The gene for tallness (T) in a pea plant is dominant over the gene for shortness (t).

In a cross between two heterozygous parent pea plants, we can predict that what percentage of the offspring will be tall?

A. 100%
B. 50%
C. 75%
D. 25%​

Answer:

verdadero

Explanation:

porque esoo \(\lim_{n \to \infty} a_n x_{123} \frac{x}{y} \sqrt[n]{x} x^{2} \sqrt{x} \pi \neq \lim_{n \to \infty} a_n \left[\begin{array}{ccc}1&2&3\\4&5&6\\7&8&9\end{array}\right] \int\limits^a_b {x} \, dx \left \{ {{y=2} \atop {x=2}} \right.\) 

Answer:

A logic bomb and a time bomb are both types of malicious software or code that are designed to cause harm to a computer system or network. Here's a brief explanation of each:

Logic Bomb:

A logic bomb is a piece of code or software that is intentionally inserted into a system to execute a malicious action when specific conditions are met. It remains dormant until triggered by a predefined event or circumstance, such as a specific date, time, or user action. Once triggered, the logic bomb may perform various harmful actions, such as deleting files, corrupting data, or disrupting system functionality. The purpose of a logic bomb is often to cause damage or to gain unauthorized access to a system.

Time Bomb:

A time bomb is similar to a logic bomb, but it is specifically designed to activate or execute its malicious payload at a certain date or time. It is usually programmed to remain undetected until the predetermined time arrives. The time bomb can be set to trigger after a specific time period or on a particular date, at which point it may carry out destructive actions. Time bombs can be used by attackers to target specific events or to coordinate an attack to occur simultaneously across multiple systems.

Both logic bombs and time bombs are considered forms of malicious code or malware and are used with malicious intent to disrupt, damage, or compromise computer systems or networks. They can be extremely harmful, and it is important to have strong security measures, such as antivirus software and regular system updates, to protect against such threats.

Explanation:

According to the above-balanced reaction, 2 moles of hydrogen and 1 mol of oxygen combine to form 2 moles of water.

As long as there is one mole of O2, 2 H2 + O2 2 H2O produces the same amount of water as H2. Hence, if you start wit 3 mole of H2 and 1.5 moles with O2, you will end up with 3 mole of H2O.

Response and justification 6 moles more oxygen gas must be produced in order to make 12 moles of water. This is due to the fact that water and hydrogen mix according to the equation for balance: O2 (g) + 2H2 (g) = 2H2O (g) 2 H2 (g) with O2 (g) results in 2 H2 O (g).

To know more about reaction visit:

https://brainly.com/question/28984750

#SPJ1

Answer:

See the answer below

Explanation:

The chaparral biome is a temperate biome with a characteristic high temperature and dryness during summer and mild rainy winters and springs. The biome can be found in relatively small amounts in the major continents of the world with its rich plant and animal diversity who have successfully adapted to the conditions of the biome.

Due to the high biodiversity of the chaparral biome, one would expect it to be resilient to the loss of a single species. The more the biodiversity of a biome or community, the more resilient such biome or community would be to the loss of species and lower the biodiversity, the more sensitive the community would be to the loss of species.

Answer:

The chaparral biome is a temperate biome with a characteristic high temperature and dryness during summer and mild rainy winters and springs. The biome can be found in relatively small amounts in the major continents of the world with its rich plant and animal diversity who have successfully adapted to the conditions of the biome.

Due to the high biodiversity of the chaparral biome, one would expect it to be resilient to the loss of a single species. The more the biodiversity of a biome or community, the more resilient such biome or community would be to the loss of species and lower the biodiversity, the more sensitive the community would be to the loss of species.

