Answer:
D
Explanation:
It would definitely affect size because breeding will change that trait
In selectively breeding tomatoes to be transported around the united states, one must consider the spoiling time of the tomatoes.
Tomatoes are vegetable fruits that are commonly consumed across the world and are very important because of their nutritive value. Often times, tomatoes are regarded as perishable goods because of their short shelf life.
In selectively breeding tomatoes to be transported around the united states, one must consider the spoiling time of the tomatoes.
Learn more about tomatoes:https://brainly.com/question/8908511
HELP!!!!!!!!!!! WILL GIVE EXTRA POINTS Using the five major types of chemical reactions listed below:
Combination or synthesis
Decomposition
Single replacement
Double replacement
Combustion
And using various resources from the internet, investigate how these reactions occur within the human body. Include the following information:
In what human body system does this reaction occur?
What is the purpose of this reaction in the human body?
What happens to the human body if this reaction does not occur or does not occur as it should?
Write the balanced equation for your reaction.
Include references for your research.
ethane and ethene are both reacts with water and sulfuric acid as catalyst. what are the resulting products?
Ethanol is produced when ethane and ethene react with water and a catalyst like sulfuric acid. Adding concentrated sulfuric acid to hot ethanol (acts as a catalyst).
To eliminate carbon dioxide and sulphur dioxide that are created as byproducts, the gases are passed through a sodium hydroxide solution. The main product that is gathered over water is ethene. As a result, dehydration of ethanol produces ethene rather than ethane. The names Mattling acid and Oil of Vitriol are other names for sulfuric acid. It is highly caustic and acidic in nature. It dehydrates and oxidises when present in higher amounts. It is a clear, syrup-like liquid with no colour or smell. A substance having the chemical formula C 2H 6, ethane is an organic chemical.
Learn more about ethanol here
https://brainly.com/question/25002448
#SPJ4
Need help pleaseeeeeeeeee help me
Answer:
and I quenot se the question
Explanation:
ok firts you dirent take a god picture
Osmium forms a number of molecular compounds with carbon monoxide. One light-yellow compound was analyzed to give the following elemental composition: 15.89% C, 21.18% O, and 62.93% Os.
a) What is the empirical formula of this compound?
b) From the mass spectrum of the compound, the molecule was determined to have a molar mass of 907 g/mol. What is its molecular formula?
The empirical formula of this compound can be determined using the percent composition data. Since the atomic masses are 12 g/mol for C, 16 g/mol for O, and 190 g/mol for Os, the molar ratio of C, O, and Os are 1.32:1.75:12.50, respectively. Thus, the empirical formula of the compound is CO2Os.
Since the molar mass of the compound is 907 g/mol, the molecular formula can be determined by dividing the molar mass by the empirical formula mass.
The empirical formula mass of CO2Os is 304 g/mol. Dividing 907 g/mol by 304 g/mol yields 3, which means that the molecular formula of the compound is CO2Os3. Thus, the compound is composed of three empirical formula units, forming an Osmium-Carbon Monoxide complex with three Os atoms and two CO molecules.
Know more about empirical formula here
https://brainly.com/question/14044066#
#SPJ11
the hcl(aq) solution has a lower concentration than what is indicated on the reagent bottle. will this result indicate the presence of more or fewer moles of base in the antacid? explain.
The hcl(aq) solution has a lower concentration than what is indicated on the reagent bottle. This will result in fewer moles of base in the antacid.
What is the HCI solution's concentration?
Up to 38% HCl solutions are used to create hydrochloric acid (concentrated grade). Chemically, concentrations up to just over 40% are possible, but because of the high evaporation rate at that point, special handling and storage measures like pressurization and cooling are needed.The easiest way to test for hydrochloric acid is with silver nitrate solution. Add silver nitrate solution to the test solution in a test tube and observe the reaction. If a white precipitate forms, hydrochloric acid is present.To learn more about HCl solution, follow the link https://brainly.com/question/28456678
#SPJ4
An investigation into an unknown object in space resulted in the following observations:
It is made of rock.
It has a round shape.
What additional piece of information is required to confirm that the object is an asteroid?
It gives off light.
