The substance that causes the production of bubbles in the reaction of zinc with sulfuric acid is hydrogen gas.
The reaction of zinc with sulfuric acid can be written as follows:
Zn (s) + H2SO4 (aq) ----------> ZnSO4 (aq) + H2 (g)
s = solidaq = aqueous (dissolved in water)g = gasFrom the reaction above, we can see that the reaction between solid zinc and aqueous sulfuric acid produces hydrogen gas (H2) as one of the products. This hydrogen gas appears in the reaction as bubbles that occur significantly and vigorously as the reaction is going on.
Note: other than s, aq, and g, another state of matter in a reaction is l (liquid).
Learn more about the reaction between zinc and sulfuric acid at https://brainly.com/question/15578324
#SPJ4
what makes up a molecule of oxygen gas?
Answer:
2 oxygen atoms make oxygen gas
A molecule of oxygen gas is composed of two oxygen atoms chemically bonded together. The symbol for oxygen is "O," and the atomic number is 8, indicating that each oxygen atom has 8 protons in its nucleus.
A covalent bond is a type of chemical bond that occurs between two atoms when they share one or more pairs of electrons. It is a strong bond that holds atoms together to form molecules.
In a covalent bond, atoms share electrons in order to achieve a more stable electron configuration, typically by filling their outermost energy levels (valence shells). By sharing electrons, both atoms involved in the bond can achieve a more stable configuration, similar to the noble gas configuration.
In an oxygen gas molecule, the two oxygen atoms are held together by a covalent bond. Covalent bonds involve the sharing of electron pairs between atoms. In the case of oxygen gas, each oxygen atom shares two electrons with the other oxygen atom, resulting in a stable molecule.
Therefore, a molecule of oxygen gas is made up of two oxygen atoms (O) bonded together by a covalent bond.
For more details regarding oxygen gas, visit:
https://brainly.com/question/1064242
#SPJ6
What is the meaning of N, E, M, and S in periodic table Need ASAP!
Answer:
Molybdenum is M, Einsteinium is E, and N is Nitrogen. Lastly, S is sulfur.
Which of the following is an adaptation of organisms in avoiding unfavorable condition due to a change in abiotic factor?
A. Migration of birds due to change in seasons.
B. Hibernation of a snake from September to December.
C. Plants die due to lack of water and high temperature.
D. Body temperature regulation of polar bears during winter
Volcanic eruption is considered as one of the changes in abiotic factors in the ecosystem. Which of the following is/are the effect/s of volcanic eruptions in the ecosystem?
A. I and II only
B. I and III only
C. II and III only
D. I, II, and III
Help plsssssss
The effects of volcanic eruption include acid rain and destruction of lives and property.
What are abiotic factors?The term abiotic factors refers to those factors that are non living such as rainfall, topography, etc. The adaptation of organisms in avoiding unfavorable condition due to a change in abiotic factor is hibernation of a snake from September to December.
A volcanic eruption is a sudden outburst of molten magma from the earth's crust. The effects of volcanic eruption include acid rain and destruction of lives and property.
Learn more about volcanic eruptions: https://brainly.com/question/1622004
draw a table to compare the advantages and disadvantages of three feels _ ethanol,hydrogen, and diesel
please answer
Answer:
Lower fuel efficiency than Conventional Diesel
Pros of Biodiesel Cons of Biodiesel
Renewable May damage fuel filters and pipes
Incredibly Safe Can Effect Food Supply
Ready to Use Little bit Expensive
Extends engine lifespan Lower fuel Efficiency than DieselHydrogen Fuel Cell Advantages and Disadvantages in Material...
Hydrogen Fuel Cell Technology.
Advantage: High Energy Density Improves Productivity.
Disadvantage: The Use of Fossil Fuels in Hydrogen Production.
Disadvantage: Hydrogen Storage and Transportation.
Disadvantage: Fuel Cell Efficiency.Ethanol Fuel is Cost-effective Compared to Other Biofuels. ...
Ecologically Effective. ...
Helps Reduce Global warming. ...
Easily Accessible. ...
Minimizes Dependence on Fossil Fuels. ...
Contributes to Creation of Employment to the Country. ...
Opens up Untapped Agricultural Sector. ...
Ethanol Fuel is a Source of Hydrogen.draw a table to compare the advantages and disadvantages of three feels _ ethanol,hydrogen hope it's right
What is the coefficient of H2 when the following equation is correctly balanced? CO (g) + H2(g) → H20 (g) + CH4 (9)
Answer:
3. CO + 3H₂ ⇒ H₂O + CH₄
Explanation:
match reactants and products on both sides of the equation.
