Identify the possible quantitative analysis you can do using only the 28.02 g/mol as a unit factor.

Answers

Answer 1

The molar mass of a substance is an important unit factor that can be used to perform various quantitative analyses. With the molar mass of 28.02 g/mol as a unit factor, several calculations can be performed, including:

1.Calculation of the number of moles of a substance: By dividing the mass of a sample by its molar mass, the number of moles of that substance can be determined.

2.Calculation of the mass of a substance: By multiplying the number of moles of a substance by its molar mass, the mass of that substance can be calculated.

3.Calculation of the percentage composition of a compound: By dividing the mass of an element in a compound by the total mass of the compound, and then multiplying by 100%, the percentage composition of that element can be calculated.

4.Calculation of the empirical formula of a compound: By determining the molar ratios of the elements present in a compound, and using these ratios to write the simplest whole number ratio of the elements, the empirical formula of the compound can be calculated.

To know more about molar mass click here

brainly.com/question/30441146

#SPJ11


Related Questions

Ammonia gas can be prepared by the reaction of a metal oxide such as calcium oxide with ammonium chloride.
CaO(S) + 2 NH4Cl(s) 2 NH3(g) + H2O(g) + CaCl2(s)

If 139 g of CaO and 245 g of NH4Cl are mixed, what is the maximum possible yield of NH3?

What mass of the excess reactant remains after the maximum amount of ammonia has been formed?

Answers

24.7 g of NH4Cl will remain as excess reactant after the maximum amount of NH3 has been formed.

What is Reactant?

In a chemical reaction, a reactant is a substance that undergoes a chemical change or reaction with other substances to form a product. Reactants are typically written on the left side of a chemical equation and are used to represent the starting materials in a chemical reaction. The reactants are consumed during the reaction, and the resulting products are formed.

To determine the maximum possible yield of NH3, we first need to calculate the limiting reactant of the reaction, which is the reactant that is completely consumed and determines the maximum amount of product that can be formed.

The balanced chemical equation for the reaction is:

CaO(S) + 2 NH4Cl(s) → 2 NH3(g) + H2O(g) + CaCl2(s)

The molar mass of CaO is 56.08 g/mol, and the molar mass of NH4Cl is 53.49 g/mol.

To find the limiting reactant, we can use the mole ratio of CaO and NH4Cl in the balanced equation.

Number of moles of CaO = 139 g / 56.08 g/mol = 2.476 mol

Number of moles of NH4Cl = 245 g / 53.49 g/mol = 4.588 mol

The mole ratio of CaO to NH4Cl is 1:2, which means that 1 mole of CaO reacts with 2 moles of NH4Cl.

Therefore, the amount of NH4Cl required to react with all the CaO is:

2.476 mol CaO × (2 mol NH4Cl / 1 mol CaO) = 4.952 mol NH4Cl

Since we have only 4.588 mol of NH4Cl available, it is the limiting reactant. This means that all the NH4Cl will be consumed in the reaction and the amount of NH3 produced will be limited by the amount of NH4Cl.

The maximum possible yield of NH3 can be calculated using the mole ratio of NH4Cl and NH3 in the balanced equation:

4.588 mol NH4Cl × (2 mol NH3 / 2 mol NH4Cl) × (17.03 g NH3 / 1 mol NH3) = 155 g NH3

Therefore, the maximum possible yield of NH3 is 155 g.

To determine the mass of the excess reactant remaining, we can use the amount of NH4Cl consumed in the reaction and subtract it from the initial amount of NH4Cl:

245 g NH4Cl - (4.588 mol NH4Cl × 53.49 g/mol) = 24.7 g NH4Cl

Learn more about Reactant from the given link

https://brainly.com/question/26283409

#SPJ1

what is the oxidizing agent in this corrosion reaction?

Answers

Oxygen is the oxidizing agent in a corrosion reaction.

Corrosion is an example of a redox reaction which involves both reduction and oxidation process. During corrosion a metal loses electrons and becomes oxidized to form a metal ion.  Therefore, oxygen is the oxidizing agent since it undergoes reduction by gaining electrons.