Explanation:

Answer:

is B

Explanation:

Answer:

Ti

Explanation:

We have that  he element X is

X= Titanium

From the question we are told that

XCl4 contains 74.8% Cl by mass

Hence for a 100g

Cl=74.8g

Mole of Cl=\frac{74.8}{35.5}

Mole of Cl=2.1

Meanin that 4 M of Cl=1 M of X

Generally the equation for the moles   is mathematically given as

moles = \frac{mass}{ molar mass}

Where

mass of X=100-74,8=25.3

and

moles of X=\frac{2.1}{4}

moles of X=0.527

0.527= \frac{25.2}{ molar mass}

molar mass=47.8g

Therefore

Element with molar mass=47.8g is Titanium

Hence

X= Titanium

For more information on this visit

https://brainly.com/question/17756498?referrer=searchResults

Answer:

what you've asked so I guess the answer will be 10 days

Answer:

The composition of the objects because not all the planets have been explored

Answer:

B

Explanation:

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

Answer:

If it is not proven and if it isn't backed up by any facts or has been proven to be false.

The correct answer is the radioactive decay.

Let us understand this.

For example, alpha decay is radioactive decay in which an atomic nucleus emits an alpha particle (helium nucleus).

Another example of nuclear fission is radioactive decay process in which the nucleus of an atom splits into smaller parts and huge amount of energy is released.

Hence, the correct process is radioactive decay.

To learn  more about radioactive decay, refer: https://brainly.com/question/9796067

#SPJ9

Answer:

the l sign means the substance in the chemical equation is a liquid. (hope this helped : D )

Answer:

6 protons and 8 neutrons (please help me with my questions too!)

Explanation:

The atomic mass is 18, if you subtract the atomic number ( the number of protons) to the atomic mass you get it.

Answer:

Orbiter

Explanation:

Space shuttles are made out of three main parts: rocket boosters, a fuel tank, and orbiter (the part that resembles an airplane

Ptolemy was born 100 AD.

Claudius Ptolemy was a mathematician, astronomer, geographer, and astrologer who wrote about a dozen scientific treatises, three of which were of importance to later Byzantine, Islamic, and Western European science.

I hope this helps!

A)Nuclear fusion releases protons and neutrons, so the total number of protons and neutrons in a star changes throughout its life is the true statement.

A suggested method of producing energy would use heat from nuclear fusion processes to produce electricity. A heavier atomic nucleus is created by the fusion of two lighter ones, which also produces energy. Fusion reactors are devices created to use this energy.

Nuclear fusion is less risky than nuclear fission because the fuel rods produced by nuclear fission include dangerous radioactive waste that may be used in weapons and must be maintained carefully for thousands of years.

Powering the Sun and other stars are nuclear fusion processes. Two light nuclei combine to produce one heavy nucleus during a fusion process. The resultant single nucleus's total mass is less than the mass, which causes the process to release energy.

learn more about Nuclear fusion refer

https://brainly.com/question/17870368

#SPJ13

The equilibrium molarity of (SO4)2- ion is 0.00051 M.

The sulfuric acid (H2SO4) dissociates in water as follows:H2SO4 + H2O ⇌ H3O+ + HSO4-HSO4- ⇌ H+ + SO42-

Therefore, the equilibrium molarity of (SO4)2- ion can be determined by first calculating the concentration of H+ ions formed in the solution due to the dissociation of H2SO4.

For the given solution with a concentration of 0.043 M sulfuric acid, the initial concentration of H2SO4 is also 0.043 M.

Using the first dissociation equation:

[H2SO4] = [H3O+] + [HSO4-]

At equilibrium, assuming x moles of H+ ions and HSO4- ions are formed:

[H2SO4] = (0.043 - x) M[H3O+] = x M[HSO4-] = (0.043 - x) M

Using the second dissociation equation:[HSO4-] = [H+] * [SO42-] / Ka2

where Ka2 is the dissociation constant for the second dissociation of sulfuric acid.

From the ALEKS Data resource, Ka2 for sulfuric acid is

1.2 × 10^-2.

Substituting the values:

(0.043 - x) = x * [SO42-] / Ka2

Rearranging:

[SO42-] = (0.043 - x) * Ka2 / x

At equilibrium, the concentration of (SO4)2- ion is given by:[SO42-] = (0.043 - x) * Ka2 / x

Substituting the equation from the first dissociation:

[SO42-] = (0.043 - x) * Ka2 / x

[SO42-] = (0.043 - x) * 1.2 × 10^-2 / x

Simplifying:[SO42-] = 0.000516 - 0.012x

To solve for x, the quadratic equation:

x^2 + Ka2x - Ka2[HSO4-]initial = 0 can be used,

where [HSO4-]initial is the initial concentration of HSO4- ions, which is 0.043 M.

