The concentration of hydronium ions is greater than 1 x 10^−7 for acidic solutions. True False

Answers

Answer 1

Answer:

True.

Explanation:

Remember that hydronium ions indicate the concentration of an acid.

On the pH scale, the acids are between 0 and 7, and for bases, the pH is between 7 and 14.

The formula to calculate the pH of an acid is the following:

\(pH=-log\lbrack H_3O^+].\)

Now, let's replace the value of the given concentration in the formula, which is 1 x 10⁻⁷:

\(pH=-log\lbrack1\cdot10^{-7}]=7.\)

You can note that if the value of hydronium concentration is greater than 1 x 10⁻⁷, and we replace it in the formula, we will obtain lower pHs, which means that it is an acidic solution.

The answer would be true.


Related Questions

What is the pH of a solution of 0.300 mole of acetic acid (CH3CO₂H) (Ka = 1.8 × 10-5) and 1.50
moles of sodium acetate (NaCH3CO₂) dissolved in 1.00 L of water?

Answers

The pH of the solution is 2.44.

we first need to write the chemical equation for the dissociation of acetic acid in water:

\(CH_3CO_2H + H_2O - > CH_3CO_2^- + H_3O^+\)

We can use the acid dissociation constant (Ka) for acetic acid to determine the concentration of hydronium ions (H3O+) in the solution, and then use the pH equation to calculate the pH:

Ka = [CH₃CO₂⁻][H₃O⁺] / [CH₃CO₂H]

We know the concentrations of acetic acid and sodium acetate, so we can calculate the concentration of acetate ions ([CH₃CO₂⁻]) using the stoichiometry of the reaction:

[CH₃CO₂⁻] = [NaCH₃CO₂] = 1.50 moles / 1.00 L = 1.50 M

We can assume that all of the acetic acids dissociate into acetate ions and hydronium ions, so the initial concentration of acetic acid is equal to the change in concentration of acetate ions:

[CH₃CO₂H] = 0.300 moles / 1.00 L = 0.300 M

[CH₃CO₂⁻] = [H3O+] = x

Substituting these values into the Ka expression, we get:

1.8 x 10⁻⁵ = (1.50 M)(x) / (0.300 M)

Solving for x, we get:

x = 0.0036 M

Now, we can use the pH equation to calculate the pH:

pH = -log[H₃O+]

pH = -log(0.0036)

pH = 2.44

Therefore, the pH of the solution is 2.44.

learn more about pH here

https://brainly.com/question/172153

#SPJ9

A neutral atom of on element has two electrons
with n=1, eight electrons with n=2, eight electrons
with n=3 and one electron with n =4 and has mass
number of 39. Deduce the following from the above
information
i the atomic number of the element.
is number of neutrons in the nucleus
i total number of s electrons.
iv total number of p electrons .
v the group the element belongs to

Answers

A neutral atom of on element has two electrons with n=1, eight electrons with n=2, eight electrons with n=3 and one electron with n =4 and has mass number of 39 then the atomic number of element is 39 and number of neutron in the nucleus is 50 and total number of s electron is 2 and total number of p electron is 8 and the group is 3rd group

Yttrium is a metallic element with atomic number 39 usually included in the rare earth group that occur usually with other rare earth element in minerals and is used especially in phosphorous and YAG laser and alloy etc and element with mass number of 39 is yttrium and the atomic number of element is 39 and number of neutron in the nucleus is 50 and total number of s electron is 2 and total number of p electron is 8 and the group is 3rd group

Know more about element

https://brainly.com/question/12054275

#SPJ1

The chemical equation below is unbalanced. CaS + AlC → A + CaC Balance this equation.

Answers

The balanced chemical equation is CaS + AlC → A + CaC

To balance the chemical equation CaS + AlC → A + CaC, we need to ensure that the same number of atoms of each element is present on both sides of the equation. Here's the step-by-step process to balance the equation:

Begin by counting the number of atoms of each element on both sides of the equation.

Left side (reactants):

Calcium (Ca): 1

Sulfur (S): 1

Aluminum (Al): 1

Carbon (C): 1

Right side (products):

A: 1

Calcium (Ca): 1

Carbon (C): 1

Sulfur (S): 0

Start by balancing the elements that appear in the fewest compounds. In this case, we can balance sulfur (S) first. Since there is only one sulfur atom on the left side and none on the right side, we need to add a coefficient of 1 in front of A on the right side to balance the sulfur.

CaS + AlC → 1A + CaC

Next, balance calcium (Ca) by adding a coefficient of 1 in front of CaS on the left side.

1CaS + AlC → 1A + CaC

Now, balance aluminum (Al) by adding a coefficient of 1 in front of AlC on the left side.

