How do ethical concerns affect scientific research

Answers

Answer 1

Answer:

Ethical concerns affect scientific research by adding boundaries to what can and cant be experimented on. An example is that its socially unacceptable to experiment on humans because its considered wrong and horrific, even at the expense of learning more about human nature and/or the human body.


Related Questions

The equation below represents the dissociation of vinegar which is a weak acid. How can you tell that it is an acid and it is weak? Just from looking at the equation.

The equation below represents the dissociation of vinegar which is a weak acid. How can you tell that

Answers

Because it is not very effective at transferring \(H^{+}\) ions to water, vinegar is a weak acid. Less than 0.4% of the \(CH_{3}CO_{2}H\)molecules in a 1 M solution interact with water to create \(H_{3}O^{+}\)and \(CH_{3}CO_{2}^{-}\) ions. More than 99.6% of the acetic acid molecules are still whole.

Weak acidsAcids that partially dissociate in solution are referred to as weak acids. To put it another way, a weak acid is any acid that is not a strong acid. A weak acid's strength is influenced by how much it dissociates; the more it dissociates, the stronger the acid.In comparison to weak acids, strong acids have a lower pH. 2) Strong acids dissociate more, resulting in a lower pH (greater concentration of \(H^{+}\) ions in solution). 3) This can be verified by using

For more information on weak acid kindly visit to

https://brainly.com/question/22104949

#SPJ1

Liquid octane (CH3(CH2)6CH3) will react with gaseous oxygen (O2) to produce gaseous carbon dioxide (CO2) and gaseous water (H2O). Suppose 17. g of octane is mixed with 112. g of oxygen. Calculate the maximum mass of water that could be produced by the chemical reaction. Round your answer to significant digits.

Answers

The maximum mass of water that could be produced by the chemical reaction is 162 g.

The given chemical equation is: 2 C8H18(l) + 25 O2(g) → 16 CO2(g) + 18 H2O(l)In the chemical reaction of liquid octane with gaseous oxygen, the products are gaseous carbon dioxide and gaseous water.According to the balanced chemical equation, 2 moles of C8H18 react with 25 moles of O2 to form 18 moles of H2O.So, 1 mole of C8H18 react with 25/2 = 12.5 moles of O2 to form 9 moles of H2O.The molar mass of C8H18 is 114 g/mol. So, the number of moles in 17 g of C8H18 is:17 g / 114 g/mol = 0.149 molThe molar mass of O2 is 32 g/mol. So, the number of moles in 112 g of O2 is:112 g / 32 g/mol = 3.5 molFrom the balanced chemical equation, 1 mole of C8H18 react with 12.5 moles of O2 to form 9 moles of H2O.So, the number of moles of O2 required to react with 0.149 mol of C8H18 to form H2O is:(12.5 mol / 1 mol) × (0.149 mol / 2 mol) = 0.935 molThe maximum number of moles of H2O that can be produced from 0.149 mol of C8H18 and 0.935 mol of O2 is 9 mol.So, the mass of water produced from 17 g of C8H18 and 112 g of O2 is:9 mol × 18 g/mol = 162 g

for more questions on chemical reaction

https://brainly.com/question/25769000

#SPJ8

Given the unbalanced chemical equation below. What would be the coefficient of AgNO3?

__AgNO3 + __H2S —> __Ag2S + __HNO3

Answers

2
I can’t really explain in words so I took a pic of the work I did (Ignore the worksheet and just look at what I wrote to balance the equation.)
Given the unbalanced chemical equation below. What would be the coefficient of AgNO3? __AgNO3 + __H2S

Convert 1.25 x 1024 atoms of carbon to moles of carbon.

Answers

Answer:

2.076

Explanation:

1 mole is 6.02 * 10^23

To convert from atoms (or molecules or compounds or ions etc.) to mols, you divide the number of atoms (or molecules or etc.) by 6.02 * 10^23

So it is (1.25 * 10^24)/(6.02 * 10^23)

=2.076

Answer:

\(\boxed {\boxed {\sf 2.08 \ mol \ C}}\)

Explanation:

We are asked to convert a number of carbon atoms to moles.

