Considering the image, sample A bears the lowest value of Temperature change,
This is further explained below.
What is temperature change?Generally, When there is a rise or decrease in temperature as a result of the transfer of heat, this is referred to as a temperature change.
This causes a change in the chemical equilibria toward the products or the reactants, which may be identified by examining the reaction and determining whether or not it is endothermic or exothermic.
In conclusion, Taking into consideration the picture, sample A has the lowest value of temperature change; this indicates that it will take the most time to cool down or change the temperature while it is being cooled down.
Read more about temperature change
https://brainly.com/question/19051558
#SPJ1
What quantity in moles of chlorine gas at 120.0 °C and 33.3 atm would occupy a vessel of 14.0 L?
A vessel of 14.0 L would hold 1.78 moles of chlorine gas at 120.0 °C and 33.3 atm.
The ideal gas law relates the pressure (P), volume (V), temperature (T), and the number of moles (n) of a gas to a constant R known as the universal gas constant. In this equation, P, V, and T are directly proportional to n, which means that as the number of moles of gas increases, so does the pressure, volume, and temperature.
Using the ideal gas law, PV = nRT, we can solve for the number of moles of chlorine gas:
n = PV/RT
First, we need to convert the temperature to Kelvin by adding 273.15:
T = 120.0 + 273.15 = 393.15 K
Next, we can plug in the values we have:
n = (33.3 atm)(14.0 L)/(0.0821 L•atm/mol•K)(393.15 K)
n = 1.78 moles
Therefore, 1.78 moles of chlorine gas at 120.0 °C and 33.3 atm would occupy a vessel of 14.0 L.
To know more about the Chlorine gas, here
https://brainly.com/question/19782746
#SPJ1
If you had 0.08841 mol of sucrose present in a 625 mL aqueous solution, what would be the molarity of the solution? (Remember that molarity is defined in terms of liters of the solution!)
The molarity of the solution with 0.08841 moles of sucrose in 625 mL of aqueous solution is 0.1414 M.
Given the number of moles of sucrose (n) = 0.08841mol
The volume of aqueous sucrose solution (V) = 625mL = 0.625L
Let the molarity of solution = M
Molarity (M) is the number of moles of solute per liter of solution. To find the molarity of a solution, we need to divide the number of moles of solute by the number of liters of solution.
Therefore, the molarity of the solution with 0.08841 moles of sucrose in 625 mL of aqueous solution can be calculated as follows:
Molarity (M) = (moles of solute(n)) / (Volume of solution(V))
M = (0.08841 mol sucrose) / (0.625 L solution)
M = 0.1414M sucrose
To learn more about molarity click here https://brainly.com/question/8732513
#SPJ1
7.25 divided by 10 and multiplied by 10
Answer:
7.25
Explanation:
give reason why mendeleev's definition of transition elements is no longer acceptable
A student uses a sample of KOH stock solution and dilutes it to a total of 120 mL. If the diluted solution is 0.60 M KOH and its original concentration was 2.25 M, what was the volume of the original sample? *
1.4 mL
89 mL
32 mL
5.5 mL
(DON'T POST LINKS PLEASE)
Answer:
5.5
Explanation:
i think so?????????
The diluted solution of volume 120 ml has the molarity of 0.60 M. Then, the volume of the original solution with a molarity of2.25 M is 32 ml.
What is molarity ?The molarity of a solution is the ratio of the number of moles of its solute particles to the volume of solution in liters.
To solve the given problem, we can use the formula for dilution:
C1V1 = C2V2
where C1 is the initial concentration, V1 is the initial volume, C2 is the final concentration, and V2 is the final volume.
We are given that the diluted solution has a concentration of 0.60 M and a total volume of 120 mL. We are also given that the original concentration was 2.25 M, and we want to find the original volume.
Using the formula for dilution, we can write:
2.25 M x V1 = 0.60 M x 120 mL
Simplifying, we get:
V1 = (0.60 M x 120 mL) / 2.25 M
V1 = 32 mL
Therefore, the original volume of the KOH stock solution was 32 mL.
