecol.

Which mixture would be best to use as a wash for removal of the alkylcatechol from skin exposed to poison

Mg + P4 → Mg3P2
Assuming an unlimited amount of phosphorous (P4), how many grams of Mg are needed in order to
produce 1200.00 grams of Mg3P2?

Answers

Answer:

648.7g of Mg must be added

Explanation:

Based on the reaction:

3Mg + 1/2P4 → Mg3P2

3 moles of Mg produce 1 mole of Mg3P2

To solve this problem we neeed to find the moles of Mg3P2 in 1200g. With these moles and the chemical reaction we can finf moles of Mg and its mass:

Moles Mg3P2 -Molar mass: 134.88g/mol-:

1200.0g Mg3P2 * (1mol / 134.88g) = 8.897 moles of Mg3P2

Moles Mg:

8.897 moles of Mg3P2 * (3mol Mg / 1mol Mg3P2) = 26.69 moles of Mg

Mass Mg -Molar mass: 24.305g/mol-:

26.69 moles of Mg * (24.305g / 1mol) =

648.7g of Mg must be added

A gas is heated from 246 K to 289 K while its volume is increased from 22.0 L to 30.5 L by moving a large piston within a cylinder. If the original pressure was 0.98 atm, what would be the final pressure?

Answers

The answer is 0.998 atm.

To determine the final pressure of the gas, we can use the combined gas law equation:

P1 * V1 / T1 = P2 * V2 / T2

where:
P1 = initial pressure
V1 = initial volume
T1 = initial temperature
P2 = final pressure (what we want to find)
V2 = final volume
T2 = final temperature

Given:
P1 = 0.98 atm
V1 = 22.0 L
T1 = 246 K
V2 = 30.5 L
T2 = 289 K

Plugging in the values into the equation, we have:

0.98 atm * 22.0 L / 246 K = P2 * 30.5 L / 289 K

Now we can solve for P2:

P2 = (0.98 atm * 22.0 L * 289 K) / (246 K * 30.5 L)
P2 = 0.98 * 22.0 * 289 / (246 * 30.5)
P2 ≈ 0.998 atm

Therefore, the final pressure of the gas would be approximately 0.998 atm.

5 lollipops = 6 gumballs

8 gumballs = 6 lemonheads

14 lemonheads = 11

Answers

Explanation:

5 lollipops = 6 gumballs

8 gumballs = 6 lemonheads

14 lemonheads = 11 lollipops

It is in chain rule form.

Answer:

야만적 인 사랑은 누군가가 천사처럼 보이지만 야만적 인 사랑은 당신의 마음을 부러 뜨리게했다너무 귀엽다

Explanation:

난 천사야 네가 무슨 뜻인지 말해줘나는 모든 것을 가지고 나는 그것을 다시 포기하지 않을 것이다

Why do electrolytic cells require an electricity source to operate?

Why do electrolytic cells require an electricity source to operate?

Answers

ANSWER

The redox reaction in the cell is non spontaneous and requires energy to occur.

option A

EXPLANATION

Electrolytic cell is an electrochemical cell that requires an external source of electrical energy to drive a chemical reaction.

The oxidation-reduction reaction in electrolytic cell would not occur spontaneously, so, there is a need for an external source (electrical energy) to cause the reaction to occur

Therefore, the redox reaction in the cell is non spontaneous and requires energy to occur.

The correct answer is option A

I need these questions answered

I need these questions answered

Answers

Because the there’s not enough inertia to keep the bouncy ball going at the same rate

Answer:

Three objects with kinetic energy

A ball rolling down the street

Moving Car

Bullet

Law of Conservation of Energy states that the total energy of an isolated system remains constant; it is said to be conserved over time.

Though technically there are limitless forms of both types of energy, officially there's five types of kinetic energy: radiant, thermal, sound, electrical and mechanical and potential energy adds gravitational, nuclear, and elastic.

3. A metal tank contains three gases: oxygen, helium, and nitrogen. If the partial pressures of the three

gases in the tank are 35.0 atm of O2, 5.0 atm of N, and 25.0 atm of He, what is the total pressure

inside of the tank?

Answers

Total Pressure = A partial + B partial….

35+5+25 = 65.0 atm

How many atoms are in 12 g of Carbon-12 (12C)?