1CaS + 1AlC → 1A + CaC

Finally, balance carbon (C) by adding a coefficient of 1 in front of CaC on the right side.

1CaS + 1AlC → 1A + 1CaC

The balanced chemical equation is:

CaS + AlC → A + CaC

For more question on balanced chemical equation visit:

https://brainly.com/question/30196693

#SPJ8

a. Using the Born-Mayer Equation, calculate the lattice enthalpy for sphalerite
(zinc blende), ZnS. You must look up the appropriate parameters for the equation.

b. Using the Born-Mayer Equation, calculate the lattice enthalpy for wurtzite, ZnS. You must
look up the appropriate parameters for the equation.

c. Which is thermodynamically stable at ambient conditions (25 °C, 1 bar)? Find a reference
with the T and P phase diagram for ZnS. Submit the pdf of the reference with your file . Also,
compare your answer to the standard enthalpies of formation for wurtzite compared to sphalerite.

Answers

ΔLatticeU = ΔLatticeH – pΔVm is the lattice energy of wurtzite.  Ionic compounds often have flat surfaces that meet at distinctive angles and are stiff, brittle, crystalline materials.

Remember that when a metal reacts with a nonmetal, often an ionic compound results from the transfer of electrons form the metal (the reductant) towards the nonmetal (the oxidant). Ionic compounds often have flat surfaces that meet at distinctive angles and are stiff, brittle, crystalline materials. They melt at rather high temperatures and are not easily distorted.   ΔLatticeU = ΔLatticeH – pΔVm is the lattice energy of wurtzite.

To know more about lattice energy, here:

https://brainly.com/question/29735933

#SPJ1

PLEASE HELP I HAVE LIMITED TIME!!
How many particles of water (H20) are in a collection of snowflakes
with a mass of 0.005 g?

PLEASE HELP I HAVE LIMITED TIME!!How many particles of water (H20) are in a collection of snowflakeswith

Answers

Answer:

Explanation:

Si tomamos en cuenta el peso molecular del agua, que es equivalente a:

1 Átomo de H₂O

O = 16 gr/mol

H = 1 gr/mol

H₂O = 18 gr/mol

Teóricamente sabemos que en 1 mol de H2O habrá 18 gr.

 

Para obtener los moles presentes en 1 mg de H₂O, (como 1 gr = 1000 mg), decimos:

1 mol H2O …………………………..  18000 mg

       X          ……………………………   1 mg

X = 1 / 18000 = 5,56 X 10⁻⁵ moles de H20

 

Y para obtener la cantidad de moléculas presentes, de acuerdo a los moles, multiplicamos por el número de Avogadro (6,023 X 10²³ moléculas /mol)

Moléculas de H₂O = 5,56x 10⁻⁵ mol x 6,023 x 10²³

Moléculas de H₂O = 3,34488 x10¹⁹ moléculas de H₂O

En el copo de nieve habrá 3,34488 x 10¹⁹ moléculas de H₂O.

Espero que te sirva =)

5,43 X 10²² particles of water (H20) are in a collection of snowflakes with a mass of 0.005 g.

What do you mean by mole ?

The term mole is defined as the amount of substance of a system which contains as many elementary entities.

One mole of any substance is equal to 6.023 × 10²³ units of that substance such as atoms, molecules, or ions. The number 6.023 × 10²³ is called as Avogadro's number or Avogadro's constant.

The mole concept can be used to convert between mass and number of particles.

1 atom of H₂O

O = 16 g/mol

H = 1 gr/mol

H₂O = 18 gr/mol

1 mol H₂O …………………………..  18000 mg

?      X          ……………………………   1 mg

X = 1 / 18000

= 5,43 X 10²² moles de H20

Thus, 5,43 X 10²² particles of water (H20) are in a collection of snowflakes with a mass of 0.005 g.

To learn more about the mole,follow the link;

https://brainly.com/question/26416088

#SPJ6

use the slider or the + or - signs above the periodic table to increase or decrease the temperature of the elements which are gasses at 25 degrees Celsius? select each element that is a gas at 25 degrees celsius

Answers

The elements that is a gas at 25 degrees Celsius are given below.

What do you mean by Gas?

Gas is a state of matter in which a substance exists as a collection of molecules in constant random motion, dispersed throughout a given volume. Gases differ from solids and liquids in that they have neither a definite shape nor a definite volume. Examples of gases include air, oxygen, nitrogen, carbon dioxide, and methane.

- Hydrogen

- Helium

- Oxygen

- Nitrogen

- Neon

- Fluorine

- Chlorine

- Argon

At 25 degrees Celsius, all of these elements exist as gases under standard atmospheric pressure.