Find more on molarity :
https://brainly.com/question/8732513
#SPJ3
PLEASE CHECK MY ANSWERS AND VERIFY THEM! THANK YOU SO MUCH !!!!!
please help me please it's urgent
Answer:
Paraphrase this! I got this online!1.A a Chemical Reaction is a process that involves rearrangement of the molecular or ionic structure of a substance, as opposed to a change in physical form or a nuclear reaction.
1.A Chemical reactions involve breaking chemical bonds between reactant molecules (particles) and forming new bonds between atoms in product particles (molecules)
1A.Chemical bonding, any of the interactions that account for the association of atoms into molecules, ions, crystals, and other stable species that make up the familiar substances of the everyday world.
2a.A gas evolution reaction is a chemical reaction in which one of the end products is a gas such as oxygen or carbon dioxide. Gas evolution reactions may be carried out in a fume chamber when the gases produced are poisonous when inhaled or explosive.
2b.a color change is usually an indicator that a reaction is occurring
2c.Processes involved in changes of state include melting, freezing, sublimation, deposition, condensation, and evaporation
3A.When you increase the pressure, the molecules have less space in which they can move. That greater density of molecules increases the number of collisions
3B.As an object gets hot, its atoms and molecules vibrate. As they vibrate, they release energy in the form of light. ... In chemiluminescence, energy from a chemical reaction excites the electrons of a substance
3C. Catalysis is the process of increasing the rate of a chemical reaction by adding a substance known as a catalyst. Catalysts are not consumed in the reaction and remain unchanged after it.
3D.Most chemical reactions involve the breaking and formation of chemical bonds. It takes energy to break a chemical bond but energy is released when chemical bonds are formed. If more energy is released than consumed, then the chemical reaction evolves heat and is said to be exothermic. ... Most reactions are exothermic.
Paraphrase this! I got this online!Paraphrase this! I got this online!Paraphrase this! I got this online!How many moles of copper atoms are in a 25.7 g sample of CuSO4?
There are 0.161 moles of copper atoms in a 25.7 g sample of CuSO4.
To determine the number of moles of copper atoms in a sample of CuSO4, we first need to know the molar mass of CuSO4.
The molar mass of CuSO4 can be calculated by adding the atomic masses of copper, sulfur, and four oxygen atoms:
1 x Cu = 63.55 g/mol
1 x S = 32.06 g/mol
4 x O = 15.99 g/mol x 4 = 63.96 g/mol
Molar mass of CuSO4 = 63.55 g/mol + 32.06 g/mol + 63.96 g/mol = 159.57 g/mol
Now that we know the molar mass of CuSO4, we can use it to calculate the number of moles of copper atoms in a 25.7 g sample:
moles of Cu atoms = mass of CuSO4 / molar mass of CuSO4
moles of Cu atoms = 25.7 g / 159.57 g/mol
moles of Cu atoms = 0.161 moles
Therefore, there are 0.161 moles of copper atoms in a 25.7 g sample of CuSO4.
For more such questions on moles
https://brainly.com/question/19964502
#SPJ11
Ca(OH)2 - How many Carbon, how many oxygen, and how many hydrogen in this formula? - please explain
Answer: 1Ca + 2O + 2H
Explanation:
Ca is 1 since there is no subscript
O and H each have 2 because the subscript 2 is outside the parenthesis so you multiply their subscript (1) by 2
Please I need help thank you
Answer:
its sodium hydroxide
Explanation:
Calculate the pH of the solutions, given the following [H+], and then identify the solution as acidic, basic, or neutral.
[H+] = 1.2 x 10^-2 M
[H+] = 5.8 x 10^-9 M
[H+] = 3.92 x 10^-12 M
[H+] = 4.52 x 10^-5 M
pH = 1.92, acidic
pH = 8.24, basic
pH = 11.41, basic
pH = 4.34, acidic
To calculate the pH of a solution, we use the formula:
pH = -log[H+]
where [H+] is the concentration of hydrogen ions in moles per liter.
For [H+] = 1.2 x 10^-2 M:
pH = -log(1.2 x 10^-2) = 1.92
This solution is acidic.
For [H+] = 5.8 x 10^-9 M:
pH = -log(5.8 x 10^-9) = 8.24
This solution is basic.
For [H+] = 3.92 x 10^-12 M:
pH = -log(3.92 x 10^-12) = 11.41
This solution is basic.