Answers

There are approximately 6.022 × 10^23 atoms in 12 grams of Carbon-12 (12C).

The number of atoms in a given amount of a substance can be calculated using Avogadro's number, which represents the number of atoms or molecules in one mole of a substance. Avogadro's number is approximately 6.022 × 10^23.

Carbon-12 is a specific isotope of carbon, with an atomic mass of 12 atomic mass units (amu). One mole of Carbon-12 has a mass of 12 grams. Since one mole of any substance contains Avogadro's number of particles, in the case of Carbon-12, it contains 6.022 × 10^23 atoms.

Therefore, if we have 12 grams of Carbon-12, which is equal to one mole, we can conclude that there are approximately 6.022 × 10^23 atoms in this amount of Carbon-12.

In summary, 12 grams of Carbon-12 contains approximately 6.022 × 10^23 atoms. Avogadro's number allows us to relate the mass of a substance to the number of atoms or molecules it contains, providing a fundamental concept in chemistry and enabling us to quantify and understand the microscopic world of atoms and molecules.

for such more questions on atoms

https://brainly.com/question/6258301

#SPJ8


Define temperature in terms of kinetic energy.

Answers

Answer: :)

The temperature of a gas is directly proportional to the average kinetic energy of the particles of the gas. But the total kinetic energy of the molecules of a gas is a measure of the internal energy or thermal energy of the gas.

Explanation:

If we have 0.06 moles of HCI

How many grams of magnesium metal is that?

If we have 0.06 moles of HCI How many grams of magnesium metal is that?

Answers

Answer:

1.44 g

Explanation:

From the question given above, the following data were obtained:

Number of mole of HCl = 0.06 mole

Mass of Mg =?

From the question given above, we discovered the number of mole of HCl is equivalent to the number of mole of Mg. Thus,

Number of mole of Mg = number of mole of HCl

Number of mole of Mg = 0.06 mole

Finally, we shall determine the mass of Mg. This can be obtained as follow:

Number of mole of Mg = 0.06 mole

Molar mass of Mg = 24 g/mol

Mass of Mg =?

Mass = mole × molar mass

Mass of Mg = 0.06 × 24

Mass of Mg = 1.44 g

Therefore, the mass of magnesium is 1.44 g

The q of a system that releases 12.4J of heat to surroundings is _____J.

a.) 12.4
b.) -12.4
c.) 0
d.) not enough info

If you explain why I'll give brainly!!​

Answers

Answer: B.) -12.4

Explanation: This is because the sign of heat transfer is determined by the system's perspective. In this case, the system is releasing heat to the surroundings, which means that heat is flowing out of the system, making the heat transfer negative. The magnitude of the heat transfer is 12.4 J.

How many moles in 206.91 g Na

Answers

Answer:

The answer is 9.000090040048176

1. If you place 30.0 L of ethyl acetate (C4H8O2) in a sealed room that is 7.25 m long, 2.75 m wide, and 2.75 m high, will all the ethyl acetate evaporate? If some liquid remains, how much will there be? The vapor pressure of ethyl acetate is 94.9 torr at 25 °C, and the density of the liquid at this temperature is 0.901 g/mL. Treat the room dimensions as exact numbers.

Answers

There will be 0.4589 mL of ethyl acetate left in the space after evaporation.

What is evaporation?

The conversion of a liquid substance into a gas is known as evaporation. As a result of the liquid absorbing energy from its surroundings, molecules begin to travel faster and faster until they finally become a vapour and escape into the environment. Usually, the energy is absorbed as heat, but it can also be in the form of light or electricity.

No, the ethyl acetate won't all evaporate. The amount of ethyl acetate that will stay in the space after evaporation can be determined using the ideal gas law. As per the ideal gas law, PV = nRT

P is the overall system pressure, V is the room's volume, n is the amount of ethyl acetate in moles, R is the ideal gas constant, and T is the temperature.