What do isotopes of an element have in common? How do they differ?
Answer:
Isotopes are atoms of the same element that have different numbers of neutrons but the same number of protons and electrons. The difference in the number of neutrons between the various isotopes of an element means that the various isotopes have different masses.
Answer:
It is the electrons that determine the chemical behaviour of a particular element. Isotopes of an element share the same number of protons but have different numbers of neutrons
Explain the connection between atoms and electricity
Answer:
The protons and electrons of an atom are attracted to each other. They both carry an electrical charge. Protons have a positive charge (+) and electrons have a negative charge (-). The positive charge of the protons is equal to the negative charge of the electrons.
Explanation:
Determine which set of properties correctly describes a salt crystal (NaCl)?A. Malleable, brittle, soluble in oil or gasoline, high melting point, simple structureB. Ionic lattice, brittle, soluble in oil or gasoline, low melting point, does not conduct electricityC. Dense, malleable, soluble in water, conducts electricity, metallic latticeD. Dense, soluble in water, brittle, ionic lattice, high melting point
Answer: D) Sodium Chloride is dense, soluble in water, brittle, ionic lattice, high melting point.
Match the following terms describing phase changes with their definitions.
Liquid to gas Solid to gas Solid to liquid Liquid to solid boiling
freezing
melting sublimation
Liquid to gas - Boiling: The phase change from a liquid to a gas that occurs when the substance reaches its boiling point, resulting in the formation of vapor.
Solid to gas - Sublimation: The phase change from a solid directly to a gas without going through the liquid state.
Solid to liquid - Melting: The phase change from a solid to a liquid when heat is applied, causing the substance to transition from a rigid to a more fluid state.
Liquid to solid - Freezing: The phase change from a liquid to a solid when the substance loses heat, resulting in the formation of a solid crystal lattice.
Therefore, the correct match would be:
Liquid to gas - Boiling
Solid to gas - Sublimation
Solid to liquid - Melting
Liquid to solid - Freezing
To learn more about phase change of matter, visit:
https://brainly.com/question/30720253
#SPJ11
Describe the feedback loop involving water vapor and temperature. Is it positive or negative?
Answer:
The feedback loop involving water vapor and temperature is a positive feedback loop. As temperature increases, the amount of water vapor that can be held in the atmosphere also increases. This leads to an increase in the amount of water vapor in the atmosphere, which further amplifies the greenhouse effect and contributes to additional warming.
In other words, warmer temperatures lead to more water vapor in the atmosphere, which traps more heat, causing further warming, and so on. This positive feedback loop can amplify the initial warming effect caused by other factors such as greenhouse gas emissions or changes in solar radiation.
Conversely, if the temperature decreases, the amount of water vapor that can be held in the atmosphere decreases, which can lead to a decrease in the amount of water vapor present in the atmosphere, reducing the greenhouse effect and contributing to cooling. However, this negative feedback loop is weaker than the positive feedback loop described above, and it tends to be dominated by the positive feedback loop under most circumstances.
Determine the number of moles of 725.0 g of BaSO4
Answer:
It would be 3.1063937724731447 moles.
Hope this helps :)
Which of the following compounds
does not contain a polar Covalent bond
A) CH2 CH₂ CH₂OH
B) ozone
C)CH₂ CH (NH₂) CH₂ CH2
D) CH4 CH₂ CH₂ Ch
H2 li
Answer:
the correct answer is letter B
Water is a pure substance. Which of the following is true about water?
A. Its compounds can only be chemically separated into the elements that make it up.
B. Its compounds can only be physically separated into the elements that make it up.
C. It is made up of a variety of compounds, each with a different set of properties.
D. It is made up of one element and one compound, each with the same properties.
The [H+] is 0.001 M. What is the pH?
help pls!!
H2O(g) → H2O(l)
The chemical equation above describes a(n) __________.
A) irreversible state change
B) physical change
C) endothermic change
D) chemical change
Answer:
C, physical change
Explanation:
take a look at the equation. Next to each form of water do you see the little (g) and (l)? These represent the state of matter the water is in. So, the water is going from a gas to a liquid. The chemical compound is the same so its a physical change, not chemical, and it is reversible. You could change the liquid water back to the gas through evaporation. Endothermic has literally nothing to do with this equation so you can easily eliminate that answer choice.
