Find the Difference: 0.325-0.01

Answers

Answer 1

Answer:

= 0.315

Step-by-step explanation:

hope this helps :)


Related Questions

SOMEONE HELPP!! giving brainlist to anyone who answers

SOMEONE HELPP!! giving brainlist to anyone who answers

Answers

Answer:

Rahul:

\(53000( {1.02875}^{7} ) = 64631.59\)

Layla:

\(53000 {e}^{.0225 \times 7} = 62040.78\)

$64,631.59 - $62,040.78 = $2,590.81

After 7 years, Rahul's account will have $2,591 more than Layla's account.

a) After allowing 15% discount on the marked price of a camera, 13% VAT was levied and sold it. If the selling price of the camera with VAT is Rs 4,420 more than its price after discount, find the marked price of the camera. [Hint:S.P with VAT-S.P=RS 4,420] ​

Answers

Answer:

Step-by-step explanation:

Pls check

a) After allowing 15% discount on the marked price of a camera, 13% VAT was levied and sold it. If the

1: Here is an inequality: -2x>10.

List some values for x that would make this inequality true.



2: How are the solutions to the inequality -2x10 different from the solutions to -2x>10? Explain your reasoning.

Answers

Answer: The solution for the inequality -2x > 10 is the opposite of this solution, because we flipped the direction of the inequality when we divided by -2.

Step-by-step explanation:

To solve the inequality -2x > 10, we need to isolate x on one side of the inequality by dividing both sides by -2, while flipping the direction of the inequality:

-2x > 10

x < -5

So, any value of x less than -5 would make this inequality true. For example, x = -6, x = -7, x = -10, etc.

The solutions to the inequality -2x > 10 are different from the solutions to -2x < -10 because the direction of the inequality is reversed when we multiply or divide both sides by a negative number.

For example, if we multiply both sides of -2x > 10 by -1, we get:

2x < -10

Dividing both sides by 2, we get:

x < -5

This is the same solution as for the inequality -2x < -10. However, the solution for the inequality -2x > 10 is the opposite of this solution, because we flipped the direction of the inequality when we divided by -2.

To know more about flipping refer here

https://brainly.com/question/10749993#

#SPJ11

Kenjis dog has 3-12's of treats in the box of dog treats on monday. Hisdog ate 2-12's of treats on tuesday. What fraction more of the box of the treats did his dog eat on monday than tuesday

Answers

Answer: 1/12 of the box

Step-by-step explanation:

On Monday the dog ate 3/12 of the treats in the box and on Tuesday ate 2/12 of the treats in the box.

The answer to this question is the difference between both these fractions:

= 3/12 - 2/12

= 1/12 of the box

Identify the reciprocal of ⁴/₉

Answers

Answer: 9/4

Step-by-step explanation:

Reciprocal is when the numerator and denominator flips their position

So here, reciprocal of 4/9 = 9/4

Evaluate cos 150° without using a calculator.Ο Α.√32B. 2O C. -1/2OD. -32

Evaluate cos 150 without using a calculator. .32B. 2O C. -1/2OD. -32

Answers

Answer:

Explanation:

Note that:

\(\begin{gathered} cos(A+B)=cosAcosB-sinAsinB \\ cos(150^0)=cos(90+60) \end{gathered}\)

Applying the addition formula given above to cos 150:

\(\begin{gathered} cos(150)=cos(90)cos(60)-sin(90)sin(60) \\ \\ cos(150)=0(\frac{1}{2})-1(\frac{\sqrt{3}}{2}) \\ \\ cos(150)=0-\frac{\sqrt{3}}{2} \\ \\ cos \end{gathered}\)

Sylvia invested $500 in an account compounded annually with an interest rate of 8%. manuel invested $600 in an account with a compound interest rate of 7.25%. using the rule of 72, startfraction 72 over t endfraction, who will double their money first?
a. sylvia will double her money first, in approximately 9 years.
b. manuel will double his money first, in approximately 10 years.
c. manuel will double his money first, in approximately 9 years.
d. sylvia will double her money first, in approximately 10 years.

Answers

Using the rule of 72, startfraction 72 over t endfraction, Manuel will double his money first, in approximately 9 years. Option C is the answer.

The rule of 72

The rule of 72 is a quick and simple way to estimate the number of years it takes for an investment to double given the

interest rate. It is calculated by dividing 72 by the interest rate.