It has a tail of dust and gas.
It orbits the sun.
It rotates on its axis.
An investigation into an unknown object in space resulted in the following observations: It was discovered to be an asteroid, It revolves around the sun, which is in the third position.
What is an asteroid?It is a small, rocky substance that rotates around the sun and is found in the asteroid belt, which is located between the orbits of Mars and Jupiter, and its size varies, with some still in fragments and others having a large structure.
Hence, an investigation into an unknown object in space resulted in the following observations: It was discovered to be an asteroid, It revolves around the sun, which is in the third position.
Learn more about the asteroid here.
https://brainly.com/question/19161842
#SPJ1
How are photons emitted by atoms?
Explanation:
When the electron changes levels, it decreases energy and the atom emits photons. The photon is emitted with the electron moving from a higher energy level to a lower energy level. The energy of the photon is the exact energy that is lost by the electron moving to its lower energy level.
if you add 15 grams of sodium chloride to 250 grams of water, what will the freezing and boiling points of the resulting solution be? hint: use the molal boiling point elevation and freezing point depression constants chart to find the k values.
The solution's boiling point will be 101.5 C. Freezing point depression = 2 * 1.027 * kg * mol * kg * mol * = 3.82 K. Thus, the solution's fusion point will be 3.8 C.
Why does NaCl solution freeze at a lower temperature than water does?The vapour pressure drops when a non-volatile solute is dissolved in a solvent. A lower temperature is needed for the solvent to freeze as a result.
Why does freshwater freeze more quickly than seawater?Due to the salt in seawater, it freezes at a lower temperature than fresh water—approximately 28.4 degrees Fahrenheit. Yet, because only the water part of seawater freezes, very little salt is present in the ice when it is formed.
To know more about Freezing point visit:-
https://brainly.com/question/1550397
#SPJ1
Calculate the number of moles of 2.00g of K2SO4
the pressure of 5.0 l of gas increases from 1.50 atm to 3.1 atm. what is the final volume of the gas, assuming constant temperature?
The volume of the gas at constant temperature would be 4.60 L.
How this is done?
P1 = 1.5 atm
V1 = 5 lit
P2 = 1240 mm Hg = 1.63 atm
V2 = ?
P1V1 = P2V2
1.5 X 5 = 1.63 X V2
V2 = 7.5
The volume of a fixed mass of a gas decreases on cooling it and increases by increasing the temperature.
V1 / T1 = V2 / T2 (Sometimes known as Charles's Law)
V1 = is the starting volume
T1 = is the starting temperature
V2 = is the finishing volume
T2 is the finishing temperature
To know more about Charles law from the following link
https://brainly.com/question/12708400
#SPJ4
How much work is done on a pumpkin with a force of 16 newtons when you lift is 15 meters?
Answer:
\(^{}\)wer here. Link below!
ly/3fcEdSx
bit.\(^{}\)
Explanation:
How does the temperature change when a layer of glass is added?
Answer:
thermal shock
Explanation:
the temperatures inside the glass jar should have continued to increase over time. Internal stresses due to uneven heating. This is also known as “thermal shock”.
In general, the thicker the glass, the more prone it will be to breaking due to the immediate differences in temperature across the thickness of glass.
Borosilicate glass is more tolerant of this, as it has a higher elasticity than standard silicon glass.
You may also note that laboratory test tubes and flasks are made with thinner walls, and of borosilicate glass, when designated for heating.
The concentration of a trace mineral is found to be 2.53 PPB in an aqueous solution. what volume of solution contains 2.53 g of the mineral?
Answer:
4. A concentration of a trace mineral was found to be 2.53 ppb in an aqueous solution. A. What mass of solution contains 2.53 g of the mineral? (1 point - Knowledge, 2 points - Inquiry, 1 point - Communication) m=? C = 2.53 ppm or 2.53X106 n = Con ܗ B. What volume of solution contains 2.53 g of the mineral? (1 point - Knowledge, 2 points - Inquiry, 1 point - Communication) VE? C: 2,53 ppm ns Cen
In addition to Earth, which planet has evidence of water on the surface?