A substance that contributes electrons to another chemical species, reducing it, is known as a reducing agent. Strong reducing agents include several metal hydrides as well as active metals including sodium, potassium, and calcium. These reducing substances have the ability to form hydroxide ions (OH⁻) and hydrogen gas (H₂) when they come into contact with water.

Therefore, during corrosion of iron, iron is the reducing agent and gives electrons, while oxygen is the oxidizing agent and accepts the electrons.

To know more about corrosion here

https://brainly.com/question/12594180

#SPJ4

What particle limitation to the widespread of this reusable water bottles? Pls help someone

Answers

Answer: Plastic water bottles

Explanation:

If you use disposable water bottles, here are some important concerns you should know about how they’re made as well as the problems they cause for the planet, your health, and your wallet.

what is the correct way to write the formula of the compound formed by a hydrogen ion and a sulfate ion? group of answer choices h 2 (so 4 ) 2 hso 4 h 2 so 4 h(so 4 ) 2

Answers

The correct way to write the formula of the compound formed by a hydrogen ion and a sulfate ion is c. h2so4.

A compound is a pure substance composed of two or more different atoms chemically bonded in a fixed proportion. The atoms in a compound can be combined in a range of methods and in various ratios. When atoms of two or more elements chemically combine, they form a compound.

The hydrogen ion or proton has a chemical symbol of H+. Chemical formula of sulfate ion. The chemical formula for sulfate ion is SO42-. Formula of the compound formed by a hydrogen ion and a sulfate ion. The formula of the compound formed by a hydrogen ion and a sulfate ion is h2so4.

Learn more about proton at:

https://brainly.com/question/1264222

#SPJ11

cars run on gasoline, where octane (c8h18) is the principle component. this combustion reaction is responsible for generating enough energy to move a vehicle, or do other work. how much co2 and h2o (in grams) are produced in the combustion of 0.87 gallons of octane? (density of octane

Answers

The combustion of 0.87 gallons of octane produces approximately 6.98 kg of CO₂ and 3.21 kg of H₂O.

To calculate the amount of CO₂ and H2O produced in the combustion of octane, we need to first convert the volume of octane from gallons to moles using its density and molar mass.

The density of octane is around 0.703 g/mL and its molar mass is 114.23 g/mol. One gallon is approximately 3.785 liters.

So, the amount of moles of octane in 0.87 gallons is:

moles of octane = (0.87 gallons) x (3.785 L/gallon) x (0.703 g/mL) / (114.23 g/mol) = 19.8 moles

The balanced chemical equation for the combustion of octane is:

2 C₈H₁₈ + 25 O₂ → 16 CO₂ + 18 H₂O

From this equation, we see that 2 moles of octane reacts with 25 moles of oxygen to produce 16 moles of CO₂ and 18 moles of H₂O.

Using stoichiometry, we can calculate the amount of CO₂ and H₂O produced from 19.8 moles of octane:

moles of CO₂ produced = 16/2 x 19.8 moles = 158.4 molesmoles of H₂O produced = 18/2 x 19.8 moles = 178.2 moles

To convert moles to grams, we can use the molar mass of each compound:

mass of CO₂ produced = 158.4 moles x 44.01 g/mol = 6,979 g or 6.98 kg (rounded to 2 decimal places)mass of H₂O produced = 178.2 moles x 18.02 g/mol = 3,209 g or 3.21 kg (rounded to 2 decimal places)

Therefore, the combustion of 0.87 gallons of octane produces approximately 6.98 kg of CO₂ and 3.21 kg of H₂O.

Learn more about combustion on:

https://brainly.com/question/10458605

#SPJ11

Identify two reasons why the relative size of an atom become smaller due to the loss of electrons .

Answers

Answer:

nucleus as electrons are being added to the same principal energy level. These electrons are gradually pulled closer to the nucleus because of its increased positive charge. Since the force of attraction between nuclei and electrons increases, the size of the atoms decreases.

Explanation:

Nuclear attractive pull to the electrons results in smaller atomic radius. Two reasons that leads the size of an atom smaller by electron loss are nuclear pulling and emptying outermost orbital.

