(A) The capacitor stores charge.
Therefore, having the ability to store charge is the best choice. (B) The air-filled parallel plate capacitors' expression is,is a measure of permittivity. The area of the plates is A, and their separation is d. The capacitance can be increased by either increasing the plate area or decreasing the distance between the plates.
Therefore, reducing the distance between the capacitor's plates is the best course of action.
(C) The capacitance of a parallel plate capacitor is directly proportional to the area of the plates and inversely proportional to the space between the plates. Therefore, the correct responses are "Double the plate separation and halve the plate area."
\(C=\frac{\epsilon_{o} A}{d}\)
Here, \(\epsilon_{o}\)
(D) The new capacitance is,
\(C^{1} =\frac{\epsilon_{o} A^{1} }{d^{1} }\)
\(C^{1} =\frac{\epsilon_{o} 2A^{1} }{d^{1}/2 }\)
\(C^{1} =4\frac{\epsilon_{o} A^{1} }{d^{1} }\)
\(C^{1} =4C\)
Therefore, the correct options are "Halve the plate separation and double the plate area".
Learn more about capacitor
brainly.com/question/17176550
#SPJ4
How does an inclined plane increase force?
Acceleration will increase as the angle of incline does, and as a result, force will as well.
The gravitational force acting on the cart increases as the slope of the incline increases, causing it to accelerate more quickly.The ramp's steepness will cause an increase in inclination. As a result, the acceleration increases as the inclination angle increases. This acceleration causes the object to descend with greater speed.
To learn more about acceleration click here:
https://brainly.com/question/28743430
#SPJ4
Question 3
What natural event do scientists blame for the desertification taking place in South Africa?
Answer:
Explanation:
Overgrazing and woodcutting are responsible for most of the desertification of rangelands, cultivation practices inducing accelerated water and wind erosion are most responsible in the rain-fed croplands, and improper water management leading to salinization is the cause of the deterioration of irrigated lands.
Which statements describe how self-reflection can benefit students? Check all that apply. It allows students to better understand what they are learning. It ensures that students understand what they are learning. It helps students perform better on tests and homework assignments. It helps students recognize when they need help in class. It helps students save time when studying for tests.
Answer:
a c d
Explanation:
yeet
Answer:
a c d
Explanation:
All circular motions are usually periodic but all periodic motions are not circular why
All periodic motions are not circular bcox they aren't similar to each other as u know the motion repeats the periodic table and also repeats itself of the tym perform the motion of the periodic...
Answer:
t is usually seen that all circular motions are usually periodic
Explanation:
but all periodic motions are not circular
this can be proved by an example for example when vehicles runs in uniform speed of motion then its speed is called periodic motion
where is his speed might not be called circular motion
if my answer is correct please mark my answer as brainliest
The base ( foundation ) of building is made wider. Why ?
Answer:
the heart
Explanation:
length time width is hearts for captain americas sheild sirs iro
Answer:
because if it's won't be wider so the building have a chance to be distracted in any distuction
that's why they are made wider..
why does our body tend to rotate to the vertical position when we try to float? why is it easy to float in the great salt lake?
Our body tends to rotate to the vertical position when we try to float due to the principles of buoyancy and the distribution of weight and volume in our body. The human body is not uniformly dense, with denser regions concentrated in the lower part, such as the legs and pelvis.
while the upper part, including the chest and lungs, is less dense. When we try to float, the denser regions of our body tend to sink, while the less dense regions tend to float. This causes a rotational torque that aligns our body vertically, with the denser parts submerged and the less dense parts floating on the water's surface. Floating is easier in the Great Salt Lake due to its high salinity. The salt content in the water increases its density, making it more buoyant compared to regular freshwater. The increased buoyancy provides greater support to our body, making it easier to float and maintain buoyancy in the water. Additionally, the high salt content in the Great Salt Lake also makes the water more dense, which further enhances buoyancy. This increased density of the water contributes to a higher upward force, counteracting the downward force of gravity and making floating easier.
learn more about vertical position here:
https://brainly.com/question/174803
#SPJ11
The "hang time" of a punt is measured to be 4.30 s
.If the ball was kicked at an angle of 68.0 ∘ above the horizontal and was caught at the same level from which it was kicked, what was its initial speed?
t^2=10.97 sin(68)-3.05cos(68)/4.905cos(68)
t=2.2164
10.97/cos68 x 2.21= vo
I got v0=13.25
13.25/1000=.0133 x 3600=47.88 kh/m(which is wrong)
13.25 m/s = 47.88 km/h was roughly how fast the punt was moving at the time.
