Malia tried to prove that cos(theta) = sin (90 - theta) using the following diagram. Her proof is not correct

Malia Tried To Prove That Cos(theta) = Sin (90 - Theta) Using The Following Diagram. Her Proof Is Not

Answers

Answer 1

Answer:

B

Makes the most sense for the question and answer

Answer 2

The correct proof of sin(90-theta)=cos theta is given below.

We have given that

Malia tried to prove that cos(theta) = sin (90 - theta)

What is the formula for sin(a-b)?

The formula for sin(a-b) is sin(a)cos(b)-cos(a)sin(b)

\(Sin(90-\theta)=cos\theta\)

\(sin(90-\theta)=sin(90)cos(\theta)-cos(90)sin(\theta)\\We \ know\\ sin(90)=1 and cos(90)=0\\=(1)cos(\theta)-(0)sin(\theta)\\=cos(\theta)\)

Therefore we get sin(90-theta)=cos theta.

To learn more about the trigonometry visit:

https://brainly.com/question/24349828


Related Questions

100 points PLEASE ANSWER ASAP thank you so much

100 points PLEASE ANSWER ASAP thank you so much

Answers

Answer:

X elevated to 21/25

Step-by-step explanation:

Exponent law say you have to multiplied the exponents:

(3/5)*(7/5) =

21/25

The mistake was using sumatory instead multiplication.

Regards

Answer:

\(\large\text{$ x^{\frac{21}{25}} $}\)

Step-by-step explanation:

Given expression:

\(\large \text{$ \left(x^{\frac{3}{5}}\right)^{\frac{7}{5}} $}\)

\(\textsf{Apply exponent rule} \quad (a^b)^c=a^{bc}:\)

\(\implies \large \text{$ x^\left(\frac{3}{5} \times \frac{7}{5}\right) $}\)

\(\implies \large \text{$ x^{\frac{21}{25}} $}\)

How many schools have fewer than 50 classrooms

How many schools have fewer than 50 classrooms

Answers

Answer:

7 schools have fewer than 50 classrooms.

The tables represent the points earned in each game for a season by two football teams.


Panthers
14 10 10
10 17 3
28 13 17
32 16 10
14 7 21
Cowboys
10 3 8
6 24 12
21 3 10
28 28 7
7 13 3

Which team had the best overall record for the season? Determine the best measure of center to compare and explain your answer.
Panthers; they have a larger median value of 14 points
Cowboys; they have a larger median value of 10 points
Panthers; they have a larger mean value of about 14.8 points
Cowboys; they have a larger mean value of about 12.2 points

Answers

Answer:

Therefore, the Panthers had a better overall record for the season, with a total of 212 points earned compared to the Cowboys' total of 173 points.

Step-by-step explanation:

To compare the measures of center, we can calculate the mean and median points earned by each team:

Panthers: Mean = 212/15 = 14.13 points, Median = 14 points

Cowboys: Mean = 173/15 = 11.53 points, Median = 10 points

Based on these calculations, we can see that the Panthers have a larger mean value of about 14.13 points compared to the Cowboys' mean value of about 11.53 points. However, the median value for both teams is less useful for comparison since they are only one point apart. Therefore, we can conclude that the Panthers had the better overall record for the season based on both the total points earned and their larger mean value.

So, the answer is Panthers; they have a larger mean value of about 14.8 points (Option C is incorrect as the mean value of Panthers is approximately 14.13 and not 14.8).

Solve each proportion. 9/8 = x/7

Answers

Answer:

x=63/8

Step-by-step explanation:

9/8=x/7

or, 9*7=x*8

or, 63=8x

x=63/8

157 29 Marks
Put these fractions in order of size, smallest to largest
7
10
2
3
4
5
11
15
smallest

Answers

Complete question :

Put these fraction in order of size smallest to largest : 7/10, 2/3, 4/5, 11/15

Answer:

2/3, 7/10, 11/ 15, 4 /5

Step-by-step explanation:

In other to make solving the question easier, we can convert the fractions to decimal in other to make comparison easier :

7/10 = 0.7

2/3 = 0.667

4 /5 = 0.8

11 /15 = 0.733

Using the placement or how the numbers will appear to the right of a number line ;

0.667, 0.7, 0.733, 0.8

Thus we have :

2/3, 7/10, 11/ 15, 4 /5

A spinner has 10 sections numbered 1 to 10. Consider the events in the table.

