Electron Identify the type of charge of the following particles in an
atom
Electron
Neutron
Proton

Answers

Answer 1

Answer:

Electron charge: -1

Neutron charge: 0

Proton charge: +1


Related Questions

what are the colors of a rainbow

Answers

The colors of a rainbow, in order, are: red, orange, yellow, green, blue, indigo, and violet
Red orange yellow green blue purple indigo

what is the correct meaning of the word catapult?

example :
mounting tension between england and the colonies helped catapult washingtons rank in the continental army.

a. hamper
b. improve
c. propel
d. define

Answers

Answer:

A. hamper

Explanation:

i did this question before.

Answer:

Improve

Explanation:

They improved Washington's rank so that he could rise to the top.

Which characteristic is used to classify metamorphic rocks as foliated or non-foliated?

Answers

arrangement of grains

Answer: d. Arrangement of grains

Explanation:

Edge:)))

A 5.0 L sample of gas contains 50% CO2 and equal parts of O2 and water vapor. If
the total pressure on the mixture of gases is 1.15 atm, what are the partial pressures
of each of the gases in the mixture? Whose/what law is this? SHOW YOUR WORK!!!

Answers

CO₂: 0.575 atm O₂: 0.575 atm Water Vapor: 0.575 atm This is an example of Dalton's Law of Partial Pressures. Dalton's Law states that the total pressure of a mixture of gases is equal to the sum of the partial pressures of each individual gas.

How to define the term partial pressure?

Partial pressure is a term used to describe the pressure exerted by a single gas or vapor in a gas mixture. It is defined as the pressure that the gas or vapor would have if it alone occupied the same volume as the mixture. It is usually expressed as a fraction of the total pressure of the mixture.

For example, if a mixture of oxygen and nitrogen gases is at a total pressure of 1 atmosphere, the partial pressure of oxygen in the mixture would be 0.21 atmospheres (21 percent of 1 atmosphere).

What is an ideal gas mixture?

An ideal gas mixture is a combination of gases with known mixtures of particular components, such as oxygen and nitrogen, that exist in a ratio that behaves in a way that can be predicted using the Ideal Gas Law. This law states that the ratio of the different gas particles is constant, regardless of the amount of pressure and temperature they experience. In practice, however, ideal gas mixtures are not truly ideal due to small discrepancies in the composition of the mixture, which can cause the behavior of the mixture to be slightly different than predicted.

To know more about Ideal Gas Law, visit:

https://brainly.com/question/30458409

#SPJ1

Calculate the molarity of a solution prepared by diluting 60.02 mL of a 0.574 M potassium chloride solution to 150.00 mL.

Answers

The molarity of the solution prepared by diluting 60.02 mL of a 0.574 M potassium chloride solution to 150.00 mL is 0.229 M.

The initial molarity of the potassium chloride, M₁ = 0.574 M

The initial volume potassium chloride , V₁ = 60.02 mL

The final molarity potassium chloride, M₂ = ?

The final volume potassium chloride, V₂ = 150 mL

The expression is as follows :

M₁  V₁  = M₂ V₂

M₂ = M₁  V₁  / V₂

M₂ = ( 0.574 × 60.02 ) / 150

M₂ = 0.229 M

The molarity of the solution is 0.229 M with the volume of the 150 mL.

To learn more about molarity here

https://brainly.com/question/28285409

#SPJ4

Question 2 of 10
Which chemical equation is balanced?
A. CO₂ + H₂O → H₂CO₂
B. K+ H₂O → K₂O + H₂
C. CaO2 + HCl → CaCl₂ + H₂O
OD. MgO + 2HCl → MgCl₂ + H₂O

Answers

The equation MgO + 2HCl → MgCl₂ + H₂O is  a balanced equation.

A balanced chemical equation contains equal number of atoms on both sides of the equation.The equation is MgO + 2HCl → MgCl₂ + H₂O  which contains 1 atom of Mg, 2 atoms of chlorine, 2 atoms of chlorine, 1 atom of oxygen on both reactants and products sides.So the equation is balanced.An equation for a chemical reaction is said to be balanced if both the reactants and the products have the same number of atoms and total charge for each component of the reaction. In other words, both sides of the reaction have equal amounts of mass and charge.It follows law of conservation of mass.Mass is neither created nor destroyed rather it can be transferred from one form to another.