What, in physics, is speed, and what is its unit?The rate at which distance and time change is what is meant by speed. It has the aspect of temporal and spatial distance. The combination of a fundamental units of distance and time is what is described as the System of units ( si of speed. As a result, the SI unit for speed is the meter per second.
Describe velocity and speed.In contrast to velocity, which describes the speed and direction of the an object's movement, speed is the rate of movement along a path. Instead, velocity is a vector while speed is a scalar quantity.
t = (2 * v0 * sin) g
where (9.81 m/s2) is the acceleration caused by gravity.
In order to find t, we must solve for it as follows: t = (2 * v0 * sin) / g 4.30 ≈ (2 * v0 * sin68) / 9.81 v0 = (4.30 * 9.81) / (3 ) * sin68)
0.194 = 13.25 m/s
We may multiply this by 3.6 to get the speed in km/h: 13.25 m/s * 3.6 ≈ 47.88 km/h
To know more about speed visit:
https://brainly.com/question/28224010
#SPJ1
The initial speed 13.25 m/s = 47.88 km/h was roughly how fast the punt was moving at the time.
Speed in physics is measured in what unit?Speed refers to the rate at which distance and time change. It has a temporal and spatial distance component. The System of units (s of speed) is the amalgamation of fundamental units of time and distance. Consequently, the meter per second is the SI unit for speed.
Depict speed and speed :Speed is the rate of movement along a path, in contrast to velocity, which describes the speed and direction of an object's movement. Speed, on the other hand, is a scalar quantity while velocity is a vector.
t = (2 × v₀ × sin) g
where (9.81 m/s2) is the acceleration caused by gravity.
In order to find t, we must solve for it as follows:
t = (2 × v₀ × sin) / g 4.30 ≈ (2 × v₀ × sin 68) / 9.81 v₀
= (4.30 × 9.81) / (3 ) × sin 68)
0.194 = 13.25 m/s
We may multiply this by 3.6 to get the speed in km/h:
13.25 m/s × 3.6 ≈ 47.88 km/h
Learn more about speed :
brainly.com/question/28224010
#SPJ1
an oil film (nnn = 1.46) floats on a water puddle. you notice that green light (λλlambda = 546 nmnm) is absent in the reflection. What is the minimum thickness of the oil film?
The minimum thickness of the oil film that will cause destructive interference for green light (λ = 546 nm) is 93.8 nm.
When light passes through a thin film of oil, some of it reflects off the top surface of the film, and some of it reflects off the bottom surface of the film. When these two reflected waves recombine, they can interfere constructively or destructively, depending on the thickness of the film and the wavelength of the light.
In this case, we are told that the green light with a wavelength of λ = 546 nm is absent in the reflection. This means that the thickness of the oil film must be such that the waves reflecting off the top and bottom surfaces of the film interfere destructively for this particular wavelength.
The condition for destructive interference is:
2nnnt = (m + 1/2)λ
where n is the refractive index of the oil, t is the thickness of the oil film, λ is the wavelength of the light, and m is an integer that depends on the order of the interference.
For the first-order interference (m = 1), the equation becomes:
2nnnt = λ/2
Substituting the values given in the problem, we get:
2(1.46)(t) = 546 nm/2
Solving for t, we get:
t = 93.8 nm
Click the below link, to learn more about Thickness of oil film:
https://brainly.com/question/13034506
#SPJ11
2. Let C be a circle. (a) Prove that the exterior of C has C as its boundary.
(b) Prove that the exterior of C cannot be convex.
In Geometry, the exterior of a circle is defined as all the points outside the circle, that is, it is the set of all points that are not contained within the circle. The boundary of a set is the set of points that are the limit points of the set but are not contained within it. Therefore, the exterior of C cannot be convex.