We will use Avogadro's Number for this, which is 6.022 × 10²³. This is the number of particles (atoms, molecules, formula units, etc.) in 1 mole of a substance. For this problem, the particles are atoms of carbon. There are 6.022 ×10²³ atoms of carbon in 1 mole of carbon.

We will also use dimensional analysis to solve this problem. To do this, we use ratios. Set up a ratio using the underlined information.

\(\frac {6.022 \times 10^{23} \ atoms \ C}{1 \ mol \ C}\)

We are converting 1.25 ×10²⁴ atoms of carbon to moles, so we multiply the ratio by that value.

\(1.25 \times 10^{24} \ atoms \ C* \frac {6.022 \times 10^{23} \ atoms \ C}{1 \ mol \ C}\)

Flip the ratio. It remains equivalent, but it allows us to cancel the units atoms of carbon.

\(1.25 \times 10^{24} \ atoms \ C* \frac{1 \ mol \ C} {6.022 \times 10^{23} \ atoms \ C}\)

\(1.25 \times 10^{24} * \frac{1 \ mol \ C} {6.022 \times 10^{23} }\)

\(\frac{1.25 \times 10^{24} } {6.022 \times 10^{23} } \ mol \ C\)

\(2.075722351 \ mol \ C\)

The original measurement of atoms has three significant figures, so our answer must have the same. For the number we calculated, that is the hundredths place. The 5 in the thousandths place tells us to round the 7 up to an 8.

\(2.08 \ mol \ C\)

1.25 ×10²⁴ atoms of carbon is equal to approximately 2.08 moles of carbon.

Predict the product for the following reaction sequence.3,4-dimethyl-7-nonanol 3,4-dimethyl-7-nonanone 6,7-dimethyl-3-nonanone 6,7-dimethyl-3-nonanal 6,7-dimethyl-3-nonanol

Answers

Answer:

Hello your question is incomplete attached below is the complete question

answer : 6,7-dimethyl-3-nonanone ( B )

Explanation:

The product for the following reaction sequence as attached below is

6,7-dimethyl-3-nonanone

The following reaction sequence can be categorized under Carbon Nucleophiles.

Carbon Nucleophiles which can be used to convert  aldehydes and ketones into  carboxylic acids or alkenes.

Predict the product for the following reaction sequence.3,4-dimethyl-7-nonanol 3,4-dimethyl-7-nonanone

The product for the given reaction sequence is 6,7-dimethyl-3-nonanone.

IUPAC (International Union of Pure and Applied Chemistry) naming is a systematic method used to name chemical compounds according to a set of rules established by the IUPAC.

The purpose of IUPAC naming is to provide a consistent and unambiguous way to communicate the structure of a compound through its name.

The outcome of the subsequent chain of reactions, which is appended below, is 6,7-dimethyl-3-nonanone

Under the heading of Carbon Nucleophiles, the following reaction chain can be categorised.

Aldehydes and ketones can be transformed into carboxylic acids or alkenes using carbon nucleophiles.

Thus, the answer is 6,7-dimethyl-3-nonanone.

For more details regarding IUPAC naming, visit:

https://brainly.com/question/16631447

#SPJ6

Your question seems incomplete, the probable complete question is:

Predict the product for the following reaction sequence.3,4-dimethyl-7-nonanol 3,4-dimethyl-7-nonanone

Which refers to the passing of a wave through an object?
sound
O interference
O transmission
O frequency
O sound

Answers

The term that refers to the passing of a wave through an object is "transmission."

Transmission refers to the process by which a wave passes through an object or medium. In the context of sound, transmission occurs when sound waves travel through different substances, such as air, water, or solids.

When a sound wave encounters an object, it can be transmitted through it, reflected off it, or absorbed by it, depending on the properties of the object and the medium through which the sound is traveling.

