calculate ph of a sloution prepared by dissloving 2.05g of sodium acetate, CHCOONa in 92.0mlof 0.15M acetate acid, CH3COON(ag). assume the volume change upon dissloving the solution acetate is neglizible. Ka of CH3Choon is 1.75x10-5

Answers

Answer 1

The pH of the solution is 4.58.

What is pH?

pH which denotes "potential of hydrogen", is described as a scale used to specify the acidity or basicity of an aqueous solution.

In order to find the pH of the solution, we need to use the weak base-strong acid equation:

Kb = Kw / Ka = [CH3COO-][H+] / [CH3COOH]\

Ka = [H+][CH3COOH] / [CH3COO-]

[H+] = sqrt(Ka * [CH3COOH]) = √t(1.75x10^-5 * 0.15) = 1.36x10^-5 M

We then  find the concentration of acetate ions from the sodium acetate.

We have 2.05 g of sodium acetate, which is equivalent to 2.05 / (82.03 + (12 + 16 + 1) * 2) = 0.0163 moles.

[CH3COO-] = 0.0163 M

Kb = Kw / Ka = 1.36x10^-5 / 0.0163 = 8.36x10^-10

In conclusion,

pH = pKb + log([CH3COO-] / ([CH3COOH] + [CH3COO-]) = 4.58

Learn more about pH at: https://brainly.com/question/172153

#SPJ1


Related Questions

How can or organism's genetic traits affect its ability to survive?​

Answers

Answer:

According to Charles Darwin's theory of evolution by natural selection, organisms that possess heritable traits that enable them to better adapt to their environment compared with other members of their species will be more likely to survive, reproduce, and pass more of their genes on to the next generation.

What is a system called when neither energy nor matter is exchanged between the system and the surroundings?

Closed system
Free energy
Isolated system
Open system

Answers

Answer:

open system

Explanation:

Answer:

Isolated system

Explanation:

An isolated system is one that cannot exchange either matter or energy with its surroundings.

An ideal gas mixture contains 5 moles N2 and 15 moles O2. The total pressure in the container is 40 atm. What is the partial pressure of N2?

Answers

The partial pressure of the nitrogen gas is 10 atm.

What is the partial pressure?

According to the Dalton's law, when we have a mixture of gases, the partial pressure of the gas is the pressure of one of the gases that we find in the system. Thus the total pressure of the system is the sum of all the partial pressures of all the gases.

We have the following information;

Total pressure of the gas =  40 atm

Total number of moles = moles of nitrogen +  moles of oxygen = 15 mols + 5 mols

= 20 moles

Mole fraction of nitrogen gas = 5 moles

We now have;

Mole fraction * Total number of moles

= 5 moles/20 moles * 40 atm

= 10 atm

Learn more about partial pressure:https://brainly.com/question/13199169

#SPJ1

Chose the element pairings that are likely to react with each other
Na and K or Na and Br

Answers

Answer:

Na k

Explanation:

because na is a metal and potassium is also a metal and both are active metal so is less likely to react as no bond is formed between them

please help fast :/

how many moles are present in 60 grams of hydrochloric acid , HCI ?

a : 1.40 moles
b : 36.45 moles
c : 1.65 moles
d : 60 moles

Answers

Answer: C- 1.65 moles

Explanation:

HCl = 1 + 35.45 = 36.45 g/mol    

If 10 moles of a gas are at a pressure of 3.6 atm and at a temperature of 27°C, what is the volume of the container that the gas is in.

Answers

Answer:

68.4 liters

Explanation:

PV = nR T       R = gas constant = .082057  L atm / K-mole

                        n = 10      T = 27C = 300.15 K

3.6 V = 10 * .082057 * 300.15      solve for V = 68.4 liters

Select all the correct answers.
Which of these are examples of mixing and separating?
removing seed casings from grains
a soda bottle bubbling when it is opened
a bright copper statue turning green from weathering
removing salt from seawater
water decomposing to oxygen and hydrogen Select all the correct answers.
Which of these are examples of mixing and separating?
removing seed casings from grains
a soda bottle bubbling when it is opened
a bright copper statue turning green from weathering
removing salt from seawater
water decomposing to oxygen and hydrogen

Answers

Answer: Removing salt from sea water

Answer:

removing seed casings from grains

a soda bottle bubbling when it is opened

removing salt from seawater

What describes how gas particles collide?
*
1 point
Collisions between gas particles and the walls of a container.
Gas particles do not attract or repel one another.
Gas particles are in constant random motion.
Collisions are perfectly elastic.
The space between gas particles is larger than in other phases.
Average kinetic energy of the gas particles.