For example, if an investment has an interest rate of 8%, it will take approximately 72 / 8 = 9 years to double the investment.

Applying this rule, we can estimate the time it will take for Sylvia's investment to double: 72 / 8 = 9 years.

And for Manuel's investment to double: 72 / 7.25 = 10 years.

Since Manuel's investment will double in approximately 9 years, he will double his money first.

Learn more about rule of 72 here https://brainly.com/question/26573154

#SPJ1

If the sales tax in your city is 12% and your item cost $97, how much tax would you pay on that item?

Answers

Answer:

Step-by-step explanation:

11.64

Which angles in standard position have their terminal side in quadrant II?

Select all that apply.

Which angles in standard position have their terminal side in quadrant II?Select all that apply.

Answers

Angles in standard position with their terminal side in quadrant II have measures between 90 and 180 degrees.

Therefore, the angles that have their terminal side in quadrant II are

120 degrees

135 degrees

150 degrees

165 degrees

So, all of the above angles apply.

To know more about quadrant here

https://brainly.com/question/13739829

#SPJ1

The U.S. Senate consists of 100 senators, with 2 from each of the 50 states. There are 50 Democrats in the Senate. A committee of size 10 is formed, by picking a random set of senators such that all sets of size 10 are equally likely. a) Find the expected number of Democrats on the committee. b) Find the expected number of states represented on the committee (by at least one senator) c) Find the expected number of states such that both of the state's senators are on the committee.

Answers

Note that based on probabilities,

The expected number of Democrats on the committee is 5.

The expected number of states represented on the committee is 26.

The expected number of states such that both of the state's senators are on the committee is 9.09.

 How is this so ?

a)  The probability that a randomly chosen senator is a Democrat is 50/100 = 1/2.

So, the expected number of Democrats on a committee of size 10 is

1/2 * 10 = 5.

b) The minimum number of   states that can be represented on a committee of size 10 is 2, and the maximum numberis 50.

The expected number of states representedon the committee is the average of these two values, which is (2 + 50)/  2 = 26.

c)  There are 50 states, and each state has 2 senators. So, there are a total of 100 pairs of senators.

The probability that a randomly chosen pair of senators both belong to the same state is 50/100 * 49/99

= 1/11.

The expected number of states such that both of the state's senators are on the committee is 100 * 1/11 = 9.09.

Learn more about probability  at:

https://brainly.com/question/30390037

#SPJ4

Abigail and Liza work as carpenters for different companies. Abigail earns $20

per hour at her company and Liza earns $25 per hour at her company. Last

week, Abigail and Liza worked for a total of 30 hours and together earned atotal of $690. How many hours did Liza work last week?

Answer as detailed as possible. Thanks :)

Answers

Answer:

L = 18 = hours worked by Lisa

a = 12 = hours worked by Abigail

Step-by-step explanation:

Given the following :

Abigail's earning = $20

Lisa's earning = $25

Last week :

Let number of hours worked by Abigail = a

Number of hours worked by Lisa = L

Total earning = $690

Total hours worked :

a + L = 30 - - - - (1)

To obtain their total earning:

(Lisa's earning per hour * hours worked) + (Abigail's earning per hour * hours worked)). $690

($25 * L) + ($20 * a) = $690

25L + 20a = 690 - - - - (2)

a + L = 30 - - - - (1)

25L + 20a = 690 - - - - (2)

L = 30 - a

25(30 - a) + 20a = 690

750 - 25a + 20a = 690

-5a = 690 - 750

-5a = - 60

a = 12

From (1)

a + L = 30 - - - - (1)

12 + L = 30

L = 30 - 12

L = 18

L = 18 = hours worked by Lisa

a = 12 = hours worked by Abigail

I’ll give brainliest! Please explain in your words why you think 180 degrees and n-2 are in the Polygon Angle- Sum Formula, 180 degrees (n-2) ?!

Answers

Answer:

If you look back at the formula, you'll see that n – 2 gives the number of triangles in the polygon, and that number is multiplied by 180, the sum of the measures of all the interior angles in a triangle. Do you see where the "n – 2" comes from? It gives us the number of triangles in the polygon.