For [H+] = 4.52 x 10^-5 M:
pH = -log(4.52 x 10^-5) = 4.34
This solution is acidic.
So, the pH and nature of the solutions are:
pH = 1.92, acidic
pH = 8.24, basic
pH = 11.41, basic
pH = 4.34, acidic
For more such questions on pH
https://brainly.com/question/17218129
#SPJ11
The half-life of a radioactive isotope is 27 years. How long will its
mass take to fall from 2.00 g to 0.25 g?
years.
Life will come out to be 10 days. This is the required value of half life.
what is radioactive isotope?
An unstable form of a chemical element that releases radiation as it breaks down and becomes more stable. Radioisotopes may occur in nature or be made in a laboratory. In medicine, they are used in imaging tests and in treatment. Also called radionuclide. Radioactive isotopes have many useful applications. In medicine, for example, cobalt-60 is extensively employed as a radiation source to arrest the development of cancer. Other radioactive isotopes are used as tracers for diagnostic purposes as well as in research on metabolic processes.Atoms of the same element with different numbers of neutrons are called isotopes. Many elements have one or more isotopes that are radioactive. Their nuclei are unstable, so they break down, or decay, and emit radiation.To learn more about isotope refers to:
https://brainly.com/question/364529
#SPJ1
chemical name of this formula Na2SO4.
Na is for sodium and SO4 is sulfate...
Answer: The chemical compound name for Na₂SO₄ is Sodium Sulfate.
1. Write the IUPAC names for the following 1.1 1.2 N 1.3 O NO2 x Y ·0 OH 5
1. The IUPAC name of N is nitrogen.
2. Nitrogen dioxide
3.The IUPAC name of O is oxygen
4.The IUPAC name of OH is hydroxyl.
The IUPAC name of ·0 is a radical. It is commonly found in organic chemistry and plays an important role in many reactions.
IUPAC names for the given compounds are:1.1. N: Nitrogen
The IUPAC name of N is nitrogen.
It is a non-metal and belongs to group 15 in the periodic table. It has an electronic configuration of 1s2 2s2 2p3.1.2. NO2: Nitrogen dioxide
Explanation: NO2 is a chemical compound that is formed by the combination of nitrogen and oxygen. It is a reddish-brown gas that has a pungent odor.
The IUPAC name of NO2 is nitrogen dioxide.1.3. O: Oxygen
Explanation: The IUPAC name of O is oxygen.
It is a non-metal and belongs to group 16 in the periodic table. It has an electronic configuration of 1s2 2s2 2p4.
X: UnknownExplanation: No IUPAC name can be given to an unknown compound as the structure and composition are not known.
Y: Hydroxyl Explanation: The IUPAC name of OH is hydroxyl.
It is a functional group that is composed of an oxygen atom and a hydrogen atom (-OH). It is commonly found in alcohols and phenols. ·0: RadicalExplanation: A radical is a molecule or an ion that contains an unpaired electron.
for more question on electronic configuration
https://brainly.com/question/26084288
#SPJ8
Note: The complete question is given below
Provide the IUPAC names for the following compounds:
\(CH_3CH_2CH(CH_3)CH_2CH_2CH_2CH_3\)
C6H5CH(CH3)2
H2NCH2CH2CH2CH2CH2NH2
CH3CH2CH2CH2CH2OH
CH3CH2CH2CHOHCH3
Kinetic energy is described as..
A. Destroyed energy
B. Created energy
C. Movement
D. Stored energy
Answer:B.
Explanation: I trust me on this
Determine if the following two structures areidentical, isomers, or unrelated?identicalisomersunrelated
Isomers are different chemical substances that have different physical and chemical properties, but have the same molecular formula, that is, the same number of atoms of each chemical element.
First, let's see if both have the same molecular formula:
Compound 1: C4H8
Compound 2: C4H8
They have a double bond and have a double bond between the 2nd and 3rd carbons and the carbon is in the opposite direction. This is an indication of geometric isomerism. Geometric spatial isomers is a particular case of spatial isomerism in which isomers are formed by unsaturated open structures (composed of a double bond between carbons).
Therefore, they are cis and trans isomers.
Answer: B. Isomers.
write the number represented by the following prefixes of tera?