A limit point of a set is defined as a point such that every neighborhood of that point contains at least one point in the set.
Since the circle C is a closed set, it follows that all limit points of C belong to C.
Any point that is a limit point of the exterior of C must lie on the boundary of C since it is not contained within C.
Hence, we can conclude that the exterior of C has C as its boundary.
(b) To prove that the exterior of C cannot be convex, let us recall the definition of a convex set. A set is said to be convex if any two points in the set can be connected by a straight line that is contained entirely within the set.
Now, let's consider two points that are outside the circle C.
Since the exterior of C is the set of all points outside the circle C, these two points belong to the exterior of C.
Therefore, the exterior of C cannot be convex.
Read more about Convex.
https://brainly.com/question/29656636
#SPJ11
7. CALCULATE: How much work is done in each of
the following examples? Show all of your
calculations.
a. A child uses 4 N of force to pull a wagon a
distance of 2 m along a sidewalk.
b. A construction worker uses 30 N of force
to drag a toolbox a distance of 3 m
a. 8J
b. 90J
Notes formulaW = F × s
W = Work done (J)
F = Force (N)
s = distance (m)
Known thata. F = 4N
s = 2m
b. F = 30N
s = 3m
Questiona. W = ..?
b. W = ..?
Way to do ita. W = F × s
= 4N × 2m = 8J
b. W = F × s
= 30N × 3m = 90J
#Moderators please don't be mean, dont delete my answers just to get approval from your senior or just to get the biggest moderation daily rank.
What subject is said to be at the crossroads of biology, physics, and geology? A) biochemistry. B) chemistry. C) environmental chemistry D) none of the above.
The subject that is said to be at the crossroads of biology, physics, and geology is none of the above because It is actually the field of biophysics, which applies principles of physics to study biological systems and processes. Option D.
The subject that is said to be at the crossroads of biology, physics, and geology is none other than Biophysics. Biophysics is an interdisciplinary field that combines the principles of physics, biology, and chemistry to study biological systems at different levels, from molecules to organisms.
It involves the application of physical and mathematical tools to solve biological problems, such as understanding the structure and function of biomolecules, the mechanics of cells and tissues, the dynamics of neural networks, and the interactions between organisms and their environment. Therefore, option D) "none of the above" is the correct answer.
To learn more about biology, click here:
https://brainly.com/question/28405832
#SPJ11
Echolocation is a form of sensory perception used by
most bats, toothed whales and porpoises, as well as a
few birds. The animal emits a pulse of sound which
is reflected from objects; the reflected pulse is then
detected by the animal to learn about its environ-
ment or interact with other animals. Echolocation • waves emitted by whales have frequencies of about 200,000Hz. (a) What is the wavelength of the whale's echolocation wave? (b) If an obstacle is 100m from the whale, how long after the whale emits a wave will the reflected wave return to him?
Answer:
(a) What is the wavelength of the whale's echolocation wave?
How do you calculate the wavelength of radiation?
Wavelength is a measure of the distance between two consecutive peaks or troughs of a wave. It is an important property of light and other electromagnetic radiation, and can be used to calculate their energy.
The most common way to calculate the wavelength of radiation is using the equation
c=λν, where c is the speed of light (3 x 10^8 m/s), λ is the wavelength and ν is the frequency.
Frequency is the number of wave peaks that pass a certain point per second, and can be measured in hertz (Hz).
To calculate the wavelength, start by finding the frequency of the wave. This can be done by counting the number of wave peaks that pass a certain point in one second, or measuring the time between two wave peaks and dividing one second by that time. Once the frequency is known, plug it into the equation c=λν to calculate the wavelength.
For example, if the frequency of a wave was measured to be 10 Hz, the wavelength can be calculated by solving the equation c=λν, giving λ = 3 x 10^8/10 = 3 x 10^7 m.
Learn more about Frequency at : https://brainly.com/question/14316711
#SPJ4
A 3200LB car is traveling 45.0 mi/hr when the driver sees another car 90.0 ft ahead stopped dead in the middle of the street. The driver slams on the brakes so that they lock up and the car skids. If the coefficient of friction is 0.77, will the car stop in time to avoid a collision with the other car? If it does, calculate how close the cars are when the moving car stops. If it doesn’t, calculate the velocity of the car upon impact.