Have a nice day   :)

Harry used 0.75 liters of gasoline on the first day of his trip, 1.5
liters on the second, 2.25 liters on the third, and 3 liters on the
fourth. Write a function to describe the sequence, and then use
the function to predict the amount of gasoline used on the
eighth day of his trip.
Oy=0.5n; 4 L
O y = 0.75n; 6 L
Oy=n; 8L
Oy=1.5m; 12 L

Answers

The function is to describe the sequence and the amount of gasoline used on the eighth day of his trip will be y = 0.75n and 6 L respectively. Option B is correct.

What is an arithmetic sequence's sum of terms?

Each consecutive term in an arithmetic sequence has a common constant difference.

The sequence of the  liters of gasoline on each day is;

0.75,1.5,2.25,3

The given series is an arithmetic series with a common difference of 0.75

Common difference,d=0.75

First-term,a=0.75

The amount of gasoline used on the eighth day of his trip.

The nth term of the arithmetic sequence is;

\(\rm a_n = a+(n-1)d \\\\ \rm a_8 = 0.75+(8-1)0.75 \\\\ a_8 = 6\)

The 8th term of the arithmetic sequence is 6L.

The function is to describe the sequence and the amount of gasoline used on the eighth day of his trip will be y = 0.75n and  6 L.

Hence, option B is correct.

To learn more about the arithmetic sequence refer;

https://brainly.com/question/15412619

#SPJ1

Credit Card Statement Calculate the newPrevious Balance $120.00 balance on thisFinance Charge $15.00 account after theseNew Purchases $200.00 charges andPayments $(300.00) payments areCredits$0.00applied.A. $35.00B. $635.00C. $235.00D. $395.00

Answers

Previous Balance: $120

Finance Charge: $15

New Purchases: $200

Payments: $300

Recall this is a Credit Card Statement.

To find the new balance we must subtract the payments and add the charges:

New Balance = $120 - $300 + $15 + $200

New Balance = $35

Answer: A. $35.00

Can you answer this math homework? Please!

Can you answer this math homework? Please!

Answers

Answer:

1. (2.2, -1.35) and (2.2, -1.4)

2. y = 8x - 7

3. infinite number of solutions

4. (2.2,-1.4) (2.2,-1.35)

5. 6

6. (1.33,1)

Step-by-step explanation:

Use the function below (whose parameters qualify it as a STC function) to answer the questions.

"STC "=" 6 "+"9 Q - 3" "Q" ^2 +" (1/3)" "Q" ^3

a) Total fixed cost is $_________

b) Obtain the AFC function from (a) and write it here __________________

c) Obtain the AVC function contained in the STC function and write the AVC function here _________________________

d) Write here the MC function __________________________

e) Find the value which AFC approaches as Q gets very large. Also write a sentence or two explaining what this implies for fixed costs per unit (AFC) as production quantities get ever larger.

f) Find the value of Q at which AVC is a minimum.

g) Is productive efficiency at the value in (f) greatest or least?

h) Demonstrate that the value of SMC equals the value of AVC at the value of Q where AVC is a minimum. Hint: The level of Q you found in (f) is where AVC is a minimum. If you plug this level of Q into AVC (see c) and also into MC (see d) the two outcomes should be the same if SMC crosses AVC at this level of Q.

i) Why does the derivative of Short Run Total Cost (STC) equal the derivative of Total Variable Cost (TVC)? Stated another way, why does dSTC/dQ = dTVC/dQ? Explain in a couple of sentences.

j. Find the value of Q where increasing returns ceases and diminishing returns begins. Hint: Diminishing returns begins at the level of Q where MC is a minimum

Answers

Total fixed cost is $6. The value of AFC is $6 / Q. Productive efficiency is greatest at Q = 4.5. Diminishing returns begin when Q = 3. The total fixed cost (TFC) does not change because it is fixed.

a) Total fixed cost is $6

b) We can obtain the average fixed cost function (AFC) from the total fixed cost (TFC) by dividing it by output (Q) as follows: AFC = TFC / Q. So, the value of AFC is $6 / Q.

c) The AVC function is calculated by dividing total variable cost (TVC) by output (Q).