Event A
Spin an odd number

Event B Spin a number greater than 5
Event C
Spin a 4

Event D Spin a multiple of 2
Which pairs of events are disjoint and cannot occur at the same time?

Select all that apply.

Events A and B

Events B and C

Events C and D

Events A and C

Events A and D

Answers

The pairs of events that are disjoint and cannot occur at the same time are:

Events A and CEvents A and D

What are disjoint events?

Two events are mutually exclusive or disjoint in logic and probability theory if they cannot both occur at the same time.

For example, the results of a single coin flip, which can result in either heads or tails but not both is a disjoint event since both head and tail cannot appear.

Considering the events given:

Event A: Spin an odd number

Event B: Spin a number greater than 5

Event C: Spin a 4

Event D: Spin a multiple of 2

Event A and Event C are disjoint because one cannot spin an odd number and a 4 since it is an even number.

Event A and Event D are disjoint because one cannot spin an odd number and a multople of 2 since it will an even number.

Learn more about disjoint events at: https://brainly.com/question/28777946

#SPJ1

If a binary logistic regression has a pseudo R-Square (L) of 60%, then a) the model is better than another logistic regression with a R-square (CS) of 50%. b) 60% of the variation in the data can be explained by the logistic regression c) Other types of pseudo R-squares may be greater or less than 60% with the same logistic regression model. d) the model is better than another multiple linear regression model with an R- square of 55%.

Answers

The correct answer is c) Other types of pseudo R-squares may be greater or less than 60% with the same logistic regression model.

Pseudo R-squares, such as the one used in logistic regression, are measures of how well the model fits the data, but they cannot be directly compared to R-squared values from other types of regression models. Therefore, we cannot conclude that the logistic regression model with a pseudo R-Square of 60% is better than another logistic regression with an R-square (CS) of 50% or a multiple linear regression model with an R-square of 55%. However, we can say that 60% of the variation in the data can be explained by the logistic regression model, based on its pseudo R-Square value.

Learn more about logistic regression model here:

https://brainly.com/question/30439764

#SPJ11

Problem 14.f(2)(a) Determine the equations of the perpendicular bisectors througheach side of the triangle.C(4,6)B(7,3)A(2,2)I

Answers

The product of the slopes of the perpendicular lines is -1, which means if the slope of one of them is m, then the slope of the perpendicular line is -1/m

In triangle ABC

The perpendicular bisector of the side BC is drawn from the opposite vertex A

Then to find it find the slope of BC and reciprocal it and change its sign to get its slope and find the midpoint of BC to use it in the equation of the perpendicular bisector

Since B = (7, 3) and C = (4, 6)

Let us find the slope of BC, using the rule of the slope

\(m=\frac{y2-y1}{x2-x1}\)

Let (x1, y1) = (7, 3) and (x2, y2) = (4, 6)

\(\begin{gathered} m_{BC}=\frac{6-3}{4-7} \\ m_{BC}=\frac{3}{-3} \\ m_{BC}=-1 \end{gathered}\)

Now to find the slope of the perpendicular line to BC reciprocal it and change its sign

Since the reciprocal of 1 is 1 and the opposite of negative is positive, then

Then the slope of the perpendicular line is 1

Now, let us find the mid-point of BC

The rule of the midpoint is

\(M=(\frac{x1+x2}{2},\frac{y1+y2}{2})\)

Then the mid-point of BC is

\(\begin{gathered} M_{BC}=(\frac{7+4}{2},\frac{3+6}{2}) \\ M_{BC}=(\frac{11}{2},\frac{9}{2}) \\ M_{BC}=(5.5,4.5) \end{gathered}\)

Now we can form the equation of the perpendicular bisector of BC using its slope 1 and the point (5.5, 4.5)

