Answer:
Explanation:
transfer of warmth by development of huge volumes of liquids ... One finish of a copper bar is set in a fire of a Bunsen burner. Little bits of wax put along the pole soften at continuously bigger separation from the fire. ... Warm air over the sea shore rises while cooler thick air from the sea surges in due to.
What are some ways we can measure how much energy a substance has?
The sum of all an object's atoms and molecules' energies makes up the substance's total energy.
What is a substance's total amount of energy?The sum of all an object's atoms and molecules' energies makes up the substance's total energy. Both the potential energy resulting from the interactions between molecules and the kinetic energy of the particles resulting from the motions of molecules within the material and of atoms inside molecules make up thermal energy.The equation q = m c T , where m is the mass of the sample, c is the specific heat, and T is the temperature change, may be used to determine how much heat is acquired or lost by a sample (q).
To learn more about energy refer to:
https://brainly.com/question/13881533
#SPJ1
which alkyl halide would proceed with the faster rate of sn2 reaction?
The primary alkyl halide would proceed with the faster rate of Sn2 reaction.
The rate of Sn2 reaction depends on the nucleophilicity and steric hindrance of the nucleophile, as well as the steric hindrance of the alkyl halide. The less the steric hindrance around the halogen atom, the faster the Sn2 reaction will be. Thus, primary alkyl halides will react faster than secondary and tertiary alkyl halides
The reaction rate in Sn2 reaction is mainly influenced by the steric hindrance of the alkyl halide and the nucleophilicity of the nucleophile. The greater the steric hindrance, the slower the Sn2 reaction will be as the reaction will encounter a larger energy barrier before proceeding. On the other hand, the greater the nucleophilicity, the faster the reaction will be, as a result of the nucleophile's strength in attacking the carbon atom bearing the leaving group.
A primary alkyl halide is the simplest form of an alkyl halide and possesses the least amount of steric hindrance. Because of this, the Sn2 reaction rate will be faster in primary alkyl halides than in secondary and tertiary alkyl halides.
Learn more about primary alkyl halide: https://brainly.com/question/17063582
#SPJ11
tests show that the hydrogen ion concentration of a sample of apple juice is 0.0003 and that of ammonia is . find the ph of each liquid using the formula , where is the hydronium ion concentration.
The pH of the apple juice is approximately 3.52.
The pH of ammonia is approximately 11.13.
The pH of the apple juice can be calculated using the formula pH = -log[H₃O⁺], where [H₃O⁺] is the hydronium ion concentration. Given that the hydrogen ion concentration of the apple juice is 0.0003, the hydronium ion concentration can be calculated as follows:
[H₃O⁺] = 10^(-pH)
0.0003 = 10^(-pH)
-pH = ㏒(0.0003)
pH = -㏒(0.0003)
pH = 3.52
As a result, the pH of apple juice is roughly 3.52.
Similarly, the pH of ammonia can be calculated using the same formula. However, we are given the hydrogen ion concentration for ammonia, so we need to calculate the hydronium ion concentration first. Ammonia is a base, so it reacts with water to produce hydroxide ions (OH⁻):
NH₃ + H₂O → NH₄⁺ + OH⁻
The equilibrium constant for this reaction is the base dissociation constant, Kb. For ammonia, Kb = 1.8 x 10⁻⁵ at 25°C. Using this value, we can calculate the concentration of hydroxide ions as follows:
Kb = [NH4⁺][OH⁻]/[NH₃3
1.8 x 10⁻⁵ = x²/0.05
x = 1.34 x 10⁻³
Therefore, the concentration of hydroxide ions is 1.34 x 10⁻³ M. Using the formula for pH, we can now calculate the pH of ammonia:
pOH = -㏒[OH⁻] = -㏒(1.34 x 10⁻³) = 2.87
pH = 14 - pOH = 14 - 2.87 = 11.13
As a result, the pH of ammonia is about 11.13.