STC = TFC + TVC6 + 9Q - 3Q2 + (1/3)Q3TVC = 9Q - 3Q2 + (1/3)Q3AVC = TVC / QAVC = (9Q - 3Q2 + (1/3)Q3) / QAVC = 9 - 3Q + (1/3)Q2

d) The MC function is derived by taking the first derivative of the STC function with respect to output (Q). The derivative of the STC function is: MC = dSTC / dQMC = 9 - 6Q + Q2

e) As Q approaches infinity, the denominator of AFC becomes larger and larger. So, AFC approaches zero as Q gets very large. This implies that fixed costs per unit decrease as production quantities get larger.

f) We can find the value of Q at which AVC is a minimum by taking the first derivative of the AVC function and setting it equal to zero. The first derivative of AVC is: AVC = 9 - 3Q + (1/3)Q2

dAVC / dQ = -3 + (2/3)Q= 0

Q = 4.5

g) Productive efficiency is greatest when AVC is at its minimum. Therefore, productive efficiency is greatest at Q = 4.5.

h) We can demonstrate that the value of SMC equals the value of AVC at the value of Q where AVC is a minimum by plugging Q = 4.5 into both the AVC and MC functions. AVC = 9 - 3(4.5) + (1/3)(4.5)2AVC = 7.125MC = 9 - 6(4.5) + 4.52MC = 7.125

Since SMC = MC, we can conclude that SMC equals AVC at the value of Q where AVC is a minimum.

i) In the short run, the total fixed cost (TFC) does not change because it is fixed. Therefore, the derivative of the STC function with respect to output (Q) is equal to the derivative of the TVC function with respect to output (Q). This means that dSTC / dQ = dTVC / dQ.

j) Increasing returns to scale cease when the marginal cost (MC) is equal to average total cost (ATC). Diminishing returns to scale begins when MC exceeds ATC. ATC is calculated by dividing the total cost (TC) by output (Q). TC is calculated by adding total fixed cost (TFC) and total variable cost (TVC).

ATC = TC / QATC = (6 + 9Q - 3Q2 + (1/3)Q3) / Q

Now, we can find the level of Q where increasing returns to scale cease by calculating the first derivative of ATC and setting it equal to zero.

ATC = (6 + 9Q - 3Q2 + (1/3)Q3) / QdATC / dQ = (6 - 6Q + Q2) / Q2= 0

Q = 3

Now, we can calculate the marginal cost function and find the level of Q where diminishing returns begins. We know that diminishing returns begin where the marginal cost is at its minimum.

MC = 9 - 6Q + Q2MC = 9 - 6(3) + 32MC = 3

So, diminishing returns begin when Q = 3.

To know more about total fixed cost, visit:

https://brainly.com/question/30826886

#SPJ11

PLEASE HELP! A candy dish at a restaurant has a strawberry candies out of a total of 15 candies the owner of the restaurant wants to add in strawberry candies to the dish so that the ratio of the strawberry candies tutorial candies is 3:4.

PLEASE HELP! A candy dish at a restaurant has a strawberry candies out of a total of 15 candies the owner

Answers

Answer:

The rational equation is;

(8 + n)/(15 + n) = 3/4

Step-by-step explanation:

Here, we want to write a rational equation.

Before the addition we have a total of 8 strawberries out of a total 15 candies

So to make the ratio 3:4, we are going to add n strawberries and this also will increase the total to (15 + n)

So the rational equation will be;

(8 + n)/(15 + n) = 3/4

Intellectually gifted people score in the top _____ percent on a standard IQ test.
A. 10
B. 5-10
C. 5
D. 1-2

Answers

Intellectually gifted people score in the top 1 - 2percent on a standard IQ test.

How to complete the blank in the statement

From the question, we have the following parameters that can be used in our computation:

IQ of intellectual gifted people

The general rule is that

People with intellectuals are usually ranked high and the range is usually small

Next, we test the options

A. 10

The top 10% has a high range

B. 5-10

The top 10% omits people in top 5%

C. 5

The top 5% has a high range

D. 1-2

This has a small range and it is the highest

Read more about IQ test at

https://brainly.com/question/31202174

#SPJ1

Write a statement to compare the Theoretical and Experimental Probabilities .

Answers

Answer:

Hello!