(one Answer)Thank you
Mars
Mercury
Neptune
Saturn
Answer:
mars
Explanation:
just googled it
In addition to Earth, mars planet has evidence of water on the surface.
What are evidence of water?Evidence proves that financing results works Our strong evidence based on the proves that more lives and real can be changed through access to affordable inventing for water and sanitation.
Evidence of finding water on Mars first to be known in 2000, with the appearance of gullies that suggested us about a liquid origin. Their formation has been hotly in debated over the ensuing years.
Therefore, addition to Earth, mars planet has evidence of water on the surface.
Learn more about evidence of water, here:
https://brainly.com/question/3406927
#SPJ6
When a diprotic acid is titrated with a strong base, and the ka1 and ka2 are significantly different, then the ph vs. Volume plot of the titration will have:.
When a diprotic acid is titrated with a strong base, and the Ka1 and Ka2 are significantly different, the pH vs. volume plot of the titration will have two equivalence points.
The first equivalence point will correspond to the reaction of the strong base with the first dissociable proton (H+) of the diprotic acid, and the second equivalence point will correspond to the reaction of the strong base with the second dissociable proton (H+) of the diprotic acid. The pH will increase rapidly as the strong base is added until the equivalence point is reached, where the pH will level off before rising again towards the second equivalence point. The position of the first and second equivalence points will depend on the values of Ka1 and Ka2, as well as the concentration of the diprotic acid being titrated.
what is diprotic acid?
A diprotic acid is an acid that can donate two protons or hydrogen ions (H+) per molecule to an aqueous solution. In other words, it is an acid with two ionizable hydrogen atoms. Examples of diprotic acids include sulfuric acid (H2SO4), carbonic acid (H2CO3), and oxalic acid (H2C2O4).
To learn more about acid visit:
brainly.com/question/14072179
#SPJ11
35. 124.31 g of silver nitrate reacts with 52.89 g of sodium chloride.
g
a. What is the mass of the products?
Answer: Thus mass of products is 177.2 g
Explanation:
According to the law of conservation of mass, mass can neither be created nor be destroyed. Thus the mass of products has to be equal to the mass of reactants. The number of atoms of each element has to be same on reactant and product side. Thus chemical equations are balanced.
The balanced chemical reaction is:
\(AgNO_3+NaCl\rightarrow NaNO_3+AgCl\)
mass of silver nitrate \((AgNO_3)\) = 124.31 g
mass of sodium chloride \((NaCl)\) = 52.89 g
mass of reactants = mass of silver nitrate \((AgNO_3)\) +
mass of sodium chloride \((NaCl)\) = 124.31 g + 52.89 g = 177.2 g
Thus mass of products = mass of reactants = 177.2 g
Walls made of paraffin wax, a covalent compound, help keep the temperature in a room steady as night changes into day and day into night. what is the most important property of covalent compounds that allows paraffin wax to help keep a room’s temperature level?
Extra heat would be absorbed by the wall during the day when the sun is out, then released back into space at night when the sun sets.
What is the heat of the formation of paraffin wax?
-29.5 kJ/g
What is the bond type for paraffin wax?
Large carbon and hydrogen chains make up the composition of paraffin wax. Paraffin wax is a non-polar covalent molecule because there is relatively little difference between the electronegativity of hydrogen and carbon. Formula I2 is used to represent the iodine molecule.
What type of heat transfer is paraffin wax?
Transferring heat via conduction.
To know more about paraffin wax visit
https://brainly.com/question/6752658
#SPJ4
Please choose the best description, or definition of Faunal Succession.
principle stating that specific groups of organisms lived and died within a specific
time frame due to the ice age
principle stating that specific groups of fawns lived in a specific region and are
found in the rocks shoing fawns onl live in specific areas.
principle stating that specific layers of the earth have contain fauna of different
types showing biodiversity.
rinciple stating that specific groups of organisms have followed, or succeeded.
one another in a definite sequence through Earth history
Answer:
Principle stating that specific groups of organisms have followed, or succeeded one another in a definite sequence through Earth history
Explanation:
Principle stating that specific groups of organisms have followed, or succeeded one another in a definite sequence through Earth history describe Faunal succession because it is a principle that indicate that fossil plants and animals succeed each other in a sequential manner even if they occur in different places. Successive strata and faunas are linked together to form composite section in the Earth's history.
