Answer:
\(V_1=0.139L=139mL\)
Explanation:
Hello!
In this case, since the dilution processes are characterized by the decrease of the original stock solution by holding the moles constant and therefore modify the volume, for the described dilution we can write:
\(C_1V_1=C_2V_2\)
Whereas we are asked to compute the volume of the original solution; thus, we can solve for it as shown below:
\(V_1=\frac{C_2V_2}{C_1}=\frac{1.0M*2.5L}{18.0M}\\\\V_1=0.139L=139mL\)
Best regards!
Answer:
1: C- Vf= MfVi/Mi
2: 1.5
3: B- Add 1.5 mL of 4.00 M H2SO4 to 10.5 mL of water to get 12 mL of 0.50 M H2SO4.
Explanation:
How many bonds are formed when the following atoms combine?
a) Hydrogen and oxygen in water
b) Hydrogen and chlorine in hydrogen chloride
c) Hydrogen and carbon in methane
Answer:
the answer is a I think
Explanation:
Apples are peeled, cored, and pureed to produce an unpasteurized applesauce. The applesauce must be heated to 96°C to ensure that it is microbiologically stable for hot fill packaging. A tube-in-tube heat exchanger is used to heat the applesauce (Cp = 3.83 kJ/kgK) from an initial temperature of 10°C to the target temperature. Steam at 130°C with 70% quality is used as the heating medium with the condensate leaving the heat exchanger at 130°C.
How much steam (mass flow rate in kg/hr) is required per kilogram of applesauce processed?
C6H12O6 + 602 → 6CO2 + 6H₂O
The most efficient ratio is
1 C6H12O6 6 02.
Which set of reactants will be the most
efficient (least wasteful of materials) for
the reaction?
A. 1.0 mol C6H12O6 and 3.0 mol O₂
B. 1.5 mol C6H₁2O6 and 3.0 mol O₂
C. 3.0 mol C6H₁2O6 and 6.0 mol O₂
D. 0.5 mol C6H₁2O6 and 3.0 mol O₂
Answer:
D
Explanation:
The ratio of C6H12O6 (which will be referred to as "the carb") to oxygen is 1 to 6, so if we find an answer which has the same ratio, it should be chosen. A is 1:3
B is even worse with a ratio of the carb to oxygen of 1:2
C is the same as B, 1:2
D has a ratio of the carb to oxygen of 1:6, which is what we are looking for.
Compare the behavior of the mixture of gases with each solitary gas in the presence of flame.
The heat made by a mixture of gases is less than that produced by solitary gases of hydrogen or oxygen.
How are the gases behave in the mixture?The property becomes a solution of a homogeneous mixture. Some of the effects of gas mixtures are easy to control. if we know the composition of the gases in the mix. In gas mixtures, all components in the gas phase can be used separately. The atmosphere is a mixture of different gases. The part, usually present in solution, first has to be atomized in a flame. Premixed combustion flame, a mixture of fuel and oxidant gas, and diffusion. compared to liquid streams, is relatively simple because the bulk characterization of a single phase is implicit. However, when gas. The heat produced by a mixture of gases is less than that produced by solitary gases. of hydrogen or oxygen.
so we can conclude that the flame appears yellow if there are impurities in the air whereas a pure hydrogen gas flame will not produce any smoke.
Learn more about gases here: https://brainly.com/question/25736513
#SPJ1
! 20 points !need answer FAST!
In nuclear reactions, how can huge amounts of energy be produced?
A. By converting chemical energy into nuclear energy
B. By releasing thermal energy in uranium
C. By creating energy from the surrounding space
D. By destroying matter to create energy
Answer:
C.
Explanation: In nuclear fission and fusion reactions, some of the energy in matter is converted to energy. If you weigh the reactants and the products, the products will weigh less than the reactants. This is called the mass defect and is the result of turning matter into energy.
Answer:
D.
Explanation:
With the Fat Boy and Little Boy nuclear bombs that were drop on Japan, They used a little gun (inside the bomb) that shot a little slug. this hit and caused a chain reaction that caused the bomb to detonate. This released much energy. Destroying much of the two cities when the bombs were dropped.
CH3 H H CH3
| | | |
CH3--- C -------C------ C -------C--CH3
| | | |
CH2 CH2 CH2 CH2
| | | |
CH3 CH3 CH3 CH3
what is the name of this compund
The systematic name of the compound is 2,2,3,3-tetramethylbutane.