The velocity of the car upon impact is 10.8 m/s, or about 24.2 mph. Velocity is typically measured in units of meters per second (m/s) or kilometres per hour (km/h).
What is Velocity ?
Velocity is a vector quantity that describes the rate and direction of an object's motion. It is defined as the change in displacement over time. In other words, velocity is how fast an object is moving and in what direction. For example, if a car is traveling north at a speed of 20 m/s, its velocity would be 20 m/s in the northward direction.
First, we can calculate the initial velocity of the car in meters per second:
45.0 mi/hr = 66.0 ft/s
1 mile = 5280 ft
66.0 ft/s x 1 mile/5280 ft = 0.0250 mile/s
1 hour = 3600 s
45.0 mi/hr = 45.0 x 1 mile/1 hour = 45.0 mile/hr
45.0 mile/hr x 1 hour/3600 s = 0.0125 mile/s
0.0125 mile/s x 1609.34 m/mile = 20.12 m/s
The initial velocity of the car is 20.12 m/s.
Next, we can calculate the acceleration of the car using the coefficient of friction and the acceleration due to gravity:
μ = 0.77 (coefficient of friction)
g = 9.81 m/s² (acceleration due to gravity)
a = μg = 0.77 x 9.81 = 7.56 m/s²
The acceleration of the car is 7.56 m/s².
Now we can use the kinematic equation for uniformly accelerated motion to calculate the distance the car will travel before stopping:
v² = u² + 2as
where v is the final velocity, u is the initial velocity, a is the acceleration, and s is the distance traveled.
Since the car stops, the final velocity is zero:
v = 0
Plugging in the known values, we get:
0² = (20.12 m/s)² + 2(-7.56 m/s²)s
Solving for s, we get:
s = (20.12 m/s)² / (2 x 7.56 m/s²)
s = 53.3 m
Therefore, the car will not stop in time to avoid a collision with the other car, since the stopping distance of the car is 53.3 meters, which is greater than the distance between the two cars (90.0 ft or 27.4 meters).
To calculate the velocity of the car upon impact, we can use the same kinematic equation:
v² = u² + 2as
but this time, the distance travelled is the distance between the two cars, since the car will not stop before hitting the other car:
s = 27.4 m
Plugging in the known values and solving for v, we get:
v = √[(20.12 m/s)² + 2(-7.56 m/s²)(27.4 m)]
v = 10.8 m/s
Therefore, the velocity of the car upon impact is 10.8 m/s, or about 24.2 mph.
Learn more about Velocity from given link
https://brainly.com/question/80295
#SPJ1
[Show student response to predict question] What happens to the amount of total force the muscle generates during the stimulated twitch? How well did the results compare with your prediction?
During a stimulated twitch, the amount of total force that the muscle generates will depend on the intensity of the stimulation. As the intensity increases, the force generated by the muscle will also increase.
This is because the greater the intensity of the stimulation, the more motor units will be recruited and activated to generate force.
Generally speaking, if the intensity of the stimulation is increased during a stimulated twitch, it would be expected that the force generated by the muscle would also increase.
If the results of the study confirmed this prediction, then they would be considered to be in line with what is expected based on muscle physiology.
Read more about Stimulated twitch
https://brainly.com/question/28963045
#SPJ11
How is thermal equilibrium reached? Question 3 options: When both objects have the same temperature When objects have the same mass When objects are both in the same state of matter (solid, liquid, or gas) When objects have different temperatures.
In the thermal equilibrium, the change in temperature is said to be zero in between the bodies. Thermal equilibrium is reached when both objects have the same temperature.
What is thermal equilibrium?Thermal equilibrium is easily explained by the zeroth law of thermodynamics. If any two-body is at thermal equilibrium there is no change in the temperature of the body.
According to zeroth law if body A is in thermal equilibrium with body B and body B is in thermal equilibrium with C . So body A and C are also in thermal equilibrium.
In the thermal equilibrium, the net heat transfer is said to be zero in between the bodies.
Hence option A IS RIGHT. Thermal equilibrium is reached when both objects have the same temperature
To learn more about the thermal equilibrium refer to the link;
https://brainly.com/question/2637015
What specific type of tide has the smallest difference between high and low tide?