Answers

Gas particles are in constant random motion and collisions between them are perfectly elastic.

This means that the kinetic energy of the particles is conserved during collisions with one another and that they can bounce off of each other without losing energy.Collisions between gas particles are perfectly elastic, meaning that no energy is lost in the collision and the kinetic energy of the particles is conserved.  The space between gas particles is larger than in other phases, which allows them to move around freely and not be strongly affected by the other particles. The average kinetic energy of the gas particles is determined by the temperature of the system.

learn more about collisions Refer:brainly.com/question/11647605

#SPJ1

What is the best way to measure the pH of a natural solution while out in a forest?

Answers

The best way to measure the pH of a natural solution while out in a forest is to use a portable pH meter or pH test strips specifically designed for field use. These instruments provide accurate and reliable pH measurements and are convenient for outdoor applications.

1. Prepare the necessary equipment: Before heading out to the forest, gather the required tools. You will need a portable pH meter or pH test strips, as well as the necessary reagents or calibration solutions if using a pH meter.

2. Collect the sample: Locate the natural solution you want to measure the pH of, such as a stream, pond, or soil. Use a clean container to collect a representative sample of the solution.

3. Calibrate the pH meter (if applicable): If you are using a portable pH meter, it is essential to calibrate it before taking measurements. Follow the manufacturer's instructions to calibrate the meter using the provided calibration solutions.

4. Conduct the measurement: For pH meters, immerse the electrode into the collected sample. Allow some time for the reading to stabilize, and then record the pH value indicated on the meter's display.

5. Using pH test strips: If you are using pH test strips, dip the strip into the collected sample for the recommended amount of time. Remove the strip and compare the color change with the provided color chart. Determine the corresponding pH value from the chart.

6. Repeat for accuracy: To ensure reliability, repeat the measurement process at least once and compare the results. This step helps confirm the accuracy of your measurements.

7. Record and analyze the data: Note down the pH values obtained and any relevant observations. Analyze the data as needed for your research or monitoring purposes.

By following these steps and using the appropriate equipment, you can effectively measure the pH of a natural solution while in a forest setting.

For more such questions on measurements, click on:

https://brainly.com/question/28391278

#SPJ8

What is the mass of 2.7 x 10^18 molecules of HBr? (molar mass of HBr = 80.912 g/mol)

Answers

Answer:3.6 X 10-4 g

Explanation:

2.7 X 10^18 X (1 mole / (6.02 X 10^23) X ( 80.912 g / 1 mole) = 3.629 X 10-4 g HBr.  If needed to correct Sig Figs 3.6 X 10-4 g HBr

1. A sample of commercial concentrated hydrochloric acid is 11.8 M HCl and has a density of 1.190 g/mL. Calculate (a). the mass % of HCI (b). the molality of HCI (c). the mole fraction of HCI​

Answers

(a)  The mass percent of HCl in the solution is approximately 36.1%.

(b)  The molality of HCl in the solution is approximately 15.5 mol/kg.

(c)  The mole fraction of HCl in the solution is approximately 0.218.

(a) To calculate the mass percent of HCl, we need to determine the mass of HCl in a given volume of the solution.

Given: Concentration of HCl = 11.8 M

Density of the solution = 1.190 g/mL

First, we need to calculate the mass of the solution. Since density is mass per unit volume, the mass of 1 mL of the solution is 1.190 g.

Next, we need to calculate the mass of HCl in 1 mL of the solution. Since the concentration is given in moles per liter (M), and the molar mass of HCl is 36.46 g/mol, we can calculate the mass of HCl in 1 mL as follows:

Mass of HCl = concentration × volume × molar mass

          = 11.8 mol/L × 0.001 L × 36.46 g/mol

          = 0.430 g

Now, we can calculate the mass percent of HCl using the following formula:

Mass percent = (mass of solute ÷ mass of solution) × 100

           = (0.430 g ÷ 1.190 g) × 100

           ≈ 36.1%

(b) The molality of HCl is calculated by dividing the moles of solute (HCl) by the mass of the solvent (water) in kilograms.

Since the density of the solution is given as 1.190 g/mL, the mass of 1 mL of the solution is 1.190 g. However, we need to consider the density of the solvent (water) to calculate the mass of water in the solution.