For example, when you speak into a microphone, the sound waves produced by your voice travel through the air and are transmitted to the microphone's diaphragm. The diaphragm converts the sound waves into electrical signals, which can then be amplified and reproduced as sound through speakers.

In summary, transmission is the term used to describe the passage of a wave, such as a sound wave, through an object or medium. It is an essential concept in understanding how waves interact with their surroundings and how sound propagates through different materials.

for such more questions on  transmission

https://brainly.com/question/18451537

#SPJ8

Calculate the vapor pressure at 85.0°C of a solution prepared by dissolving 0.300 mol of liquid dibromoethane (C₂H4Br₂, Pº=127 torr)
in 1.80 mol of liquid dibromopropane (C3H6Br2, P=173 torr).
torr

Answers

The vapor pressure at 85.0°C of a solution prepared by dissolving 0.300 mol of liquid dibromoethane the vapor pressure at 85.0°C of a solution prepared by dissolving 0.300 mol of liquid dibromoethane is 164.83 torr.

What is vapor pressure ?

The term vapor pressure is defined as the tendency of a material to change into the vapour state, and it increases with temperature.

For calculating mole fraction of C₂H₄Br₂ as follows

X C₂H₄Br₂ = moles of C₂H₄Br₂ / moles of C₂H₄Br₂ + moles of C₃H₆Br₂

= 0.3 / 0.3 + 1.80

= 0.14

For calculating mole fraction of C₃H₆Br₂ as follows:

XC₃H₆Br₂ =  moles of C₃H₆Br₂ / moles of C₂H₄Br₂ + moles of C₃H₆Br₂

= 1.80 / 2.1

= 0.85

For calculating total vapor pressure as follows:

P total = [ ( 0.14 × 127) + (0.85 × 173) ]

= 17.78 + 147.05

= 164.83 torr

Thus, The vapor pressure at 85.0°C of a solution prepared by dissolving 0.300 mol of liquid dibromoethane the vapor pressure at 85.0°C of a solution prepared by dissolving 0.300 mol of liquid dibromoethane is 164.83 torr.

To learn more about the vapor pressure, follow the link;

https://brainly.com/question/11864750

#SPJ1

Using Boyle's Law solve the following: An unknown gas has a volume of 200.0 mL and a pressure of 350.0 torr, pressure were increased to 700.0 torr, what is the resulting volume?

Answers

Answer:

400 mL

Explanation:

Boyle's Law: \(P_1*V_1 = P_2*V_2\)

Let x = the resulting volume

350 (200) = 700 (x)

x = 400 mL

A first-order decomposition reaction has a rate constant of 0.00683 yr−1. What is the half-life of the reaction?

Answers

Answer:

101 years

Explanation:

Use the half life equation, where t1/2 is the half life, and k is the rate constant:

t1/2 = 0.693/k

t1/2 = 0.693/0.00683 yr -1

t1/2 = 101 years

What’s the answer?????? I accidentally clicked the 1st one.

Whats the answer?????? I accidentally clicked the 1st one.

Answers

Answer:

its the 1st one at the top

Question 3:(answer in place of item 15)
The battery below is allowed to operate for 8 hours. At the end of this time the zinc strip is
visibly corroded and much smaller while the copper strip is shiny and thicker. Which way
(left-right or right-left) are electrons flowing.
Is the zinc being reduced or oxidized? How do you know?

Question 3:(answer in place of item 15)The battery below is allowed to operate for 8 hours. At the end

Answers

In the given Galvanic cell, the electrons are flowing from left to right. The Zinc is oxidized into Zn²⁺ ions.

What is a Galvanic cell?

A galvanic cell can be described as an electrochemical cell in which electricity is produced from spontaneous Oxidation-Reduction reactions. Galvanic cells exhibit spontaneous redox reactions but the energy generated from the said reaction.

