Answer:
Tetrahedral shape
Explanation:
The compound SiCl₄ has a molecular geometry of a tetrahedral shape. The shape of compound can be predicted using the valence shell electron pair repulsion theory model.
The total electron pair around the central atoms is 4. The number of bond pairs is 4. Lone pair is zero.Consider the heating curve for water.
Heating Curve for Water
160
140
120
100
80
60
40
20
Temperature (°C)
-20
1 2 3 4 5 6 7 8 9 10
Time (min)
At what temperature does the solid start melting?
The solid starts melting at 0°C. The heating curve for water shows the temperature changes as heat is added to the substance.
The horizontal flat line on the graph represents the phase change from solid to liquid. In the case of water, this occurs at 0°C. This is known as the melting point, or the temperature at which a substance changes from a solid to a liquid at atmospheric pressure.
It is an important characteristic of a substance and can be used to identify it. It is also important in many industrial processes, such as melting metals for casting. Therefore, understanding the melting point of a substance is crucial in various fields of science and technology.
Learn more about heating curve:
https://brainly.com/question/29592874
#SPJ1
How many grams of sodium chloride are there in 2.34 moles of sodium chloride (NaCl)?
How many grams of sodium chloride are there in 2.34 moles of sodium chloride (NaCl)?
To find the mass that we have in 2.34 moles of NaCl, we need the molar mass of NaCl. To get the molar mass of NaCl we have to look for the atomic mass of Na and Cl in the periodic table:
Na: 22.99 amu Cl: 35.45 amu
Using those values we can calculate the molar mass of NaCl:
molar mass of NaCl = 22.99 + 35.45
molar mass of NaCl = 58.44 g/mol
Now that we know the mass of 1 mol of NaCl, we can find the mass of NaCl that there are in 2.34 moles of it.
mass of NaCl = number of moles of NaCl * molar mass of NaCl
mass of NaCl = 2.34 moles * 58.44 g/mol
mass of NaCl = 136.75 g
Answer: There are 137 g of NaCl in 2.34 moles of it.
0.965g of iodine was shaken with a mixture of 50cm3 trichloromethane and 50cm3 of water in the separating funnel until equilibrium was attained at 25 degrees Celsius. After the layers had settled, 25cm3 of aqeous layers required 4.4cn3 of 0.01M sodium thiosulphate solution using starch indicator. Determine the distribution coefficient of iodine between trichloromethane and water
Answer:
i don't know about your question
write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
Math the Definitions! Please & Thank You :) Screenshot Attached.
SOMEONE HELP!
After analysing the given options and data we conclude that the matching of the given options as
1) Proposed by Nicolaus Copernicus and Aristarchus - heliocentric model
2) Proposed by Aristotle - 3) geocentric model
3) geocentric model - A) Earth at the center of the universe
4) The universe started from a single point - C) Big Bang Theory
5) Proposed by George Lemaitre - C) Big Bang Theory
6) The sun at the center of the universe - 3) geocentric model
7) heliocentric model - 6) The sun at the center of the universe
The Big Bang Theory is a scientific explanation regarding the original creation of the universe. The theory is based on several key assumptions, one of which is the isotropy of the universe. This assumption projects that the universe, more or less, appears the same in all directions of time and space.
Another key theory is that of cosmic inflation, which projects why the universe is so symmetrical on such a significant scale.
To learn more about Big bang theory
https://brainly.com/question/6841128
#SPJ1
Which of the following statements is correct?
Answer: A
Explanation: i took the test
A 0.649 g sample containing only K2SO4 (M.M. 174.25) and (NH4)2SO4 (M.M. 132.13) was dissolved in water and treated with Ba(NO3)2 to participate all SO42- as BaSO4 (M.M. 233.38). Find the weight percent of K2SO4 in the sample if 0.977 g of precipitate was formed.
Based in the data provided, the percentage by mass of K2SO4 is 60.55 %.
What is the mass of K2SO4 in the mixture?The mass of K2SO4 in the mixture is obtained from the data given as follows:
Total mass of sample = 0.649 g
Let the mass of K2SO4 in the mixture be X g
Mass (NH4)SO4 = (0.649 - X )g
Moles of K2SO4 = X g/174.25 g/mol
= 0.00574X mol
Moles of (NH4)2SO4 = (0.649 - X)g / 132.13 g/mol
= (0.00491 - 0.00757X) mol
Total number of moles SO42- ions precipitated = 0.00574X mol + (0.00491 - 0.00757X)mol
= (0.00491-0.00183X) mol
Mole ratio of SO42- ions to Ba2+ ions = 1:1
Thus, moles of Ba2+ ions = (0.00491 - 0.00183X)mol
Moles of BaSO4 precipitated = 0.977 g/233.38 g/mol = 0.00419 moles
1 mole of BaSO4 produces 1 mole of Ba2+ ions
Therefore,
(0.00491 - 0.00183X) mol = 0.00419mol
0.00183X = 0.00491 - 0.00419mol
0.00183X = 0.00072
X = 0.00072/0.00183 = 0.393 g
Mass of K2SO4 = 0.393 g
Percentage by mass of K2SO4 = (0.393/0.649) × 100
Percentage by mass of K2SO4 = 60.55 %
Learn more about percentage by mass at: https://brainly.com/question/26150306
The elevated ridges of the brain are
called the
are patches of gray matter that
regulate skeletal muscle movement.
is the gray matter is located in the
outermost region of the brain
involved with integration.