Assuming the density of water is 1 g/mL, the mass of water in 1 mL of the solution is (1.190 g - 0.430 g) = 0.760 g.

To calculate the molality of HCl, we need to convert the mass of water to kilograms:

Mass of water (kg) = 0.760 g ÷ 1000 = 0.000760 kg

The molality (m) is calculated using the formula:

Molality = (moles of solute ÷ mass of solvent in kg)

        = (11.8 mol/L × 0.001 L) ÷ 0.000760 kg

        ≈ 15.5 mol/kg

(c) The mole fraction (X) of HCl is calculated by dividing the moles of HCl by the total moles of all components in the solution.

To calculate the mole fraction, we need to consider the volume of the solution and convert it to liters.

Given: Concentration of HCl = 11.8 M

Volume of the solution = 1 mL

Volume of the solution (L) = 1 mL ÷ 1000 = 0.001 L

To calculate the mole fraction of HCl, we need to calculate the moles of HCl and the moles of water (solvent) in the solution.

Moles of HCl = concentration × volume

            = 11.8 mol/L × 0.001 L

            = 0.0118 mol

Moles of water = mass of water ÷ molar mass of water

             = 0.760 g ÷ 18.015 g/mol (molar mass of water)

             = 0.0422 mol

Total moles in the solution = moles of HCl + moles of water

                           = 0.0118 mol + 0.0422 mol

                           = 0.054 mol

Mole fraction of HCl = moles of HCl ÷ total moles

                   = 0.0118 mol ÷ 0.054 mol

                   ≈ 0.218

For such more questions on molality

https://brainly.com/question/14366957

#SPJ8

Calcium carbonate and copper sulfate are each mixed into a beaker of water.
After a few minutes the calcium carbonate settles on the bottom of its beaker,
while the copper sulfate stays dissolved. Which statement is true about this
experiment?
A. Copper sulfate is a solvent.
B. Calcium carbonate in water is a solution.
C. Copper sulfate in water is a solution.
D. Calcium carbonate is a solvent.

Answers

The correct answer is C: Calcium carbonate in water is a solution

Ca(NO3)2(aq) + KCl(aq) →
Express your answer as a chemical equation.

Answers

Ca(NO3)2 + 2KCl → CaCl2 + 2KNO3

The chemical equation is

\(\rm Ca(NO_ 3)_2 (aq) + 2KCl (aq) \rightarrow CaCl_2 + 2KNO_3\)

What are chemical equation?

Chemical equation is defined as a symbolic representation of a chemical reaction in the form of symbols, in which the reactants and products are expressed in terms of their respective chemical formulas. It can also be called as chemical reactions.

There are basically six types of chemical reactions.

Combination reactionDecomposition reactionPrecipitation reactionNeutralization reactionCombustion reactionDisplacement reaction

Thus, the chemical equation is

\(\rm Ca(NO_ 3)_2 (aq) + 2KCl (aq) \rightarrow CaCl_2 + 2KNO_3\)

To learn more about chemical equations, refer to the link below:

https://brainly.com/question/28294176

#SPJ2

Glucose, C6H12O6, is used to prepare intravenous feeding solutions. What volume of 5.0 % W/V glucose solution can be prepared using 125 g of glucose? Show your working.

Please if the answer is correct, ill give brainliest

Answers

250 L of 5.0% w/v glucose solution can be prepared using 125 g of glucose.

We use the below formula to solve our problem,

w/v = [ mass of solute (g) / volume of solution (mL) ] × 100

Substitute the values from our problem,

5.0 % w/v = [ 125 g / volume of solution (mL) ] × 100

Rearranging the formula, we have

volume of solution (mL) = [ 125 g / 5.0 % w/v ] x 100

Substitute further for w/v,

volume of solution (mL) = [ 125 g / (5.0 / 100) ] x 100

Simplify the expression,

volume of solution (mL) = [ 125 g / 0.05 ] x 100

Hence, the volume of solution (mL) = 250,000 mL or 250 L

How do ionic and molecular compounds behave in water?

How do ionic and molecular compounds behave in water?

Answers

Ionic compounds dissolve in water by a process called dissociation. Water molecules separate the cations and ions by means of ion-dipole attractions to form hydrated ions.

Answer:

When ionic compounds dissolve in water they go through a process called dissociation, splitting into the ions that make them up. However, when you place covalent compounds in water, they typically do not dissolve but form a layer on top of the water.