Solving the quadratic equation gives x = 4.4 × 10^-4 M.

Therefore, the equilibrium concentration of (SO4)2- ion is:

[SO42-] = 0.000516 - 0.012x

[SO42-] = 0.000516 - 0.012(4.4 × 10^-4)

[SO42-] = 0.000510 M

Rounding off to 2 significant figures, the equilibrium molarity of (SO4)2- ion is 0.00051 M.

Learn more on equilibrium molarity here

https://brainly.com/question/8732513

#SPJ1

Answer:

A conductor is an object that allows electrical charges to flow easily. Conductors are mainly metals.

Explanation:

A conductor is an object that allows electrical charges to flow easily. Conductors are mainly metals. As well as having objects that conduct electricity there are objects that do not conduct electricity. Conductors : Gold, Silver, Copper, Iron, Lead, Salt Water.

Answer: conductor

Explanation: A conductor allows electricity to flow though it.

The balanced chemical equation for the decomposition of aspirin (acetylsalicylic acid) is:

\(2C_{9}H_{8}O_{4} (aspirin) → 2C_{7}H_{6}O_{3} (salicylic acid) + 2CO_{2} (Carbon dioxide) + H_{2}O (water)\)

In this reaction, the aspirin molecule breaks down into salicylic acid, carbon dioxide, and water. The reaction is typically catalyzed by heat or exposure to acidic or basic conditions.

Aspirin, or acetylsalicylic acid, contains ester functional groups that can undergo hydrolysis. Under suitable conditions, the ester bond in aspirin is cleaved, leading to the formation of salicylic acid, which is the primary decomposition product. Additionally, carbon dioxide and water are released as byproducts of the reaction.

The balanced equation shows that for every two molecules of aspirin, two molecules of salicylic acid, two molecules of carbon dioxide, and one molecule of water are formed. Understanding the decomposition of aspirin is important in pharmaceutical and chemical industries to ensure the stability and shelf-life of the compound, as well as to study its breakdown products and potential side reactions.

Know more about aspirin here:

https://brainly.com/question/13533428

#SPJ8

while zinc is an important mineral with numerous functions in the body, it is not true that grains are the most reliable food source of zinc. A balanced diet that includes a variety of foods can provide adequate zinc intake for most people.

How to solve the problem?

The statement that is NOT true of zinc is "Grains are the most reliable food sources of zinc." While grains can be a source of zinc, they are not necessarily the most reliable source.

Zinc is an essential mineral that plays important roles in many biological processes, including immune function, protein synthesis, wound healing, and DNA synthesis. It is involved in various enzymatic reactions, and acts as a cofactor for many enzymes. Zinc is also important for proper growth and development, especially during childhood and adolescence.

Excess zinc intake can lead to decreased copper absorption, as both minerals compete for absorption in the intestines. This can lead to copper deficiency, which can cause anemia neutropenia, and other health problems. Therefore, it is important to maintain a balance between zinc and copper intake.

While grains can be a source of zinc, other foods such as meat, seafood, and dairy products are also good sources. Vegetarians and vegans may need to pay particular attention to their zinc intake, as plant-based sources of zinc may be less bioavailable than -based sources. Zinc supplements can also be used to prevent or treat deficiencies, but should be used with caution as excessive intake can have negative health effects.

In summary, while zinc is an important mineral with numerous functions in the body, it is not true that grains are the most reliable food source of zinc. A balanced diet that includes a variety of foods can provide adequate zinc intake for most people.

To know more about enzymes visit :-

https://brainly.com/question/14577353

#SPJ1

Answer:

n = 0.0088

Explanation:

Molar mass of N2 = 2 x 14 = 28

Moles = mass/molar mass

n = 0.247/28

n = 0.0088...

The number of moles of Nitrogen in 0.247g of Nitrous Oxide is 0.01122 moles.