David noticed that when he ate chocolates they melted in his hands faster when his hands were slightly wet from sweat than his hands were dry. He was curious to see if other liquids would affect how fast they would melt? He decided to test out four different liquids, water, milk, lemon-lime soda, and orange juice. He then timed how long it took them to melt. He thought the chocolate would melt faster in orange juice that the other liquids because it is more acidic. The results are below.
QUESTIONS:
1) What was David's Question?
2) What was David Hypothesis?
3) What his independent Variable?
4) What his Dependent variable?
Answer:
1. What liquid would melt the chocolate faster?
2. He thought that the orange juice would melt the chocolate faster.
3. The independent variable is the liquids.
4. The dependent variable is the chocolate.
Explanation:
1. He was curious to see if other liquids would affect how fast they would melt? This is his question.
2. He thought the chocolate would melt faster in orange juice than the other liquids because it is more acidic.
He made a prediction or a hypothesis.
3. His independent and dependent variables are chocolate and liquid. Since he wants to know how fast the chocolate melts in different liquids, how fast the chocolate melts is dependent on the liquid that he uses.
How does solid neon compare to liquid neon?
Answer:
The liquid molecules stay towards the bottom but one or two do make it all the way to the top. The molecules in the gas are also moving faster than the molecules in the liquid phase.
Answer: basically liquid molecules stay toward the bottom but one or two do make it all away to the top and the molecules in the gas are moving faster than the molecules in the liquid phase
Explanation: hope this helped
An example of a fossil fuel is
Answer:
Coal, Oil and Natural Gas.
Explanation:
Coal: It is the primary fuel for the production of electricity and is responsible for about 40% of the electric power supply in the United States. The burning of coal and the mining process is harmful to the environment releasing air pollutants such as sulfur dioxide, nitrogen oxide, and mercury.
2. Oil: Oil is the primary source for the world's transportation. Most oil is pumped out of underground reservoirs but may also be found in shale and tar sands.
3. Natural Gas: About 27% of U.S. energy is fueled by natural gas. It is commonly used to produce heat or electricity for buildings and industrial processes.
Which best describes the sequence of elements in Period 5 of the periodic table? (Read the table from left to right and choose the best description)
Nonreactive gases, Metalloids, Nonreactive metals, Highly reactive metals, Highly reactive gases
Highly reactive gases, Relatively nonreactive metals, Metalloids, Very nonreactive gases, Nonreactive nonmetals
Highly reactive metals, Relatively nonreactive metals, Metalloids, Reactive nonmetals, Nonreactive gases
Nonreactive gases, Nonreactive metals, Highly reactive metals, Metalloids, Reactive nonmetals, Reactive gases
Answer: It’s the 3rd one
The elements of period 5 is best described as the Highly reactive metals, Relatively nonreactive metals, Metalloids, Reactive nonmetals, Nonreactive gases.
The elements of period 5 include metals and nonmetals,
For example-
Rubidium and Strontium reactive metals.It contains Relatively nonreactive metals,Nitrogen and phosphorus are nonmetals in period 5.Xenon is the non reactive gas in period 5.Therefore, the elements of period 5 is best described as the Highly reactive metals, Relatively nonreactive metals, Metalloids, Reactive nonmetals, Nonreactive gases.
To know more periodic table,
https://brainly.com/question/11155928
What must be present in order for
electricity to flow?
A. positive and negative charges
B. an electrical outlet
C. Neutrons
D. water
Sulfuric acid + sodium hydroxide
Answer:
sulfuric acid + sodium hydroxide -> sodium sulfate + water
NaOH (aq) + H₂SO₄ (aq) → Na₂SO₄ (aq) + H₂O
(″ロ゛) x
write a general equation for the reaction of a halogen with another halogen.
Answer:
All the halogens react directly with hydrogen, forming covalent bonds and—at sufficient levels of purity—colorless gases at room temperature. Hydrogen reacts with fluorine, chlorine, bromine, and iodine, forming HF, HCl, HBr, and HI, respectively
Determine the hydronium and hydroxide ion concentration in a solution that is 1.0 x 10-3 M HNO3
Detailed, easy-to-understand answer, please.
Explanation:
When HNO3 (nitric acid) is dissolved in water, it undergoes a dissociation reaction as follows:
HNO3 + H2O → H3O+ + NO3-
This means that for every HNO3 molecule that dissolves, one H3O+ ion and one NO3- ion are produced.