To know more about gas,

https://brainly.com/question/27870704

#SPJ1

Consider the reaction described by the chemical equation shown.
C2H4(g)+H2O(l)⟶C2H5OH(l)Δ∘rxn=−44.2 kJ

Use the data from the table of thermodynamic properties to calculate the value of Δ∘rxn
at 25.0 ∘C.


ΔS∘rxn= ? J⋅K−1

Calculate Δ∘rxn.

ΔG∘rxn= ? kJ


In which direction is the reaction, as written, spontaneous at 25 ∘C
and standard pressure?
reverse
both
neither
forward

Consider the reaction described by the chemical equation shown.C2H4(g)+H2O(l)C2H5OH(l)rxn=44.2 kJUse

Answers

Answer:

To calculate Δ∘rxn, we can use the following formula:

ΔG∘rxn = ΔH∘rxn - TΔS∘rxn

where ΔH∘rxn is the enthalpy change of the reaction, T is the temperature in Kelvin, and ΔS∘rxn is the entropy change of the reaction.

We know that ΔH∘rxn = -44.2 kJ and we want to find ΔS∘rxn at 25.0 ∘C (298 K). We can use the following formula to calculate ΔS∘rxn:

ΔG∘rxn = -RTlnK

where R is the gas constant (8.314 J/mol K), T is the temperature in Kelvin, and K is the equilibrium constant.

We can find K using the following formula:

ΔG∘rxn = -RTlnK K = e^(-ΔG∘rxn/RT)

We know that ΔG∘rxn = -44.2 kJ/mol and R = 8.314 J/mol K, so we can calculate K:

K = e^(-(-44.2 kJ/mol)/(8.314 J/mol K * 298 K)) K = 1.9 x 10^7

Now we can use K to calculate ΔS∘rxn:

ΔG∘rxn = -RTlnK ΔS∘rxn = -(ΔH∘rxn - ΔG∘rxn)/T ΔS∘rxn = -((-44.2 kJ/mol) - (-8.314 J/mol K * 298 K * ln(1.9 x 10^7)))/(298 K) ΔS∘rxn = -0.143 kJ/K

Therefore, ΔS∘rxn is -0.143 kJ/K.

To determine whether the reaction is spontaneous at 25 ∘C and standard pressure, we can use Gibbs free energy (ΔG). If ΔG < 0, then the reaction is spontaneous in the forward direction; if ΔG > 0, then it is spontaneous in the reverse direction; if ΔG = 0, then it is at equilibrium.

We know that ΔG∘rxn = -44.2 kJ/mol and T = 25 ∘C (298 K). We can use the following formula to calculate ΔG:

ΔG = ΔG∘ + RTlnQ

where Q is the reaction quotient.

At equilibrium, Q = K (the equilibrium constant). Since we calculated K earlier to be 1.9 x 10^7, we can use this value for Q.

ΔG = ΔG∘ + RTlnQ ΔG = (-44.2 kJ/mol) + (8.314 J/mol K * 298 K * ln(1.9 x 10^7)) ΔG = -43.6 kJ/mol

Since ΔG < 0, the reaction is spontaneous in the forward direction at 25 ∘C and standard pressure.

A \pu{1.60 g}1.60 g1, point, 60, space, g calcium supplement contains 37.8\%37.8%37, point, 8, percent \ce{Ca}CaC, a by mass. The calcium is present in the supplement as \ce{CaCO3}(s)CaCOX 3 ​ (s) (molar mass \pu{100.09 g/mol}100.09 g/mol100, point, 09, space, g, slash, m, o, l). How many grams of \ce{CaCO3}(s)CaCOX 3 ​ (s) are in the calcium supplement?

Answers

A 1.60 g calcium supplement that contains 37.8% Ca by mass, contains 1.51 g of CaCO₃.

We want to calculate the mass of CaCO₃ in a 1.60 g supplement. We need to consider the following relationships.

The mass percent of Ca is 37.8%, that is, there are 37.8 g of Ca every 100 g of supplement.The molar mass of Ca is 40.08 g/mol.The molar ratio of Ca to CaCO₃ is 1:1.The molar mass of CaCO₃ is 100.09 g/mol.

\(1.60gSup \times \frac{37.8gCa}{100gSup} \times \frac{1molCa}{40.08gCa} \times \frac{1molCaCO_3}{1molCa} \times \frac{100.09gCaCO_3}{1molCaCO_3} = 1.51gCaCO_3\)

A 1.60 g calcium supplement that contains 37.8% Ca by mass, contains 1.51 g of CaCO₃.