1. Making coffee or tea requires hot water to remove soluble components from the grounds or leaves. This is a separation process called extraction, removing a soluble component from solid material. What other separation technique is used to prepare the coffee or tea to drink

Answers

Answer:

The other technique which used to separate the coffee or tea is Filtration.

Filtration is a physical, biological or chemical operation that separates solid matter and fluid from a mixture with a filter medium that has a complex structure through which only the fluid can pass.

Solid particles that cannot pass through the filter medium are described as oversize and the fluid that passes through is called the filtrate.

What state
of matter
exists in
area B?
A. gas
B. liquid
C. solid
Pressure
(atm)
61
6543210
0
50 100 150 200
Temperature (°C)

Answers

Considering the phase diagram, the state of matter that exists in area B is gas.

The correct option is A.

What is a phase diagram?

A phase diagram is a graphical representation that shows the conditions of temperature and pressure at which different phases or states of a substance exist.

The axes of a phase diagram typically represent temperature (usually on the horizontal axis) and pressure (usually on the vertical axis). The diagram is divided into regions that correspond to different phases, and the lines separating these regions represent phase boundaries.

The point where three phase boundaries meet is known as the triple point, which represents the temperature and pressure at which all three phases can coexist in equilibrium.

Learn more about phase diagrams at: https://brainly.com/question/28097253

#SPJ1

What stateof matterexists inarea B?A. gasB. liquidC. solidPressure(atm)616543210050 100 150 200Temperature

Which of the following chemical formulas show three molecules of a compound that has one
NEED FAST
atom of mercury and two atoms of bromine
1. 3Mc2Br
2. Hg3Br2
3. 3McBr2
4.McBr23
5.3HgBr2
6.3Hg2Br

Answers

The chemical formula : 3HgBr₂(Mercury(II) bromide)

Further explanation

Given

The chemical formulas of Mercury and Bromine

Required

The appropriate chemical formula

Solution

A molecular formula is a formula that shows the number of atomic elements that make up a compound.  

The number of molecules is determined by the coefficient in front of the compound

the number of atoms is determined by the subscript after the atom and the coefficient

Three molecules⇒ coefficient = 3

one atom of Mercury ⇒Hg

two atoms of Bromine ⇒ Br₂

The chemical formula : 3HgBr₂

Complete the table. Then explain how wavelength and frequency are mathematically related.

Complete the table. Then explain how wavelength and frequency are mathematically related.

Answers

The wavelength is same.

What is wavelength?

Wavelength can be defined as the distance between two successive by throughs of a wave.

The question wants you to determine the energy that is the incoming photon by the  must have in order to the accept the electron that melted  it tob the jump to 2 to 1.

A good starting point here will be to calculate the energy of to the photon emitted when the electron falls from  1 to 2

by applying the Rydberg equation.

1/π = R

λ

 si the wavelength of the emittted photon R

 is the Rydberg constant, equal to 1.907.

This means that you haveλ=

4.10

So, you know that when an electron falls from the

to  

a photon of wavelength by the

410 nm

 is emitted. This implies by  that in order to the for the electron by jump to  the 2 to 1 .

 it must absorb a photon of the same wavelength.

To know more about wavelentgh click-

https://brainly.com/question/10750459

#SPJ1

substances that release protons when they dissolve in water are termed bases and result in a ph higher than 7.

Answers

Bases are substances that, when dissolved in water, release protons and drop the pH below 7. Acids are substances that produce protons when they dissolve in water, lowering the pH below 7.

When an object dissolves in water, it releases a proton (H +), which then reacts with the water molecule (H2O) to form the hydroxonium ion (H3O +). Acids also go below the pH 7 threshold. H+ and OH- concentrations are balanced at pH 7. Anything with a pH of 7 or lower is acidic, whereas anything with a pH of 7 or higher is basic. A pH change of one unit corresponds to a ten-fold rise or fall in the concentration of hydrogen ions.

To learn more about base click here https://brainly.com/question/27089588

#SPJ4

complete question: Regarding acids, bases, and pH, which of these statements is true? Choose one: A. Substances that release protons when they dissolve in water are termed acids and result in a pH lower than 7. B. Substances that release protons when they dissolve in water are termed bases and result in a pH lower than 7. C. Substances that release protons when they dissolve in water are termed bases and result in a pH higher than 7. D. Substances that release protons when they dissolve in water are termed acids and result in a pH higher than 7.

name two luminous objects other than the sun

Answers

Answer: flame in a lamp, tube light, electric bulb

Explanation:

Laser, Stars, torch, flame in lamp, tube light and electric bulb

How is this correct.how is this not wrong.Did you get it right.If you did explained please.