Learn more about balanced equation at:

brainly.com/question/2829417

#SPJ9

Assume that 8.5 L of iodine gas (I2) are produced at STP according to the following balanced equation:
2KI (aq) + Cl2 (g) --> 2KCl (aq) + I2 (g)

a. How many moles of I2 are produced? ________ moles I2 (3 sig figs)

b. How many moles of KI were used? _________ moles KI (3 sig figs)

c. How many grams of KI were used? _________ grams KI (3 sig figs)

50 points

Answers

The molar volume of any gas behaving ideally at STP occupies a volume of 22.414 L. The number of moles of I₂ produced is  0.379  , number of moles of KI used is 0.758 , the grams of KI used is 126 g.

What is mole?

One mole of a substance is defined as that quantity of it which contains as many entities as there are atoms exactly in 12 g of carbon - 12. The formula used to calculate the number of moles is:

Number of moles (n) = Given mass / Molar mass

Here at STP V = 8.5 L, P = 1 atm, T = 273 K. Then the value of 'n' is calculated from the ideal gas equation :

PV = nRT

1 × 8.5  = n × 0.0821 × 273

n = 8.5 / 0.0821 × 273

n = 0.379 mole

So number of moles of I₂ produced is 0.379 mole.

In the given equation, 2KI (aq) + Cl₂ (g) --> 2KCl (aq) + I₂ (g)

2 mole of Kl reacts with 1 mole of  Cl₂ to give 2 mole of KCl and 1 mole of   I₂ .

The number of moles of KI used = 0.379 × 2 = 0.758 mole

The mass of KI used = n / Molar mass of KI = 0.758 × 166.0 = 125.82 g ≈ 126 g

Thus,

a. 0.379 moles I₂

b. 0.758 moles KI

c. 126 g KI

To know more about moles, visit;

https://brainly.com/question/19730733

#SPJ1

what would the result be of adding one proton to an atom​

Answers

Answer:Protons carry a positive electrical charge and they alone determine the charge of the nucleus. Adding or removing protons from the nucleus changes the charge of the nucleus and changes that atom's atomic number. For example, adding a proton to the nucleus of an atom of hydrogen creates an atom of helium and thats your answer

Explanation:

yurrrrrrr

List the 2 pKa's for H2SO4

Answers

No pKa1 because it is strong acid, pKa2 = 1.99

Which of the following compounds would form an acid when dissolved in water as an aqueous solution?

NaCl
NO2
H2SO3
HCl

Answers

Answer:

Explanation:

An acid is a substance that can donate protons (H+) to water when dissolved in it, resulting in an increase in the concentration of H+ ions in the solution.

When NaCl (sodium chloride) is dissolved in water, it dissociates into its individual ions, Na+ and Cl-. These ions do not donate protons to water, so NaCl does not form an acid when dissolved in water.

NO2 (nitrogen dioxide) is a neutral compound, it does not donate protons to water and does not form an acid when dissolved in water.

H2SO3 (sulfurous acid) is an acid, when dissolved in water, it donates protons to water and forms H+ ions and SO3- ions.

HCl (hydrochloric acid) is an acid, when dissolved in water it donates protons to water and forms H+ ions and Cl- ions.

So the answer is H2SO3 and HCl are the compounds that would form an acid when dissolved in water as an aqueous solution.

The volume of a sample of oxygen is 200.0 mL when the pressure is 3.000 atm and the temperature is 37.0 C. What is the new temperature if the volume increases to 400.0 mL and the pressure decreases to 2.000 atm?

Answers

Answer:

140.3 *C

Explanation:

(P1 * V1) / T1 = (P2 * V2) / T2

where P1 = 3.000 atm, V1 = 200.0 ml, T1 = 37.0°C + 273.15 = 310.15 K, P2 = 2.000 atm, V2 = 400.0 ml.