The form of the equation using a point and a slope is

\(y-y1=m(x-x1)\)

m is the slope and (x1, y1) is a point on the line

Since m = 1 and (x1, y1) = (5.5, 4.5), then

\(\begin{gathered} m=1,x1=5.5,y1=4.5 \\ y-4.5=1(x-5.5) \\ y-4.5=x-5.5 \end{gathered}\)

Add 4.5 to both sides

\(\begin{gathered} y-4.5+4.5=x-5.5+4.5 \\ y=x-1 \end{gathered}\)

The equation of the perpendicular bisector of BC is

\(y=x-1\)

We will do the same to AB and AC

Which statement about the location of √7 on the number line is true?
A= It is located at the number 7 on the number line.
B= It is located at the number 3.5 on the number line.
C= It is located between the numbers 2 and 3 on the number line.
D=It is located between the numbers 4 and 9 on the number line

Answers

Answer is C) it is located between the numbers 2 and 3 on the number line

Explanation

The square root of a number is “what number times itself”

2 x 2 = 4

3 x 3 = 9

7 is between 4 and 9 so C is the correct answer

Dividing the sum of (7/8) (15/4) (1/12) by their multiplication gives _________

Answers

The Division of the sum of (7/8), (15/4), and (1/12) by their multiplication is (2712/168).

To find the division of the sum of (7/8), (15/4), and (1/12) by their multiplication, we first need to calculate the sum and multiplication of the given fractions.

The sum of the fractions is:

(7/8) + (15/4) + (1/12)

To add these fractions, we need a common denominator. The least common multiple of 8, 4, and 12 is 24. Let's convert each fraction to have a denominator of 24:

(7/8) = (21/24)

(15/4) = (90/24)

(1/12) = (2/24)

Now we can add the fractions:

(21/24) + (90/24) + (2/24) = (113/24)

The multiplication of the fractions is:

(7/8) * (15/4) * (1/12)

To multiply fractions, we multiply the numerators and denominators:

(7*15*1) / (8*4*12) = (7/96)

Now we can divide the sum of the fractions by their multiplication:

(113/24) / (7/96)

To divide fractions, we multiply the first fraction by the reciprocal of the second fraction:

(113/24) * (96/7) = (2712/168)

Therefore, the division of the sum of (7/8), (15/4), and (1/12) by their multiplication is (2712/168).

For more questions on Division .

https://brainly.com/question/30340100

#SPJ8

After graduating from college, Trevor gets a job at a software company with a starting salary of 50,000 dollars and is given a 10% raise every year. After 10 years, what will his total earnings have been at the company? (Round to the nearest dollar)

Answers

Answer:

796871

Step-by-step explanation:

Based on the given conditions, formulate:

5000 x (1 - (1 + 10%) 10)

-------------------------------                                                                  

           1 - (1 + 10%)                                                                          

Evaluate the equation/expression:

796871.23005

Find the closest integer to

798871.23005

=  796871

The volume of a tree stump can be modeled by considering it as a right cylinder. Lauren measures it’s height as 0.7ft and it’s radius as 20in find the volume of the stump in cubic inches. Round your answer to the nearest tenth if necessary

Answers

The volume of the tree stump is approximately 1005.3 cubic inches when rounded to the nearest tenth.

To calculate the volume of the tree stump, we can use the formula for the volume of a cylinder, which is given by:

Volume = π * r^2 * h

Given:

Radius (r) = 20 inches

Height (h) = 0.7 feet

First, let's convert the height from feet to inches since the radius is already in inches. There are 12 inches in 1 foot, so:

Height (h) = 0.7 feet * 12 inches/foot = 8.4 inches

Now, we can substitute the values into the volume formula:

Volume = π * (20 inches)^2 * 8.4 inches

Calculating the volume:

Volume = 3.14159 * (20 inches)^2 * 8.4 inches

≈ 3.14159 * 400 inches^2 * 8.4 inches

≈ 1005.3096 cubic inches

Rounding the volume to the nearest tenth:

Volume ≈ 1005.3 cubic inches

Therefore, the volume of the tree stump is approximately 1005.3 cubic inches when rounded to the nearest tenth.

for such more question on volume

https://brainly.com/question/6204273

#SPJ8

Complete the statement for triangle HJK with medians (HN), (JL), and (KM), and centroid P. PN = ____ HN *
1 point
1/2
2
1/3
2/3

Answers

Answer:

Step-by-step explanation:

PN = \(\frac{1}{3}\) HN

please I need help with this​

please I need help with this

Answers

A. The following are sets A and B:

A = {2, 3, 5, 7, 11}

B = {1, 2, 3, 4, 6, 12}

C. Elements not in A or A' = ∅

B. The Venn diagram is attached

How to solve sets?