Why atomic radius reduces by electron loss?

The nucleus have a net positive charge and electrons are negative in charge, thus, each electron experience a nuclear attractive pull. However, each electrons are shielded slightly from this attraction by the surrounding electrons.

The reasons which make the atomic radius smaller are the following.

By losing electrons the total number of electron is reducing therefore, the screening or shielding of an electron by other electron from the nuclear attractive pulling reduces, and thus due to the nuclear attraction, the orbitals shrinks inwards and reduces the atomic size. By losing electron from the outermost orbital if it contains only one electron then the orbital becomes empty and the atomic radius shrinks to the penultimate shell or orbital.

Therefore, due the two reasons mentioned above, the atomic radius reduces by electron loss.

To learn more about atomic size, refer the link below:

https://brainly.com/question/1127028

#SPJ2

why is El nino considered to be a trouble maker?
a. because scientists have to use satellites to chart its progress
b. because it occurs every year late in december
c. because it can cause droughtsflooding and other extreme or unusual weahter events
d. because it prevents a la nina from occuring

Answers

The correct answer is C. Hope this helps. Please mark brainliest

which of the following characteristics identifies a ph-balanced shampoo

Answers

The pH scale ranges from 0 to 14, with values below 7 considered acidic, 7 being neutral, and values above 7 being alkaline. Hair and scalp have a slightly acidic pH, and using a pH-balanced shampoo helps maintain the natural balance.

The characteristic that identifies a pH-balanced shampoo is having a pH level close to the natural pH level of the hair and scalp, which is around 4.5 to 5.5. Therefore, a pH-balanced shampoo will have a pH level in the acidic to neutral range, typically between 4.5 and 5.5, to avoid causing damage or disrupting the natural pH balance of the hair and scalp.

Learn more about natural pH here ;

https://brainly.com/question/5171852

#SPJ11

Final answer:

A pH-balanced shampoo should have a pH between 4.5 and 5.5, contain mild acids or bases, and help to keep the hair and scalp's natural pH level balanced.

Explanation:Characteristics of a pH-balanced shampoo:pH is between 4.5 and 5.5Contains mild acids or bases to maintain the desired pH level Helps to keep the hair and scalp's natural pH level balanced

A pH-balanced shampoo is important because it prevents the scalp from becoming too dry or too oily. It ensures that the hair cuticle is closed, reducing frizz and improving shine. Using a pH-balanced shampoo can also help maintain the effectiveness of other hair products.

Learn more about pH-balanced shampoo here:

https://brainly.com/question/32512053

#SPJ6

1.Rank the following three ionic compounds in order of increasing lattice energy: NaF, KCl, MgO. (Your answer should have highest lattice energy first, lowest last.) A) NaF > KCl > MgO B) NaF > MgO > KCl C) KCl > NaF > MgO D) KCl > MgO > NaF E) MgO > NaF > KCl F) MgO > KCl > MgO2.In which ONE of the following compounds would the bonding be expected tohave the highest percentage of ionic character?A) LiBr B) RbF C) MgBr2 D) NaCl E) KI

Answers

KCl > NaF > MgO. NaCl has the highest percentage of ionic character because it has the greatest difference in electronegativity between the two elements.

Lattice energy is the energy required to completely separate one mole of an ionic compound into its gaseous ions. Generally, the more electronegative element (the one with the higher electronegativity) has a higher lattice energy. In this case, KCl has the highest lattice energy because Cl is more electronegative than Na or Mg. NaF has the second highest lattice energy due to the relatively high electronegativity of F. MgO has the lowest lattice energy because O is less electronegative than both K and F. Therefore, the order of increasing lattice energy is KCl > NaF > MgO. The electronegativity difference between Na and Cl is 2.1, which is the highest of the five compounds given. This large difference in electronegativity between the two elements leads to a much stronger attraction between the positive and negative charges, which makes the bonding more ionic in nature.

