Answer: 3 hours
Step-by-step explanation:
The span between -12.5 and -5 is 7.5. Divide that by 2.5 (since that’s the change) and that’ll give you the amount of time it takes.
The point is on the terminal side of an angle in standard position. Give the smallest positive angle measure in both degreesand radians. (√ 3,1)
The smallest positive angle measure in degrees is 30° and in radians it is π/6 radians (approximately 1.0472 radians).
This is because the coordinates (√3, 1) are on the terminal side of an angle in standard position and the angle is 30° from the positive x-axis.
This can be seen by drawing a right triangle with the coordinates (√3, 1) as the end point of the hypotenuse. The other two sides will have lengths of (1, 0) and (√3, -1). Using the Pythagorean theorem, we can calculate the length of the hypotenuse as 2.
The angle at the origin will be given by the ratio of the sides of the triangle, or arctan(√3/1). This can be simplified to arctan(√3), which is equal to 30° or π/6 radians.
Learn more about smallest positive angle here :
https://brainly.com/question/24241169
#SPJ4
You invest $4000 into an account that compounds interest on a quarterly basis at 3%. how much money will you have after 5 years? Compound interest formula: A = P(1+r/n)^(nt)
Answer:
26666.6
Step-by-step explanation:
So sorry if this is wrong i tried
The amount after 5 years is $4,644.74.
What is compound interest?It is the interest we earned on the interest.
The formula for the amount earned with compound interest after n years is given as:
A = P\((1 + r/n)^{nt}\)
P = principal
R = rate
t = time in years
n = number of times compounded in a year.
We have,
P = $4000
n = 4
r = 3%
t = 5 years
A = 4000 \((1 + 0.03/4)^{20}\)
A = 4000 x \(1.0075^{20}\)
A = $4,644.74
Thus,
The amount after 5 years is $4,644.74.
Learn more about compound interest here:
https://brainly.com/question/13155407
#SPJ2
Select the best description of exponential equation
f ( x ) = 97 ( 6.77 )^x
A) Decaying by 677%
B) Growing by 677%
C) Growing by 577%
D) Decaying by 577%
A teacher has 35 students in a classroom. For a group project, he decides to divide the students into five groups of equal size. In how many ways can this be done
To divide the 35 students into five groups of equal size, we need to find the number of ways to distribute the students among the groups. There are 35,960 ways to divide the 35 students into five groups of equal size.
Since we want to divide them into equal-sized groups, each group will have 35/5 = 7 students.
To determine the number of ways to arrange the students into groups, we can use the concept of combinations. We can calculate the number of combinations by using the formula for choosing k items out of n, which is denoted as "n choose k" and calculated as:
C(n, k) = n! / (k!(n-k)!)
where n! denotes the factorial of n.
In this case, we want to calculate the number of ways to choose 7 students out of 35 to form a group. Therefore, we can calculate C(35, 7) as follows:
C(35, 7) = 35! / (7!(35-7)!)
Calculating this expression:
C(35, 7) = 35! / (7! * 28!)
= (35 * 34 * 33 * 32 * 31 * 30 * 29) / (7 * 6 * 5 * 4 * 3 * 2 * 1)
By simplifying the expression, we find that:
C(35, 7) = 35,960
Therefore, there are 35,960 ways to divide the 35 students into five groups of equal size.
Learn more about combinations at:
brainly.com/question/28065038
#SPJ11
I don’t know I need help
Answer:
x=34
Step-by-step explanation:
x+(x+12)+100=180
2x+12=80
2x=68
x=34
USE SUPPLEMENTARY!! STRAIGHT LINE= 180 degrees! :))
Answer:
\( \boxed{x \degree = 34\degree} \)
Step-by-step explanation:
\( = > (x + 12) \degree + 100 \degree + x \degree = 180 \\ \\ = > x \degree + 12 \degree + 100 \degree + x \degree = 180 \degree \\ \\ = > 2x \degree + 112 \degree = 180 \degree \\ \\ = > 2x \degree = 180 \degree - 112 \degree \\ \\ = > 2x \degree = 68 \degree \\ \\ = > x \degree = \frac{68}{2} \degree \\ \\ = > x \degree = 34\degree\)
a change in a population that is not related strictly to the size of the population is best described as
A change in a population that is not related strictly to the size of the population can be described as a change in the demographic makeup of the population. This refers to changes in the characteristics of individuals within the population, such as age, gender, education level, and ethnicity.