A common apparatus of the galvanic cell consists of two different metals or electrodes such as Zinc and copper electrodes, each immersed in different beakers containing their respective ion solution. Therefore, the Zinc electrode is placed in ZnSO₄ solution and the copper electrode is placed in CuSO₄ solution.

On the left end, the zinc metal is oxidized into Zn²⁺ ions, and the electrons from the Zinc electrode travel to the copper electrode (right end). The cooper Cu²⁺ ions from the CuSO₄ solution accepts those electrons and deposit as copper metal on the copper electrode.

Learn more about Galvanic cells, here:

brainly.com/question/13031093

#SPJ1

What is the nickname for mitochondria

Answers

Answer:

the powerhouse of the cell

Which part of a flower can make eggs

Answers

Within the flower, sperm cells are produced by pollen at the tips of stamens, while egg cells develop in ovules, tiny structures embedded in the ovary at the base of the pistil.

Answer:Within the flower, sperm cells are produced by pollen at the tips of stamens, while egg cells develop in ovules, tiny structures embedded in the ovary at the base of the pistil.

I didn't realize the person up top had the same answer give them the brainliest! :)

Write a summary explaining how photosynthesis is occurring in this drawing

Write a summary explaining how photosynthesis is occurring in this drawing

Answers

Answer:

In the picture, it's shown that the energy from the sun and carbon dioxide is absorbed by plants through the leaf and is used for cooking food in plants. It is also shown that nutrients and water needed for the plant is absorbed through the roots of the plant. And it's also shown that cooking results in the formation of Glucose and Oxygen in which oxygen is released into the atmospehere and the glucose is stored in the plant for its own needs.

Answer:

In the picture, it's shown that the energy from the sun and carbon dioxide is absorbed by plants through the leaf and is used for cooking food in plants. It is also shown that nutrients and water needed for the plant is absorbed through the roots of the plant. And it's also shown that cooking results in the formation of Glucose and Oxygen in which oxygen is released into the atmospehere and the glucose is stored in the plant for its own needs.

The rotational spectrum of 79BrºF shows a series of equidistant lines spaced 0-714 33 cm - apart. Calculate the rotational constant B, and hence the moment of inertia and bond length of the molecule. Determine the wavenumber of the J = 9+= 10 transition, and find which transition gives rise to the most intense spectral line at room temperature (say 300 K).
and calculate the number of revolutions per second which the Brf molecule undergoes when in (a) the J = 0 state, (b) the J = 1 state, and (c) the J = 10 state. Hint: Use E = {lwin conjunction with Eqs (2.10) and (2.13), but remember that here w is in radians per second.[its Q season 2 from fundamentals of molcular spectruscopy . banwell.c.n]​

Answers

In the J = 0 state, the BrF molecule does not undergo any revolutions per second. In the J = 1 state, it undergoes approximately 0.498 revolutions per second, and in the J = 10 state, it undergoes approximately 15.71 revolutions per second.

To calculate the rotational constant B, we can use the formula:

B = 1 / (2 * π * Δν)

Where:

B = rotational constant

Δν = spacing between consecutive lines in the rotational spectrum

Given that the spacing between consecutive lines is 0.71433 cm^(-1), we can substitute this value into the formula:

B = 1 / (2 * π * 0.71433 cm^(-1))

B ≈ 0.079 cm^(-1)

The moment of inertia (I) of the molecule can be calculated using the formula:

I = h / (8 * π^2 * B)

Where:

h = Planck's constant

Given that the value of Planck's constant (h) is approximately 6.626 x 10^(-34) J·s, we can substitute the values into the formula:

I = (6.626 x 10^(-34) J·s) / (8 * π^2 * 0.079 cm^(-1))

I ≈ 2.11 x 10^(-46) kg·m^2

The bond length (r) of the molecule can be determined using the formula:

r = sqrt((h / (4 * π^2 * μ * B)) - r_e^2)

Where:

μ = reduced mass of the molecule

r_e = equilibrium bond length

To calculate the wavenumber (ν) of the J = 9+ to J = 10 transition, we can use the formula:

ν = 2 * B * (J + 1)

Substituting J = 9 into the formula, we get:

ν = 2 * 0.079 cm^(-1) * (9 + 1)

ν ≈ 1.58 cm^(-1)

To determine the most intense spectral line at room temperature (300 K), we can use the Boltzmann distribution law. The intensity (I) of a spectral line is proportional to the population of the corresponding rotational level:

I ∝ exp(-E / (k * T))

Where:

E = energy difference between the levels

k = Boltzmann constant

T = temperature in Kelvin

At room temperature (300 K), the population distribution decreases rapidly with increasing energy difference. Therefore, the transition with the lowest energy difference will have the most intense spectral line. In this case, the transition from J = 0 to J = 1 will have the most intense spectral line.

To calculate the number of revolutions per second, we can use the formula:

ω = 2 * π * B * J

Where:

ω = angular frequency (in radians per second)

J = rotational quantum number

For J = 0:

ω = 2 * π * 0.079 cm^(-1) * 0 = 0 rad/s

For J = 1:

ω = 2 * π * 0.079 cm^(-1) * 1 ≈ 0.498 rad/s

For J = 10:

ω = 2 * π * 0.079 cm^(-1) * 10 ≈ 15.71 rad/s

For more such questiosn on  BrF molecule visit;

https://brainly.com/question/30624940

#SPJ8

Describe how you would prepare 5.00 × 102 mL of a 1.75 M H2SO4 solution, starting with an 8.61 M stock solution of H2SO4

Answers

We prepare the volume of the 8.61 M stock solution of 0.102 L, then we dilute it by adding water to 0.5 L

Further explanation

Given

5.00 × 10² mL of a 1.75 M H₂SO₄ solution

8.61 M stock solution

Required

The volume of stock solution

Solution

Molarity from 8.61 M to 1.75 M ⇒Dilution

We can use dilution formula :

\(\tt \boxed{\bold{M_1.V_1=M_2.V_2}}\)

M₁=8.61 M

V₂=500 ml = 0.5 L

M₂=1.75 M

\(\tt V_1=\dfrac{M_2.V_2}{M_1}\\\\V_1=\dfrac{1.75\times 0.5}{8.61}\\\\V_1=0.102~L\)

A. Liquid water can change shape, but water vapor cannot.
B. Both liquid water and water vapor have definite volume.
C. Water vapor is less dense than liquid water.
D. Particles of water vapor have less energy than particles of liquid water.

A. Liquid water can change shape, but water vapor cannot.B. Both liquid water and water vapor have definite

Answers

Answer: c

because gasses are less dense than liquids

When electrons are filling energy levels, the lowest energy sublevels are occupied first. This is ____________.

Answers

When electrons are filling energy levels, the lowest energy sublevels are occupied first. This is Hund's rule.

Hund's rules state that:

Every orbital in a sublevel has to be singularly occupied before any other orbital is able to be doubly occupied.

All of the electrons in single occupied orbitals have to have the same spin to maximize the total spin.

It is called Aufbau Principle

Si-4) AN= 14 AM= 28

e= n=

Answers

Answer:

have a good day

Explanation:

I’m confused can u post a picture plz

Draw the line-bond structure of oleic acid (cis-9-octadecenoic acid), CH3(CH2)7CH=CH(CH2)7COOH, at physiological pH. You do not need to draw hydrogen atoms attached to carbon atoms.

Answers

Answer:

Explanation:

Oleic acid originates from an unsaturated fatty acid with 18 carbon atoms and one double bond, which can be found in olive oil and many other vegetable and animal oils and fats. Its economic importance includes the production of soap making and cosmetics etc.

The line-bond structure of the given oleic acid in the question can be found in the attached below.