To learn more about lattice energy click here https://brainly.com/question/18222315

#SPJ4

rehardens the newly arranged disulfide bonds as well as neutralizes any remaining waving lotion in the hair through oxidation is called

Answers

Rehardens the newly arranged disulfide bonds as well as neutralizes any remaining waving lotion in the hair through oxidation is called a neutralizer.

Waving Lotion / Solution is the one that softens and swells the cuticle layer then it breaks the disulfide bonds through the process of reduction.

Neutralizer is the substance that  rehardens the newly arranged disulfide bonds as well as neutralizes any remaining waving lotion in the hair through oxidation.

Learn more about Waving Lotion, here:

https://brainly.com/question/31284882

#SPJ4

3) The distance from the Earth to the Moon is 238,900 mi. What is the distance in inches?

Answers

The distance from the Earth to the Moon in inches is 18304704000 inches.

What is the distance from the Earth to the Moon?

Distance is a measure of the point of separation of two point or the amount of space between two points.

The SI unit for measuring distance is meters with symbol m.

Other common units of measuring distance or length include:

miles with distance miinches with symbol infeet with symbol ft

The distance from the Earth to the Moon is given in miles as 238,900 mi

1 mile = 63360 inches

238900 miles = 238900 * 63360

238900 miles = 18304704000 inches.

Distance = 18304704000 inches.

Learn more about miles to inches at: https://brainly.com/question/93330

#SPJ1

The correct coefficients needed to balance the following reaction are:
___ PbI2 + ___ ZnS → ___ PbS + ___ZnI2
a) 1, 2, 2, 1
b) 1, 1, 1, 1
c) 1, 1, 2, 2
d) 2, 1, 1, 2

Answers

I think the correct answer is c if not it’s d

How does the temperature change when a layer of glass is added?

Answers

Answer:

thermal shock

Explanation:

the temperatures inside the glass jar should have continued to increase over time. Internal stresses due to uneven heating. This is also known as “thermal shock”.

In general, the thicker the glass, the more prone it will be to breaking due to the immediate differences in temperature across the thickness of glass.

Borosilicate glass is more tolerant of this, as it has a higher elasticity than standard silicon glass.

You may also note that laboratory test tubes and flasks are made with thinner walls, and of borosilicate glass, when designated for heating.

P orbitals line up side to side to form what kind of bond?

Answers

P orbitals line up side to side to form a pi (π) bond.

The first bond formed between two atoms is a sigma bond and the second and third bonds are called pi-bond.

Pi bonds are easier to break than sigma bonds.

To know more about pi bonds, click below.

https://brainly.com/question/4518679

#SPJ11

the backbone of the dna molecule consists of what molecules?

Answers

Backbone of DNA is made of phosphate and sugar residues

What is ​Phosphate Backbone?DNA consists of two strands that wind around each other like a twisted ladder. Each strand has a backbone made of alternating sugar (deoxyribose) and phosphate groups. Attached to each sugar is one of four bases--adenine (A), cytosine (C), guanine (G), or thymine (T).A phosphate backbone is the portion of the DNA double helix that provides structural support to the molecule. DNA consists of two strands that wind around each other like a twisted ladder. Each strand has a backbone made of alternating sugar (deoxyribose) and phosphate groups.It consists of 5-carbon deoxyribose sugars and phosphate groups. These sugars are linked together by a phosphodiester bond, between carbon 4 of their chain, and a CH2 group that is attached to a phosphate ion. They are extremely important in the function of DNA.

To learn more about ​Phosphate Backbone refers to:

brainly.com/question/8627667

#SPJ4

Write balanced half-reactions for the following redox reaction: 2CO2(g)+12H+(aq)+6C2O2−4(aq)→ C2H5OH(l)+3H2O(l)+12CO2(aq) reduction: oxidation: Include state of matter

Answers

The reduction half-reaction is C2O2^4-(aq) + 2H+(aq) + 2e- → C2H5OH(l) + CO2(aq), and the oxidation half-reaction is CO2(g) + 4H+(aq) + 4e- → 2H2O(l) + CO2(aq).

In order to write the balanced half-reactions, we need to identify the species that are being reduced and oxidized in the given redox reaction.