To know more about the Concentration, here
https://brainly.com/question/28113949
#SPJ4
3 Ag(s) + 4 HNO3 → 3 AgNO3 + NO(g) + 2 H2OThe reaction of silver metal and dilute nitric acid proceeds according to the equation above. If 0.10 mole of powdered silver is added to 10. milliliters of 6.0-molar nitric acid, the number of moles of NO gas that can be formed is
Answer:
\(0.015\text{ mol}\)Explanation:
Here, we want to get the number of moles of NO gas that can be formed
To answer this, we need to be sure of the limiting reagent
The limiting reagent is the one that is responsible for the number of moles of product formed
From the shown balanced equation of reaction, 3 moles of silver produced 1 mole of the gas
Thus, 0.1 mol of powdered silver will produce:
\(\frac{0.1}{3}\text{ = 0.033 mol}\)For the nitric acid, we need to get the number of moles that reacted
To get this, we have to multiply the volume (in L) that reacted by the molarity
Mathematically, we have that as:
\(\begin{gathered} 10\text{ ml = }\frac{10}{1000}\text{ = 0.01 L} \\ \\ number\text{ of moles = volume }\times\text{ molarity} \\ number\text{ of moles = 0.01 }\times\text{ 6 = 0.06 moles} \end{gathered}\)From the equation of reaction, 4 moles of the nitrate gave 1 mole of the gas
Thus, we have it that 0.06 moles will give:
\(\frac{0.06}{4}\text{ = 0.015 mole}\)From what we see, the number of moles produced by the nitrate is less than what was produced by the solid
Thus, the nitrate is the limiting reagent and the number of moles of the gas produced is 0.015 mol
Given the following equation: H2(g)+F2(g)=2HF(g)
How many grams of HF gas are produced as 5 mol of fluorine react?
Answer:
200grams
Explanation:
The balanced chemical equation for this reaction is given as follows:
H2(g)+F2(g) → 2HF(g)
This equation shows that it takes 1 mol of both hydrogen gas (H2) and fluorine gas (F2) to produce 2 moles of hydrogen fluoride (HF)
Hence, 5 moles of fluorine gas (F2) will produce 5 × 2 = 10 moles of HF.
In order to convert the mole value of HF to gram value, we use the following formula;
Mole = mass/molar mass
Molar mass of HF = 1 + 19 = 20g/mol
mass = mole × molar mass
mass = 10 × 20
mass = 200grams of HF.
The proton flow through the transmembrane H+ carrier of ATP synthase results in
a) bending of the carrier and stalk to produce mechanical force.
b) mechanical rotation that is converted into the chemical-bond energy of ATP.
The proton flow through the transmembrane H+ carrier of ATP synthase results in b) mechanical rotation that is converted into the chemical-bond energy of ATP.
The proton flow through the transmembrane H+ carrier of ATP synthase results in the rotation of a portion of the enzyme called the rotor. This rotation is then transmitted to another portion of the enzyme called the stator, which is fixed in position, causing conformational changes that lead to the synthesis of ATP.
The energy from the proton gradient is converted into mechanical energy through the rotation of the rotor, which is then transformed into the chemical-bond energy of ATP. This is known as chemiosmotic coupling, which is the process by which the electrochemical gradient generated by the movement of protons across the membrane is used to drive the synthesis of ATP.
To learn more about ATP, click here:
https://brainly.com/question/893601
#SPJ11
a rock weighing 26.0 is placed in a graduated cylender displacing the volume from 13.2ml to 25.3ml what is the density in g/cm3
Answer:
m=26.0 g
v₁=13.2 mL
v₂=23.5 mL
p=m/(v₂-v₁)
P=26.0/(23.5-13.2)=2.524 g/cm³
Explanation:
hope this helps!
have a good day!
which gas must not enter the carboy in order for fermentation to occur?
For fermentation process to successfully occur, Oxygen gas (O2) must not enter the carboy, because the pyruvate used in the process, gets completely oxidized when oxygen gas is present.
Fermentation is a metabolic process that always must take place in the absence of oxygen. Many of the beneficial microorganisms, create desired changes in different types of beverages and foods through this process of fermentation. And the resulting products of fermentation reaction thus formed, have better/more favorable flavor and taste, and also more life as they get preserved during the process. In addition to this, these microorganisms also provide several health benefits.
The process of fermentation to occur successfully, does not require oxygen gas as it is an anaerobic process. If by any chance or means, oxygen gas is present, the pyruvate used would be completely oxidized during the reaction forming carbon dioxide and water molecules as the by products, by the action of yeast spiration. Moreover, these yeast species needed in the reaction, produce ethanol only in an anaerobic (oxygen-less) environment by another process called the Pasteur Effect.
There are generally three types of fermentation processes based on the end products obtained using the pyruvate. They are:
Acetic Acid Fermentation, Lactic Acid Fermentation, and Alcoholic Fermentation.
Therefore, Oxygen Gas is the correct answer to this question.