Since the concentration of HNO3 in the solution is 1.0 x 10-3 M, the concentration of H3O+ ions will also be 1.0 x 10-3 M, because one H3O+ ion is produced for every HNO3 molecule that dissociates.
Therefore, [H3O+] = 1.0 x 10-3 M
To find the concentration of hydroxide ions, we can use the equation for the ion product of water:
Kw = [H3O+][OH-] = 1.0 x 10^-14
Rearranging the equation gives:
[OH-] = Kw/[H3O+]
Since we know the value of [H3O+], we can calculate the value of [OH-]:
[OH-] = (1.0 x 10^-14) / (1.0 x 10^-3) = 1.0 x 10^-11 M
Therefore, the hydronium ion concentration is 1.0 x 10^-3 M and the hydroxide ion concentration is 1.0 x 10^-11 M.
HNO3 is a strong acid that completely dissociates in water, which means that it completely breaks apart into its constituent ions when dissolved in water.
Determine the hydronium and hydroxide ion concentration in a solution that is 1.0 x 10-3 M HNO3In a solution of 1.0 x 10^-3 M HNO3, the concentration of hydronium ions (H3O+) and hydroxide ions (OH-) can be determined using the following equation:
HNO3 + H2O -> H3O+ + NO3-
Since HNO3 dissociates completely in water, we can assume that the concentration of H3O+ in the solution is equal to the initial concentration of HNO3, which is 1.0 x 10^-3 M.
Therefore, [H3O+] = 1.0 x 10^-3 M.
To find the concentration of hydroxide ions, we can use the equation for the ion product constant of water, Kw = [H3O+][OH-], which is equal to 1.0 x 10^-14 at 25°C.
Rearranging this equation to solve for [OH-], we get:
[OH-] = Kw/[H3O+]
Substituting the values, we get:
[OH-] = 1.0 x 10^-14 / 1.0 x 10^-3
[OH-] = 1.0 x 10^-11 M
Therefore, the concentration of hydroxide ions in a 1.0 x 10^-3 M solution of HNO3 is 1.0 x 10^-11 M.
Learn more about hydronium and hydroxide ion concentration from
https://brainly.com/question/15879446
#SPJ1
if ka is 1.85 x 10^-5 for acetic acid, calculate the ph at one half the equivalnce point and at the quivalence point for a tiration of 50 ml of 0.1 m acetic acid with 0.1 m naoh
The value of Ka for acetic acid is 1.85 × 10-5.
The given solution is titrated using a 0.1 M solution of NaOH. 50 mL of 0.1 M acetic acid is titrated by 0.1 M NaOH.
We can use the Henderson-Hasselbalch equation to calculate the pH at any point in the titration of a weak acid with a strong base.
PH of acetic acid solution
= -log[H3O+]Ka = [H3O+][CH3COO-]/[CH3COOH]pKa = -logKa
At the half-equivalence point
Half equivalence point
(pKa - pH = 0.5)PH = pKa + log([A-]/[HA])pH = pKa + log(1)
because
[A-] = [HA]pH = pKa + 0.5pH = 4.74 + 0.5pH = 5.24
At the equivalence point
The number of moles of NaOH is equal to the number of moles of acetic acid
50 mL of 0.1 M acetic acid contains 0.005 moles of acetic acid.NaOH is added to the solution until the number of moles of NaOH is equal to the number of moles of acetic acid.
0.005 moles of NaOH is equal to 0.005 moles of acetic acid.
Then,
[CH3COOH] = 0.005/0.05 = 0.1 M[OH-] = 0.1 M and the pH of the solution is 14 - pOH = 13pOH = -log([OH-]) = -log(0.1) = 1pH + pOH = 14pH = 14 - pOH = 13
learn more about PH here
https://brainly.com/question/172153
#SPJ11
if the temperature is raised by 100 k , does the equilibrium constant for this reaction increase or decrease?
The equilibrium constant increases. For an endothermic reaction, heat is a reactant. An increase in temperature and heat favors the forward reaction, and the value of Kc increases.
The equilibrium constant, Kc, is a measure of the extent to which a reaction will proceed at a given temperature. For an endothermic reaction, heat is a reactant and an increase in temperature will favor the forward reaction. This means that the value of Kc will increase as the temperature is raised.
Conversely, for an exothermic reaction, heat is a product and an increase in temperature will favor the reverse reaction. This means that the value of Kc will decrease as the temperature is raised.