Tera is 1 trillion
1 trillion has 12 zeros
10^12
How many moles of water would be used reacting with 500g of P4010? *
P20,0 + H2O → H, PO,
PO
4
4 10
Answer:
410
Explanation:
:)))))))))))))))))))))))))))))))
write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
What is the mass of 6.02 x 1024 molecules of the compound HCl?
Answer:
First, we need to determine the molar mass of HCl.
The molar mass of HCl = the mass of hydrogen (1.008 g/mol) + the mass of chlorine (35.45 g/mol) = 36.45 g/mol.
Next, we can use Avogadro's number (6.02 x 10^23 molecules/mol) to convert the number of molecules to moles:
6.02 x 10^24 molecules / 6.02 x 10^23 molecules/mol = 10 moles
Finally, we can use the molar mass to convert moles to grams:
10 moles x 36.45 g/mol = 364.5 grams
Therefore, the mass of 6.02 x 10^24 molecules of HCl is 364.5 grams.
Could someone in simple terms explain the definition of physical chemistry?
The branch of chemistry dealing with the physical changes associated with chemical reactions
Answer:
Physical chemistry is the part of chemistry that has to do with the physical structure of compounds, and how they react with other matters and bonds that hold atoms together.
Explanation:
Hope that helps.
COLUMN A
1. A giant interstellar gas cloud where solar
system originated
2. An encounter between sun and a passing
forms planetary bodies
3. The theory suggests that planets and moons
were formed from great cloud of gas and
dust that shrank into more compact masses
4. It states that the planetary materials were
originated from stellar surface by a tidal force
5. the gravitationally bound system of the Sun and the
objects that orbit it
COLUMN B
A. Protoplanet
B. Encounter hypothesis
C. Nebulae
D. Star
E. Solar system
Answer:
COLUMN A COLUMN B
A giant interstellar gas cloud C. Nebulae
where solar system originated
An encounter between sun and a passing B. Encounter hypothesis
forms planetary bodies
The theory suggests that planets and moons A. Protoplanet
were formed from great cloud of gas and
dust that shrank into more compact masses
It states that the planetary materials were B. Encounter hypothesis
originated from stellar surface by a tidal force
the gravitationally bound system of the E. Solar system
Sun and the objects that orbit it
What volume of 0.900% w/v saline solution can be prepared from 0.300 L of a 3.00% w/v saline solution available in stock?
Percentage denotes a quantity per million ( ppm, where a part for a solution is a unit of mass (g, g, g, kg, et.) or capacity (L, mL, L, etc.). The quantity expressed in percent solutions
What stage is a solution in?
When the solvent makes up a significant portion of the combination, as is frequently the case, the solution typically has the condition of the solvent. The concentration of a solution, which measures how much solute is present in a specific volume of solution or solvent, is one crucial parameter. When water is one of the solvents, the phrase "aqueous solution" is used.
What material is dissolving in the solution to create a solution?
A solute is the material that dissolves in a solvent to create a solution. It is less prevalent in the solution than the solvent. A solvent is a substance that is present in a solution that dissolves a solute. It is more prevalent than the solute in solution. If we use a saltwater solution.
To know more about solutions visit:
https://brainly.com/question/30665317
#SPJ1
Which of the following is NOT an example of a colligative property?
Group of answer choices
A. Salt is added to ice to make homemade ice cream.
B. Salt is added to roads before a snow storm.
C. Antifreeze is added to a radiator of a car.
D. Salt water dehydrates someone that drinks it.
D. The option that is NOT an example of a colligative property is salt water dehydrates someone that drinks it.
What is colligative property?
Colligative properties are the physical changes that result from adding solute to a solvent.
Colligative Properties depend on how many solute particles are present as well as the solvent amount, but they do NOT depend on the type of solute particles, although do depend on the type of solvent.
One important thing to note is that colligative property is going to change the melting point or the boiling point of a substance.
Thus, the option that is NOT an example of a colligative property is salt water dehydrates someone that drinks it.
The correct option is D.
Learn more about colligative property here: https://brainly.com/question/1831338
#SPJ1
I need help with number three and all the parts that go with it!
Answer and Explanation:
A combustion reaction occurs in the presence of oxygen (O2),and it gives carbon dioxide (CO2) and water (H2O) as main products.