Learn more about fermentation here:
https://brainly.com/question/13050729
#SPJ4
how much is 3.5 gallons in cups
Answer:
3.6 gallons are equal to 56 cups
What does one mole of h20 correspond to
Answer:
One mole of H2O corresponds to 18 g .
What four hydroxy aldehydes are formed by a crossed aldol reaction of ch3ch2ch2cho and c6h5ch2cho?
In a crossed aldol reaction between CH3CH2CH2CHO (butyraldehyde) and C6H5CH2CHO (benzaldehyde), four hydroxy aldehydes can be formed.
These products include two self-aldol reaction products and two crossed-aldol reaction products:
Self-aldol of butyraldehyde: CH3CH2CH2CH(OH)CH2CHO (3-hydroxyhexanal)
Self-aldol of benzaldehyde: C6H5CH(OH)CH2CHO (2-hydroxy-1-phenylethanone)
Crossed-aldol of butyraldehyde (enolate) and benzaldehyde: CH3CH2CH2CH(OH)CH2C(O)C6H5 (3-phenyl-3-hydroxypropanal)
Crossed-aldol of benzaldehyde (enolate) and butyraldehyde: C6H5CH(OH)CH2C(O)CH2CH2CH3 (2-benzyl-2-hydroxypropanal)
These hydroxy aldehydes are the products formed in a crossed aldol reaction involving butyraldehyde and benzaldehyde as the reactants.
To learn more about : hydroxy
https://brainly.com/question/27328650
#SPJ11
how to write 0.99966788 in scientific notation?
Answer:
9.9966788 x 10^-1
__________ is a result of a chemical reaction between pollutants and water and is one cause of chemical weathering of rock.
A.) carbon dioxide
B.) acid rain
C.) oxidation
D.) ice crystals
Answer:ice crystals
Explanation:
Under the same conditions of temperature and pressure, 1 l of oxygen gas was mixed 1 l of carbon dioxide gas. The mass ration of the gases in the mixture will be:
The mass ratio of oxygen gas to carbon dioxide gas in the mixture will be equal, with a ratio of 1:1. This is because equal volumes of gases under the same conditions contain an equal number of particles.
When 1 liter of oxygen gas is mixed with 1 liter of carbon dioxide gas under the same conditions of temperature and pressure, the mass ratio of the gases in the mixture will be 1:1. This is because gases behave ideally, according to Avogadro's Law, which states that equal volumes of gases, under the same conditions of temperature and pressure, contain an equal number of particles. In other words, the number of moles of each gas in the mixture will be the same.
The molar mass of oxygen (O₂) is 32 g/mol, while the molar mass of carbon dioxide (CO₂) is 44 g/mol. Since both gases have the same volume and contain an equal number of moles, the mass ratio can be calculated using their molar masses.
Let's assume the volume of the gases is 1 liter each. In 1 liter of oxygen gas, there will be (1 mole of O₂). The mass of 1 mole of O₂ is 32 g. Therefore, the mass of oxygen gas in the mixture will be 32 g.
Similarly, in 1 liter of carbon dioxide gas, there will be (1 mole of CO₂). The mass of 1 mole of CO₂ is 44 g. Hence, the mass of carbon dioxide gas in the mixture will be 44 g.
Therefore, the mass ratio of oxygen gas to carbon dioxide gas in the mixture will be 32 g : 44 g, which simplifies to 8 g : 11 g or 1:1.
Learn more about Mass ratio
brainly.com/question/31695052
#SPJ11
How does a nucleus maintain its stability even though it is composed of many particles that are positively charged? The neutrons shield these protons from each other. The Coulomb force is not applicable inside the nucleus. The strong nuclear forces are overcoming the repulsion. The surrounding electrons neutralize the protons.
A nucleus maintains its stability despite being composed of positively charged particles due to the strong nuclear force that overcomes the repulsion between the protons.
The neutrons in the nucleus play a crucial role in maintaining stability. Neutrons have no charge and do not contribute to the electrostatic repulsion. Their presence helps to increase the attractive nuclear force, balancing the repulsive force between protons. This shielding effect allows the nucleus to remain stable.
Another important factor is that the Coulomb force, which describes the electrostatic repulsion between charged particles, is not applicable at the nuclear level. The range of the Coulomb force is limited, and its influence diminishes at very short distances inside the nucleus. Instead, the strong nuclear force takes over and becomes the dominant force, binding the protons and neutrons together.