The question is asking about the quantification of moles of 'N' in a given amount of Nitrous oxide (N2O). The Molar mass of Nitrous oxide (N2O) is approx 44.01 g/mole, and the molar mass of Nitrogen (N) is approx. 14.01 g/mole. Hence, there are 2 moles of N in a single mole of N2O as depicted by the molecular formula. Therefore, first we calculate the number of moles of N2O by the formula: moles = mass/molar mass. Using the given mass (0.247g), moles of N2O = 0.247/44.01 = 0.00561 moles. As there are 2 moles of N in every mole of N2O, the moles of N in 0.247g N2O = 2 * 0.00561 = 0.01122 moles.

https://brainly.com/question/35158407

A 5 carat diamond has a mass of 1.000 g. If the gemstone displaces a liquid from 1.00 mL to 1.30 mL, and the density of the diamond is 3.33 g/mL

To calculate the density of the diamond, we can use the formula:

Density = Mass / Volume

Given that the mass of the diamond is 1.000 g and it displaces a liquid from 1.00 mL to 1.30 mL, we can substitute these values into the formula:

Density = 1.000 g / (1.30 mL - 1.00 mL)

By subtracting the initial volume from the final volume, we find:

Density = 1.000 g / 0.30 mL

Performing the division, we obtain:

Density = 3.33 g/mL

Therefore, the density of the diamond is 3.33 g/mL.

It's important to note that the units for density are grams per milliliter (g/mL) because the mass is given in grams and the volume is given in milliliters.

Understanding and applying the formula for density allows us to determine the mass per unit volume of a substance. In this case, the density provides information about how much mass is contained within a given volume for the diamond.

Know more about Volume here:

https://brainly.com/question/14197390

#SPJ8

Answer:

log = ( - 0.51 z 2) / ( 1 + ( / 305)

Explanation:

Explanation:

Nope both atoms aren't isotopes of same chemical elements.. In isotopes both atom should have same number of protons or atomic number with different mass number, but here it's 13 and 14 protons so different atomic number

Answer: “Atomic mass is expressed in atomic mass units while molar mass is expressed in grams.”

It’s true that atomic mass is expressed in atomic mass unity, called u.m.a. or dalton, but surely molar mass is expressed in the same unity too and not in grams. For example the atomic mass of hydrogen is 1.008 u.m.a.. The molar mass of water (H2O) is the sum of 2 atomic mass of hydrogen and 1 atomic mass of oxygen: 1.008x2+16=18.016 u.m.a.

Explanation:  The unit of atomic mass and molar mass is the same and it corresponds to 1/12 of the mass of the nucleus of the carbon isotope 12. Therefore both are not masses but pure dimensionless numbers. When I say that sodium (Na) has atomic mass 22.997 u.m.a., I simply say that sodium atoms weighs 22.997 time more than the atomic mass unity. When I say that CO2 has a molecular mass of 44.01 u.m.a. I say that the CO2 molecule weighs 44.01 time more than the atomic mass unity.

To move from the atomic mass to the gr-atoms, used for single atoms, or moles (gr-moles) used for molecules, both used in the stoichiometric calculations, you have simply to use the atomic mass and the molecular mass and put the dimension in grams. For the moles you can use lower dimensions (millimoles, micro moles, etc.) and higher dimensions (kilomoles, tonmoles, etc.).

The enthalpy of combustion for 1kg of urea is -1223525.84 J/mol.