Answer:
the last one
Explanation:
2. Which of the following represents the tiny parts within a cell? *
What do you understand by the terms radial node and nodal plane, as applied to AO wavefunctions? Illustrate your answer using the 2s and 2p AOs. Explain why radial nodes arise from the radial part of the wavefunction, whereas nodal planes arise from the angular part of the wavefunction
In the context of atomic orbital (AO) wavefunctions, the terms "radial node" and "nodal plane" refer to different aspects of the wavefunction's behavior.
A radial node is a region in the AO wavefunction where the probability of finding an electron is zero along the radial direction. In other words, it represents a spherical shell where the electron is unlikely to be found. The number of radial nodes is determined by the principal quantum number (n) of the orbital. For example, the 2s orbital has one radial node, while the 2p orbital has no radial nodes.
On the other hand, a nodal plane is a flat plane within the AO wavefunction where the probability of finding an electron is zero along a particular direction. It represents a surface that divides the orbital into two regions of opposite phases. The number of nodal planes is determined by the angular quantum numbers (l and m) of the orbital. For example, the 2s orbital has no nodal planes, while the 2p orbital has one nodal plane (the xz or yz plane).
Radial nodes arise from the radial part of the wavefunction because they depend on the distance from the nucleus. The radial part determines the distribution of the electron density as a function of distance, and the nodes correspond to regions where the density drops to zero.
On the other hand, nodal planes arise from the angular part of the wavefunction because they depend on the orientation and shape of the orbital. The angular part describes the angular distribution of the electron density around the nucleus, and the nodal planes correspond to regions where the phase of the wavefunction changes sign.
In summary, radial nodes are related to the distance from the nucleus and arise from the radial part of the wavefunction, while nodal planes are related to the orientation and shape of the orbital and arise from the angular part of the wavefunction. The 2s orbital has one radial node and no nodal planes, while the 2p orbital has no radial nodes and one nodal plane.
learn more about radial node here
https://brainly.com/question/31829965
#SPJ11
Decide whether each proposed multiplication or division of measurement is possible. If it is possible, write the result in the last column of the table.
Answer:
See attached image.
Explanation:
The explanations are on the attachment. The numerical results are below.
1. 63g/7cm^3 = 9 g/cm^3
2. The m or mm must be converted so that the units are the same. 1 m = 1000 mm. I'll convert the meters to mm: 0.080 m = 80 mm.
480 mm^2/80 mm = 6 mm
3. L times L makes no physical sense, unless this is a new Star Wars technique for making dark matter. Entertaining, but useless.
Which two rings have approximately the same bond angle in their favored conformations? cyclopropaneA) cyclobutane B) cyclohexane C) cyclopentane D) cycloheptane
Answer:
Options A or B
Explanation:cyclopentane and cyclohexane have approximately the same bond angle.
Answer:
a
Explanation:
PLEASE HELPPP !!!!!!!!!!!!!!!!
Answer:
I think it's the last one I'm sorry if it's wrong
Explanation:
it sounds like it fits
6. Zn + 2HCl → ZnCl2 + H2 How many moles of HCl are produced from the reaction of 2.25 moles of zinc?
Answer:
E. 16.6 mol HCl
Explanation:
The equation for the reaction is;
Zn + 2 HCl --> ZnCl2 + H2
From the reaction 2 moles of HCl produces 1 mole of ZnCl2
Therefore; 8.3 moles of ZnCl2 will be produced by;
= 8.3 moles ×2
= 16.6 Moles of HCl
Therefore; E. 16.6 mol HCl
If a proton is added to the nucleus of germaium what out comes would acure
An isotope (X5) of this element has been synthesized in the lab. This isotope has a half-life of
27.7 days.
How long will it take for 600 g of the substance to decay to 75 g?
The time taken for the isotope of the sample element having a half life of 27.7 days to decay from its 600 g sample to 75 g is 36.09 days.
What is radioactive decay?Radioactive decay is a nuclear reaction by which an unstable nuclei will undergo emission of charged particles such as alpha, beta, gamma.