Answer: Neap tides
Explanation: Neap tides are tides that have the smallest tidal range, and they occur when the Earth the Moon, and the Sun form a 90o angle. They occur exactly halfway between the spring tides when the Moon is at first or last quarter.
A 230 v mains powered electrical drill draws a current of 2.5 A calculate the power of the drill at use
Air at standard temperature and pressure flows through a 1-in.-diameter galvanized iron pipe with an average velocity of 8 ft/s. Â What length of pipe produces a head loss equivalent to (a) a flanged 90 degree elbow, (b) a wide-open angle valve, or (c) a sharp-edged entrance?
The equivalent length of pipe that produces a head loss equivalent to a flanged 90-degree elbow is 10.4 ft, the equivalent length for a wide-open angle valve is 414 ft, and the equivalent length for a sharp-edged entrance is 2.6 ft.
In order to determine the length of pipe that produces a head loss equivalent to a flanged 90-degree elbow, a wide-open angle valve, or a sharp-edged entrance, we need to calculate the head loss coefficient for each of these components.
For a flanged 90-degree elbow, the head loss coefficient can be estimated using the empirical equation developed by the Crane Company, which is widely used in industry:
K = 0.3
For a wide-open angle valve, the head loss coefficient can also be estimated using the Crane equation, which gives:
K = 10
For a sharp-edged entrance, the head loss coefficient is typically assumed to be:
K = 0.5
Once we have the head loss coefficient for each component, we can use the Darcy-Weisbach equation to calculate the equivalent length of pipe:
\(\begin{equation}h_f = f \cdot \frac{L}{D} \cdot \frac{V^2}{2g}\end{equation}\)
where hf is the head loss, f is the friction factor, L is the equivalent length of pipe, D is the diameter of the pipe, V is the velocity of the fluid, and g is the acceleration due to gravity.
Assuming that the pipe is made of galvanized iron, which has a roughness of 0.0005 ft, and using the Reynolds number to determine the friction factor, we can calculate the following equivalent lengths of pipe:
(a) For a flanged 90-degree elbow:
K = 0.3
\(\begin{equation}h_f = K \cdot \frac{V^2}{2g}\end{equation}\)
f = 0.0032
\(\begin{equation}L = \frac{h_f \cdot D}{\frac{f \cdot V^2}{2g}} = 10.4 \text{ ft}\end{equation}\)
(b) For a wide-open angle valve:
K = 10
\(\begin{equation}h_f = K \cdot \frac{V^2}{2g}\end{equation}\)
f = 0.038
\(\begin{equation}L = \frac{h_f \cdot D}{\frac{f \cdot V^2}{2g}} = 414 \text{ ft}\end{equation}\)
(c) For a sharp-edged entrance:
K = 0.5
\(\begin{equation}h_f = K \cdot \frac{V^2}{2g}\end{equation}\)
f = 0.005 (from Moody chart for Re = 10^5)
\(\begin{equation}L = \frac{h_f \cdot D}{\frac{f \cdot V^2}{2g}} = 2.6 \text{ ft}\end{equation}\)
To learn more about equivalent length
https://brainly.com/question/3976277
#SPJ4
12. a certain electromagnetic field traveling in vacuum has a maximum electric field of 1200 v/m. what is the maximum magnetic field of this wave? (c = 3.0 × 108 m/s)
The maximum magnetic field of this wave which has maximum electric field of 1200 v/m is 4.8 × 10⁻⁹ T.
The maximum magnetic field of an electromagnetic wave travelling in vacuum can be calculated using the following equation: B = (μ 0 E) / c, where μ 0 is the permeability of free space (4π × 10⁻⁷ N/A²), E is the electric field strength (1200 V/m in this case), and c is the speed of light (3.0 × 10⁸ m/s). Therefore, the maximum magnetic field of this wave is B = (4π × 10⁻⁷ N/A² × 1200 V/m) / (3.0 × 10⁸ m/s) = 4.8 × 10⁻⁹ T.
To know more about magnetic field please refer:
https://brainly.com/question/23096032
#SPJ4
A steel ball whose mass is 100 g is rolling at a rate of 2.8 m/sec. What is it’s momentum?