To solve for n, the quantity of moles of ethyl acetate, we can rearrange the equation as follows: n = PV/RT

When the values are plugged in, we get:

n = (94.9 torr)(7.25 m x 2.75 m x 2.75 m)/(8.314 J/K mol)(298 K)

\(n = 4.666 \times 10^{-3} mol\)

The molar mass of ethyl acetate (88.11 g/mol) can then be used to compute the mass of ethyl acetate:

Mass = \(n \times M = (4.666 x 10^{-3} mol)(88.11 g/mol)\) = 0.4125 g

Using the density of ethyl acetate (0.901 g/mL), it is possible to determine the volume of the liquid that is still present:

Volume = mass/density = (0.4125 g)/(0.901 g/mL) = 0.4589 mL

As a result, there will be 0.4589 mL of ethyl acetate left in the space after evaporation.

To learn more about evaporation, visit:

brainly.com/question/24258

#SPJ1

Lesson 8.2 geometry notetaking guide

THEOREM 8.6 if a quadrilateral is a parallelogram, then its diagonals__each other.
The diagonals of STUV intersect at point W. Find the coordinate of W.
By Theorem 8.6, the diagonals of a parallelogram__each other. So, W is the__of the diagonals TV and SU. Use the __.
...
....
...

Lesson 8.2 geometry notetaking guideTHEOREM 8.6 if a quadrilateral is a parallelogram, then its diagonals__each

Answers

The coordinates of point W are (xW, yW), where xW = (x1 + x2) / 2 and yW = (y1 + y2) / 2.

Theorem 8.6 states that if a quadrilateral is a parallelogram, then its diagonals bisect each other. In the given quadrilateral STUV, the diagonals intersect at point W. Therefore, according to Theorem 8.6, point W is the midpoint of the diagonals TV and SU.To find the coordinate of W, we need to determine the midpoint of the line segments TV and SU. The midpoint of a line segment is the average of the coordinates of its endpoints.Let's assume the coordinates of point T are (x1, y1), the coordinates of point V are (x2, y2), the coordinates of point S are (x3, y3), and the coordinates of point U are (x4, y4).

To find the coordinates of point W, we can use the midpoint formula:

xW = (xT + xV) / 2

yW = (yT + yV) / 2

Substituting the coordinates, we have:

xW = (x1 + x2) / 2

yW = (y1 + y2) / 2

Using this formula, we can calculate the coordinates of point W by plugging in the specific values for the coordinates of points T and V.

for such more questions on coordinates

https://brainly.com/question/30149496

#SPJ8

Which best describes the relationship between population size, carrying capacity, and limiting factors?
O The size of a population usually stays high due to its carrying capacity and limiting factors.
The size of a population usually stays near its limiting factors due to carrying capacity.

The size of a population usually stays near its carrying capacity due to limiting factors. O

The size of a population usually stays low due to its carrying capacity and limiting factors. ​

Answers

The best description of the relationship between population size, carrying capacity, and limiting factors is: "The size of a population usually stays near its carrying capacity due to limiting factors."

Carrying capacity refers to the maximum number of individuals that a particular environment can sustainably support. It represents the limit to which a population can grow given the available resources, such as food, water, and habitat. Limiting factors, on the other hand, are the factors that restrict population growth by reducing birth rates, increasing death rates, or limiting access to resources.As a population approaches its carrying capacity, limiting factors come into play and regulate the population size. These limiting factors can include competition for resources, predation, disease, availability of suitable habitat, and other environmental factors. They act as checks on population growth, preventing it from exceeding the carrying capacity of the ecosystem.

Therefore, the size of a population usually stays near its carrying capacity because the limiting factors ensure that the population does not exceed the available resources and ecological limits of the environment. If the population surpasses the carrying capacity, the limiting factors will intensify, causing a decline in resources and an increase in mortality rates, which ultimately brings the population back towards the carrying capacity.It's important to note that the relationship between population size, carrying capacity, and limiting factors is dynamic and can vary depending on various ecological and environmental factors.

for such more questions on capacity

https://brainly.com/question/29792498

#SPJ8

Chemistry Help Please! It's worth a lot of points
1.Write the equilibrium expression for the following reactions
a. H2SO4(aq) + H2O(L) ⇆ HSO4-(aq) + H3O+(aq)
b. 4NH3(g) + 5O2(g) ⇆ 4NO(g) + 6H2O(g)
c. NH4Cl(s) ⇆ NH3(g) + HCl(g)
d. N2O4(g) ⇆ 2NO2(g)

2. The following reaction has a K value of 0.050. What does that mean about the concentrations of the reactants as compared to the products? Be specific in your answer.
N2(g) + 3H2(g) ⇆ 2NH3(g)