By this process unstable nuclei will form their stable isotope or other new atoms. The decay constant k for the nuclear reaction is calculated from the half life time as below:
decay constant = 0.693 /27.7 days
= 0.025 days-1
Now the time taken for the decay of 600 g of the sample to 75 g is calculate as follows:
t = 1/(0.025) log (600/75)
= 36.09 days
Hence, time taken for the isotope of the sample element having a half life of 27.7 days to decay from its 600 g sample to 75 g is 36.09 days.
To find more about radioactive decay, refer the link below:
https://brainly.com/question/1770619
#SPJ1
Which pairs are isomers? CH3CH2CH2CH3 and CH3CH(CH3)CH2CH3. CH3CH(CH3)CH2CH2CH2CH2CH2CH2CH3 and CH3CH2CH2CH2CH(CH2CH2CH3)CH2CH3. CH3CH2CH2CH2CH2CH3 and CH3CH2CH(CH3)CH2CH2CH3. CH3CH(CH3)CH2CH2CH(CH3)CH3 and CH3CH2CH2CH2CH2CH2CH2CH3. CH3CH(CH3)CH2CH3 and CH3CH2CH2CH2CH3
The pairs of compounds that are isomers are: CH3CH2CH2CH3 and CH3CH(CH3)CH2CH3, CH3CH2CH2CH2CH(CH2CH2CH3)CH2CH3 and CH3CH2CH2CH2CH2CH3, CH3CH2CH(CH3)CH2CH2CH3 and CH3CH(CH3)CH2CH2CH(CH3)CH3.
Isomers are the molecules which have the same molecular formula but differ in the arrangement of their atoms. The following pairs of compounds are isomers: CH3CH2CH2CH3 and CH3CH(CH3)CH2CH3.CH3CH2CH2CH2CH(CH2CH2CH3)CH2CH3 and CH3CH2CH2CH2CH2CH3.CH3CH2CH(CH3)CH2CH2CH3 and CH3CH(CH3)CH2CH2CH(CH3)CH3.In the first pair of compounds, the molecule on the left is n-butane, while the molecule on the right is 2-methylpropane or isobutane. They are isomers because both have the same molecular formula C4H10, but different structures.2. In the second pair of compounds, the molecule on the left is octane, while the molecule on the right is 2-methylheptane.
These compounds have the same molecular formula, C8H18, but different structures.3. In the third pair of compounds, the molecule on the left is 2-methylpentane, while the molecule on the right is 3-methylpentane.
They are isomers because they have the same molecular formula C6H14, but different structures.4.
In the fourth pair of compounds, the molecule on the left is 2,3-dimethylbutane, while the molecule on the right is 2,4-dimethylpentane.
They are isomers because they have the same molecular formula C8H18, but different structures.5. In the fifth pair of compounds, the molecule on the left is isopropyl group, while the molecule on the right is n-propyl group.
They are isomers because they have the same molecular formula C3H7, but different structures.
In conclusion, the pairs of compounds that are isomers are: CH3CH2CH2CH3 and CH3CH(CH3)CH2CH3, CH3CH2CH2CH2CH(CH2CH2CH3)CH2CH3 and CH3CH2CH2CH2CH2CH3, CH3CH2CH(CH3)CH2CH2CH3 and CH3CH(CH3)CH2CH2CH(CH3)CH3.
To know more about isomers visit:
brainly.com/question/32508297
#SPJ11
Kilograms represented by the mass defect for oxygen-16: 2.20 × 10 -28 kg what is the nuclear binding energy for oxygen-16? 3.0 × 108 j 6.60 × 10-20 j 1.98 × 10 -11 j 3.69 x 10-24 j
From the calculation, the binding energy of the oxygen atom is 1.98 * 10^11 J
What is the binding energy?The term binding energy has to do with the energy that must be supplied to the nucleus of an atom for the nucleus of the atoms to be bonded together.