Learn more: https://brainly.com/question/14990953

A 1.60 g calcium supplement contains 37.8% Ca by mass. The calcium is present in the supplement as CaCO₃(s) (molar mass 100.09 g/mol). How many grams of CaCO₃(s) are in the calcium supplement?

please help asap!

3. A double replacement reaction occurs between two solutions of lead (II) nitrate and potassium bromide. Write a
balanced equation for this reaction-identifying the product that will precipitate, and the product that will remain in
solution.
a) Write the balanced equation for this double replacement reaction.
b) If this reaction starts with 32.5 g lead (II) nitrate and 38.75 g potassium bromide, how many grams of the
precipitate will be produced? Remember to use the limiting reactant to calculate the amount of precipitate
formed.
c) How many grams of the excess reactant will remain?

please help asap!3. A double replacement reaction occurs between two solutions of lead (II) nitrate and

Answers

Answer:

Explanation:

a) The balanced equation for the double replacement reaction between lead (II) nitrate and potassium bromide is:

Pb(NO₃)₂(aq) + 2KBr(aq) → PbBr₂(s) + 2KNO₃(aq)

In this reaction, lead (II) bromide (PbBr₂) will precipitate, while potassium nitrate (KNO₃) will remain in solution.

b) To determine the amount of precipitate produced, we need to first determine the limiting reactant. We can do this by calculating the number of moles of each reactant and comparing it to the stoichiometry of the balanced equation.

The molar mass of lead (II) nitrate is 331.21 g/mol and the molar mass of potassium bromide is 119.00 g/mol.

The number of moles of lead (II) nitrate is 32.5 g / 331.21 g/mol = 0.0981 mol The number of moles of potassium bromide is 38.75 g / 119.00 g/mol = 0.3256 mol

According to the balanced equation, one mole of lead (II) nitrate reacts with two moles of potassium bromide to produce one mole of lead (II) bromide. This means that if all the lead (II) nitrate were to react, it would require 0.0981 mol * 2 = 0.1962 mol of potassium bromide.

Since we have more than enough potassium bromide (0.3256 mol > 0.1962 mol), lead (II) nitrate is the limiting reactant.

The number of moles of lead (II) bromide produced will be equal to the number of moles of lead (II) nitrate consumed, which is 0.0981 mol.

The molar mass of lead (II) bromide is 367.01 g/mol, so the mass of lead (II) bromide produced will be 0.0981 mol * 367.01 g/mol = 36.0 g.

c) To determine the amount of excess reactant remaining, we need to subtract the amount consumed from the initial amount.

The number of moles of potassium bromide consumed is half the number of moles of lead (II) nitrate consumed, which is 0.0981 mol / 2 = 0.04905 mol.

The mass of potassium bromide consumed is 0.04905 mol * 119.00 g/mol = 5.84 g.

The mass of potassium bromide remaining is 38.75 g - 5.84 g = 32.91 g.

The H* concentration in an aqueous solution at 25 °C is 5.7 x 10.
What is [OH-]?

Answers

Answer:

Explanation:

To find the concentration of hydroxide ions ([OH-]) in an aqueous solution, we can use the relationship between hydrogen ion concentration ([H+]) and hydroxide ion concentration in water at 25 °C, which is given by the equation:

[H+] x [OH-] = 1.0 x 10^-14

Given that the hydrogen ion concentration ([H+]) is 5.7 x 10^-10 (derived from the H* concentration provided), we can rearrange the equation to solve for [OH-]:

[OH-] = (1.0 x 10^-14) / [H+]

[OH-] = (1.0 x 10^-14) / (5.7 x 10^-10)

[OH-] ≈ 1.754 x 10^-5

Therefore, the concentration of hydroxide ions ([OH-]) in the given aqueous solution is approximately 1.754 x 10^-5.

A solution is made by mixing 50.0 mL of liquid A with 75.0 mL of liquid B. Which is the solute, and which is the solvent? Is it valid to assume that the volume of the resulting solution will be 125 mL? Explain your answer.

Answers

If two liquid solutions are mixed together, the solute would be the one with the lower volume while the solvent would be the solution with the higher volume.

What are liquid solutes?

The mixing of two liquids requires that one is a solute while the other is a solvent.

Thus, the solution with the higher volume acts as the solvent while the one with the lower volume act as the solute.

For example, a solution made by mixing 25% water with 75% alcohol has water as the solute and alcohol as the solvent.

More on liquid-liquid mixture can be found here: https://brainly.com/question/14112110

#SPJ1

What is the relationship between the number of molecules and the mass of 22.4 L of different gases at STP?

Answers

Answer:

One mole of gas will occupy the same volume as one mole of any other gas at same temperature and pressure, despite mass difference.