Draw the line-bond structure of oleic acid (cis-9-octadecenoic acid), CH3(CH2)7CH=CH(CH2)7COOH, at physiological

The line-bond structure of oleic acid is given in the image attached. The line-bond structure represents the number of carbon atoms.

Oleic acid:

Oleic acid is an omega-9 fatty acid. It can be made by the body. It is also found in foods. Highest levels are found in olive oil and other edible oils. Oleic acid is most commonly used for preventing heart disease and reducing cholesterol. It is long chain of 18 Carbon atoms.

It is found in oils such as olive, palm, peanut, and sunflower.

Find more information about Oleic acid here:

brainly.com/question/26651977

Draw the line-bond structure of oleic acid (cis-9-octadecenoic acid), CH3(CH2)7CH=CH(CH2)7COOH, at physiological

the difference between Major purchase Consumer good​

Answers

A major purchase refers to a high-cost item or service that is considered a significant investment for an individual or household, such as a car, home, or college education. Major purchases usually involve a large sum of money and require careful planning and consideration before a final decision is made.

Any item that a person or a household buys for their own use or consumption is called a consumer good. Durable and non-durable goods are two types of consumer goods that can be classified. Consumer goods are tangible items that people or households buy for their own use or consumption.

Learn more about major purchase, here:

https://brainly.com/question/29998590

#SPJ1

Your question is incomplete, most probably the complete question is:

The difference between Major purchase and Consumer good​?

ANSWERED. !!!!!!!!!!!!!!!!

Answers

Answer:

:)

Explanation:

I’m sorry where is the question

What is the process whereby stars create elements heavier than hydrogen?

atomic growing

atom splitting

nucleosynthesis

hydrogenation

Answers

Answer:

nucleosynthesis

Explanation:

The correct answer is nucleosynthesis.

How do stars create heavier elements?

After the hydrogen in the star's core is exhausted, the star can fuse helium to form progressively heavier elements, carbon and oxygen, and so on, until iron and nickel are formed. Up to this point, the fusion process releases energy. The formation of elements heavier than iron and nickel requires an input of energy.

What was the process of the formation of heavy elements?

In a supernova explosion, neutron capture reactions take place (this is not fusion), leading to the formation of heavy elements. This is the reason why it is said that most of the stuff that we see around us comes from stars and supernovae (the heavy elements part).

Learn more about nucleosynthesis here https://brainly.com/question/20767918

#SPJ2

The following Lewis diagram represents the valence electron configuration of a main-group element.


This element is in group
.

According to the octet rule, this element would be expected to form an ion with a charge of
.

If is in period 5, the ion formed has the same electron configuration as the noble gas
.

The symbol for the ion is
.

Answers

This element is in group 1.

According to the octet rule, this element would be expected to form an ion with a charge of +1.

If X is in period 5, the ion formed has the same electron configuration as the noble gas Krypton

The symbol for the ion is Rb⁺

What is electronic configuration?

Electronic configuration refers to the arrangement of electrons in the orbitals of an atom or molecule, indicating the energy level of the electrons, the number of electrons in each energy level, and the number of electrons in each orbital.

Considering the given element:

It has one valence electron, hence it is in group 1. Group 1 elements form ions with a charge of +1.

Losing one electron will give the ion the same electron configuration as Kyrton since it is the noble gas in Period 4.

The element is rubidium and the ion is Rb⁺.

Learn more about electronic configuration at: https://brainly.com/question/26084288

#SPJ1

The following Lewis diagram represents the valence electron configuration of a main-group element.This

For the following reaction, if 19.7 g of H2, is reacted with excess CO in the laboratory, and 144.5 g of CH3OH is produced, what is the percentage yield of CH3OH? Round your answer to the nearest whole percent.CO + 2 H2 → CH3OHSelect one:a.100%b.44 %c.82 %d.93 %

Answers

Step 1

The reaction involved:

CO + 2 H2 → CH3OH (completed and balanced)

------------

Step 2

Data provided:

19.7 g H2 (the limiting reactant)