A universal set is a set which consists of all elements related to the given sets. It is denoted by U.

A. Set A:

A = {2, 3, 5, 7, 11}

Set B:

B = {1, 2, 3, 4, 6, 12}

U = {1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12}

A' = {1, 4, 6, 8, 9, 10, 12}

C. Elements not in A or A' = ∅

Complement of set A is refers to a set that contains the elements present in the universal set but not in set A.

Hence, the Venn diagram of sets A, B and U has been attached.

Read more on set theory:

https://brainly.com/question/13458417

#SPJ1

please I need help with this

Let v=-9i+j and w=-i-6j find 8v-6w

Let v=-9i+j and w=-i-6j find 8v-6w

Answers

Answer:

78i+52j

Step-by-step explanation:

8(9i+2j)-6(-i-6j)

72i+16j+6i+36j

=78i+52j


PLEASE HELP !! ILL GIVE BRAINLIEST *EXTRA 40 POINTS* DONT SKIP :(( .!

PLEASE HELP !! ILL GIVE BRAINLIEST *EXTRA 40 POINTS* DONT SKIP :(( .!

Answers

Answer:

DCA and EFH

Step-by-step explanation:

Answer D is cut off but if you come to a different conclusion you can always use process of elimination

Answer D is cut off but if you come to a different conclusion you can always use process of elimination

Answers

The total monthly payments is  $2169.49

What is mortgage payment?

You should understand that a mortgage is a home loan that is secured by the property the borrower finances with the loan funds.

The mortgage payment is

 A = (210,000·0.95)(0.045/12)/(1 -(1 +0.045/12)^(-12·15)) ≈ 1526.16

The monthly set-aside for taxes is

 3.5%*200,000/12 = 583.33

The monthly set-aside for insurance is

 720/12 = 60

So the total of P&I + taxes + insurance will be

In conclusion, the monthly payment is given by :

 $1526.16 +583.33 +60.00 = $2169.49

Learn more about mortgage on https://brainly.com/question/15074748

#SPJ1

√2x² + 7x + 5√2 = 0
find the roots of the following quadratic equation by factorization method



PLS HELP ME FAST

Answers

Step-by-step explanation:

√2x² + 7x +√2=0

2x + 7x + √ 2 =0

√2=9x

x = o.15713484

The measures of the angles of a triangle are in the extended ratio 4:5:6. Find the measure of the largest angle in the
triangle.

A 60°
B. 72°
C. 120°
D. 132°

Answers

Answer: B) 72°

Step-by-Step Explanation:

We know, the Angles of a Triangle sum up to 180 degrees (A.S.P)

Ratio of Angles = 4 : 5 : 6

Therefore, framing the Equation :-
=> 4x + 5x + 6x = 180

Therefore,
4x + 5x + 6x = 180
9x + 6x = 180
15x = 180
x = 180/15
=> x = 12

Finding each Angle :-

4x = 4 * 12 = 48°
5x = 5 * 12 = 60°
6x = 6 * 12 = 72°

Therefore, the largest angle is 72°

Find the solution set of the inequality
\qquad8x - 8 \leq -72.8x−8≤−72.

Find the solution set of the inequality\qquad8x - 8 \leq -72.8x872.