Additionally, the surrounding electrons in an atom contribute to the nucleus's stability. Electrons are negatively charged and are located in the electron cloud surrounding the nucleus. Their negative charge helps neutralize the positive charge of the protons, reducing the overall electrostatic repulsion within the atom. This electron-proton attraction further contributes to the stability of the nucleus.
Learn more about Coulomb force here:
https://brainly.com/question/31828017
#SPJ11
Identify: How are properties of matter classified?
Which of the following actions decreases the entropy of a system?
A-mixing baking soda and salt
b- freezing water
c- dissolving salt in water
d-boiling water
Answer:
b- freezing water
Explanation:
Solid<liquid<gas is the general rule for entropy increase
Freezing water would change the phase from liquid to solid which would lead to less entropy
Assume we have 759 liters of N, at ST. What is the mass of the nitrogen gas? Give answers to the nearest whole number.
The mass of the nitrogen gas is approximately 949 grams.
What is the mass of the nitrogen gas?The mass of the nitrogen gas can be calculated using the ideal gas law, which states:
PV = nRT
Where P is the pressure, V is the volume, n is the number of moles of gas, R is the gas constant, and T is the temperature in Kelvin. R is the ideal gas constant ( 0.08206 Latm/molK )
Given thw volume of the Nitrogen gas to be 759l, at ST, temperature equals 273.15 K and pressure 1 atm.
we can rearrange the ideal gas law to solve for n:
PV = nRT
n = PV / RT
Plug in the values
n = ( 1 atm × 759 L ) / ( 0.08206 Latm/molK × 273.15 K )
n = 33.86 mol
Finally, we can calculate the mass of the nitrogen gas using the molar mass of nitrogen:
m = n × M
Where M = 28.02 g/mol is the molar mass of nitrogen.
m = 33.86 mol × 28.02 g/mol
m = 949 g
Therefore, the mass is 949 g.
Learn more about ideal gases here: brainly.com/question/15634266
#SPJ1
Buffer solutions containing Na2CO3 and NaHCO3range in pH from 10.0 to 11.0. The chemical equation below represents the equilibrium between CO32- and H2O, and the table lists the composition of four different buffer solutions at 25°C.CO32- (aq) + H2O (l) ⇄ HCO3- (aq) + OH- (aq);Kb= 2.1 × 10-4 at 25°CBuffer [NaHCO3] Na2CO3 pH1 0.150 0.100 ?2 0.200 0.200 10.323 0.100 0.100 10.324 0.100 0.200 ?Which of the following chemical equilibrium equations best shows what happens in the buffer solutions to minimize the change in pH when a small amount of a strong base is added?A. H3O+(aq) + OH−(aq) ⇄ 2 H2O(l)B. HCO3−(aq)+ OH−(aq) ⇄ CO32−(aq) + H2O(l)C. CO32−(aq) + H3O+(aq) ⇄ HCO3−(aq) +H2O(l)D. CO32−(aq) + H2O(l) ⇄ HCO3−(aq)+ OH−(aq)
The correct answer is D. \(CO_3^{2-}(aq) + H_ 2O(l) \rightleftharpoons HCO_3^-(aq) + OH^-(aq)\). This chemical equilibrium equation best shows what happens in the buffer solutions to minimize the change in pH when a small amount of a strong base is added.
Buffer solutions containing \(Na_2CO_3\) and \(NaHCO_3\) range in pH from 10.0 to 11.0. The chemical equation given represents the equilibrium between \(CO_3^{2-}\) and \(H_2O\), and the table lists the composition of four different buffer solutions at 25°C. When a small amount of a strong base is added to a buffer solution, the pH will start to increase. This equation helps to minimize the change in pH by shifting the equilibrium so that the concentration of \(HCO_3^-\) is increased. This decreases the concentration of \(OH^-\) and the pH increases less than it would if the equilibrium had not shifted.
To know more about buffer solutions, click on below link:
https://brainly.com/question/24262133
#SPJ11
Which state of matter represented by the particles
Answer:
A solid
the internolecular forces are packed and leave no space behind
4. The density of lead is 11.3 g/cm, Determine the mass of 4.25 cm of lead, (18.09)
Answer:
48.03grams
Explanation:
Density of a substance is calculated as follows:
Density (g/cm³) = mass (g) / volume (cm³)
Based on the information given in this particular question:
Density of lead (Pb) = 11.3 g/cm³
Volume of lead (Pb) = 4.25 cm³
Density = m/V
11.3 = mass/4.25
Mass = 48.025
= 48.03grams.