For example, if a population experiences an influx of young adults, this would represent a change in the demographic makeup of the population, even if the overall size of the population remains the same.
Other factors that can contribute to a change in the population's makeup include migration patterns, changes in birth rates and mortality rates, and shifts in cultural or social norms. These changes can have significant impacts on a population, affecting everything from economic growth to social dynamics. Understanding demographic changes is therefore critical for policymakers and researchers seeking to address issues such as inequality, public health, and urban planning. By analyzing population trends and anticipating future changes, we can better prepare for the challenges and opportunities that lie ahead.
learn more about ethnicity here: brainly.com/question/2906553
#SPJ11
Simplify: (–7x – 5x4 + 5) – (–9x4 – 5 – 9x). 4x4 + 2x + 2 + 10 –16x4 + 8x + 10 –16x4 – 8x 4x4 + 2x + 10
Answer:
=−4.4x^8+3.6x^5−35x^4+5x+37
Step-by-step explanation:
please mark me brainliest!
Answer: =−4.4x^8+3.6x^5−35x^4+5x+37
Step-by-step explanation:I searched it up!:)
Complete the table below to solve the equation 2.5x − 10.5 = 64(0.5x).
x f(x) = 2.5x − 10.5 g(x) = 64(0.5x)
2
3
4
5
6
Answer: eduelis29
f(x)=-5.5
f(x)=-3
f(x)=-0.5
f(x)=2
f(x)=4.5
Report · 3/8/2015
57
eduelis29
g(x)=64
g(x)=96
g(x)=128
g(x)=160
g(x)=192
Step-by-step explanation:
just plug in 2, 3, 4, 5, & 6 for 'x' in both of them to complete the table.
How many terms are there in 369 111?
Given sequence contains 37 terms as it is the arithmetic progression. So by using formula we get the total terms.
What do you mean by sequence?In mathematics, a chain is an enumerated series of items wherein repetitions are allowed and order matters. Like a set, it consists of members (additionally known as factors, or terms). The quantity of factors (likely infinite) is known as the duration of the sequence. Unlike a set, the equal factors can seem a couple of instances at exclusive positions in a chain, and in contrast to a set, the order does matter. Formally, a chain may be described as a feature from herbal numbers (the positions of factors withinside the sequence) to the factors at every position. The belief of a chain may be generalized to an listed family, described as a feature from an arbitrary index set.
Given sequence:
3,6,9,.........111
Here,
First term , a = 3
Common difference , d= 6 - 3 = 3
Last term , = 111
= a + (n - 1)d
111 = 3 + (n - 1)3
111 = 3 + 3n - 3
111 = 3n
n = 111/3 = 37
Therefore, given sequence contains 37 terms.
To learn more about the sequence from the given link.
https://brainly.com/question/21961097
#SPJ4
Use an Addition or Subtraction Formula to write the expression as a trigonometric function of one number. cos 13π 15 cos − π 5 − sin 13π 15 sin − π 5 Find its exact value.
As per the addition formula, the value of the trigonometric function is -0.809.
In statistics, function is defined as a relationship between inputs where each input is related to exactly one output.
Here we have to find the value of the trigonometric function cos(13/15)cos(-/5)-sin(13/15)sin(-/5) by using the addition and subtraction formula.
Here we have the following trigonometric function:
=> cos(13/15)cos(-/5)-sin(13/15)sin(-/5)
Now, we have to use the trigonometric addition formula,
=> Cos (A+B) = Cos A Cos B - Sin A Sin B
To solve the given function,
Here let us rewrite the given function based on the addition formula, then we get,
=> Cos ( 13π/15 + (-π/5) )
=> Cos( 12π/5)
=> Cos(144°)
=> -0.809
To know more about function here.