Urea is a compound that is used in fertilizers and in some plastics.The enthalpy of combustion for urea is the amount of energy that is released when urea is burned. In order to calculate the enthalpy of combustion for 1kg of urea, we need to use the information that is provided to us in the question. Let us start by writing down the balanced equation for the combustion of urea: CO(NH2)2 + 3/2 O2 → CO2 + 2H2O + N2
The balanced equation shows that 1 mole of urea reacts with 1.5 moles of oxygen gas to produce 1 mole of carbon dioxide, 2 moles of water, and 1 mole of nitrogen gas. The enthalpy change for this reaction is equal to the amount of energy that is released when 1 mole of urea is burned.
The heat of combustion (ΔHc) of urea is -632.6 kJ/mol. This means that 632.6 kJ of energy is released when 1 mole of urea is burned. We know that 12g of urea raised the temperature of water by 30°C. We can use this information to calculate the amount of energy that was released when 12g of urea was burned.
The specific heat capacity of water is 4.18 J/g°C. This means that it takes 4.18 J of energy to raise the temperature of 1 gram of water by 1°C. Therefore, it takes 4.18 x 1000 = 4180 J of energy to raise the temperature of 1 kg of water by 1°C.
We know that 12g of urea raised the temperature of water by 30°C. Therefore, the amount of energy that was released when 12g of urea was burned is:
Energy = mass x specific heat capacity x temperature change
Energy = 0.012 kg x 4180 J/kg°C x 30°C
Energy = 1497.6 J
We can now use this information to calculate the enthalpy of combustion for 1kg of urea:
Enthalpy of combustion = energy released / moles of urea burned
Enthalpy of combustion = 1497.6 J / (0.012 kg / 60.06 g/mol)
Enthalpy of combustion = - 1223525.84 J/mol
for such more questions on enthalpy
https://brainly.com/question/14047927

#SPJ8

Answer:

the amount of a substance that will dissolve in a given amount of solvent.

Explanation:

Solubility is a term used to describe how readily a substance can be dissolved in a solvent to form a solution. Thus, a substance is said to be soluble if it dissolves completely in a solvent and insoluble if it doesn't dissolve or only dissolves partially.

For example, sodium chloride (NaCl) when mixed with water dissociates into sodium and chloride ions. Thus, salt (sodium chloride) is said to be soluble because it dissolves completely in water.

Furthermore, a compound that dissolves completely in water to produce an aqueous solution is said to be soluble in water.

In conclusion, solubility is simply the amount of a substance such as salt, that will dissolve in a given amount of solvent. A solvent is any liquid such as water, coffee, tea, etc., that dissolves a liquid, gaseous, or solid solute to produce a solution.

Answer:

C. Because my teacher said so

Hope this helps :)

Answer:

Because my teacher said so

Explanation:

You good? lol

The balanced equation is: 4 \(H_2S\)+ 3 \(O_2\)→ 4 \(SO_2\)+ 8 \(H_2O\)

The given chemical equation is unbalanced. To balance it, we need to adjust the coefficients in front of each chemical species until the number of atoms on both sides of the equation is equal.

The unbalanced equation is:

2 \(H_2S\)+ 3 \(O_2\)→ \(SO_2\)

Let's start by balancing the sulfur (S) atoms. We have two sulfur atoms on the left side and one sulfur atom on the right side. To balance the sulfur, we can place a coefficient of 2 in front of the \(SO_2\):

2 \(H_2S\)+ 3 \(O_2\)→ 2 \(SO_2\)

Now, let's balance the hydrogen (H) atoms. We have four hydrogen atoms on the left side (2 from each \(H_2S\)) and none on the right side. To balance the hydrogen, we can place a coefficient of 4 in front of the water (H2O) on the right side:

2 \(H_2S\)+ 3 \(O_2\)→ 2 \(SO_2\)+ 4 \(H_2O\)

Finally, let's balance the oxygen (O) atoms. We have six oxygen atoms on the right side (3 from \(O_2\) and 3 from 2 \(SO_2\)) and three on the left side (2 from \(H_2S\)). To balance the oxygen, we can place a coefficient of 3/2 in front of the O2:

2 \(H_2S\)+ (3/2) \(O_2\)→ 2 \(SO_2\)+ 4 \(H_2O\)

To remove the fractional coefficient, we can multiply all coefficients by 2:

4 \(H_2S\) + 3 \(O_2\)→ 4 \(SO_2\)+ 8 \(H_2O\)

Now the equation is balanced, with an equal number of atoms on both sides. The balanced equation is:

4 \(H_2S\)+ 3 \(O_2\)→ 4 \(SO_2\)+ 8 \(H_2O\)

For more such questions on  balanced equation visit:

https://brainly.com/question/23877810

#SPJ8