Explanation:

The volume occupied by one mole of gas at stp is known as the standard molar volume of a gas. It has been found to be 22.41410 L. According to Avagadro's law, one mole of any gas will occupy the same volume as one mole of any other gas at the same temperature and pressure, despite mass difference. Knowing the volume of gas, you can use 1 mol/22.4L as a conversion factor to find the number of moles, and therefore the mass, of a given volume of a given gas at STP.

Behaviour of gases:

In gases, the molecules are far apart and mutual interaction amongst the molecules are negligible except when they collide.At low temperature and high pressure, the gases follow a simple reaction:

‎ㅤ‎ㅤ‎ㅤ PV = KT

how many milliliters of 0.105 M HCL are needed to titrate 22.5 ml of 0.118 M NaOH to the equivalence point

Answers

0.118 is + 100 = 718

When energy is converted from one form to another in a chemical or physical change, which of the following also changes by a measureable amount?a. The total mass in the system b. The force of gravity c. The total energy d. None of the above

Answers

The correct answer is d. None of the above, as the total mass and force of gravity do not change, while the total energy does change during energy conversions.

When energy is converted from one form to another in a chemical or physical change, the total mass in the system does not change. According to the law of conservation of mass, mass is neither created nor destroyed during a chemical or physical process. Therefore, the total mass in the system remains constant. Similarly, the force of gravity does not change during energy conversion. Gravity is a fundamental force that acts on objects with mass and is independent of the energy transformations occurring in the system. The force of gravity is determined by the masses of the objects involved and their distance from each other, but it is not influenced by energy conversions. The total energy in the system does change during energy conversions. Energy can be transferred or transformed from one form to another, but the total energy within a closed system is conserved according to the law of conservation of energy. The amount and type of energy may vary, but the total energy content remains constant. Therefore, the correct answer is d. None of the above, as the total mass and force of gravity do not change, while the total energy does change during energy conversions.

for more questions on energy
https://brainly.com/question/29339318
#SPJ8

Reaction:
N2 + 3H2 ------> 2NH3

Question 1: Calculate the mass of N2 needed to react with 10 g of H2

Question 2: Calculate the mass of N2 needed to produce 15 g of NH3​

Answers

Explanation:

The reactant contains 2N and 6H

The product contains 2N and 6H

Therefore, the chemical equation is balanced

From the equation, for every 1 mole of N2 that reacts, 3 moles of H2 are required.

We know 28.6 grams of N2 reacted, but we don’t know the mass ratio but just the mole ratio, so we have to convert 28.6 grams of N2 to the corresponding moles of N2.

From the periodic table, the molar mass of N is about 14 g/mol, so the molar mass of nitrogen gas or N2 is two times of that which is 28 g/mol.

With this, we can calculate moles of N2, but we also need to make sure the equation is setted up the right way.

Looking at the units, if we cancel out the grams, we are left with mol. We also know that in multiplication, numerator of one number cancel with the denominator of another number and vice versa

So the equation looks like this 28.6g * mol/28g = 1.021 mol N2

So the number of moles of H2 required is 1.021 mol N2 * 3 mol H2/1 mol N2 = 3.063 mol H2 (notice that mol N2 canceled out, so the equation is set up correctly)

However, the question ask for number of grams of H2 needed, so we need the molar mass of hydrogen gas or H2, which is 1*2 = 2 g/mol

3.063 mol H2 * 2 g H2/ mol H2 = 6.126 g H2

Ans: 6.126 g H2

Predict and explain the structure of the major and minor products when hydrogen bromide is added to 2-methylbut-2- ene, (Ch3)2CCHCH3
Pls help with homework!!!!

Answers

When hydrogen bromide (HBr) is added to 2-methylbut-2-ene ((CH3)2CCHCH3), an electrophilic addition reaction takes place, where the π bond of the alkene is broken, and the hydrogen and bromine atoms are added to the resulting carbocation.

The reaction proceeds through a Markovnikov addition, where the hydrogen atom attaches to the carbon atom with the greater number of hydrogen atoms.

In this case, the initial addition of HBr to 2-methylbut-2-ene leads to the formation of a primary carbocation, as the positively charged carbon atom only has one alkyl group attached to it. The primary carbocation is relatively unstable, and it can undergo a rearrangement to form a more stable secondary carbocation.

The major product that is typically obtained is the 2-bromo-2-methylbutane. The hydrogen atom from HBr adds to the carbon with three hydrogen atoms (the more substituted carbon), resulting in the formation of a secondary carbocation.

On the other hand, a minor product is also formed, which is 3-bromo-2-methylbutane. This product arises from the addition of HBr to the primary carbocation, which is less stable. Although the primary carbocation is less favored, it can still be formed and lead to the formation of the minor product.