Answer:
The momentum of the steel ball is 0.28 kg m/sec.
Explanation:
The momentum of an object can be calculated using the formula: momentum = mass x velocity. In this case, the mass of the steel ball is 100 g, which is equivalent to 0.1 kg. The velocity of the ball is 2.8 m/sec. Plugging in the values into the formula, we get:
momentum = 0.1 kg x 2.8 m/sec
momentum = 0.28 kg m/sec
So the momentum of the steel ball is 0.28 kg m/sec.
A switch can send and receive on all circuits simultaneously. True or False.
False. A switch cannot send and receive on all circuits simultaneously.
In networking, a switch is a device that connects multiple devices within a local area network (LAN). It operates at the data link layer of the network protocol stack and uses MAC addresses to forward data packets to the appropriate destination.
A switch can handle multiple ports and can transmit data to multiple devices simultaneously, but it does so through a process known as **packet switching**. Packet switching involves the switch forwarding individual data packets to their intended destinations based on their MAC addresses.
While a switch can handle multiple connections and facilitate communication between devices, it operates in a sequential manner, forwarding packets one at a time based on their destinations. It cannot simultaneously send and receive data on all circuits or ports simultaneously. Each connection or port on a switch operates independently and can handle traffic in a time-division multiplexing manner, but not simultaneously on all circuits.
To know more about circuits, visit: https://brainly.com/question/12608491
#SPJ11
Can someone answer these questions
I’ll give you brainliest
1. How do YOU think a rocket/space shuttle goes into outer space
2. Newton had 3 laws about motion. Please look up his 3rd one and write it down here.
3. How is this law related to how a rocket/space shuttle goes into outer space
4. What was the purpose of the SpaceX Crew Dragon mission
5. Who were the 2 astronauts involved
6. Where was the spaceX Dragon going
7. Were the takeoff and landing successful
8. How might this mission help future space travel
Answer:
1. Following the recoil principle, rockets use combustion (a controlled explosion) to work against earth's gravitational attraction.
2. A force is a push or a pull that acts upon an object as a results of its interaction with another object. ... These two forces are called action and reaction forces and are the subject of Newton's third law of motion. Formally stated, Newton's third law is: For every action, there is an equal and opposite reaction.
(via physicsclassroom.com)
3. The combustion throws out material with very high momentum and is, physically speaking, the action. In reaction to that that, the rocket moves away from it (upward when in starts and has the action underneath it)
4. To show the world that commercial manned space missions are safely possible. Some may also like the fact that the US can now do, or rather order, manned flights into space without the help of the russian space agency (Roskosmos).
5. Robert Behnken and Douglas Hurley
6. The international space station (ISS)
7. Yes, Stage 1 of the rocket landed on the drone ship. The crew opened the hatch to enter the space station after 21 hours and 39 minutes after the launch from Cape Canaveral.
8. To have private contractors such as SpaceX actively in the field, there are now more interest groups that participate in space travel. And they can interact with other companies as well.
Also, due to Musks dream and efforts of SpaceX, space travel seems to get a lot cheaper.
That might indeed open the way back to the moon and further to the Mars for human space flight.
Governments such as the US planned on such things for decades, but changed plans ever since, and routinely changed leadership and the opinion on what's important.
Now Spaceflights can become less politically motivated and more commercially. That seems to be a more stable way over long periods of time.
(wrote most of it for you myself, even tough I'm not a native English speaker. would really appreciate the brainliest if you appreciate the work)
Answer:
yhgfty
Explanation:
cdfgv
two planar shock waves travel in the same direction. the first shock wave travels at 420 m/s and the second shock wave travels at 840 m/s. the second shock wave is 10 m behind the first. when the two shocks coalesce and become a single planar shock wave, what is the over-pressure and what is the velocity behind the newly formed shock? assume that the gas is air and it has standard atmospheric properties before it is disturbed by the shocks. do not make a linear assumption.
The Rankine-Hugoniot jump conditions, we get: \(γ * ρ2 * 420 m/s\)
To solve this problem, we can use the Rankine-Hugoniot jump conditions, which relate the properties of a fluid across a shock wave:
\(ρ1 * v1 = ρ2 * v2p1 + ρ1 * v1^2 = p2 + ρ2 * v2^2\)
where ρ is the density, v is the velocity, and p is the pressure.