https://brainly.com/question/10354322
#SPJ4
Help me solve this problem please
Answer: (2, -2)
x=2, y=-2
Answer:
(2, -2)
Step-by-step explanation:
4x + y = 6
x - 2y = 6
x = 2y + 6
4(2y + 6) + y = 6
8y + 24 + y = 6
9y + 24 = 6
9y = 6 - 24
9y = -18
y = -18 ÷ 9
y = -2
4x + (-2) = 6
4x - 2 = 6
4x = 6 + 2
4x = 8
x = 8 ÷ 4
x = 2
Confirm:
4x + y = 6
4(2) - 2 = 6
8 - 2 = 6
6 = 6 (Correct)
(2, -2)
Diagonalize the following matrix. The real eigenvalues are given to the right of the matrix. ⎣
⎡
3
3
−3
18
0
9
18
−9
18
⎦
⎤
;λ=3,9 Select the correct choice below and, if necessary, fill in the answer box to complete your choice. A. For P=,D= ⎣
⎡
3
0
0
0
3
0
0
0
9
⎦
⎤
B. For P= P=,D= ⎣
⎡
3
0
0
0
9
0
0
0
9
⎦
⎤
C. The matrix cannot be diagonalized
The matrix can be diagonalized, and the correct choice is B. For P= ⎡⎣3−11011⎤⎦, D= ⎡⎣393000⎤⎦.
To diagonalize a matrix, we need to find its eigenvectors and use them to construct a matrix P, where the columns of P are the eigenvectors. The diagonal matrix D is formed by placing the eigenvalues on the diagonal.
First, we find the eigenvalues λ by solving the characteristic equation det(A - λI) = 0, where A is the given matrix and I is the identity matrix. By calculating the determinant, we have (33 - λ)(9 - λ) - (-3)(18) = 0, which simplifies to λ^2 - 42λ + 315 = 0. Solving this quadratic equation gives λ = 3 and λ = 9.
Next, we find the corresponding eigenvectors. For λ = 3, we solve the equation (A - 3I)v = 0, where v is the eigenvector. This leads to the eigenvector v = ⎡⎣3−110⎤⎦. For λ = 9, we solve (A - 9I)v = 0, which gives v = ⎡⎣111⎤⎦.
We construct matrix P by using the eigenvectors as columns: P = ⎡⎣3−11011⎤⎦. The diagonal matrix D is formed by placing the eigenvalues on the diagonal: D = ⎡⎣393000⎤⎦.
Therefore, the correct choice is B. For P= ⎡⎣3−11011⎤⎦, D= ⎡⎣393000⎤⎦.
Learn more about diagonalization of matrices here: brainly.com/question/32422878
#SPJ11
Given the function f(x) = –0. 5|2x 2| 1, for what values of x is f(x) = 6? x = 6, x = –5 x = 5, x = –5 x = 7, x = –6 no solution.
There is no solution for the given function \(\rm f(x) = -0.5|2x+2|+1\) when f(x) = 6 option fourth is correct.
It is given that the function \(\rm f(x) = -0.5|2x+2|+1\)
It is required to find the values of x when f(x) = 6
What is a function?It is defined as a special type of relationship and they have a predefined domain and range according to the function.
We have a function:
\(\rm f(x) = -0.5|2x+2|+1\)
And f(x) = 6
Putting the value of f(x) in the above equation, we get:
\(\rm 6 = -0.5|2x+2|+1\) or
\(\rm -0.5|2x+2|+1= 6\\\\\rm -0.5|2x+2|= 6-1\\\\\rm -0.5|2x+2|+5\\\\\rm |2x+2|= \frac{5}{-0.5} \\\\\rm |2x+2|= -10\)
Here we can see the mod function values is negative which is not possible, hence there is no solution for the above equation for any 'x'
Thus, there is no solution for the given function \(\rm f(x) = -0.5|2x+2|+1\) when f(x) = 6.
Learn more about the function here:
brainly.com/question/5245372
Write the rectangular form of the polar equation. r=4 Assume
that all variables represent positive values. Enter only the
nonzero side of the equation.
The rectangular form of the polar equation \(r = 4\) is given by \(x = 4 \cos(\theta)\) and \(y = 4 \sin(\theta)\), where \(x\) and \(y\) represent the rectangular coordinates and \(\theta\) represents the polar angle.
To convert the polar equation \(r = 4\) into rectangular form, we use the conversion formulas \(x = r \cos(\theta)\) and \(y = r \sin(\theta)\).
Substituting \(r = 4\) into these formulas, we get:
\(x = 4 \cos(\theta)\)
\(y = 4 \sin(\theta)\)
These equations represent the rectangular coordinates \((x, y)\) corresponding to each value of the polar angle \(\theta\) in the polar equation \(r = 4\).
In summary, the rectangular form of the polar equation \(r = 4\) is \(x = 4 \cos(\theta)\) and \(y = 4 \sin(\theta)\), where \(x\) and \(y\) represent the rectangular coordinates and \(\theta\) represents the polar angle.