Answers

Step-by-step explanation:

- 8 is the ans .hope this help you. mark me as brainliest

Find the solution set of the inequality\qquad8x - 8 \leq -72.8x872.
answer is -8 hope this helps

Equivalent expressions of z+(z+6)

Answers

Answer:

2z+6 or 2(z+3) are the equivalent expressions

Step-by-step explanation:

z+(z+6)

opening the brackets

z+z+6

=2z+6

or if we take 2 as common the answer is

=2(z+3)

i hope this will help you :)

Answer:

Given that the expression is z+(z+6)

The equivalent expression to the give expression

From the given expression z+ (z+6)

z+ (z+6)

=z+z+6

Adding the like terms

=2z+6

Taking the common term 2 outside of the above expression

=2(z+3)

Therefore z+ (z+6)  =2(z+3)

Therefore the other given optional expressions are not equivalent to the given expression.

The option 2(z+3) is correct and it is the equivalent expression.

Hence the given expression z+ (z+6)  is equivalent to the expression 2(z+3)

Daniel’s tennis team made $582.85 from running the concession stand at a basketball game. The food and drinks cost the team $64. What expression would model the amount of money each player would receive if the money is divided equally?


How much would each player receive if there are 8 players on the tennis team?

Answers

Answer:

$518.85/x

Step-by-step explanation:

$582.85 - $64 = $518.85

$518.85/x = How much each player would get

Answer:

1. (582.85-64)/p

2. 64.85

Step-by-step explanation:

i did the assignment and got it correct.

hope this helps!

HELPP


You want to enclose a rectangular region with an area of
1200 square feet and a length of 40 feet, 50 feet, or 60 feet.
Find the perimeter for each possible region. Explain why
you might rewrite the area formula to find the solutions.

Answers

The possible perimeters are 140 feet, 148 feet and 160 feet.

In order to determine the width that would be used to determine the possible perimeters, the formula for the area would have to be rewritten.

What are the possible perimeters?

A rectangle is a 2-dimensional quadrilateral with four right angles and two diagonals that bisect each other at right angles.

Area of a rectangle = length x width

Width = area / length

1200 / 40 = 30 feet

1200 / 50 = 24 feet

1200 / 60 = 20 feet

Perimeter of a rectangle = 2 x (length + width)

Perimeter when width is 30 feet : 2(40 + 30) = 140 feet

Perimeter when width is 24 feet : 2(24 + 50) = 148 feet

Perimeter when width is 20 feet : 2 (20 + 60) = 160 feet

To learn more about the perimeter of a rectangle, please check: https://brainly.com/question/3205029

#SPJ1

To evaluate whether customers enjoy the barista’s new smoothie, a restaurant manager surveys every other customer who orders the new smoothie. The manager determines that customers enjoy the new smoothie. Select all the statements that are true about the sampling method.

Answers

The sampling method used by the restaurant manager allows for efficient data collection and a representative sample, it may introduce bias and lacks randomization.

Based on the information provided, we can identify the following statements that are true about the sampling method used by the restaurant manager to evaluate customer satisfaction with the new smoothie:

1. The manager uses systematic sampling: The manager surveys every other customer who orders the new smoothie. This systematic approach involves selecting every second customer, providing a consistent and organized sampling method.

2. The sample is representative: By surveying every other customer who orders the new smoothie, the manager ensures that the sample includes a variety of customers, reflecting the customer population as a whole.

3. The sample size may be smaller than the total customer base: Since the manager surveys every other customer, the sample size may be smaller compared to surveying every customer. This allows for efficient data collection and analysis.

4.The sampling method may introduce bias: The manager may inadvertently introduce bias by only surveying every other customer. Customers who are skipped in the survey may have different preferences or opinions, leading to a potential bias in the results.

5. The sampling method lacks randomization: Randomization is not employed in this sampling method, as the manager systematically selects customers. This could potentially introduce bias or exclude certain types of customers from the sample.

for more such questions on sampling method

https://brainly.com/question/13219833

#SPJ8

Help me with this question no explanation needed or just give it to me

Answers

Answer:

Step-by-step explanation:

No explanation is needed because there is no question.

Answer:

you got it

Step-by-step explanation:

no explanation needed

Summarizing allows you to focus on the important information by finding the introduction, topic sentence and
conclusion.
Please select the best answer from the choices provided
True or false

Answers

True. Summarizing allows you to focus on the important information by finding the introduction, topic sentence and conclusion.