The reduction half-reaction involves the species C2O2^4-(aq), which is being reduced to C2H5OH(l). In the process, two hydrogen ions (H+) and two electrons (2e-) are consumed. The state of matter for C2H5OH(l) is a liquid.

The oxidation half-reaction involves the species CO2(g), which is being oxidized to CO2(aq). Four hydrogen ions (4H+) and four electrons (4e-) are produced in this process. Additionally, two water molecules (2H2O(l)) are formed as a result of the oxidation.

By balancing the number of atoms and charges on both sides of the half-reactions, we obtain the following balanced half-reactions:

Reduction half-reaction: C2O2^4-(aq) + 2H+(aq) + 2e- → C2H5OH(l) + CO2(aq)

Oxidation half-reaction: CO2(g) + 4H+(aq) + 4e- → 2H2O(l) + CO2(aq)

The reduction half-reaction is C2O2^4-(aq) + 2H+(aq) + 2e- → C2H5OH(l) + CO2(aq), and the oxidation half-reaction is CO2(g) + 4H+(aq) + 4e- → 2H2O(l) + CO2(aq). These balanced half-reactions represent the reduction and oxidation processes occurring in the given redox reaction.

To know more about half-reaction, visit:

https://brainly.com/question/21851295

#SPJ11

What is the balanced reduction half-reaction for the unbalanced oxidation-reduction reaction? Na(s) + Cl2lo) - NaCl(s) 1. Cla) + 2 - 2 C1"(s) 2. Cl2(g) 2 + 2 C1-(s) 3. Na(s) + +-Nat(s) 4. Na(s) - Na'(s) + 2 O 1

Answers

The balanced equation shows that two sodium atoms react with one chlorine molecule to form two molecules of sodium chloride.

The balanced reduction half-reaction for the unbalanced oxidation-reduction reaction Na(s) + Cl2(g) → NaCl(s) can be found by identifying the species being reduced. In this case, it is the chlorine molecule (Cl2) that is being reduced to form chloride ions (Cl-). The reduction half-reaction for this process can be written as follows:
Cl2(g) + 2e- → 2Cl-(aq)
This equation represents the balanced reduction half-reaction for the given oxidation-reduction reaction. To balance the full reaction, we need to combine it with the oxidation half-reaction, which represents the oxidation of sodium atoms (Na) to form sodium ions (Na+). The oxidation half-reaction can be written as:
Na(s) → Na+(aq) + e-
By combining the two half-reactions, we get the balanced oxidation-reduction reaction:
2Na(s) + Cl2(g) → 2NaCl(s)
This reaction represents the balanced reduction half-reaction and oxidation half-reaction combined. The reduction half-reaction involves the gain of electrons by chlorine atoms, while the oxidation half-reaction involves the loss of electrons by sodium atoms. The balanced equation shows that two sodium atoms react with one chlorine molecule to form two molecules of sodium chloride.

learn more about atoms

https://brainly.com/question/1566330

#SPJ11

the party guy, mr. balloon, is making animal figures out of long thin balloons that he twists into different shapes. assume that the balloons are of uniform thickness, and that twisting them has a negligible effect on the volume of gas inside them. therefore, the length of a balloon is proportional to its volume. mr. balloon makes a doggie balloon out of a 2.0 meter balloon, and a butterfly out of a 1.5 meter balloon. the butterfly contains 3.5 moles of gas. how many moles are in the doggie balloon?

Answers

4.68 moles are their in 2m gas balloon.

As we know that,

1.5 m balloon contains 3.5 moles of gas

1 m balloon = \(\frac{3.5}{1.5} moles\)

1 m balloon = 2.34 moles

For 2 m balloon,

2 * 2.34 = 4.68 moles of gas are their.

A pure gas may consist of individual atoms (such as a noble gas like neon), elemental molecules made of a single type of atom (such as oxygen), or complex molecules made of several different types of atoms (e.g. carbon dioxide). There are many different pure gases in a gas mixture like air. The great separation of the individual gas particles is what sets gases apart from liquids and solids. A colorless gas becomes invisible to a human observer due to this gap.