Step-by-step explanation:

Theoretical probability is what's expected to happen

Experimental probability is what's happen based on the experiment

Daisy gets 20 cats delivered to her shelter in the last month She expects to get 20 this month based on the theoretical probability but she actually gets 15 cats this month so her theoretical probability was 5 more then her experimental probability Hope that helps!

please help I need it done now correct answer will get brainliest

Answers

Answer:what is the question

Step-by-step explanation:

Answer:

ok i dont see a question but if you post another question i will answer it

Step-by-step explanation:

Find the surface area of this cube

Find the surface area of this cube

Answers

Answer:

512 in^3

Step-by-step explanation:

It would be length x height x width = AREA

8 x 8 x 8= 512 and since its 3d it will be 512^3

Okay so I will not be doing an explanation cause I do them to long so I will just give you the answer 512^2 in.Hope this helps :)

a chord is drawn perpendicular to the radius of the circle. if the radius is 5 inches and the point of intersection between the chord and the radius is 2 inches away from the circumference of the circle, find the length of the chord.

Answers

The length of the chord is approximately 7.62 inches.

Let's call the center of the circle point O, the radius of the circle 5 inches, the point where the chord intersects the radius point A, and the point where the chord intersects the circle point B.

Since the chord is perpendicular to the radius, we know that angle AOB is a right angle. Also, since OA is 5 inches and AB is 2 inches, we can use the Pythagorean theorem to find the length of OB

OB^2 = OA^2 + AB^2

OB^2 = 5^2 + 2^2

OB^2 = 25 + 4

OB^2 = 29

OB = sqrt(29) ≈ 5.39 inches

Now that we know the length of OB, we can use it to find the length of the chord. Let's call the length of the chord CD, where C and D are the points where the chord intersects the circle. Since OB is perpendicular to CD, we can use the Pythagorean theorem again to find the length of CD

CD^2 = 2OB^2

CD^2 = 2(29)

CD^2 = 58

CD = sqrt(58) ≈ 7.62 inches

Learn more about Pythagorean theorem here

brainly.com/question/14930619

#SPJ4


Priya starts with $50 in her bank account. She then deposits $20 each week for 12 weeks.
How many weeks does it take her to have $250 in her bank account?
O 15 weeks
O 4.6 weeks

O 10 weeks

O 5.4 weeks


Answers

Answer:

10 weeks

Step-by-step explanation:

20x+50=250

First subtract 50 from both sides, which gives you 20x=200

then divide 20 from both sides which gives you x=10

In 2014 the number of days the average employee at Philadelphia hospital is late for work is 12 days. The hospital has built a new parking garage, but it is two blocks away. They want to determine if this is increasing the number of days employees are late. From the sample of employees below, can you prove their claim using a .05 significance level? Make the decision regarding H0 (Use the z or t value of 2.18) Sample Data: [5_6_7_9_8_6_10_8_6_4_6_8]

Answers

Based on the given sample data and a significance level of 0.05, the calculated t-value of 2.18 does not exceed the critical t- value of 2.201. Therefore, we fail to reject the null hypothesis and cannot prove that the new parking garage is increasing the number of days employees are late.

To determine if the new parking garage is increasing the number of days employees are late, we can perform a hypothesis test. Let's set up the hypotheses:

H 0: The new parking garage does not increase the number of days employees are late.

H 1: The new parking garage increases the number of days employees are late.

We will use a significance level of 0.05.

Given the sample data: [5, 6, 7, 9, 8, 6, 10, 8, 6, 4, 6, 8]

Calculate the sample mean:

Sample mean (X) = (5 +6 +7+ 9+ 8+ 6+ 10+ 8+ 6+ 4+ 6+ 8) / 12 = 7

Calculate the sample standard deviation (s) using the formula:

s = √[ Σ(X - x)² / (n-1) ]

Where Σ denotes the sum, x is each individual data point, X is the sample mean, and n is the sample size.

s ≈ 1.83

Calculate the test statistic (t-value) using the formula:

t = (x - μ) / (s / √n)

Where μ is the hypothesized mean under the null hypothesis.

Given t = 2.18

Compare the absolute value of the calculated t-value with the critical value from the t - distribution table (with n-1 degrees of freedom) at a significance level of 0.05.

The critical t- value for a two-tailed test with a significance level of 0.05 and 11 degrees of freedom is approximately ± 2.201.

Since the absolute value of the calculated t- value (2.18) is less than the critical t-value (2.201), we fail to reject the null hypothesis (H 0). This means there is not enough evidence to prove that the new parking garage increases the number of days employees are late.

Therefore, based on the given data and a significance level of 0.05, we do not have enough evidence to support the claim that the new parking garage is increasing the number of days employees are late.