The complete question is as follows:
Fill in the blanks: if the temperature is raised by 100 k, does the equilibrium constant for this reaction increase or decrease?
The equilibrium constant _____________. For an_________ reaction heat is a reactant. An increase in temperature and heat favors the __________ and the value of Kc _____________
learn about the equilibrium constant
https://brainly.com/question/3159758
#SPJ11
In a hydrogen atom, a transition from the 2nd to the 1st excited state will produce
A) a dark absorption line.
B) the bright red Balmer alpha emission line.
C) no emission line.
D) three different emission lines.
E) an ultraviolet spectral line.
The correct answer is B) the bright red Balmer alpha emission line.Each transition produces a specific wavelength of light, resulting in different spectral lines. In this particular transition, only one emission line is produced, corresponding to the Balmer alpha line in the red part of the spectrum.
When an electron in a hydrogen atom transitions from a higher energy level to a lower energy level, it releases energy in the form of light. This emitted light corresponds to a specific wavelength or color, creating spectral lines. The Balmer series specifically refers to the spectral lines produced when an electron transitions from higher energy levels (n > 2) to the second energy level (n = 2).
In this case, the transition is from the 2nd (n = 2) to the 1st (n = 1) excited state. This transition is known as the Balmer alpha transition. It results in the emission of light with a specific wavelength corresponding to the red color in the visible spectrum. Hence, the answer is B) the bright red Balmer alpha emission line.
The emission lines observed in hydrogen's atomic spectrum have been extensively studied and categorized based on the different energy level transitions. Each transition produces a specific wavelength of light, resulting in different spectral lines. In this particular transition, only one emission line is produced, corresponding to the Balmer alpha line in the red part of the spectrum.
To know more about alpha , visit:
brainly.com/question/275306
#SPJ11
Distinguish between the terms solute, solvent and solution?
the solute is dissolved in the solvent.
the solvent is able to dissolve other substances.
a solution is a special type of homogeneous mixture composed of two or more substances, meaning that its composition is identical in every sample.
hope i helped, good luck!
A chemist wants to make 750mL of a 6M NaOH solution. What mass (in grams) of NaOH will they need?
Answer:
180 g NaOH
Explanation:
Step #1 : Use the molarity equation to find moles. The volume is needed in liters, so convert the milliliters to liters.
Molarity (M) = moles (mol) / liters (L) ---->
Molarity (M) x liters (L) = moles (mol)
750 mL NaOH 1 L
x ---------------- = 0.75 L NaOH
1,000 mL
(6 M NaOH) x (0.75 L NaOH) = ? mol
= 4.5 mol NaOH
Step #2 : Find the mass using the moles and the molar mass of the solution. The molar mass can be calculated using the values of the elements on the periodic table.
Molar Mass (g/mol) = grams (g) / moles (mol) --->
Molar Mass (g/mol) x moles (mol) = grams (g)
? g/mol = (22.99 g/mol Na) + (15.999 g/mol O) + (1.008 g/mol H)
? g/mol = 39.997 g/mol NaOH
(39.997 g/mol NaOH) x (4.5 mol NaOH) = ? g
= 179.99 g NaOH
= 180 g NaOH (2 sig figs)
= 200 g NaOH (1 sig fig)
Why is it preferable to use Am in smoke detector?
Low stable and highly reactive
High stability over long time and source need not be replaced
High penetration and high ionization
A good source of beta radiation and has a half-life of 432 years
Answer:
Ionization smoke detectors use americium as a source of alpha particles. Alpha particles from the americium source ionize air molecules. This makes some particles positively charged and some negatively charged. ... Because of this shielding, the smoke detector poses no radiation health risk when they are properly handled.
Explanation:
Hope this helped! :D
it requires 2.10 moles of ammonia in a particular chemical reaction. what volume of ammonia would these be if measured at 760 mmHg and 0.00 c
The volume of ammonia would be 6.27 L.
The Ideal gas law is the equation of state of a hypothetical ideal gas. It is a good approximation to the behaviour of many gases under many conditions, although it has several limitations. The ideal gas equation can be written as
PV = nRT
where,
P = Pressure
V = Volume
T = Temperature
n = number of moles
Given,
moles of ammonia = 2.10 moles
Pressure = 760 mm Hg
Temperature = 273K
PV = nRT
760 × V = 2.1 × 8.314 × 273
V = 6.27 L
Learn more about Ideal Gas law, here:
https://brainly.com/question/28257995
#SPJ1