To know more about gas click here:

https://brainly.com/question/18124975

#SPJ4

True or false; A solution always contains only one solvent.

Answers

A solution is defined as a mixture of two or more substances, usually, a solute and a solvent, and the difference between these two are in quantity, solute represents the smallest amount and solvent will represent the highest amount, and while you can have more than one solute, you can only have one solvent for a solution. Therefore the statement is true

How many atoms of each element are in 4Na3PO4?

3 sodium, 1 phosphorus, 4 oxygen
4 sodium, 4 phosphorus, 4 oxygen
12 sodium, 1 phosphorus, 4 oxygen
12 sodium, 4 phosphorus, 16 oxygen

Answers

Answer:

12 sodium, 4 phosphorus, 16 oxygen

Explanation:

4Na3PO4

Has (4X3) Na ,( 4X1) P ,(4X4) O

Answer:

12 sodium, 4 phosphorus, 16 oxygen

DDDDDDDDDDDDD

Explanation:

If Bromine has a charge of 1-, how many electrons does it have?

Answers

Answer:

36 electrons

Explanation:

But Bromine anion with a charge of -1 has one extra electron so 35 +1 = 36 electrons.

what will happen with a double replacement reaction but will not happen with a combustion reaction

Answers

Explanation:

2 9 10 7 1 10_20 20_30 30_40 40_ 50 50_60

While both double replacement reactions and combustion reactions involve the breaking and forming of chemical bonds, there are some differences between them in terms of the products that are formed. One thing that can happen in a double replacement reaction but not in a combustion reaction is the formation of a precipitate, which is a solid that forms when two solutions are mixed together and a reaction occurs.

Chemical reactions can be broadly classified into several types based on the nature of the reactants and products involved. Two common types of chemical reactions are double replacement reactions and combustion reactions. While both of these reactions involve the breaking and forming of chemical bonds, there are some differences between them in terms of the products that are formed.

A double replacement reaction is a type of chemical reaction where the cations and anions of two ionic compounds switch places to form two new ionic compounds. This type of reaction is also known as a metathesis reaction. The general equation for a double replacement reaction is:

AB + CD → AD + CB

In this reaction, the reactants AB and CD switch their respective cations and anions to form the products AD and CB. For example, a double replacement reaction between silver nitrate (\(AgNO_{3}\)) and sodium chloride (NaCl) can be represented as:

\(AgNO_{3}\) + NaCl → AgCl + \(NaNO_{3}\)

In this reaction, the silver ion (Ag+) from silver nitrate combines with the chloride ion (Cl-) from sodium chloride to form silver chloride (AgCl), while the sodium ion (Na+) from sodium chloride combines with the nitrate ion (\(NO_{3}\)) from silver nitrate to form sodium nitrate (\(NaNO_{3}\)).

On the other hand, a combustion reaction is a type of chemical reaction where a fuel and an oxidant react to produce heat and light. The general equation for a combustion reaction is:

Fuel + Oxidant → Heat + Light

For example, the combustion of methane (\(CH_{4}\)) in the presence of oxygen (\(O_{2}\)) can be represented as:

\(CH_{4}\) + \(2O_{2}\) → \(CO_{2}\) +\(2H_{2} O\) + Heat + Light

In this reaction, methane (the fuel) combines with oxygen (the oxidant) to produce carbon dioxide (\(CO_{2}\)) and water (\(H_{2} O\)), along with heat and light.

One thing that can happen in a double replacement reaction but not in a combustion reaction is the formation of a precipitate. A precipitate is a solid that forms when two solutions are mixed together and a reaction occurs. In a double replacement reaction, the reactants are typically two aqueous solutions of ionic compounds, which means that the products are also typically aqueous solutions of ionic compounds. However, sometimes the products can be insoluble in water, which means they will form a solid and settle out of the solution. This solid is called a precipitate.

In the example double replacement reaction between silver nitrate and sodium chloride mentioned earlier, the product silver chloride is insoluble in water and will form a precipitate. This means that if the reaction is carried out in a test tube or other container, the precipitate will be visible as a cloudy or milky substance that settles to the bottom of the container.