Importance of summary

Summarizing is a technique that helps to distill the main points of a text by identifying the introduction, topic sentence, and conclusion. It involves condensing the information to focus on the most important aspects and omitting unnecessary details.

This process enables the reader to grasp the core message of the text quickly and efficiently.

By summarizing, one can communicate the key ideas in a concise and clear manner, making it easier for others to understand and engage with the information presented.

More on summary can be found here: https://brainly.com/question/24839707

#SPJ1

What is the difference?
-3 2/3 - (-2 1/4)

What is the difference? -3 2/3 - (-2 1/4)

Answers

let's firstly convert the mixed fractions to improper fractions.

\(\stackrel{mixed}{3\frac{2}{3}}\implies \cfrac{3\cdot 3+2}{3}\implies \stackrel{improper}{\cfrac{11}{3}}~\hfill \stackrel{mixed}{2\frac{1}{4}} \implies \cfrac{2\cdot 4+1}{4} \implies \stackrel{improper}{\cfrac{9}{4}} \\\\[-0.35em] ~\dotfill\\\\ -\cfrac{11}{3}-\left( \cfrac{9}{4} \right)\implies -\cfrac{11}{3}+\cfrac{9}{4}\implies \cfrac{-(4)11~~ + ~~(3)9}{\underset{\textit{using this LCD}}{12}} \\\\\\ \cfrac{-44+27}{12}\implies \cfrac{-17}{12}\implies {\Large \begin{array}{llll} -1\frac{5}{12} \end{array}}\)


Please help!!
One thousand people stood in a very large circle. Each person wore a sign on their back
with a numeral from 1 to 1000, in a clockwise sequence. They began counting off. The
first person, person A, said "one-in," and remained in the circle. Person B, the person to
the left of A, said "two-out," and left the circle. The person to the left of B, person C, said
"three-in," and remained in the circle. The person to the left, person D, said "four-out,"
and stepped out of the circle.
So it continued with each person wearing an odd number saying "in," and remaining in
the circle, and with every person wearing an even numeral leaving the circle.
It was easy to visualize who remained in the circle when the count off made it all the way
around back to the first person. Since the last person said "one thousand-out," person A,
the first person, said "one-in," and stayed in, while person C, now the next person, said
"three-out," and left the circle. This process would keep going on and on until only one
person was left in the circle.

Who was the last person standing?

Answers

The person who gets to say the last number, 1000, will be Person 6.

Here, we have,

In this scenario, we have seven people sitting in a circle and counting clockwise. The goal is to determine which person will say the last number when they reach 1000. To solve this problem, we can use the concept of modular arithmetic.

When dividing 1000 by the total number of people (7), we get a quotient of 142 and a remainder of 6 (1000 = 142*7 + 6). This means that after completing 142 full rounds of counting, the group will have reached the number 994 (142*7). In the next round, they will continue counting from 995 to 1000.

Since the remainder is 6, it indicates that the last number (1000) will be spoken by the person sitting 6 positions after the first person in the circle (clockwise). In other words, Person 1 says numbers 1, 8, 15, and so on, while Person 6 will say 6, 13, 20, and so on.

To learn more about modular arithmetic click here

brainly.com/question/29022762

#SPJ1

complete question:

10) Seven people sit in a circle and begin counting clockwise starting from 1.Each person in the group is keeping track of the numbers she is saying (e.g. 1,8, 15...) If they continue in this way, counting on and on, until they reach 1000, which person will get to say the last number

The expression's 30^2-150x-60 and (5x-20)(6x+3) define the same function, f.

a. Which expression make it easier to find f(0)? Explain your reasoning

b.find f(0)​

Answers

Answer:

\(30x^{2} -105x+60\)

Step-by-step explanation:

I just solved it.

(5x-20)(6x+3)

5x•6x=30x^2

5x•3=15x

-20•6x=-120x

-20•3=-60

Pls give Brainliest.

What will it cost to carpet a rectangular floor measuring 21 feet by 9 feet if the carpet costs $31. 29 per square yard?