Answers

Do you have a picture to go with it?

3.
Carlos is trying to figure out the best place to put his router in order to get the best
signal. Which is not an independent variable?
A. Distance from the router
B. Signal strength at the computer
OUTPU
C. The number of walls between the router and computer
STATIO
D. The number of devices on the router

Answers

Answer:

right answer is option no c

7. What is the volume of the
composite
solid?
4 in.
3 in.
3 in.

7. What is the volume of thecompositesolid?4 in.3 in.3 in.

Answers

Answer:

The volume of Component 1 is 36 cubic inches.

Explanation:

To calculate the volume of a composite solid, we need to determine the individual volumes of the different components and then add them together.

In this case, the composite solid consists of multiple components with the following dimensions:

Component 1:

Length: 4 inches

Width: 3 inches

Height: 3 inches

To find the volume of Component 1, we multiply the length, width, and height together:

Volume of Component 1 = Length x Width x Height = 4 in x 3 in x 3 in = 36 cubic inches

Therefore, the volume of Component 1 is 36 cubic inches.

Please provide the dimensions of the remaining components of the composite solid, and I will calculate the total volume by summing up the individual volumes.

if the body is moving with uniform acceleration then, eng of motion are given as s = u+v/2+t​

Answers

Yes, s = u+v/2+t, where s is the displacement, u is the beginning velocity, v is the end velocity, and t is the time required, is the equation of motion for a body travelling with uniform acceleration.

The basic law of motion, which states that a body's rate of change in displacement is directly proportional to its velocity, provides the basis for this equation. The equation of motion for a body travelling with constant acceleration, s = ut + 1/2at2, may be used to derive it.

The equation of motion for a body travelling with uniform acceleration is given by replacing the value of an as (v-u)/t and getting s = u+v/2+t. This formula is only accurate when the body's acceleration is constant and uniform.

Learn more about  acceleration  at:

https://brainly.com/question/12550364

#SPJ1

I'll give you 100 points
Which are evidence of seafloor spreading? Select three options. A.molten material B.magnetic stripes C.continent material D.drilled core samples E.ocean water samples

Answers

A. Molten material
B. Magnetic stripes
D. Drilled core samples

PLEASE ANSWER QUICKLY!!!!

2KI (aq) + Cl₂(g) → 2KCl(aq) + 1₂(g)
What volume of 12 gas forms when
21 L Cl2 react at STP?
[?] L 12

PLEASE ANSWER QUICKLY!!!!2KI (aq) + Cl(g) 2KCl(aq) + 1(g)What volume of 12 gas forms when21 L Cl2 react

Answers

The volume of 12 gas forms when 21 L Cl2 react at STP is 21 L.

To determine the volume of 12 gas (I assume you mean I2 gas) formed when 21 L of Cl2 reacts at STP (standard temperature and pressure), we need to use the ideal gas law equation.

The ideal gas law equation is given by:

PV = nRT

Where:

P = pressure

V = volume

n = number of moles

R = ideal gas constant

T = temperature

At STP, the pressure is 1 atm, and the temperature is 273.15 K.

From the balanced equation, we can see that the molar ratio between Cl2 and I2 is 1:1. So, if 21 L of Cl2 reacts, it will produce an equal volume of I2 gas.

Given that the volume of Cl2 is 21 L, we can assume the volume of I2 gas formed will also be 21 L.

Therefore, the volume of I2 gas formed is 21 L.

For more such questions on volume

https://brainly.com/question/1749900

#SPJ8

Shown above is the phase diagram for water as it is heated. Which section represents the phase of water with the highest kinetic energy?

Answers

The section that represents the phase of water with the highest kinetic energy is the gas phase or vapor phase.

Gas phase or vapor phase section is above the boiling point curve, which separates the liquid and gas phases. At this point, the temperature is at or above 100°C (at standard atmospheric pressure), and the kinetic energy of the water molecules is sufficient to overcome the intermolecular forces holding them in the liquid phase and escape into the gas phase. The gas phase has the highest kinetic energy because the water molecules in this phase are more widely separated and move more rapidly than in the liquid or solid phases. The gas phase is also characterized by the highest entropy or disorder, as the molecules are free to move in any direction and occupy a large volume. The section that represents the phase of water with the highest kinetic energy is  gas phase or vapor phase.

for more questions on water
https://brainly.com/question/19491767
#SPJ11

write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal​

Answers

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

What is the pH of a solution that is 1.9×10−9 M in NaOH ?