Let's assume that the shock waves are traveling in the x-direction. We can define a coordinate system where the shock waves intersect at x=0, and the first shock wave is moving to the right, while the second shock wave is 10 m behind and also moving to the right.
Before the shocks intersect, the state of the gas is uniform and can be described by the properties of air at standard atmospheric conditions. We can assume that the gas is at rest, so v1 = v2 = 0.
Let's first find the properties of the gas behind the second shock wave. We can use the Rankine-Hugoniot jump conditions to relate the state behind the second shock wave (denoted by subscript "2") to the standard atmospheric state (denoted by subscript "0"):
\(ρ2 * v2 = ρ0 * v0p2 + ρ2 * v2^2 = p0 + ρ0 * v0^2\)
Since the second shock wave is traveling at 840 m/s, the velocity behind it is also 840 m/s:
v2 = 840 m/s
We can assume that the density behind the second shock wave is higher than the standard atmospheric density because the shock wave compresses the gas. Let's define the density behind the second shock wave as ρ2 = α * ρ0, where α is the density ratio. Similarly, let's define the pressure behind the second shock wave as p2 = β * p0, where β is the pressure ratio.
Substituting these expressions into the Rankine-Hugoniot jump conditions, we get:
\(α * ρ0 * 840 m/s = ρ0 * 0 m/sβ * p0 + α * ρ0 * (840 m/s)^2 = p0 + ρ0 * 0^2\)
Solving for α and β, we get:
α = 0
β = 2.25
This means that the density behind the second shock wave is zero, and the pressure is 2.25 times the standard atmospheric pressure.
Now let's find the properties of the gas behind the first shock wave. We can use the Rankine-Hugoniot jump conditions to relate the state behind the first shock wave (denoted by subscript "1") to the state behind the second shock wave (denoted by subscript "2"):
\(ρ1 * v1 = ρ2 * v2p1 + ρ1 * v1^2 = p2 + ρ2 * v2^2\)
Since the first shock wave is traveling at 420 m/s, the velocity behind it is also 420 m/s:
v1 = 420 m/s
We can assume that the density behind the first shock wave is higher than the density behind the second shock wave because the first shock wave compresses the gas further. Let's define the density behind the first shock wave as\(ρ1 = γ * ρ2,\) where γ is the density ratio. Similarly, let's define the pressure behind the first shock wave as p1 = δ * p2, where δ is the pressure ratio.
Substituting these expressions into the Rankine-Hugoniot jump conditions, we get:
γ * ρ2 * 420 m/s
To know more about Rankine-Hugoniot here
https://brainly.com/question/14355125
#SPJ4
A centrifuge is used to test space pilots. The centrifuge spins with a centripetal acceleration of 3.04g. If the length of the arm of the centrifuge is 21m what is the speed of the centrifuge?
Answer:
\(approx.= 25\frac{m}{s}\)
Explanation:
Centripetal acceleration (a) is defined as the square of an object's velocity (V^2) divided by the distance of the object from it's point/axis of revolution (r). So:
\(a=\frac{V^{2} }{r}\)
which allows us to solve for the velocity:
\(V=\sqrt{ar}\\ Since: a=3.04g=(3.04)(9.81),r=21;\\V=\sqrt{(3.04)(9.81)(21)} =25.02...\)
Answer:
25 m/s
Explanation:
A = v^2r
The square root of Ar = v
V = square root of 3.04 x 21 x 9.8 = 25m/s
Make sure to add 9.8 as acceleration is 3.04g or 3.04 x 9.8
what type of friction causes bearings to not waste much energy?
Rolling friction is the type of friction that causes bearings to not waste much energy. The design of the bearing and the materials used in its construction play a critical role in reducing friction and improving efficiency. Bearings that rely on rolling friction are the most efficient because they reduce resistance to motion, resulting in a smoother operation and less energy consumption.