So, in each case, we have to write O2 in the reactants side (with the given hydrocarbons), while CO2 and H2O will be in the products side:
a. Butane (C4H10):
\(2C_4H_{10}+13O_2\rightarrow8CO_2+10H_2O\)The equation is balanced because in each side of the reaction there are: 8 C, 20 H and 26 O.
b. Cyclohexane (C6H12):
\(C_6H_{12}+9O_2\rightarrow6CO_2+6H_2O\)The equation is balanced because in each side of the reaction there are: 6 C, 12 H and 18 O.
Which of these pairs of atoms are isotopes?
1. Atom A: 13 protons, 12 neutrons and 12 electrons. Atom B: 12 protons, 12 neutrons and 12 electrons
2. Atom A: 12 protons, 12 neutrons and 12 electrons. Atom B: 12 protons, 12 neutrons and 13 electrons
3. Atom A: 12 protons, 12 neutrons and 12 electrons. Atom B: 12 protons, 13 neutrons and 12 electrons
Answer:
number 3
Explanation:
In isotopes the number of protons and electrons is always the same since they are isotopes of the same element. If the number of protons in atom "a" is different than in atom "b" then these are 2 different elements.
Isotopes have the same number of electrons and protons but a different number if neutrons.
A benzoic acid pellet weighing 6.54 g is placed in a bomb calorimeter along with 0.35 g fuse wire. The benzoic acid is ignited, and the temperature rise is 3.6°. What is the heat capacity of this calorimeter?
A compound has a molar mass of 123.22 g/mol. what is the molecular formula of a substance that has this molar mass?
A. CoH4
B. PSF3
C. SrS
D. ZrO2
The answer is (3). The number of Sr is the same so if the compound has the smallest gram formula mass, it has the highest percent composition by mass of strontium. So the answer is (3).
The study of chemical is called chemistry.
The correct answer to the question is option C that is C SrS.
What is molecular mass?The molecular mass is the mass of a given molecule: it is measured in daltons. Different molecules of the same compound may have different molecular masses because they contain different isotopes of an element.The molecular mass of Sr is 87.62 and sulfur is 32 after joining these we will get 123.22.
Hence, the correct answer is option C.
For more information about the mass, refer to the link:-
https://brainly.com/question/787658
1. Consider the following mechanism. [4 Marks]
03 O2 + 0 (fast)
03+0202 (slow)
(a) Write the overall balanced chemical equation.
(b) Identify any intermediates within the mechanism.
(c) What is the order with respect to each reactant?
(d) Write the rate law for the overall reaction.
Consider the following mechanism.
The overall balanced chemical equation : 2O₃ ----> 3O₂
The intermediates within the mechanism : O
The order with respect to each reactant : 2
The rate law for the overall reaction : R = k[O₃]²/[O]
The equations are :
O₃ ----> O₂ + O fast
O₃ + O ---> 2O₃ slow
a) The overall reaction is given as :
2O₃ ----> 3O₂
b) The intermediates within the mechanism is O.
c) The order with respect to each reactant is 2
d) slow step rate : k[O][O₃]
at equilibrium, kc = [O][O₂] / [O₃]
The rate law = R = k[O₃]²/[O]
Thus, Consider the following mechanism.
The overall balanced chemical equation : 2O₃ ----> 3O₂
The intermediates within the mechanism : O
The order with respect to each reactant : 2
The rate law expression for the reaction : R = k[O₃]²/[O]
To learn more about rate law here
https://brainly.com/question/21256997
#SPJ1
Muscular System - CLOZE Passage
plss helpppp asappppp
The body of a person is a marvel of design. The basic building blocks of life are tiny cells. Tissues, such as muscle and epithelial tissue, are made up of cell clusters. Organ systems contract are made up of groups of organs,
What jobs do muscles carry out?Their primary quality is its capacity to contract. Muscles that are attached to bones, internal organs, or blood vessels move objects. The primary cause of practically all physical movement is muscle contraction.
How important is the musculoskeletal system?Your capacity to walk, lift objects, send blood around your body, and even breathe, is supported by these muscles. When you think of your body's muscles, you probably concentrate on the ones you possess the most of. As these muscles are optional (VOL-uhn-ter-ee), you can control their movements.
To know more about contract visit:
https://brainly.com/question/27516414
#SPJ1