In summary, the addition of HBr to 2-methylbut-2-ene yields two products: the major product is 2-bromo-2-methylbutane, resulting from the addition of HBr to the more stable secondary carbocation, and the minor product is 3-bromo-2-methylbutane, originating from the less stable primary carbocation.

For more such questions on  electrophilic addition visit:

https://brainly.com/question/9643304

#SPJ8

Given the reaction: Mg(s) + 2HCl(aq) → MgCl2(aq) + H2(g)
The reaction occurs more rapidly when a 10-gram sample of Mg is powdered rather than in one piece, because powdered
Mg has
1. less surface area
2. more surface area
3. a lower potential energy
4. a higher potential energy

Answers

It’s 4 I did this the other day

Which is an example of antiracist behavior?
A. Tyler smiles at a joke made in his driver education class about Asian drivers.

B.Tyler makes a joke about the high number of African Americans dropping out of school.


C.Tyler suggests that an ethnic studies course be taught at his school

D. All of the above

Answers

Answer:

C.

Explanation:

In C.) Tyler is not suggesting that one race is better than another he is only suggesting his own non biased opinion on what courses should be taught at his school.

Answer:

Explanation:

C

does living organism capable of both process

Answers

Yes because it can produce unlike nonliving organism

What happens to the energy of gas particles when an elastic collision takes place?

Answers

Answer:

Kinetic energy might transferred from one particle to another during an elastic collision, but  i don't think that there is going to be any change in the total energy of the colliding particles. Because there are no forces of attraction or repulsion between gas particles .

Explanation:



_______-the phase where the

chromosomes pull apart

Answers

Answer:

The answer to your question isanaphase

So it would be anaphase is the phase where the chromosones pull apart.

Explanation:

The sister chromatids are pairs of identical copies of DNA joined at a point called the centromere. During anaphase, each pair of chromosomes is separated into two identical, independent chromosomes. The chromosomes are separated by a structure called the mitotic spindle.

I hope this helps and have a wonderful day!

Why do particles with different masses have the same kinetic energy when at the same temperature?

Answers

Answer: Because Kinetic energy depends on temperature and not mass

Explanation:

Average kinetic energy is defined as the average of the kinetic energies of all the particles present in a system. It is determined by the equation:

\(K.E=\frac{3RT}{2}\)

where K.E = Kinetic energy

R= gas constant

T= temperature in kelvin

It is visible that kinetic energy is dependent on the temperature of the system and not on the mass of the system. Thus particles with different masses have the same kinetic energy when at the same temperature

The gas phase reaction of H2 with CO2 To produce H2O and CO has…

(Refer to the image, please)

The gas phase reaction of H2 with CO2 To produce H2O and CO has(Refer to the image, please)

Answers

The given reaction has ΔG value  -12207KJ. Therefore, the given reaction is a spontaneous reaction as value of ΔG is negative.

A spontaneous process refers to anything that happens by itself, without external energy input. A ball is going to roll down an incline, water will flow downhill, ice will melt into water, radioactive elements will decay, and iron will rust, for instance. It is impossible for a reaction to not be spontaneous if it is exothermic (H negative) and increases the entropy for the system (S positive). The system's overall heat capacity is measured in enthalpy. The system's unpredictability is gauged by entropy.

ΔG=ΔH-T×ΔS

ΔG=11-298×41

     = -12207KJ

Since ΔG is negative, reaction is spontaneous

To know more about spontaneous reaction, here:

https://brainly.com/question/31199175

#SPJ1

How many grams of NaOH are needed to make 100. mL of solution with a concentration of 1.5 M?

Answers

To create 100 mL of solution with a concentration of 1.5 M, 6.00 grams of NaOH are required.

The amount of NaOH needed to make 100. mL of solution with a concentration of 1.5 M can be calculated using the formula:

mass = molarity x volume x molar mass

where:

molarity = 1.5 M (given)

volume = 100. mL = 0.1 L (given)

molar mass of NaOH = 40.00 g/mol (from periodic table)

Substituting the values, we get:

mass = 1.5 mol/L x 0.1 L x 40.00 g/mol

mass = 6.00 g

Therefore, 6.00 grams of NaOH are needed to make 100. mL of solution with a concentration of 1.5 M.

To know more about the Solution, here

https://brainly.com/question/14296204

#SPJ1

A compound has the empirical formula given below. C3H4O3 Which compound represents the molecular formula with a scale factor of 2? A. C6H8O6 B. C2H2O2 C. C3H4O3​

Answers

The compound which represents the molecular formula with a scale factor of 2 is \(C_6H_8O_6\) . The correct answer is option A

The empirical formula of a compound gives the simplest whole-number ratio of the atoms present in the compound. To obtain the molecular formula, we need to know the actual number of atoms in the molecule.