What is the name of this compound ?The parent chain in this compound consists of four carbon atoms, indicated by the central chain of Cs in the diagram you provided. The prefix "but" in the name indicates that there are four carbon atoms in the parent chain.
The four methyl groups are attached to different carbon atoms in the parent chain. We can indicate the position of each methyl group by numbering the carbons in the parent chain. In this case, we can number the carbons starting from the left side of the parent chain, so that the first methyl group is attached to the second carbon, the second methyl group is attached to the third carbon, the third methyl group is attached to the second-to-last carbon, and the fourth methyl group is attached to the last carbon. This gives us the substituent groups 2,2,3,3-tetramethyl-.
Finally, we combine the parent chain name and the substituent groups to get the full name: 2,2,3,3-tetramethylbutane.
Learn more about organic compounds here: https://brainly.com/question/26854014
#SPJ1
5.0 liters of a gas are at an initial pressure of 5.0 atmospheres. If the temperature and
amount of a gas are kept constant, what is the new volume of the gas when pressure
is increased to 7.0 atmospheres?
The new volume of a gas when the pressure is increased to 7.0 atmospheres is 3.57 L.
How to calculate volume?The volume of a gas can be calculated by using the following formula:
P₁V₁ = P₂V₂
Where;
P₁ = initial pressureV₁ = initial volume P₂ = final pressureV₂ = final volumeAccording to this question, 5.0 litres of a gas at an initial pressure of 5atm is given. The new volume can be calculated as follows:
5 × 5 = 7 × V
25 = 7V
V = 25/7
V = 3.57L
Learn more about volume at: https://brainly.com/question/24189159
#SPJ1
A gas is confined to a piston equipped with a cylinder at constant temperature. Under a constant pressure on the cylinder of 1.60 atm, the gas is compressed from an initial volume of 2.00 L to a final volume of 0.80 L. What is the magnitude and sign of the work done during this process, in J? (Note: 1 L-atm = 101.3 J)
The magnitude of the work done during this process is 194.496 J. Since the work is being done on the system (the gas is being compressed), the sign of the work done is negative.
How to calculate the work done during this process.First we can use the formula:
W = -PΔV
Where
W is the work done P is the pressure ΔV is the change in volumeThe negative sign indicates that work is done on the system (the gas), as it is being compressed.
In this case, the initial volume is 2.00 L and the final volume is 0.80 L, so the change in volume is:
ΔV = Vf - Vi = 0.80 L - 2.00 L = -1.20 L
The negative sign indicates that the volume has decreased.
The pressure is constant at 1.60 atm, so we can substitute these values into the formula:
W = -(1.60 atm)(-1.20 L)
W = 1.92 L-atm
We can convert this value to joules using the conversion factor provided in the problem:
1 L-atm = 101.3 J
So,
W = (1.92 L-atm)(101.3 J/L-atm)
W = 194.496 J
Therefore, the magnitude of the work done during this process is 194.496 J. Since the work is being done on the system (the gas is being compressed), the sign of the work done is negative.
Learn more about work done here : brainly.com/question/28356414
#SPJ1
How many molecules are in 24 grams of ozone (03)
Answer:48
Explanation:
Answer: 3. 0.125 X 10”23 molecules
Explanation:
Which of the following would likely be a non -conductor of electricity?a) An aqueous solution of magnesium sulfate (Epsom salts)b) Gasolinec) An aqueous solute of sodium carbonate (washing powder)d) Carbonated soft drinksExplain your answer.
This would be the Gasoline, letter B, since gasoline is a hydrocarbon and these compounds are formed with covalent bonds, they share electrons and not gain or lose, forming ions and then conducting electricity, as we can see in the other 3 options, they all form ions.
How many valence electrons does Na have when forming an iconic bond with Cl? Please help asap! needs to be right
a) 1
b) 8
c) 2
d) 4
Answer:
.............
1
a=1
because....... Na have 11 electrons
So..... the Electrons in K shell... 2
L shell 8
and m shell 1.........
Help on 1.15 please!!
In this case, multiplying 0.35 by 55 gives us the number 19. 25.2 m squared plus three squares is a match. This is equivalent to the third square of 20 by 25.4.