Excess reactant = CO

144.5 g CH3OH = actual yield

----

Data needed:

The molar masses of:

H2) 2.00 g/mol

CH3OH) 32.0 g/mol

-----------

Step 3

The theoretical yield:

By stoichiometry,

CO + 2 H2 → CH3OH (The molar rate between H2 and CH3OH = 2:1)

2 x 2.00 g H2 --------- 32.0 g CH3OH

19.7 g H2 --------- X

X = 19.7 g H2 x 32.0 g CH3OH/2 x 2.00 g H2

X = 157.6 g CH3OH (The theoretical yield)

-----------

Step 4

The % yield is defined as follows:

\(\begin{gathered} \text{ \%yield = }\frac{Actual\text{ yield}}{Theoretical\text{ yield}}x100\text{ } \\ \text{ \%yield = }\frac{144.5\text{ g}}{157.6\text{ g}}x100\text{ = 91.7 \% = 92 \% approx.} \end{gathered}\)

Answer: d. 93% (it is the nearest value in comparison to my result)

write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal​

Answers

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

The process of breaking a compound down into its elements is called
rearrangement
recombination
decomposition
dessication

Answers

I believe it’s decomposition

I can’t figure out how to draw 2 other isomers for this

I cant figure out how to draw 2 other isomers for this

Answers

Answer:

Explanation:

Here, we want to draw other isomers for the given molecule

To get the other isomers, we can simply change the position of the OH group to a different carbon atom on the ring

We can have that as:

Calculate the number of grams of solute in 1.000 L of 0.943 M potassium iodate

Answers

The number of grams of solute in 1.000 L of 0.943 M potassium iodate is  201.803g

0.943M means, 1L contains 0.943 moles KIO3.

Amount in g = no of moles× molar mass.

Molar mass of KIO3 = 214 g/mol.

So, mass of KIO3 present= 214×0.943 g = 201.803g

What are solute?

A substance  dissolved in a solution is called a solute.  In liquid solutions, the amount of solvent  is greater than the amount of solute. One of the best examples of a solute in our daily activities is salt and water. Salt dissolves in water and therefore salt is a solute.

The major types of solute are:

GaseousLiquidSolid

To learn more about solute, refer;

https://brainly.com/question/7932885

#SPJ9

Determine whether the following five molecules are polar or nonpolar and explain your answer:
a) Beryllium chloride b) Hydrogen sulphide c) Sulphur trioxide d) Water e) Trichloromethane

Answers

The following are categorized into polar or nonpolar molecules:

a) Beryllium chloride - nonpolar b) Hydrogen sulphide - polar c) Sulphur trioxide - nonpolar d) Water - polar e) Trichloromethane - polar

How to determine polar or nonpolar?

a) Beryllium chloride (BeCl₂) is a nonpolar molecule. The Be-Cl bond is polar due to the electronegativity difference between beryllium and chlorine, but the molecule is linear with the two polar bonds pointing in opposite directions, resulting in a net dipole moment of zero.

b) Hydrogen sulphide (H₂S) is a polar molecule. The H-S bond is polar due to the electronegativity difference between hydrogen and sulfur, and the molecule has a bent shape, resulting in a net dipole moment that is not zero.

c) Sulphur trioxide (SO₃) is a nonpolar molecule. The S-O bonds are polar due to the electronegativity difference between sulfur and oxygen, but the molecule is trigonal planar with the three polar bonds pointing in different directions, resulting in a net dipole moment of zero.

d) Water (H₂O) is a polar molecule. The H-O bond is polar due to the electronegativity difference between hydrogen and oxygen, and the molecule has a bent shape, resulting in a net dipole moment that is not zero.

e) Trichloromethane (CHCl₃) is a polar molecule. The C-Cl bonds are polar due to the electronegativity difference between carbon and chlorine, and the molecule has a tetrahedral shape, resulting in a net dipole moment that is not zero.