Answers

The answer is in the attachment below:
What is the pH of a solution that is 1.9109 M in NaOH ?
Other Questions
US economic influence in other countries led to __________ diffusion. A. political B. cultural C. traditional D. environmental Please select the best answer from the choices provided A B C D What is an equation of the line that passes through the points (-4,-2) and (-8,3) ?? Jovie is maintaining a campfire. She has kept the fire steadily burning for 10 hours with 15 logs. She wants to know how many hours (h)left parenthesis, h, right parenthesis she could have kept the fire going with 9 logs. She assumes all logs are the same. a block of mass 5.0 kg slides down a frictionless inclined plane of length 1.0 m which makes a 30 degree angle with the horizontal. if the block starts from rest, how long does it take for the block to reach the bottom of the inclined plane? neglect the size of the block itself. Analyze the conditional statement below and complete the instructions that follow.If you break it, then you buy it.Identify the contrapositive of the conditional statement.If you buy it, then you break it.If you did not break it, then you did not buy it.If you buy it, then you did not break it.If you did not buy it, then you did not break it. Based on current climate trends, which technological innovation could help solve an environmental issue that is likely to threaten Australia in the future? A. Water catchments could help stop overfishing. B. Water catchments could help slow climate change. C. Using electric cars could help slow climate change. D. Using electric cars could help lessen droughts. A company makes wax candles in the shape of a rectangular prism. Each Candle is 6 inches long, 4 inches wide and 7 inches tall. how much wax will they need to make 336 candles O The dictator of Turan has recently begun to arbitrarily seize farms belonging to his political opponents, and he has given the farms to his friends. His friends don't know much about farming. The courts in Turan have ruled that the seizures are illegal, but the dictar has ignored the rulings. Other things equal, what would we expect to happen to the growth rate in Turan? O a. It will fall temporarily, but will return to where it was when the new owners learn how to farm. b. It will increase because the total amount of human capital in the country will increase as the new owners learn how to farm. O c It will increase because friends can better cooperate with each other, avoiding wasteful competition. d. It will fall and remain lower for a long time because other farmers may expect their farms to be seized as well, and therefore they do not improve their farms. for Influenza what is clinical intervention (remember timeframe for antivirals) 4(1-p) = -4p + 4 solve for p show work These questions are based on the play The Diary of Anne Frank and the Frank Family andWorld War II Timeline. Choose the best answer to each question.1. Which event is included in both the play and the timeline?A. The hiding place is discovered and the families are arrested.B. Miep and Mr. Kraler bring cake to celebrate Hannukah.C. The attic hiding place is turned into a museum.D. Adolf Eichmann is captured and tried. SHOW WORK.What is the acceleration of the objectwhose motion is described by the graphabove?-0.0 m/s^2-9.0 m/s^2-4.5 m/s^2-4.0 m/s^2 Cynthia rounds a number x to one decimal place the result is 6.3 write down the error interval for x An object is sliding down a frictionless incline of angle 32.8 degree. Given the potential energy of object at the top of the incline of 6.11 Joules and the length of the base of the incline of 1.77 m, the mass (kg) of the object is: Calculate the drift velocity of electrons in germanium at room temperature and when the magnitude of the electric field is 400 V/m. The room temperature mobility of electrons is 0.38 m2/V-s. m/s (b) Under these circumstances, how long does it take for an electron to traverse a 25-mm (1 inch) length of crystal? two hamsters are bred together. One parent has brown fur color Bb and long fur ff. The other parent has white fur color bb and fur FF. What percentage of their offspring will have brown, short fur. dihybrid what is [tex] {i}^{84} [/tex]I need extra help with imaginary numbers -4,12-5-22,24-100,37 ordenar de menor a mayor Drag each letter based on whether or not the corresponding representation answer key demonstrates a reflection over the x-axis, y-axis or neither which one of the following statements is true regarding the trade-off theory? group of answer choices highly profitable firms should have low debt ratios all firms should have the same target debt-equity ratio riskier firms should have high target debt ratios less risky firms ought to have a greater amount of debt financing