What is significant numbers?We will use the least number of decimal places for addition and subtraction of important values supplied 20 0.9 kg minus 12.90 kg divided by 10 liters thus far. So there are two decimal places in this. Then, 8.0 kg divided by 100 gallons will equal 20.99 install 0.90 sequel to eight point and apologize. Therefore, take note that the least amount of significance you have is three significant numbers. As a result, this is likewise equivalent to 0.8 kg each item. We need to divide 45.82 g by three cm, 0.64 g by 0.859 cm, and 0.64 g by three cm for a letter B. Therefore, we must first solve for the parenthesis in this case. so 27 cm divided by 45.82 g. Q.divided by 0.634 cm, my nose weighs 0.64 g. Do the math with two. The division is then distributed when we are ready to resolve it. This therefore amounts to 1.7 g per centimeter. We have 1.7 gram cm Q divided by two, or Q miners 6.0 times 10 to the negative three g per centimeter cube. This is the same as 0.9 grams per centimeter. Finally, we have 0.35 m times 1.5 m, or the final 25.2 m squared, for literacy. In this case, multiplying 0.35 by 55 gives us the number 19. 25.2 m squared plus three squares is a match. This is equivalent to the third square of 20 by 25.4.To learn more about significant numbers refer to:
https://brainly.com/question/24491627
#SPJ1
Please help I got to go to bed
Answer:
\(\begin{gathered}\boxed{\begin{array}{c|c} \bf Compound \: Formula & \bf Number \: of \: Atoms \\ \\ \frac{\qquad \qquad}{} & \frac{\qquad \qquad}{} \\ \sf BeCl_2 & \sf 3 \\ \\ \sf CH_4 & \sf 5 \\ \\ \sf SF_6 & \sf 7 \end{array}} \\ \end{gathered}\)
\(\begin{gathered}\boxed{\begin{array}{c|c} \bf Shape \: Prediction & \bf Shape \: according \: to \: Stimulator \\ \\ \frac{\qquad \qquad}{} & \frac{\qquad \qquad}{} \\ \sf Linear & \sf Linear \\ \\ \sf Tetrahedral & \sf Tetrahedral \\ \\ \sf Square \: bipyramidal & \sf Octahedral \end{array}} \\ \end{gathered}\)
\(\sf \small \pink{Thanks }\: \green{for} \: \blue{joining} \: \orange{brainly } \: \red{community}!\)
What Group IA (1) ion has the electronic arrangement shown 1s22s22p6
Answer:
Explanation:
Sodium ion
what is the valence number of HCO3-.
There are eight elements in the second row (lithium to neon) of the periodic table.
Answer:
lithium, beryllium, boron, carbon, oxygen, fluorine and neon
Explanation:
There are eight elements in the second row (lithium to neon) of the periodic table as the second row can has 2 shells and second shell has maximum capacity of 8 electrons.
What is periodic table?Periodic table is a tabular arrangement of elements in the form of a table. In the periodic table, elements are arranged according to the modern periodic law which states that the properties of elements are a periodic function of their atomic numbers.
It is called as periodic because properties repeat after regular intervals of atomic numbers . It is a tabular arrangement consisting of seven horizontal rows called periods and eighteen vertical columns called groups.
Elements present in the same group have same number of valence electrons and hence have similar properties while elements present in the same period show gradual variation in properties due to addition of one electron for each successive element in a period.
Learn more about periodic table,here:
https://brainly.com/question/11155928
#SPJ2
write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
How old was this tree when it was cut down?
how do we open a business that is cheaper
Answer:dont sell as much stuff and name it something like the doller treestore LOL
Explanation:
Because the mass of the flask with water exceeds the amount that can be weighed on the digital balances, the triple-beam-balance is used, which only weighs to the nearest 0.01 g. Why doesn't using this balance affect the number of significant digits to which the experimental molecular weight of carbon dioxide can be reported
Answer:
The Less accuracy of this method is the reason for this balance affecting the number of significant digits to which the experimental molecular weight of carbon dioxide can be reported.
Explanation:
As we know the triple-beam-balance method is a less accurate method of measurement of mass.
An accurate molecular weight is not required in this case. So, this method is being used because much accuracy is not required.
That is why this balance affects the number of significant digits to which the experimental molecular weight of carbon dioxide can be reported.
2. How do you determine the charges on the ions in an ionic compound?
In ionic compounds, the charges on the ions are determined by the number of electrons donated to or accepted by each ion.
Ionic compounds are formed when a bond is formed between two atoms as a result of electron donation from one atom and electron acceptance by the other.
Thus, the charge on each ion would depend on the number of electrons donated or accepted. An atom that donates electrons will carry a positive charge with the number of electrons donated while an atom that accepts electrons will carry a negative charge with the corresponding number of accepted electrons.