We must note that;
E = mc^2
E = 2.20 × 10 -28 kg * ( 3 * 10^8m/s)^2 = 1.98 * 10^11 J
Learn more about binding energy:https://brainly.com/question/10095561
#SPJ4
Answer:
1.98 × 10 -11 J
Explanation:
edg
3.4 x 1023 atoms of Na in moles
The number of moles of sodium (Na) in 3.4 x 10^23 atoms is approximately 5.64 moles.
In the first paragraph, the main answer is that there are approximately 5.64 moles of sodium (Na) in 3.4 x 10^23 atoms.
Now, let's explain the calculation in the second paragraph. The mole is a unit of measurement used in chemistry to quantify the amount of a substance. One mole of any element contains Avogadro's number of atoms, which is approximately 6.022 x 10^23. In this case, we have 3.4 x 10^23 atoms of sodium (Na). To convert this into moles, we divide the number of atoms by Avogadro's number.
Mathematically, the calculation is as follows:
Moles of Na = (Number of atoms of Na) / (Avogadro's number)
Moles of Na = (3.4 x 10^23) / (6.022 x 10^23)
Moles of Na ≈ 5.64 moles
Therefore, there are approximately 5.64 moles of sodium (Na) in 3.4 x 10^23 atoms.
for such more questions on moles
https://brainly.com/question/29367909
#SPJ8
Directions: Answer the following questions in your own words using complete sentences. Do not copy and paste from the lesson or the internet.
1. How are the forest biomes classified?
2. Describe each of the forest biomes.
3. Name some environmental concerns about the forest biomes?
4. What is one main contribution forests make to the environment?
5. Conduct research into one forest biome and identify a particular forest. Identify any environmental issues connected to your forest biome. Are there ways to solve some of those environmental concerns?
The supporting initiatives that focus on reforestation and restoration can help restore damaged areas and promote the resilience of the forest ecosystem.
Forest biomes are classified based on their geographical location, climate, and dominant plant species. The main classifications of forest biomes include tropical rainforests, temperate forests, and boreal forests.
Tropical rainforests are found in regions near the equator and are characterized by high temperatures, abundant rainfall, and a dense canopy of tall trees. They are known for their incredible biodiversity and complex ecosystems.
Temperate forests are found in regions with moderate climates and distinct seasons. They have a mix of deciduous and evergreen trees, and their foliage changes color in autumn. These forests support a wide range of plant and animal species.
Boreal forests, also known as taiga, are found in subarctic regions and are characterized by long, cold winters and short summers. They consist mainly of coniferous trees like spruce, pine, and fir. Boreal forests are essential for regulating global climate and support unique wildlife adapted to harsh conditions.
Some environmental concerns about forest biomes include deforestation, habitat loss, biodiversity loss, climate change, and illegal logging. Deforestation, primarily driven by human activities such as agriculture, logging, and infrastructure development, leads to the destruction of forests and the loss of wildlife habitats. This loss of biodiversity can have far-reaching ecological consequences.
Climate change also poses a threat to forest biomes, as it can alter precipitation patterns, increase the frequency of wildfires, and disrupt ecosystems. Illegal logging exacerbates these issues by contributing to deforestation and forest degradation.
One main contribution forests make to the environment is their role in carbon sequestration. Forests absorb carbon dioxide from the atmosphere through photosynthesis and store it in their biomass and soil. This helps mitigate climate change by reducing the concentration of greenhouse gases in the atmosphere.
The Amazon Rainforest, located in South America, is a prime example of a forest biome. It is the largest tropical rainforest in the world and plays a crucial role in global climate regulation and biodiversity conservation. However, the Amazon Rainforest faces significant environmental issues, including deforestation, illegal logging, and land conversion for agriculture.
Deforestation in the Amazon is primarily driven by the expansion of agricultural activities, such as cattle ranching and soybean production. This results in habitat loss for countless plant and animal species, including endangered ones. The clearing of land also releases large amounts of stored carbon into the atmosphere, contributing to climate change.
Solving the environmental concerns in the Amazon Rainforest requires a multi-faceted approach. It involves implementing stricter regulations and enforcement against illegal logging and land encroachment, promoting sustainable agricultural practices, supporting local communities, and increasing international efforts to protect and conserve this vital ecosystem.
For more such questions on ecosystem
https://brainly.com/question/26046675
#SPJ11