Substituting these values into the formula gives:

(3.000 atm * 200.0 ml) / 310.15 K = (2.000 atm * 400.0 ml) / T2

Solving for T2 gives:

T2 = (2.000 atm * 400.0 ml * 310.15 K) / (3.000 atm * 200.0 ml)

T2 ≈ 413 K or 140°C.

In a science demonstration, a teacher mixed zinc (Zn) with hydrogen chloride (HCl) in a flask and quickly attached a balloon over the mouth of the flask. Bubbles formed in the solution and the balloon inflated.
What most likely occurred during this demonstration?

a.The Zn and HCl both retained their identity.
b.Either Zn or HCl, but not both, retained its identity.
c.Evaporation of one of the substances occurred.
d.One or more new substances formed.

Answers

Answer:

a. The Zn and HCl both retained their identity.

you are given a 1.50 g mixture of sodium nitrate and sodium chloride. you dissolve this mixture into 100ml of water and then add excess of 0.500M silver nitrate solution. you produce a white solid, which you then collect, dry and measure. of u had am extremely magnified view of the solution ( to the atomic molecular level) list the species you would see(include changes, if any). write tje balanced net ionic equation for the reaction that produces the solid. include phases and charge. calculate the percent sodium chloride in the original unknown mixture.

Answers

When the 0.500 M silver nitrate solution is added to the 1.50 g mixture of sodium nitrate and sodium chloride in water, a reaction occurs.

What is the balanced ionic equation and percent sodium chloride in the mixture?

When the 0.500 M silver nitrate solution is added to the mixture of sodium nitrate and sodium chloride, the following reaction takes place:

NaNO₃(aq) + AgNO₃(aq) → AgNO₃(s) + NaNO₃(aq)

NaCl(aq) + AgNO₃(aq) → AgCl(s) + NaNO₃(aq)

The solid produced is silver chloride (AgCl), which is a white precipitate.

At the atomic/molecular level, the following species would be seen:

   Sodium ions (Na⁺) and nitrate ions (NO₃⁻) from sodium nitrate (NaNO₃)    Sodium ions (Na⁺) and chloride ions (Cl⁻) from sodium chloride (NaCl)    Silver ions (Ag⁺) and nitrate ions (NO₃⁻) from silver nitrate (AgNO₃)    Solid silver chloride (AgCl)

To calculate the percent sodium chloride in the original unknown mixture, we need to know how much of the white solid we collected. Let's assume we collected 2.00 g of silver chloride.

We need to compute the number of moles of silver chloride produced:

2.00 g AgCl x (1 mol AgCl/143.32 g AgCl) = 0.01395 mol AgCl

Since silver nitrate is in excess, all the chloride ions in the original mixture will react with silver ions to form silver chloride. The number of moles of chloride ions in the original mixture is therefore equal to the number of moles of silver chloride produced:

0.01395 mol Cl- = 0.01395 mol NaCl

To calculate the percent sodium chloride in the original mixture, we need to know the total mass of the mixture:

1.50 g NaNO₃ + NaCl = 1.50 g

The percent sodium chloride is:

(0.01395 mol NaCl x 58.44 g/mol NaCl) / 1.50 g x 100% = 54.4% NaCl

Therefore, the original mixture was 54.4% sodium chloride and 45.6% sodium nitrate.

To know more about balanced chemical equations, visit:

https://brainly.com/question/12192253

#SPJ1

There are 3 parts to the Cell Theory. Which part is NOT part of the Cell
Theory??*
2 poin
All cells come from other cells.
Cells are the basic unit of life.
All organisms are made up of one or more cells.
O All cells are from plants.

There are 3 parts to the Cell Theory. Which part is NOT part of the CellTheory??*2 poinAll cells come

Answers

D. All cells are from plants
is not part of the cell theory.

Scientists digging in a cave found an unknown substance. The scientists found that the substance’s molecules were moving around each other. The scientists increased the speed of the substance’s molecules and caused a phase change. How did the scientists do this, and how did this affect the substance?

The scientists transferred energy . . .