For example, NaCl is an ionic compound formed by the combination of Na and Cl atoms. Na donated its single valence electron to Cl. Hence, in ionic form, the Na atom who donated an electron would be \(Na^+\) while the Cl atom that accepted an electron would be \(Cl^-\)
More on ionic compounds can be found here: https://brainly.com/question/9167977
What orbits, or revolves, around most planets?
(A) Comets
(B) Moons
(C) Rings
(D) Stars
Answer:
B. Moons
In almost every planet in the Milky Way galaxy, there is at least one moon in their orbit.
The cell wall regulates what enters and exits the cell? True or False
Answer:
True
Explanation:
Answer:No, the Cell Membrane does I'm pretty sure
Explanation:
Name the type of marked carbon
If [H3O^ + ]=1.7*10^ -8 M what is the pOH of the solution?
Answer: 6.23
Explanation:
1) solve for pH
pH=-log (H3O+) = - log 1.7 X 10^-8 =7.77
2) now do 14-pH = 14 -7.77=6.23
Name the substance in red blood cells that carbon monoxide from cigarette smoke combines with.
The substance in red blood cells that carbon monoxide from cigarette smoke combines with is called hemoglobin.
Hemoglobin is a protein molecule found in red blood cells that is responsible for transporting oxygen from the lungs to the rest of the body. Hemoglobin consists of four subunits, each containing a heme group. The heme group contains an iron ion, which binds to oxygen molecules in the lungs.
Carbon monoxide (CO) from cigarette smoke can bind to the iron ion in the heme group with a much greater affinity than oxygen. When CO binds to hemoglobin, it forms a stable complex called carboxyhemoglobin (COHb).
This reduces the amount of hemoglobin available for binding with oxygen, which can lead to a reduction in the amount of oxygen that can be transported to the tissues.
The formation of COHb can also affect the release of oxygen from hemoglobin in the tissues. Hemoglobin releases oxygen in response to a decrease in oxygen concentration, which is sensed by the heme group. However, when CO binds to the heme group, it alters the shape of the hemoglobin molecule and reduces its ability to release oxygen.
As a result, the presence of carbon monoxide in the blood can lead to a range of health problems, including headaches, dizziness, shortness of breath, and even death in severe cases.
The best way to prevent carbon monoxide poisoning is to avoid exposure to smoke from tobacco products and other sources of combustion, such as gas heaters and stoves.
For more question on red blood cells click on
https://brainly.com/question/1407525
#SPJ11
Hypothesis II: Write the equation with Iron (III) Chloride and balance it: Iron + Copper (II) chloride --> Iron (III) chloride + Copper
Answer:
Fe + CuCl2 = FeCl2 + Cu
Explanation:
This is already balanced.
Convert a length of 15.0 m to inches
Answer:
15 meters = 590,551 inches
What would be the specific mathematical effect on the reaction rate if you carried out the sodium iodide-in-acetone reactions on the alkyl halides using an iodide solution half as concentrated? ("Slower" or "faster" is not specific enough.)
Answer:
Slower
Explanation:
The reaction between alkyl halides and sodium iodide-in-acetone is an SN2 reaction. The rate of reaction depends on the concentration of the alkyl halide as well as the concentration of the sodium iodide. It is a bimolecular reaction.
This means that if the concentration of any of the reactants is halved, the rate of reaction decreases accordingly.
Therefore, if the iodide solution is half as concentrated, the reaction is observed to be slower in accordance with the rate law;
Rate = k[alkyl halide] [iodide]
Arrange the following three ionic compounds in the order of increasing lattice energy (from smallest lattice energy to largest lattice energy).
MgBr₂
MgO
KBr
The expected lattice energies, in increasing order, are MgO> MgBr2> KBr.
The ranking is related that the lattice energy being directly proportional to the strength of the ionic bond. If the bond is strong, the lattice energy would be high.
If the intermolecular force is strong, then the energy requires to break the bond would be greater. Thus, the lattice energy would be high.
MgO has the lowest lattice energy because it is the smallest and has the weakest attractive force between the ions. MgBr2 has a slightly higher lattice energy because the bromine ions are larger and have a stronger attractive force than the oxygen ions. KBr has the highest lattice energy because the potassium ions are larger than the bromine ions and have a stronger attractive force.
To know more about ionic bonds, click below:
https://brainly.com/question/2220825
#SPJ1