3. The following reaction has a K value of 6.8 x 103. What does that mean about the concentrations of the reactants as compared to the products? Be specific in your answer.
2SO3(g) ⇆ 2SO2(g) + O2(g)

4. When dissolving substances in water, the degree of solubility of a substance is often represented as the solubility product constant (Ksp). The solubility product constant is the same thing as the equilibrium constant for the dissolving reaction. Two substances that dissociate in water are shown below alone with the Ksp.
NaCl(s) ⇆ Na+(aq) + Cl-(aq) Ksp = 36
BaSO4(s) ⇆ Ba2+(aq) + SO42-(aq) Ksp = 1.1 x 10-16

5. Identify and label the Brønsted-Lowry acid, its conjugate base, the Brønsted-Lowry base, and its conjugate acid in each of the following equations:
a. HNO3 + H2O ⟶ H3O+ + NO3−
b. CN− + H2O ⟶ HCN + OH−
c. H2SO4 + Cl− ⟶ HCl + HSO4−
d. HSO4− + OH− ⟶ SO42− + H2O
e. O2− + H2O ⟶2OH−

6. What is the conjugate acid of each of the following? What is the conjugate base of each of the following?
a. OH-
b. H2O
c. HCO3-
d. NH3
e. HSO4-

7. The following acids are shown with their equilibrium constants (also known as the acid dissociation constant). Rank these acids from strongest to weakest. Explain your ranking.
HCN(aq) + H2O(L) ⇆ H3O+(aq) + CN-(aq) K = 6.2 x 10-10

HC2H3O2(aq) + H2O(L) ⇆ H3O+(aq) + C2H3O-(aq) K = 1.75 x 10-5

H2CO3(aq) + H2O(L) ⇆ H3O+(aq) + HCO3-(aq) K = 4.5 x 10-7

HIO4(aq) + H2O(L) ⇆ H3O+(aq) + IO4-(aq) K = 2.3 x 10-2

8. Calculate the pH and the pOH of each of the following solutions.
a. 0.200 M HCl
b. 0.0143 M NaOH
c. 3.0 M HNO3
d. 0.0031 M Ca(OH)2

9. Wine has a pH of 3.6. What are the hydronium and hydroxide ion concentrations?

10. The hydroxide ion concentration in household ammonia is 3.2 x 10-3 M. What is the concentration of hydronium ions?

Answers

Answer:

1. Equilibrium expressions:

a. K = [HSO4-][H3O+]/[H2SO4][H2O]

b. K = [NO]^4[H2O]^6/[NH3]^4[O2]^5

c. K = [NH3][HCl]/[NH4Cl]

d. K = [NO2]^2/[N2O4]

2. Since K = 0.050, the concentrations of the reactants (N2 and H2) are larger than the concentrations of the products (NH3).

3. Since K = 6.8 x 10^3, the concentrations of the products (SO2 and O2) are larger than the concentrations of the reactant (SO3).

4. The Ksp expression for each of the reactions is:

a. Ksp = [Na+][Cl-]

b. Ksp = [Ba2+][SO42-]

5. Brønsted-Lowry acids and bases:

a. Acid: HNO3; Conjugate base: NO3-; Base: H2O; Conjugate acid: H3O+

b. Acid: HCN; Conjugate base: CN-; Base: H2O; Conjugate acid: HCN

c. Acid: H2SO4; Conjugate base: HSO4-; Base: Cl-; Conjugate acid: HCl

d. Acid: NH3; Conjugate base: NH2-; Base: H2O; Conjugate acid: NH4+

e. Acid: H2O; Conjugate base: OH-; Base: O2-; Conjugate acid: OH-

6. Conjugate acids and bases:

a. Acid: H2O; Conjugate base: OH-

b. Acid: H3O+; Conjugate base: H2O

c. Acid: H2CO3; Conjugate base: HCO3-

d. Acid: NH4+; Conjugate base: NH3

e. Acid: HSO4-; Conjugate base: SO42-

7. The strongest acid is HIO4 (highest K value), followed by HCN, HC2H3O2, and H2CO3 (lowest K value). The K values represent the degree to which the acids dissociate in solution. HIO4 is a strong acid, meaning it dissociates almost completely in solution, while H2CO3 is a weak acid, meaning it only dissociates partially.