In a combustion reaction, the reactants are typically a fuel and an oxidant, which means that the products are typically gases or liquids. There is generally no formation of precipitates in a combustion reaction because there are no ionic compounds present that can form insoluble products.

Here you can learn more about combustion reactions

https://brainly.com/question/30562669#

#SPJ11

What is the source of most of our current knowledge of Mercury's appearance and geology?

Please answer quick !!

Answers

The source is scientists

how many atoms are in 7.2mol of sodium? step by step answer

Answers

Answer:

4.34 times 10^24

Explanation:

number of atoms=7.2 times Avogadro's number

                           =7.2 times 6.02 times 10^23

                           =4.34 times 10^24

Answer:

Explanation: we will multiple the amount of moles to the Avogadro's number for example:                                                                                                        

                                     7.2*6*10 to the power 23

it is the combination of the uppermost mantle and the crust​

Answers

Answer:

lithosphere

Explanation:

FILL THE BLANK. in the most elaborate neanderthals burials discovered, the bodies were placed in a unique position called __________________________ position.

Answers

In the most elaborate Neanderthal burials discovered, the bodies were placed in a unique position called the flexed position.

The Neanderthals

Neanderthals, an extinct species of ancient humans, demonstrated cultural practices related to burying their dead. Archaeological evidence suggests that they engaged in intentional burial rituals, with varying degrees of complexity. In some cases, Neanderthals buried their dead in shallow graves, while in more elaborate instances, the bodies were placed in flexed positions, often with accompanying grave goods. This suggests a recognition of the deceased's significance and possibly reflects a belief in an afterlife or a symbolic gesture of respect. Such burial practices indicate that Neanderthals possessed a level of social and cognitive sophistication, challenging previous notions of their cultural capabilities.

So, the sentence is complete as follows "In the most elaborate Neanderthal burials discovered, the bodies were placed in a unique position called the flexed position." This refers to the position where the limbs are bent, and the body is brought into a fetal position, likely indicating a cultural tradition of care and respect for the dead.

learn more about Neanderthals

https://brainly.com/question/722153

#SPJ11

how are silicate minerals different from nonsilicate minerals

Answers

Answer: The main difference between silicate minerals and nonsilicate minerals is that silicate minerals are composed of silicate groups whereas Nonsilicate minerals have no silicate groups.

Explanation:

1
Select the correct answer.
Which phrase correctly describes temperature?
OA
average rotational kinetic energy of the particles in an object
OB.
average energy of the particles in an object
average translational kinetic energy of the particles in an object
all energy possessed by the particles in an object

Answers

Answer:

A

Explanation:

the particles in space to be able to move their has to be temperature

Question
Which atom would be neutral?(
Responses

an oxygen atom with 9 electrons, 8 protons, and 8 neutrons
an oxygen atom with 9 electrons, 8 protons, and 8 neutrons

an oxygen atom with 16 electrons, 18 protons, and 16 neutrons
an oxygen atom with 16 electrons, 18 protons, and 16 neutrons

an oxygen atom with 8 electrons, 8 protons, and 9 neutrons
an oxygen atom with 8 electrons, 8 protons, and 9 neutrons

an oxygen atom with 4 electrons, 6 protons, and 4 neutrons

Answers

Answer:

an oxygen atom with 8 electrons, 8 protons, and 9 neutrons

an oxygen atom with 8 electrons, 8 protons, and 9 neutrons

Explanation:

In order for atoms to be neutral, it has to have the same amount of electrons and protons

Summarize your main take away about water and hydrogen bonding.​

Answers

Answer:

As water is boiled, kinetic energy causes the hydrogen bonds to break completely and allows water molecules to escape into the air as gas (steam or water vapor). When water freezes, water molecules form a crystalline structure maintained by hydrogen bonding.