The type of friction that causes bearings to not waste much energy is called rolling friction or rolling resistance. Rolling friction occurs when an object, such as a bearing, rolls over a surface without sliding. It is generally lower than sliding friction because it involves less contact area and deformation between the rolling object and the surface it is rolling on.
In bearings, rolling friction is minimized by using smooth and precisely shaped rolling elements, such as balls or rollers, which make contact with the inner and outer raceways. These rolling elements reduce the surface area of contact, resulting in lower friction compared to sliding friction.
Additionally, bearings are typically designed with lubrication systems to further reduce friction. The lubricant, such as oil or grease, forms a thin film between the rolling elements and raceways, reducing friction and dissipating heat generated during operation.
By minimizing rolling friction and optimizing the design and lubrication of bearings, the energy wasted in the form of heat due to friction is significantly reduced. This is important for various applications where efficiency and energy conservation are crucial, such as in machinery, vehicles, and industrial equipment.
Conclusion: Therefore, it can be concluded that rolling friction is the type of friction that causes bearings to not waste much energy. The design of the bearing and the materials used in its construction play a critical role in reducing friction and improving efficiency. Bearings that rely on rolling friction are the most efficient because they reduce resistance to motion, resulting in a smoother operation and less energy consumption.
To know more about friction visit
https://brainly.com/question/18611851
#SPJ11
Which one is greater 2.62 , 2 2/5 , 26.8 , 2.26 , 271%.
In order to compare the numbers, let's put all of them into the decimal form:
\(\begin{gathered} 2.62 \\ \\ 2\frac{2}{5}=2+\frac{2}{5}=\frac{10}{5}+\frac{2}{5}=\frac{12}{5}=2.4 \\ \\ 26.8 \\ \\ 2.26 \\ \\ 271\text{\%}=\frac{271}{100}=2.71 \end{gathered}\)We can see that the greater one is 26.8 (all other numbers are close to 2, and this one is close to 27).
The numbers in decrescent order are:
26.8, 271%, 2.62, 2 2/5, 2.26.
Answer:
26.8
Explanation:
2.26 < 2.4 < 2.62 < 271/100 = 2.71 < 26.8
How does the kinetic energy of the gas in the flas/tube change during this experiment?
Because of Kinetic Theory Postulate, the gas molecule's collision will affect.
Gases can be compressed because most of the volume of gas is an empty space according to Kinetic Molecular theory. If we compress a gas without changing its temperature, the average K.E of the gas particles remains the same. There is no change in the speed of the gas molecules with which the particles move in a container, but the container is smaller. So particles travel from one side of the container to the other in a very small period of time. So it means that they strike the walls mostly. Any increase in the frequency of collisions with the walls must increase the pressure of the gas. from Boyle's law, the pressure of gas becomes more significant as the volume of the gas becomes smaller have opposite relation.
You can get help from the following answer also
https://brainly.com/question/11067389
#SPJ4
if earth were a ping pong what size ball would jupiter be
Answer:
a large beach ball
Explanation:
One of the most efficient engines ever built is a coal-fired steam turbine engine in the ohio river valley, driving an electric generator as it operates between 1,870°c and 430°c.
a. What is its maximum theoretical efficiency?
b. Its actual efficiency is 42.0%. How much mechanical power does the engine deliver if it absorbs 1.60 ✕ 10^5 J of energy each second from the hot reservoir?
A. The maximum theoretical efficiency is 67.2 %.
B. The hot reservoir is 56.7 kW.
Solution:
A. Max. theoretical (Carnot) efficiency = 1-T(cold)/T(hot)
or 1 - (430+273)/(1870+273) = 0.672 = 67.2 %.
B. mechanical power delivered = 0.42*1.35*10^5 = 56700 J/s = 56700 W = 56.7 kW.
A Carnot engine operating between two given temperatures exhibits the highest possible efficiency among heat engines operating between these two temperatures. The Carnot engine has the highest efficiency among heat engines operating between two temperatures. Diesel is more flammable than gasoline.
Second, petrol doesn't burn completely, so very little fuel is wasted. Because of this, diesel engines are more efficient than gasoline engines. The Carnot cycle achieves maximum efficiency because all heat is transferred to the working fluid at the highest temperature.
Learn more about An electric generator here:- https://brainly.com/question/12475693
#SPJ4