I really need help on this question! Thank you so much!
Answer:
A. Empirical formula => C₂H₄O
B. Molecular formula => C₄H₈O₂
Explanation:
From the question given above, the following data were obtained:
Mass of C = 0.273 g
Mass of H = 0.046 g
Mass of O = 0.182 g
Molar mass of compound = 88 g/mol
A. Determination of the empirical formula of the compound.
C = 0.273 g
H = 0.046 g
O = 0.182 g
Divide by their molar mass
C = 0.273 /12 = 0.023
H = 0.046 /1 = 0.046
O = 0.182 /16 = 0.011
Divide by the smallest
C = 0.023 / 0.011 = 2
H = 0.046 / 0.011 = 4
O = 0.011 / 0.011 = 1
Thus, the empirical formula of the compound is C₂H₄O
B. Determination of the molecular formula of the compound.
Empirical formula = C₂H₄O
Molar mass of compound = 88 g/mol
Molecular formula =?
Molecular formula = [C₂H₄O]ₙ
[C₂H₄O]ₙ = 88
[(12×2) + (4×1) + 16]n = 88
[24 + 4 + 16]n = 88
44n = 88
Divide both side by 44
n = 88 / 44
n = 2
Molecular formula = [C₂H₄O]ₙ
Molecular formula = [C₂H₄O]₂
Molecular formula = C₄H₈O₂
A chemical reaction produces 13.8 mol of CO What volume in liters will that gas occupy at STP
Answer:
309 liters
Explanation:
A wonderful constant within the gas laws states that 1 mole of any gas occupies 22.4 liters at STP. ANY gas. Make that into a conversion factor you can use at your next social gathering if you want to annoy some friends:
(22.4L/1 mole) for any gas at STP.
Use that factor to find the answer:
(13.8 moles)(22.4L/1 mole) = 309 liters
__Pb(NO3)2 + __NaCI = __NaNO3 + __PbCI2
Answer:
Pb(NO3)2 + 2NaCl = 2NaNO3 + PbCl2
What is the balanced reduction half-reaction for the unbalanced oxidation-reduction reaction? Na(s) + Cl2lo) - NaCl(s) 1. Cla) + 2 - 2 C1"(s) 2. Cl2(g) 2 + 2 C1-(s) 3. Na(s) + +-Nat(s) 4. Na(s) - Na'(s) + 2 O 1
The balanced equation shows that two sodium atoms react with one chlorine molecule to form two molecules of sodium chloride.
The balanced reduction half-reaction for the unbalanced oxidation-reduction reaction Na(s) + Cl2(g) → NaCl(s) can be found by identifying the species being reduced. In this case, it is the chlorine molecule (Cl2) that is being reduced to form chloride ions (Cl-). The reduction half-reaction for this process can be written as follows:
Cl2(g) + 2e- → 2Cl-(aq)
This equation represents the balanced reduction half-reaction for the given oxidation-reduction reaction. To balance the full reaction, we need to combine it with the oxidation half-reaction, which represents the oxidation of sodium atoms (Na) to form sodium ions (Na+). The oxidation half-reaction can be written as:
Na(s) → Na+(aq) + e-
By combining the two half-reactions, we get the balanced oxidation-reduction reaction:
2Na(s) + Cl2(g) → 2NaCl(s)
This reaction represents the balanced reduction half-reaction and oxidation half-reaction combined. The reduction half-reaction involves the gain of electrons by chlorine atoms, while the oxidation half-reaction involves the loss of electrons by sodium atoms. The balanced equation shows that two sodium atoms react with one chlorine molecule to form two molecules of sodium chloride.
learn more about atoms
https://brainly.com/question/1566330
#SPJ11
what is the limiting reactant of 20.0 moles of o2 react with 30.0 moles of h2 according to the following reaction ? 2H2 + O2 = 2H2O
Answer:
The limiting reactant is hydrogen.
Explanation:
According to the balanced equation for synthesis of water, hydrogen is used up twice as fast as oxygen -- we need two moles of H2 for every one mole of O2 when creating water.
Since we have 20 moles of oxygen, this means we would need twice as much hydrogen, or 40 moles, to use it all up. There is only 30 moles of hydrogen, which means that all the hydrogen will be used before the 20 moles of oxygen is used. Hydrogen limits production in this case.