To know more about null hypotheses:

brainly.com/question/28331914

#SPJ4

Of the 40 randomly chosen students surveyed, 27 are involved in extracurricular activities at school. There are 680 students at the school. Predict the number of students in the school who are involved in after-school activities. (Please answer the right answer and how you got the answer)

Answers

Answer:

It's around 459. So 460 if need to round

Step-by-step explanation:

So, 40 randomly chosen people do not represent  the whole school, but using the ratio 27:40 you are given in the equation, you can divide the number of students (680) by the surveyed students (40) to get 17. What this means is there is 17 groups of 40 in the school, so to distribute the amount of people who are in a after-school activity, you must multiply 17 x 27 to get the assumption of about 459 kids. Hopefully you understand =)

Lisa has $580 budgeted for a trip she wants to spend five eights of it at her budget and travel expenses to the nearest cent what is she willing to spend on travel expenses?

Answers

Answer:

since it is 5/8ths of 580, multiply 5/8 by 580: 580(5/8) = 362.5 Then it says round to the nearest cent which is 0.5. So she is willing to spend $362.5 of her budget.

what is the probability that 5 card hand contains a four-of-a-kind, where the four-of-a-kind rank is a face card?

Answers

There is a slight possibility of 0.000240 that  5 card hand contains a four-of-a-kind, where the four-of-a-kind rank is a face card.

Total possible outcomes=⁵²C₅

                                        = 2598960

P( 4-of-a-kind) = ¹³C₁ * ⁴C₄

                        = 13

P( choosing one card from the rest of the deck) = ⁴⁸C₁

                                                                                 =48

P( 4-of-a-kind card with one different card)

= desired outcome / total number of outcomes.

= (13* 48) / 2598960

= 624/2598960

= 0.000240

Therefore, we get that the probability is 0.0240% .

To find similar questions on probability visit;

https://brainly.com/question/29441044

#SPJ4

63% of all bald eagles survive their first year of life. give your answers as decimals, not percents. if 47 bald eagles are randomly selected, find the probability that

Answers

The likelihood that 27 bald eagles will live is 0.8626 when 63% of all bald eagles survive their first year.

The probability is computed by dividing the total number of possible outcomes by the number of possible ways the event could occur. Probability and odds are two distinct ideas. Odds are calculated by dividing the likelihood of an event by the likelihood that it won't.

The probability is equal to the variety of possible outcomes. the total number of outcomes that could occur. For instance, there is only one way to receive a head and there are a total of two possible outcomes, hence the probability of flipping a coin and getting heads is 1 in 2. (a head or tail). P(heads) = 1/2 is what we write.

Here n=47

p=0.63 (as 63%)

P(X=27) :

\(\left \{ {{n} \atop {x}} \right. P^{x} * (1-P)^{n-x} \\\\\left \{ {{47} \atop {27}} \right. 0.63^{27} x * (1-0.63)^{47-27} \\\)

P(X=27) = 0.8626

To learn more about probability visit : brainly.com/question/13604758

#SPJ4

Correct Question:

63% of all bald eagles survive their first year of life. Give your answers as decimals, not percents. If 47 bald eagles are randomly selected, find the probability that : Exactly 27 of them survive their first year of life.

Which solid figure has the following net? square prism square pyramid triangular pyramid
need done rn

Answers

The solid figure that has the given net is C.rectangular prism.

What is a rectangular prism?

A three-dimensional solid form with six faces, including rectangular bases, is called a rectangular prism. A rectangular prism also refers to a cuboid. A cuboid and a rectangular prism have the same cross-section.

Six faces, eight vertices (or corners), and twelve edges to up a rectangular prism. We would require either 12 edge pieces and 8 corner pieces to create the rectangular prism's frame or 6 rectangles that connect at the edges to form a closed three-dimensional shape.

Therefore, option C is correct.

Learn more about figure at:

https://brainly.com/question/27405967

#SPJ1

missing options:

square pyramid

cube

rectangular prism

square prism

Which solid figure has the following net? square prism square pyramid triangular pyramidneed done rn

A hardware store rents vacuum cleaners that customers may use for part of a day before returning. The function f(x) = 6x + 14 models the total rental cost of a vacuum cleaner.

What is the flat fee that the store charges?

Answers

The flat fee that the stοre charge $14 and the cοst fοr 7 hοurs is $56. we sοlve this questiοn using linear equatiοn.

What is linear equatiοn?