To find the molecular formula with a scale factor of 2, we need to multiply the subscripts in the empirical formula by 2.

Therefore, the molecular formula with a scale factor of 2 would be:

\(C_3H_4O_3\) × \(2\)  = \(C_6H_8O_6\)

So option A is the correct answer.

For more such questions on molecular formula, click on:

https://brainly.com/question/26388921

#SPJ11

why did my dad hasn't come back with the milk for 10 years

Answers

Answer:

Milk's heavy

Explanation:

What is the volume of 6.40 grams of O₂ gas at STP?
O 4.49 liters
O 4.32 liters
04.18 liters
O 4.06 liters

Answers

The volume of 6.40 grams of O₂ gas at STP is 4.48L (option A). Details about volume can be found below.

How to calculate volume?

The volume of a gas can be calculated using the following formula:

p = m/v

Where;

p = densitym = massv = volume

According to this question, the mass of O₂ gas at STP is 6.40 grams. The density of the gas at STP is 1.43 g/L.

1.43g/L = 6.4g/V

Volume of O2 = 6.4 ÷ 1.43 = 4.48L

Therefore, the volume of 6.40 grams of O₂ gas at STP is 4.48L.

Learn more about volume at: https://brainly.com/question/1578538

#SPJ1

Answer:

This is right!!! the answer is A 4.49

Explanation:

what is the change in mass of A in
60 minutes?
Mass of A (g)
12.4
10.4
9.1
7.7
6.2
Time
O
15
30
45
60

Answers

Answer:

To determine the change in mass of A over the given time period, we need to find the difference between the initial mass of A and the final mass of A.

From the given table, we can see that the initial mass of A at t = 0 (start time) is 12.4 g and the final mass of A at t = 60 minutes (end time) is 6.2 g.

Therefore, the change in mass of A over 60 minutes is:

Final mass of A - Initial mass of A

= 6.2 g - 12.4 g

= -6.2 g

The negative sign indicates that the mass of A decreased over time, which means that A underwent some kind of reaction or process that caused it to lose mass.

The change in mass of A over 60 minutes is -6.2 grams.

To determine the change in mass of A over 60 minutes, we need to compare the initial mass to the final mass.

From the given information, we can see that the mass of A decreases over time.

Let's calculate the change in mass.

Initial Mass of A: 12.4 g

Final Mass of A: 6.2 g

Change in Mass of A = Final Mass of A - Initial Mass of A

= 6.2 g - 12.4 g

= -6.2 g

The change in mass of A over 60 minutes is -6.2 grams.

Note that the negative sign indicates a decrease in mass.

For such more questions on mass

https://brainly.com/question/1838164

#SPJ8

Which main type of sedimentary rock forms from solutions?

chemical
clastic
organic
shale

Answers

Answer:

The answer is a.

Explanation:

I took the quiz and took notes.

If your questions were the same as mine the answers would be below

Question 1: Which process moves small rock pieces during sedimentary rock formation?

Answer: erosion

------------------------------------

Question 2: Which statement describes one role of minerals during cementation?

Answer: Minerals bind sediments together.

------------------------------------

Question 3: Which correctly lists three factors that contribute to weathering of rock?

Answer: ice, water, wind

------------------------------------

Question 4: The picture shows a sedimentary rock that was formed from crystalized minerals. This is the picture in text form - Orangish red rock with coarse texture.

Actual question number 4: Which type of sedimentary rock is shown?

Answer: chemical

------------------------------------

Question 5: Which type of sedimentary rock forms from weathered sediment?

Answer: clastic

------------------------------------

Question 6: Which statement describes deposition?

Answer: Deposition happens after weathering and erosion.

------------------------------------

Question 7: Which correctly lists three agents that loosen and carry away rock during the erosion process?

Answer: plants, animals, wind

------------------------------------

Question 8: Which processes contribute to the formation of chemical sedimentary rocks?

Answer: Minerals dissolve and crystalize.

------------------------------------

Question 9: The image shows an example of a sedimentary rock. This is the picture in text form - Brown rock containing small pieces of different materials.

Actual question: Which feature of this rock demonstrates that it is a clastic sedimentary rock?

Answer: visible rock fragments

------------------------------------

Question 10: Which process squeezes layers of sediment together?

Answer: compaction

------------------------------------------------------------------------

Pictures used in question four and question nine are in the attached pictures.