Answers

Answer:

By adding heat energy It became a gas Explanation:The molecules moving about another is a clear indicator that the substance is a liquid. In a liquid, the molecules stick together and move about one another. When the scientist increase the speed of the of substance, the kinetic energy increases. if this increase causes a phase change, then the substance becomes a gas. So, by adding heat energy a substance becomes gaseous if it is a liquid already.

Explanation:

What is the atomic number?
pls help.

What is the atomic number?pls help.

Answers

Answer:

8

Explanation:

Which of the steps in prokaryotic binary fission is correct?
Question 11 options:

a) All of these choices are correct.
b) The two replicated chromosomes remain attached to the plasma membrane.
c) The cell continues to grow outward symmetrically, separating the two chromosomes.
d) Cell wall material is laid down at the midpoint to separate the two daughter cells.
e) DNA is replicated bidirectionally from a single point on the circular chromosome.

Answers

From a single location on the circular chromosome, DNA is copied in both directions.

The correct option is E.

What is of binary fission?

Binary fission is the process of asexual reproduction in which one organism is divided into two separate ones. An organism's genetic material, or deoxyribonucleic acid (DNA), doubles when it splits into two halves (cytokinesis) through binary fission, with each new species inheriting one copy of the latter.

What cells use binary fission?

Bacterial binary fission is the method by which bacteria split their cells. Find out how binary fission functions, including how to make a new cell wall and a copy of a bacterial chromosome. Mitosis and binary fission, two types of asexual reproduction, both entail the division of a parent cell into two identical daughter cells.

To know more about Binary fission visit:

https://brainly.com/question/7639952

#SPJ1

61. Given the following information:

Ag2 CrO4(s)=2Agt (aq) + CrO4²- (aq)
Ag+ (aq) + e- Ag(s)
find the standard reduction potential at 25°C for the half-reaction
Ksp = 1 × 10-12
E = +0.799 V
Ag2 CrO4(s) + 2e¯ 2Ag(s) + CrO4²- (aq)​

Answers

Q = Ksp = 1 × 10^(-12).

Substituting the values into the Nernst equation, we have:

0.799 V = E° - (RT/2F) * ln(1 × 10^(-12))

Now, solving for E°:

E° = 0.799 V + (RT/2F) * ln(1 × 10^(-12))

The value of R is the ideal gas constant, T is the temperature in Kelvin, and F is the Faraday constant.

To find the standard reduction potential at 25°C for the half-reaction Ag2CrO4(s) + 2e¯ → 2Ag(s) + CrO4²-(aq), we can use the Nernst equation, which relates the standard reduction potential (E°) to the equilibrium constant (K) and the reaction quotient (Q).

The Nernst equation is given as follows:

E = E° - (RT/nF) * ln(Q)

Given information:

Ksp = 1 × 10^(-12)

E = +0.799 V (standard reduction potential of Ag+ to Ag)

Since the reaction involves the dissolution of Ag2CrO4(s), the reaction quotient Q can be expressed as [Ag+]²/[CrO4²-].

Since the stoichiometry of the reaction is 2:1 for Ag2CrO4 to Ag+, we can say that [Ag+]² = Ksp.

Therefore, Q = Ksp = 1 × 10^(-12).

Substituting the values into the Nernst equation, we have:

0.799 V = E° - (RT/2F) * ln(1 × 10^(-12))

Now, solving for E°:

E° = 0.799 V + (RT/2F) * ln(1 × 10^(-12))

The value of R is the ideal gas constant, T is the temperature in Kelvin, and F is the Faraday constant.

Please note that without specific values for temperature (T) and the ideal gas constant (R), the exact standard reduction potential at 25°C cannot be determined.

For more question on temperature

https://brainly.com/question/4735135

#SPJ8

2. (Exercise 4.1.6) A liquid adhesive consists of a polymer dissolved in a solvent. The amount of polymer in the solution is important to the application. An adhesive dealer receives an order for 3000 lb of an adhesive solution containing 13% polymer by weight. On hand are 500 lb of 10% solution and very large quantities of 20% solution and pure solvent. Calculate the weight of each that must be blended together to fill this order. Use all of the 10% solution.