Answers

Answer:

$657.09

Step-by-step explanation:

The area of the carpet is:

21 × 9 = 189 Square foot

189 foot² = 21 yard²

We know 1 yard² = $31.29

So 21 yard² = 21 × $31.29 = $657.09

Other Questions
What is direct characterization? a character who serves only to help develop other characters a character with a complex and realistic personality a character with a very simple or two-dimensional personality a character whose actions advance the plot a character who doesn't change during the story hurry plz Made use of the whole time scale is 6.565656... a rational number? How did the demand for tobacco lead to more English settlers coming to North America? Write an equation of the line in slope interceptform given: m = -3/5 and b = -3 A line with a slope of -2 passes through the point (3-1). Which of the following is the equation of the line? (1) y=3x-2 (3) y=-2x + 5 (2) y = -4x-2 (4) y=-2x+1 An elevator has a placard stating that the maximum capacity is 1570 lb-10 passengers. So, 10 adult male passengers can have a mean weight of up to 1570/10=157 pounds. If the elevator is loaded with 10 adult male passengers, find the probability that it is overloaded because they have a mean weight greater than 157 lb. (Assume that weights of males are normally distributed with a mean of 162 lb and a standard deviation of 27 lb.) Does this elevator appear to be safe? GITTE re: The probability the elevator is overloaded is. (Round to four decimal places as needed.) Does this elevator appear to be safe? re: 9 OA. No, there is a good chance that 10 randomly selected adult male passengers will exceed the elevator capacity. B. Yes, 10 randomly selected adult male passengers will always be under the weight limit. ore: 21 OC. No, 10 randomly selected people will never be under the weight limit. D. Yes, there is a good chance that 10 randomly selected people will not exceed the elevator capacity. I NEED HELP PLEASE !!! the painting shown can be attributed to the master of calamarca (la paz school) because of its representation of Jake knows that studying for a test is absolutely essential. Which term could Jake use to describe the need to study?forerunnervitalevidentmused The number of bacteria N in a culture after t days can be modeled by the function N(t) = 1,300 (2)t/4. Find the number of bacteria present after 17 days. (Round your answer up to the next integer.) Any description of the goods which is made part of the basis of the bargain creates an express warranty that the goods shall conform to the description.TrueFalse True or false a common interpretation for a non-visit in person or entity quarry can have a fully meets rating In the research context, the term validity most commonly refers to: Whether operationalized terms actually measure what they purport to measure. the teacher prepares 2.50 liters (l) of a salt solution for a class experiment. how many quarts (qt) are in 2.50 l? (1 l Suppose a solution is prepared by adding 31. 04 g of ethylene glycol in 750 g of h20 at 25. 0 celsius calculate vapor pressure /mole fraction of solute /mole fraction of solvent/ and The SnowCity Mall is trying to decide whether to build an indoor skating rink which would cost $500,000 and last for only one season. Operating costs would be zero. Yearly passes would be sold to anyone who wanted to use the rink. Market research reveals that the demand function for passes can be represented by: P = 1500 - 1.5Q, where P is the price of the pass in dollars. The Mall management has asked you to advise them on building the rink and determining what value should be set at. a. If SnowCity's rink is the only choice for skating enthusiasts in town, derive what price should be set for each seasonal pass. Also calculate the number of passes sold at this price. b. Given the price you derived in part (a), would you recommend to the SnowCity Mall's management that they should build the rink? Explain the justification for your recommendation. Intensity during a cardiovascular endurance workout means.. A. How often the activity is performedB. How long the activity is performed C. How hard the activity is performed D. Where the activity is performed Western Company is preparing a cash budget for June. The company has $11,800 cash at the beginning of June and anticipates $30,200 in cash receipts and $34,900 in cash disbursements during June. Western Company has an agreement with its bank to maintain a minimum cash balance of $10,000. As of May 31, the company owes $15,000 to the bank. To maintain the $10,000 required balance, during June the company must: Multiple Choice Borrow $2,900. Repay $2,900. Borrow $10,000. Repay $7,100. Borrow $4,700. "love what you do" and do what you love, what does that mean