Explanation:

Other Questions
picture is down below Why was aunt jemima chained to a table? give me the truth. the lowering of barriers of distance and culture affecting global organizations has been caused in part by themultiple choiceimposition of government-enforced tariffs on imports.advancements of communication and transportation technology.rejection of the free-trade doctrine.imposition of government-enforced tariffs on exports.restrictions placed on the flow of capital between nations. The quality of our lives is determined by the quality of the _________________________ we make on a daily basis. your company, kick that ball sports, has appointed you as a project manager for its new soccer product line introduction. the product line involves three new products, two of which will be introduced together and a third one that will follow within two years. you are ready to create the wbs. all of the following are true except for which one? Which of the following characteristics makes for a good hydrogen bond donor?a) a high electronegativityb) a nonbonding pair of electronsc) both of the aboved) neither of the above The number of adjacent pages loaded by a ViewPager can be changed using which method?A. setAdjacentPageNumberB. setAdjacentQueueLimitC. setOffScreenPageLimitD. setAdjacentQueuePages maureen left her teaching job, which paid $30,000 per year, and invested $20,000 of her retirement fund (which was earning 10 percent interest) in a new real estate business. her accountant projected $50,000 net revenue the first year. her husband forecast her economic profit to be group of answer choices zero. $18,000. $32,000. $50,000. Based on Nostalgia: Refer to "why"? Ella asked expectedly ... We are utterly different people." on page 202 what is the difference between job design and job analysis? question 36 options: job analysis focuses on attracting talented candidates, whereas job design is about changing jobs to avoid legal challenges. job design focuses on restructuring jobs, whereas job analysis only describes them. job analysis focuses on determining the competencies of incumbents, whereas job design is a technique to avoid biases in the description of tasks and duties. job design describes job specifications, whereas job analysis describes tasks and duties. 5 men and 12 boys finish a piece of work in 4 days, 7 men and 6 boys do it in 5 days. The ratio between the efficiencies of a man and boy is?. Which person has based their investment plan on high risk options Simplify.4(3 x-2)(2 x+4)+3 x+5 x-6 F. 9x+3 x-14 G. 9x+13 x-14 H. 27x+37 x-38 J. 27x+27 x-26 A battery that is not connected to anything is a good analogy for the _____ of a neuron. 1. Tube that extends into the abdominal cavity and carries the sperm from the testes to the urethra for ejaculation __________ 2. Organ through which both semen and urine pass ____________ 3. Merged from the seminferous tubules, a comma shaped structure where the sperm mature __________ 4. Produces about 30% of the seminal fluid in the ejaculated semen __________ If you decrease the confidence level, the confidence interval . a. may increase or decrease, depending on the sample data b. decreases c. stays the same d. increases A property is valued at $30,000 and is insured for $24,500 at a rate of 16 cents per $100. The premium for a 3-year policy is 2 1/2 times the premium for 1 year. For a 3-year policy, the monthly cost will be:_________A. $3.33. B. $4.00. C. $2.72.D. $2.64. in snapdragon plants, t is the dominant allele for plant height (tall), t is the recessive allele for plant height (dwarf), rr flowers are red, rr flowers are white, and rr flowers exhibit incomplete dominance and are pink. a cross between ttrr and ttrr results in what proportion of offspring with pink flowers on dwarf plants? Consider a competitive economy consisting of many farmers and many tailors. The number of farmers is equal to the number of tailors. Farmers are identical. Each farmer has 10 units of food (F) but no clothing (C). Tailors are also identical. Each tailor has 20 units of clothing but no food. Suppose each person has the utility function U = FC . The price of clothing is always 1. What is the equilibrium price for food? Explain your answer.(a) If the price of food is $3, does this price support a competitive equilibrium? Explain. [Hint: Solve for the optimal consumption bundle for a farmer and the optimal consumption bundle for a tailor first. Use this information to determine whether the prices lead to a competitive equilibrium.](b) If not, what will happen to the price of food? smith company leased equipment from firstlease corp. the cost of the equipment to firstlease was $500,000. the present value of the expected residual value is $40,000. the lease includes six annual payments beginning on the first day of the lease. if the six lease payments are of an equal amount, what payment amount would provide firstlease corp with a return of 10%?