Answers

Answer:

800 lb of pure solvent , 1700 lb of 20% solution and 500 lb of 10% solution will be mixed to form 3000 lb of 13 % solution .

Explanation:

3000 lb of 13% solution is required .

Total adhesive in weight = 3000 x .13 = 390 lb of adhesive

Available = 500 lb of 10% solution = 50 lb of adhesive

Rest = 390 - 50 = 340 lb required .

rest mass of solution = 3000 - 500 = 2500 lb

mass of adhesive required = 340 lb

Let the mass  of 20% required be V

mass of adhesive = .20 V

.20 V = 340

V = 1700

rest of the volume = 2500 - 1700 = 800 lb which will be of pure solvent

So 800 lb of pure solvent , 1700 lb of 20% solution and 500 lb of 10% solution will be mixed to form 3000 lb of 13 % solution .

To form 3000 lb of 13 % solution we need 800 lb of pure solvent, 1700 lb of 20% solution, and 500 lb of 10% solution.

Required wieghts of each solution:

The required solution is 3000 lb of 13% solution

Total adhesive = 3000 x 0.13 = 390 lb

Available adhesive = 500 lb of 10% solution = 50 lb

The required adhesive  = 390 - 50 = 340 lb

The rest mass of solution is = 3000 - 500 = 2500 lb

If we assume the weight of 20% solution required to be W, then:

mass of adhesive = 0.20 W

0.20 W = 340

W = 1700 lb of 20% solution

Remaining volume = 2500 - 1700 = 800 lb

So, the pure solvent has a weight of 800 lb.

Learn more about solutions:

https://brainly.com/question/7932885?referrer=searchResults

What are 5 things that change so slow they are almost unnoticeable

Answers

people, plants, sizes, and i don’t know what else

Answer:

people ,shape ,behavior, grades ,friends

What are the answers to the following 5 multiple choice questions

What are the answers to the following 5 multiple choice questions

Answers

The balanced equation of the reaction is option d. The  limiting reactant here is KBr and excess reactant is calcium nitrate. The percent yield of the reaction is 93 %.

What is limiting reactant ?

The limiting reactant in a reaction is the reactant which is fewer in amount and as soon it is consumed, the reaction stops. For the given reaction, option d is the balanced chemical equation.

One mole of calcium nitrate requires 2 moles of KBr.

molar mass of calcium nitrate = 164 g/mol

no.of moles in 75 g = 75/164 = 0.457

molar mass of KBr = 118.9 g/mol

no.of moles 95 g = 95/118.9 = 0.798

0.457 moles of calcium nitrate needs its twice amount that is 0.9 moles of KBr. Hence, KBr is the limiting reactant and calcium nitrate is excess reactant here.

2 moles or 237.8 g of KBr gives 2 moles or 202 g of potassium nitrate. Then, 95 g of KBr will gives:

(95×202)/237.6 = 81.3 g

actual yield = 75.75 g

then percent yield  = 75.75 /81.3 × 100 = 93 %.

0.79 moles of KBr needs its half or 0.399 moles of calcium nitrate. But we have 0.45 moles. Thus, excess amount is

(0.45 - 0.399) × 164 g/mol = 9.5 g.

Therefore, the 9.5 g of excess reactant will be left over.

Find more on limiting reactants:

https://brainly.com/question/28938721

#SPJ1

3)
Acid and Base Characteristics
Substance A
Substance
Substance D
Sour taste
Neutral taste
Substance B
Bitter taste
Strongly conducts
electricity
Strongly conducts electricity,
Sharp taste
Strongly conducts
electricity
Reacts with most metals to generate
hydrogen gas.
Weakly conducts
electricity
Can react with acids or
bases
Can react to make soap.
Generally will not react,
Predict which substance would not act as an acid or a base according to Bronsted-Lowry s definition
-)
alc
NH
A)
А
hing
Cale
8
B

3)Acid and Base CharacteristicsSubstance ASubstanceSubstance DSour tasteNeutral tasteSubstance BBitter

Answers

Answer:C

Explanation:

Answer:

Substance D

Explanation:

USA Test Prep Corrections

What is the Internal Energy of a Human Body? Define internal energy as Delta E.
SHOW ALL WORK!
20 points

Answers

The internal energy of a human body is the net energy contained in the body due motion of its particle or molecules.