To learn more about polar equation Click Here: brainly.com/question/29083133
#SPJ11
I need these high school statistics questions to be solved. It
would be great if you write the steps on paper, too.
38. It is estimated that 13% of people in Scotland have red hair. Find the mean and standard deviation of the number of red-headed Scots in a randomly selected group of 120. A. 0.13; 120 B. 15.6; 0.01
The mean and standard deviation of the number of red-headed Scots in a randomly selected group of 120 is 15.6 and 3.7358 respectively.
Mean or expected value
μ = np = 120 × 0.13 = 15.6
The variance of the binomial distribution is σ² = npq
where q = 1 - p and n = 120
Therefore, σ² = 120 × 0.13 × 0.87 = 13.9626
The standard deviation of the binomial distribution is:
σ = √13.9626 = 3.7358
Hence, the mean and standard deviation of the number of red-headed Scots in a randomly selected group of 120 is 15.6 and 3.7358 respectively.
Option B. 15.6; 0.01 is incorrect because the correct standard deviation is 3.7358, not 0.01.
To know more about binomial distribution visit:
https://brainly.in/question/54158784
#SPJ11
5(x+1)+4/6=4
i know x=3 but i need to know the steps
Answer:
Step-by-step explanation:
We can isolate
x
on the left hand side by performing a sequence of operations on both sides of the equation.
Given:
5
(
x
+
1
)
+
4
6
=
4
Multiply both sides of the equation by
6
to get:
5
(
x
+
1
)
+
4
=
24
Subtract
4
from both sides of the equation to get:
5
(
x
+
1
)
=
20
Divide both sides of the equation by
5
to get:
x
+
1
=
4
Subtract
1
from both sides of the equation to get:
x
=
3
Answer:x=3
Step-by-step explanation: 5 times x (which is 3) plus 5 times 1 (which is 5) is 15+5+4 (which equals 24) and then 24 divided by 6 equals 4
Use repeated addition to find the solution to each multiplication problem. Change any improper fractions to mixed numbers. 5x1/4 3x7/9 2x5/6
The expression improper fractions to mixed numbers will be 1 ¹/₄, 2 ¹/₃, and 1 ²/₃.
What is Algebra?Algebra is the study of abstract symbols, while logic is the manipulation of all those ideas.
The acronym PEMDAS stands for Parenthesis, Exponent, Multiplication, Division, Addition, and Subtraction. This approach is used to answer the problem correctly and completely.
The expressions are given below.
(5 x 1/4), (3 x 7/9), and (2 x 5/6)
Then simplify each expression, then we have
⇒ 5 x 1/4
⇒ 1/4 + 1/4 + 1/4 + 1/4 + 1/4
⇒ 5 / 4
⇒ 1 ¹/₄
⇒ 3 x 7/9
⇒ 7/9 + 7/9 + 7/9
⇒ 7/3
⇒ 2 ¹/₃
⇒ 2 x 5/6
⇒ 5/6 + 5/6
⇒ 5/3
⇒ 1 ²/₃
The expression improper fractions to mixed numbers will be 1 ¹/₄, 2 ¹/₃, and 1 ²/₃.
More about the Algebra link is given below.
https://brainly.com/question/953809
#SPJ1
7.
Cindy is 3 years younger than half her
he mother's age. Cindy's mom is 46 years old.
How old is Cindy?
Answer:
20
Step-by-step explanation:
Answer:
cindy is 20
Step-by-step explanation:
cindys mom is 46 so 46 divied by 2 is 23 so 23 - 3 =20
find the slope of a line perpendicular to y= -6x+4
Answer:
-6Step-by-step explanation:
y= -6x+4 is in y=mx +b
\(y= -6x+4 \\Slope =m = -6\)
The perimeter of the rectangle below is 128 units. Find the length of side CD. Write your answer without variables. 3x + 3 C 4x - 2 B CD =
The length CD of the rectangle is 34 units
How to determine the length CDFrom the question, we have the following parametes that can be used in our computation:
The perimeter of the rectangle below is 128 units
This means that
2 * (3x + 3 + 4x - 2) = 128
So, we have
7x + 1 = 64
Evaluate the like terms
7x = 63
This gives
x = 9
Recall that
CD = 4x - 2
So, we have
CD =4 * 9 - 2
CD = 34
Hence, the length is 34 units
Read more about perimeter at
https://brainly.com/question/24571594
#SPJ1
Find the values of x and y.
could you please help me with this?