8. pH and pOH calculations:

a. pH = -log[H3O+] = -log(0.200) = 0.699; pOH = -log[OH-] = -log(1.0 x 10^-14/0.200) = 12.301

b. pOH = -log[OH-] = -log(0.0143) = 1.844; pH = 14.000 - pOH = 12.156

c. pH = -log[H3O+] = -log(3.0) = 0.522; pOH = 13.478

d. pOH = -log[OH-] = -log(0.0062) = 2.206; pH = 14.000 - pOH = 11.794

9. Hydronium and hydroxide ion concentrations:

pH = 3.6; hydronium ion concentration = 10^-pH = 3.98 x 10^-4 M; hydro

(Please could you kindly mark my answer as brainliest you could also follow me so that you could easily reach out to me for any other questions)

Other Questions
combining aerobic exercise and repetitive transcranial magnetic stimulation to improve brain function in health and disease acceleration is sometimes expressed in multiples of g, where is the acceleration due to the earth's gravity. in a car crash, the car's velocity may go from 20 m/s to 0 m/s in 0.067 s how many g's are experienced, on average, by the driver? (answer with just the number) The regulatory hormones that control the anterior pituitary gland arrive from the hypothalamus by way of the ______. Sales area is a unique combination of _______, _______ and _______. a) sales area, distribution channel, division b) sales organization, plant, division c) sales organization, distribution channel, customer d) sales organization, plant, distribution channel e) sales organization, distribution channel, division convert 4/3 to an mixed number lifting your arm horizontally to form a right angle with the side of the body involves a movement called of the arm. Bryantwas playing the video gameShip,ShipAhoy!He began Level 2 with 15 points but soon got6 points because his character fell overboard. What is Bryant's total scorenow? The standard free energy for the reaction of oxygen binding to myoglobin Mb+O2(g) MbO2 is G=30.0kJmol1 at 298 K and pH=7. The standard state of O2 is the dilute solution, molarity scale; therefore the concentration of O2 must be in M. What is the ratio MbO2/Mb in an aqueous solution at equilibrium with a partial pressure of oxygen pO2=400 Pa? Assume ideal behavior of O2 gas and for the protein in solution. A rotation is turning a point in a ____________ motion around a _____________ point.a A clockwise B. fixedb A. counterclockwise B. reflectedc A. circular B. fixedd A. rectangular B. reflected 5+ k When K= 6 what should I do? Find the distance from point X to line p. Evaluate (x+y)+(-6)2when x = 1 and y=-3 I'm lost please help 9. which is most accurate in describing an estuary ecosystem? a. high salt levels keep the water clear of nutrients and proteins. b. freshwater mixes with saltwater to provide a nutrient-rich environment. c. animals and plants compete for food due to pollution from surrounding areas. d. cold water mixes with saltwater to create a cooling effect that encourages growth. One pound of cereal costs $8.64. What is the unit price per ounce? How have avian species solved the problem of external temperature spikes affecting vision equation 4.16 gives the stresses at the surface of bend specimens. the derivation of this equation is based on the assumption of elastic behavior. if there is plastic deformation during the bend test, will the stress predicted by this equation be (a) too low, (b) too high, (c) either too high or too low depending on where the plastic deformation occurs, or (d) correct? The wildlife conservation group is interested in the health of reproducing female wallabies. The wildlife group has established that 83% of female wallabies have a joey in their pouch. The group also know that 68% of wallabies in the region are female. You may assume that the sex and joey status of wallabies are independent wallaby to wallaby.a) Use an appropriate limiting distributio to estimate the probability that at least 600 wallabies from a sample of 1000 have a joey.b) From birth, joeys spend an average of 280 days in their mothers pouch. To answer the following, you may assume that the time a joey spends in the pouch is exponentially distributed. When asked to recall a list of 25 words, participants are likely to remember only some of them. The words they can recall are likely to include Select one: drew and hank were camping at hanks riverfront cabin. hank told drew that he rarely used the cabin and was thinking of selling it. drew said that hed buy it from hank for $80,000, which hank agreed was a fair price. its two months later, and hank is upset that drew now says he wont buy it. why isnt this contract enforceable?