In a human body the internal energy is stored . It increases when the temperature of the body rises, or when the body observes some changes. Internal energy we can say that is the sum of kinetic and potential energy of all particles in the body.

Internal energy is a state function of a system and is an extensive quantity. Every substance possesses a fixed quantity of energy which depends upon  its chemical nature and also on its state of existence. Every substance have a definite value of Internal energy.

The change in the Internal energy of a reaction may be considered as the difference between the internal energies of the two states.

ΔU = \(E_{B}\) - \(E_{A}\)     where \(E_{B}\) and \(E_{A}\) are the initial energies of states A and B. Or we can also write the equation as:

ΔU = ΔE

To know more about Internal energy

https://brainly.com/question/13125947

#SPJ1

write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal​

Answers

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

Convert 675000 to scientific notation

Answers

Answer:

To convert 675000 to scientific notation, we need to express it in the form a × 10^n, where a is a number between 1 and 10 (but not 10 itself), and n is an integer.

Starting with 675000, we can divide by 10 repeatedly until we get a number between 1 and 10.

675000 ÷ 10 = 67500 (one division by 10)

67500 ÷ 10 = 6750 (two divisions by 10)

6750 ÷ 10 = 675 (three divisions by 10)

Now we have a number between 1 and 10 (namely, 6.75), and we know that we divided by 10 three times, so the exponent is -3.

Therefore, we can express 675000 in scientific notation as:

6.75 × 10^5

(Note that we could also express it as 6.75 × 10^2 × 10^3, but this is not in standard scientific notation, which requires the coefficient to be between 1 and 10.)

3
Which chemical equation below is balanced to correctly represent the Law of
Conservation of Mass?
04 Al + 3O2 + 2 Al2O3
O2 AL + O2 + 2 Al2O3
O AL + O2 + Al2O3

Answers

Answer:

4Al + 3O₂ →   2Al₂O₃

Explanation:

    4Al + 3O₂ →   2Al₂O₃

Only this reaction above obeys the law of conservation of mass. The others flout the rule.

The law of conservation of mass states that "matter is neither created nor destroyed in a chemical reaction but are simply transformed from one form to another".

By this law, the number of atoms on both sides of expression must be the same;

                                                    Number of atoms

Elements              Left hand side                                 Right hand side

  Al                                    4                                                     4

  O                                    6                                                    6

What is the shorthand or noble gas electron configuration for vanadium, V?
1s² 2s² 2p 3s² 3p6 4s² 3d³

A.) [Ar] 4s5
B.) [Kr] 4s2 3d3
C.) [Ar] 4s2 3d3
D.) [Kr] 3d5​

Answers

The electron configuration of vanadium can be obtained by adding the remaining electrons to the configuration of argon, which gives [Ar] 4s2 3d3.

What is Electric Configuration?

lectronic configuration is the arrangement of electrons in the shells and sub-shells of an atom or molecule. It is represented by a series of numbers and letters that indicate the number of electrons in each energy level and orbital. The electronic configuration of an atom determines its chemical properties and reactivity, as well as its physical properties such as its atomic radius and ionization energy. The electronic configuration is determined by the number of protons in the atom's nucleus, which determines its atomic number and thus the number of electrons that can be accommodated in each shell and sub-shell.

The correct answer is C.) [Ar] 4s2 3d3. The shorthand or noble gas electron configuration for vanadium (V) is written by indicating the electron configuration of the noble gas that comes before it in the periodic table, which is argon (Ar) in this case. The electron configuration of argon is [Ne] 3s2 3p6.

Learn more about Electric Configuration from the given link

https://brainly.com/question/26084288

#SPJ1

Which one of the following substances should exhibit hydrogen bonding in the liquid state?

Answers

Answer:

What are the following substances?