Find out more on polar or nonpolar here: https://brainly.com/question/17118815

#SPJ1

Other Questions
4. In Canadian coins, 16 quarters is equal in value to 2 toonies.number of quartersnumber of toonies11622024a. Fill in the table. Study the following ocean currents map.An ocean currents map is shown. On the map the locations for San Diego, California and Savannah, Georgia are marked. There is a looping current from the north past San Diego and a looping current from the south near SavannahWhich statement is most likely correct about the average temperatures in San Diego, California as compared to Savannah, Georgia? It is higher in Savannah because of the cool ocean currents from the south. It is higher in Savannah because of the warm ocean currents from the north. It is lower in San Diego because of the warm ocean currents from the south. It is lower in San Diego because of the cool ocean currents from the north. the nurse asks a patient where their pain is located, and the patient responds by pointing to the area of pain. which form of communication did the patient use? What does this mean: Who controls the past controls the future If (x+1) is a factor p(x)= x+x+2 then find the value of X. Mt ngi gi tit kim ti ngn hng mt s tin l 150 triu ng vo u mi nm theo th thc li kp k hn mt nm vi li sut c nh 8%/ nm. a) Hi sau 5 nm, s tin gc cng li m ngi nhn c l bao nhiu ? b) Hi sau bao nhiu nm th tng s tin nhn c ln u vt qu 1,5 t ng it is friday, and you are considering going to the cinema to watch a newly released movie. your alternatives to going to the movie are playing a computer game that you value at $7, going to the gym that you value at $10, and hanging out with friends that you value at $15. what is the opportunity cost to you for going to the cinema to watch the movie? Kady is teaching snowboarding lessons to four different groups today. If there are 8kids in each group, how many kids does Kady teach all day? A triple threaded square power screw is used to raise and lower a load of 25KN. The major diameter of the screw is 40mm with a pitch of 6mm and threaded frictional coefficient equal to 0.17. Additionally, a collar of diameter 60mm is also provided (fc = 0.08).a) Find the torque required to raise the load [5]b) Find the torque required to lower the load [5] The following information was provided to reconcile Archdale Company's book balance of Cash with its bank statement balance as of October 31, 2006: a) After all, posting was completed on October 31st, the company's cash account had a $26,193 debit balance, but its bank statement showed $28,020 balance. Cheques # 3031 for $1,380, # 3065 for $336 and # 3069 for $2,148 were not recored by the bank and among the cancelled cheques. b) c) A debit memorandum for $805 listed an NSF cheque for Jefferson Tyler. This bounced cheque was not recorded by the bookkeeper. d) The October 31st cash receipts, $1,197 were placed in the bank's night depository after banking hours on that date and this amount did not appear on the bank statement. e) Also enclosed with the statement was a $35 debit memorandum for bank services. It has not been recorded as no notification was received by the bookkeeper. Required: 1. Prepare the bank reconciliation for Archdale Company as at October 31st, 2006 and any adjusting entries required. 2. On the balance sheet what amount will be shown for cash? Given the plot of normal distributions A and B below, which ofthe following statements is true? Select all correct answers.A curve labeled A rises shallowly to a maximum and then fallsshallowly. A why men should not accuse female children for them a bowl in the shape of a half-sphere has a diameter of 18cm. what volume of soup can four bowls hold if they are completely filled? How does the average daily water consumption per person in the united states compare to other countries? What observations can a geologist make by working Outdoors instead of in a lab? What is an allegory? A. a comparison between two unlike things. C. When an object is given human qualities. B. A narrative with a larger symbolic significance. D. The general meaning of a work of literature. Pls I have no clue?? A light ray propagates from air to glass. The refractive index for the glass is.... Please help me Im so bad at physics that I just wanna cry whenever I study it Jon measured the length of the 6th grade hall andfound it was 7,000 cm. Amy suggested thatmeters would be more appropriate unit, andrecorded the length of the hall as _______ m. How are the two organic molecule hypotheses different?