God bless! :D

Which main type of sedimentary rock forms from solutions?chemicalclasticorganicshale
Which main type of sedimentary rock forms from solutions?chemicalclasticorganicshale

Questions
Q1.
Use the Periodic Table on page 2 to help you answer this question.
Give the name or symbol of
(a) the element in group 3 and period 4.

Answers

Gallium is the element that belongs to the group 3 and the fourth period. Ga is symbol of Gallium.

The element gallium has an atomic number of 31.While highly pure gallium is covered in a dazzling silvery colour, solid gallium is a blue-grey metal with an orthorhombic crystalline structure.It is a crucial part of numerous semiconductors. Due to its capacity to transform power into light, it is additionally used in red LEDs (light emitting diodes).Because of its high boiling point, it is perfect for recording temperatures that would cause a thermometer to vaporise.From iron pyrites, zinc blende, germanite, and bauxite, this metal can be readily removed as a byproduct.Because gallium is a corrosive chemical, it can cause serious skin and eye burns asse well as significant irritation.

Learn more about semiconductors here

https://brainly.com/question/1918629

#SPJ9

Other Questions
production resource tools are movable resources that are shared among different work centers.T/F you are buying a flower arrangement. the florist has 9 types of flowers and 7 types of vases. if you can afford exactly 2 types of flowers and need only 1 vase, how many different arrangements can you buy? Generate all permutations of {1,2,3,4} by (Do not write code to answer this question. To answer this question you have to read section 4.3 Algorithms for Generating Combinatorial Objects) a. the bottom-up minimal-change algorithm. b. the Johnson-Trotter algorithm. C. the lexicographic-order algorithm. Solve for mkx-bf=fy/m within a nucleoid, the supercoiled dna loops are held together by: Darius has at least $15 more than his big brother. Darius's big brother has $72. How much does Darius have? A car manufacturer sells its cars to local dealerships and also has a company-owned distribution center to cater to specific markets. In this scenario, match the types of customers given in the left to their respective categories given in the right.1. Company-owned distribution center2. Dealership3. People who buy the car from the dealers Please Help meeeeeeeeeee:To rename and save a document to OneDrive, you should use which option?a) Copyb)Downloadc) Saved)Save as multiple choice for question 1, identify the correct verb form for the underlined verb. i would like to thank those of you who have gave so generously to our most recent fund drive. a. give b. given c. gived d. no change necessary What does Curley's wife say to the guys in the barn about her relationshipwith Curley?A. She says Curley is the nicest guy she has ever metB. She tells them Curley has nightmares and screams a lotC. She says Curley is not a nice guy a section of lawn that is 25.5 feet by 75.0 feet needs fertilizer. the fertilizer is sold in 5.00 pound boxes and 1.00 pound of fertilizer is needed for 10.0 square yards of lawn. if each box costs $1.65, how much will it cost to fertilize the lawn? A volleyball flying through the air what type of energy is it? With your partner, calculate the mass of copper(II) sulfate pentahydrate required to make 100 mL of a 0.500 mol/L aqueous solution . Include the water molecules that are hydrated to the crystals , as given in the chemical formula , in your calculation of molar mass. Show all of your calculations. capitalism is an economic system that: private individuals and coporations the right to own productive resources. true or false? Listen to the example and match each musical element to description that best describes its use in the example.1.strings only-performing forces2.adagio-tempo and rhythm3.minor key-tonality The actual implementation of relational databases was delayed for many years after the theory was developed. what caused this delay? Bank leverage Use the information presented in Southwestern Mutual Bank's balance sheet to answer the following questions. Bank's Balance Sheet Assets Liabilities and Owners' Equity Reserves $150 Deposits $1,200 Loans $600 Debt $200 Securities $750 Capital (owners' equity) $100 Suppose a new customer adds $100 to his account at Southwestern Mutual Bank, which the owners of the bank then use to make $100 worth of new loans. This would increase the loans account and the account. This would also bring the leverage ratio from its initial value of to a new value of Which of the following do bankers take into account when determining how to allocate their assets? Check all that apply. The total value of liabilities The riskiness of each asset The size of the monetary base a graduate student is using a statistical method for identifying associations among a large number of variables to reveal more general patterns. they are performing a ____ analysis. a. matrix b. correlation c. trend d. factor What does negative 3 over 5 > 2 indicate about the position of negative 3 over 5 and 2 on the number line? A. negative 3 over 5 is located on the right of 2 B.negative 3 over 5 is located on the left of 2 C.negative 3 over 5 is located on the right of 0 and 2 is located on the left of 0 D.negative 3 over 5 is located on the left of 0 and 2 is located on the right of 0Will mark Brainliest! What are the slope and the y-intercept of the linear function that is represented by the graph?