An equatiοn is said tο be linear if the maximum pοwer οf the variable is cοnsistently 1. A linear equatiοn with οne variable has the cοnventiοnal fοrm Ax + B = 0. In this case, the variables x and A are variables, while B is a cοnstant.

let f be the tοtal rental cοst οf a vacuum cleaner fοr x hοurs

And, f(x) = 6x + 14 (Given)

Sο The flat fee that the stοre charge $14.

Reasοnable dοmain is 1  ≤  x  ≤  12

The cοst fοr 7 hοurs is,

f(7) = 6(7) + 14 = 56.

To learn more about Linear Equation, visit:

https://brainly.com/question/11897796

#SPJ1

Other Questions
if you do 100 j of work to elevate a bucket of water, what is the gravitational potential energy relative to its starting position ? Parallel to y = -3 and passes through (4,6) describe where the information and communication technology can be used it different section?guys help me i will make you brainliest Identify how the average friction and heat transfer coefficients are determined in flow over a flat plate. A) They are determined by differentiating the local friction and heat transfer coefficients at the mid-length of the plate, and then multiplying them by the length of the plate. B) They are determined by by integrating the local Reynolds number and Nusselt numbers over the entire plate. C) They are determined by integrating the local friction and heat transfer coefficients over the entire plate, and then dividing them by the length of the plate. D) They are determined by by differentiating the local Reynolds number and Nusselt numbers at the mid-length of the plate. Which of the following is correct when convection occurs in the atmosphere?ACool air rises and warm air sinks.BCool air sinks and warm air rises.CCool and warm air sink.DCool and warm air rise. PLEASE HURRYWhat is the slope and y-intercept? hansen corporation has determined its year-end inventory on a lifo basis to be 603000. information pertaining to that inventory is as follows: what should be the reported amount of the companys inventory what is a genotypeA.)an organism's combination of genes for a trait B.)the collection of dominant genes in an organism c.) the ratio of dominant to recessive genes in an individualD.) an organism's appearance as a result of its genes A firm had common stock ($0.80 in par value) of $200,000 in 2017, and common stock ($0.80 in par value) of $360,000 in 2018. the same firm had capital surplus (or additional paid-in capital) of $3,500,000 in 2017, and $5,700,000 in 2018. what was the price an individual share (i.e. one share) was sold in 2017 if the mean of the sampling distribution of a point estimator is equal to the true value of the parameter that is estimating, then it is called: Please help Asap which of the following was the establishment clause designed to do Which theorem correctly justifies why the lines m and n are parallel when cut by a transversal k THE SUM OF TWO NUMBERS IS 54. IF THE SMALLER NUMBER IS 6 LESS THAN THE BIGGER ONE, FIND THE NUMBERS. (STEP BY STEP PLZ) HELP!!!!!!!!!!!!!!!!!!!! the number of positive resl rootd for the expression for -3x+8x-7x+10=0 is less than or equal to To investigate possible differences in labour market success of graduates from two universities (University 1 and University 2), a sample of 115 graduates from University 1, and a sample of 110 graduates from University 2, are selected at random. Among graduates from University 1, the average salary (in GBP) is x = 2400 with a standard deviation of $ = 120. Among graduates from University 2, the average salary is = 2300 with a standard deviation of S2 = 140. Answer all questions (a)-(d). (a) [4%] What is the 90% confidence interval for the mean salary among graduates of University 1? (b) [10% ] Construct a 90% confidence interval for -, where is the mean salary for University 1, and 2 is the mean salary for University 2. (c) [6%] Do you reject the null hypothesis that the mean salary is the same between the two universities, at the 10% significance level? Detail each step of the statistical inference procedure. (d) [5%] (Continuing from the previous question.) For this test to be valid, is it required that the salary of each graduate in the two universities follows a normal distribution? Explain briefly. 20 X3/5 in simplest form BRAINLEST!!!!!!!!!!I countries where males are favored over females, what is one impact of the sex ratio imbalance on the population?Question 2 options:More women will enter the workforce.There will be fewer women of marriageable age.Girls will have more educational opportunities.There will be fewer men eligible for marriage.The elderly population will increase. According to the particle theory of matter, there is space between the small particles that make up matter. The space between particles differs depending on the state of the matter. Which list ranks the states of matter, according to the spacing between particles, from largest to smallest WILL GET 100 POINTS DUE SOON AND I NEED HELP!!!