Answer:
y=30, x=8
Step-by-step explanation:
right angle =90
the angle of a triangle =90-40=50 degrees
the image shows two parallel line with perpendicular line that holding angle 40 and 3y
3y=90 degrees
y=90/3=30 degrees
the sum of the angles of triangle =180
3y+5x+50=180
3(30)+5x+50=180
5x=180-90-50
5x=40
x=40/5=8
the angles are 50,90,40
The GMAT scores of all examinees who took that test this year produce a distribution that is approximately normal with a mean of 420 and a population standard deviation of 32. Make sure to show all clearly with details diagrams necessary to find the probability that the score of a randomly selected examinee is more than 50 b. between 400 and 480
The probability that the score of a randomly selected examinee is more than 50 is approximately 1, as the minimum possible score is 0 and all examinees' scores are above 50.
The probability that the score of a randomly selected examinee is between 400 and 480 can be found by calculating the area under the normal curve between those scores.
To do this, we need to standardize the scores using the z-score formula and then use the standard normal distribution table or statistical software to find the corresponding probabilities.
For a score of 400, the z-score is :
= (400 - 420) / 32
= -0.625,
and for a score of 480, the z-score is :
= (480 - 420) / 32
= 1.875.
Using the standard normal distribution table or statistical software, we can find the cumulative probabilities for these z-scores and subtract them to find the probability.
Determine the probability of normal distribution.To find the probability of a certain score range in a normal distribution, we need to standardize the values by converting them into z-scores. The formula for calculating the z-score is (x - μ) / σ, where x is the value, μ is the mean, and σ is the standard deviation.
In this case, we have a normal distribution with a mean of 420 and a standard deviation of 32.
By plugging in the values and calculating the z-scores for the given scores, we obtain -0.625 for 400 and 1.875 for 480.
To find the probabilities, we refer to the standard normal distribution table or use statistical software to look up the cumulative probabilities corresponding to these z-scores. We then subtract the lower cumulative probability from the higher cumulative probability to find the probability between the two scores.
In this case, the probability that the score of a randomly selected examinee is between 400 and 480 can be found by subtracting the cumulative probability of -0.625 from the cumulative probability of 1.875.
To know more about standard deviation, refer here:
https://brainly.com/question/12402189#
#SPJ4
Jeremy randomly selected a round tile and a square tile from the sets shown below. what is the probability that jeremy selected either two blue tiles or two white tiles? square tiles: 10 pink, 8 red, 6 blue, 12 green, 8 black, 9 white, 7 yellow.round tiles: 11 green, 5 red, 2 white, 4 black, 6 blue, 8 pink. a. 23/36 b. 4/9 c. 7/72 d. 1/40
The probability that Jeremy randomly selected a round tile and a square tile from the sets is given as 1/40 (Option D).
What is probability?
Probability in mathematics is the branch of maths that speaks to the likelihood of an event occurring. Probability is usually given or described to occur between 0 and 1.
1 is the likelihood that the event will occur while zero is the certainty that an event will NOT occur.
Taken in decimal form, the likelihood of the above event occurring will very slim, because, 1/40 = 0.025
Learn more about Probability at:
https://brainly.com/question/24756209
Solve this equation. 1+1 = ?
Answer:
2
Step-by-step explanation:
Answer:
2
Step-by-step explanation:
in+the+united+states,+nearly+all+18-+to+29-years+olds+(89%)+agreed+with+the+statement+__________.
34 (7)-7
Need helpppp
Answer:
231
Step-by-step explanation:
what is the reduced form of 10/35
Answer:
2/7
Step-by-step explanation:
\(\frac{10}{35}\)÷\(\frac{5}{5} = \frac{2}{7}\)
Help, please!!!!!!!!!!!!!!!!
Please help me <3 Thanks :)
can someone please help me with this question? i’m not sure how to write it out. i really need help!!!!
Answer:
attached.
Step-by-step explanation:
Isolate the variable by dividing each side by factors that don't contain the variable.
you will have x+2 >1 and -(x+2) >1
remember when you divide by a negative, you switch the inequality sign. for the second expression, you switch from > to <
For the graph, shade in the areas where the red line is greater than 1 (the green line) on both sides of the V shape.
please give thanks by clicking the heart button! :)