Explanation:

Answer:

since,hydrogen bonding requires a strongly electronegative atom bonded to a hydrogen atom,only HF willexhibit hydrogen bonding,as afluorine is sufficiently partially positive hydrogen that can form bondwith a lone pair an oxygen in water .

Hope this help u

Fires are classified into various classes and as such different types of portable fire extinguishers must be used. The theory behind portable fire extinguishers is that the fire can be extinguished by removing any or more of the following four elements:
Fuel, Heat, Oxygen, Chain Reaction.
Identify the extinguishing mechanism and the classe(s) of fires they are used to extinguish for the following types of fire extinguishers:
ABC Powder, Carbon dioxide, Foam, Water.​

Answers

Answer:

Explanation:

ABC Powder: sprays a very fine chemical powder. This acts to blanket the fire and suffocate it. Class A, B, C fires

Carbon dioxide: extinguishes CO2. By doing so, it removes oxygen from the fire, effectively suffocating it of oxygen. Class B fires

Foam: spray a type of foam that expands when it hits the air and blankets the fire. This prevents the vapors from rising off the liquid to feed the fire, thus starving it of fuel. Class A and B

Water: releases microscopic water molecules that fight the fire on a variety of levels. the level of oxygen in the air is decreased, which helps to suffocate the fire. Class: most all

also, your fire classes:

Class A: freely burning, combustible solid materials such as wood or paper

Class B: flammable liquid or gas

Class C: energized electrical fire (energized electrical source serves as the ignitor of a class A or B fire – if electrical source is removed, it is no longer a class C fire)

Class D: metallic fire (titanium, zirconium, magnesium, sodium)

Class K: cooking fires – animal or vegetable oils or fats

Brainiest and 10 Points
Which has a HIGHER frequency?
A. Visible
B. Ultraviolet

Answers

Answer:

B. Ultraviolet

Explanation:

UV has a higher frequency and shorter wavelength than visible light

Other Questions
Divide(3x +7x-20x-30x+25) (x+x6) Which printing technique involves direct contact between the paper and an etched copper plate? [______] printing involves direct contact between the paper and an etched copper plate. a study of married couples showed that the lo nger they had been married, the more similar their opinions on social and political issues were The equation y = 1.75z +9 gives your total cost of a pizza with x topppings. depends on How do you translate to the left? General Corporation is taxable in a number of states. This year, General made a $100,000 sale from its A headquarters to the State B office of the FBI. In which state(s) will the sale be included in the sales factor numerator what did classical physics predict would happen to the light given of by an object as its tempurtare increased If Miller had increased the concentration of NH in his experiment, how might the relative amounts of the products HCN and CHO have differed? Ball a with diameter d and ball b with diameter 2d are dropped from the same height. When the two balls have the same speed, what is the ratio of the drag force on ball a to the drag force on ball b?. Each of the following solutions were developed to lessen an asymmetric information problem. Sort each solution into the problem it aimed to address. a. a health screening to determine acceptance into a health insurance plan.b. a telematic device in a prospective car insurance customer's vehicle that tracks driving behavior.c. a video monitoring system in your home while your babysitter is there.d. a company requirement that the chief executive officer hold at least five times their annual salary in company stock.1. Adverse selection 2. Principal-agent which TWO of the following quotes best support the answer the part A puritan laws and character plss help me best answere get braaniliest Hakim has 4 pieces of square-shaped paper.The length of each piece of paper is 10 cm.He arranged them to form a bigger square.What is its area?Discuss with your classmate how you got your answerAre your methods the same? If x1 and x2 are solutions to 3x^2+15x+9=0 quadratic equation, then 1. x1+x2=2.x1x2= I require assistance please Please can someone help me write a poem about flower, Love ? Thank you How do you find the vapor pressure of water? Evaluate the limit. If the limit does not exist, enter DNE. Lim t-7 t - 49/ 2t^2 +21t + 49 Answer= Which change absorbs heat? toasting a bagel, letting soop cool, running a car engine, exploding a firecracker Who published linguistic findings that showed american sign language is a true and natural language?.