We have that
From the Question we are told that
20.0 moles of o_2
30.0 moles of h_2
Therefore
The ratio
For more information on this visit
The specific heat capacity of silver is 0.24 J/g °C. How many joules of energy are needed
to warm 0.500 g of silver from 25.0°C to 27.5°C?
Answer:
0.3 J
Explanation:
The equation for heat capacity is Q = mcΔT where Q is the heat, m is the mass of the substance, c is the specific heat capacity of the substance and delta T is the change in temperature. Plugging those values into the equation, we have Q = (.500)(0.24)(27.5-25) = 0.3
is the smallest non-metal other than noble gases.
Answer: T is the smallest non-metal other than noble gases.
Explanation:
A chemistry student needs to standardize a fresh solution of sodium hydroxide. She carefully weighs out 197. mg of oxalic acid (H, C04), a diprotic acid that can be purchased inexpensively in high purity, and dissolves it in 250. mL of distilled water. The student then titrates the oxalic acid solution with her sodium hydroxide solution. When the titration reaches the equivalence point, the student finds she has used 45.3 mL of sodium hydroxide solution.
Calculate the molarity of the student's sodium hydroxide solution.
The molarity of the student's sodium hydroxide solution is 0.0689 M.
To determine the molarity of the sodium hydroxide solution, we can use the stoichiometry of the balanced equation between sodium hydroxide (NaOH) and oxalic acid (H2C2O4).
The balanced equation for the reaction between NaOH and H2C2O4 is:
2NaOH + H2C2O4 → Na2C2O4 + 2H2O
From the balanced equation, we can see that the ratio of NaOH to H2C2O4 is 2:1. This means that for every 2 moles of NaOH, 1 mole of H2C2O4 is consumed.
Given that the student used 45.3 mL of NaOH solution, we need to convert this volume to moles of NaOH. To do this, we need to know the molarity of the oxalic acid solution.
Using the given mass of oxalic acid (197 mg), we can calculate the number of moles of H2C2O4:
moles of H2C2O4 = mass of H2C2O4 / molar mass of H2C2O4
The molar mass of H2C2O4 is 126.07 g/mol.
moles of H2C2O4 = 0.197 g / 126.07 g/mol = 0.001561 mol
Since the stoichiometry of the reaction is 2:1, the number of moles of NaOH used is twice the number of moles of H2C2O4:
moles of NaOH = 2 * moles of H2C2O4 = 2 * 0.001561 mol = 0.003122 mol
Now we can calculate the molarity of the NaOH solution:
Molarity of NaOH = moles of NaOH / volume of NaOH solution in liters
Volume of NaOH solution = 45.3 mL = 45.3/1000 L = 0.0453 L
Molarity of NaOH = 0.003122 mol / 0.0453 L = 0.0689 M.
For more such questions on molarity visit:
https://brainly.com/question/30404105
#SPJ8
If you need to produce 66 grams of carbon dioxide, how many liters of water vapor would you produce as a by product?
The question requires us to calculate the amount of vapor water produced as a by-product when 66g of carbon dioxide are obtained from the combustion of propane.
Considering the combustion of propane (C3H8), we have the following reaction:
\(2C_3H_8+9O_2\to4CO_2+2CO_{}+8H_2O_{(v)}\)IFrom the reaction, we can see that the stoichiometric relationship between C3H8 and water (H2O) is as follows:
2 mol C3H8 ---------- 8 mol H2O
Then, to calculate the amount of water produced as a by-product, we'll need to determine the amount of reactant needed to produce 66g of CO2.
Since the molar mass of CO2 is 44g/mol and considering the reaction written above, we can write:
2 mol C3H8 ---------- 4 mol CO2
x ---------- (66g/44g) = 1.5 mol CO2
Solving for x, we have that 0.75 mol of C3H8 are required to produce 66g of CO2.
Now, we calculate the amount of water that should be obtained from 0.75 mol of C3H8:
2 mol C3H8 ---------- 8 mol H2O
0.75 mol C3H8 ----- y
Solving for y, we have that 3 moles of water will be obtained as a by-product.
At last, we convert the calculated amount of vapor water into its volume considering the Standard Temperature and Pressure conditions (STP), where 1 mol of a gas corresponds to 22.4 L of the same gas:
1 mol vapor H2O ---------- 22.4 L vapor H2O
3 mol vapor H2O --------- z
Solving for z, we have that 67.2 L of vapor water will be obtained as a by-product when 66g of CO2 are produced from the combustion of propane.