--
The are large fiber tracts that
allow the two hemispheres to
communicate with each other.
--
[Choose]
[Choose]
[Choose]
[Choose]
<
>
The elevated ridges of the brain are called gyri. Motor cortex are patches of gray matter that regulate skeletal muscle movement.
Cerebral cortex is the gray matter is located in the outermost region of the brain involved with integration.
Corpus callosum are large fiber tracts that allow the two hemispheres to communicate with each other.
How to explain the informationThe elevated ridges of the brain are called the gyri. Motor cortex are patches of gray matter that regulate skeletal muscle movement.
Cerebral cortex is the gray matter is located in the outermost region of the brain involved with integration. Corpus callosum are large fiber tracts that allow the two hemispheres to communicate with each other.
Learn more about brain on
https://brainly.com/question/1247675
#SPJ1
Calculate the density of a solid in g/cm3 if it weighs 38.3 kg and has a volume of 0.00463 m3.
Answer: D=8.27 g/cm³
Explanation:
Density is mass/volume. Mass is in grams and volume is in liters. In this case, the problem wants our volume to be in cm³. All we need to do is to make some conversions to convert kg/m³ to g/cm³.
\(D=\frac{38.3kg}{0.00463m^3} *\frac{(1m)^3}{(100cm)^3} *\frac{1000g}{1kg}\)
With this equation, the m³ and kg cancel out, and we are left with g/cm³.
D=8.27 g/cm³
It is advantageous for a predator to prey exclusively on a single prey species
Answer: It is not necessarily advantageous for a predator to prey exclusively on a single prey species, as this can limit their options and make them vulnerable if the population of that prey species declines or becomes extinct. Predators that are more flexible and able to switch between different prey species may be better equipped to survive and thrive in changing environments.
However, there are some advantages to specializing in a single prey species. For example, a predator that is well adapted to hunting a particular prey species may be more efficient and successful at capturing and consuming that prey, which could provide a reliable source of energy. Additionally, if the predator and prey have co-evolved, the predator may have adaptations that specifically allow it to exploit the weaknesses or vulnerabilities of its prey, giving it an advantage over predators that are less specialized.
for the above reactions to occur, o2 must be in excess in the first step. what is the minimum amount of o2 needed in grams?
1201.6 grams of \(HNO_{3}\) is produced which is the minimum amount of reactant requires to complete the reaction.
The minimum amount of \(O_{2}\) is 915.2 grams
Step 1: Provided data
\(N_{2}\) mass = 400 grams
\(N_{2}\) molar mass = 28.0 g/mol
Step 2: Calculate the balanced equation
\(N2 (g) + 2O2 (g)\) → \(2NO2 (g)\)
\(3NO_{2} (g)+ H_{2} O (g)\) → \(NO + 2HNO_{3} (aq) (g)\)
Step 3: Determine the moles of \(N_{2}\).
\(N_{2}\) moles =\(N_{2}\) mass / \(N_{2}\) molar mass
\(N_{2}\)moles = 400 g / 28.0 g/mol
\(N_{2}\) moles = 14.3 moles
Step 4: Determine the moles of \(O_{2}\)
To produce 2 moles \(NO_{2}\), we need 2 moles O2 for 1 mol \(N_{2}\).
To produce 14.3 moles \(N_{2}\), we need 28.6 moles \(O_{2}\) and 28.6 moles \(NO_{2}\)
Step 5: Determine the mass
\(O_{2}\) Mass\(O_{2}\) = moles\(O_{2}\) * molar mass of \(O_{2}\) Mass\(O_{2}\)= 28.6 moles * 32.0 g/mol Mass \(O_{2}\) = 915.2 grams
Step 6: Determine the moles of \(NO_{2}\)
To produce 14.3 moles \(N_{2}\), we need 28.6 moles \(O_{2}\) and 28.6 moles \(NO_{2}\)
Step 7: Determine the moles of \(HNO_{3}\)
1 mole H2O is required to produce 2 moles \(HNO_{3}\) and 1 mol \(NO_{2}\) for 3 moles \(NO_{2}\).
2/3 * 28.6 = 19.07 moles \(HNO_{3}\) is required for 28.6 moles \(NO_{2}\)
Step 8: Determine the mass of \(HNO_{3}\).
\(HNO_{3}\) mass = mole \(HNO_{3}\) * molar mass \(HNO_{3}\)
\(HNO_{3}\)mass = 19.07 g/mol * 63.01 g/mol
\(HNO_{3}\)mass = 1201.6 g
Learn more about Grams of \(HNO_{3}\) here
https://brainly.com/question/14901772
#SPJ4
Complete question
\(N2 (g) + 2O2 (g)\) → \(2NO2 (g)\)
\(3NO_{2} (g)+ H_{2} O (g)\) → \(NO + 2HNO_{3} (aq) (g)\)
a. a car burns \(4.00 * 10^2\) g of \(N_{2}\). How many grams of \(HNO_{3}\) will be produced?
b. what is the minimum amount of \(O_{2}\) needed in grams?
determine the empirical formula of the compound formed when 1.2g of magnesium reacts with 3.55g of chlorine.take the molar mass of magnesium and chlorine to be 24g and 35.5g.
Answer: MgCl2
Explanation:
Convert the masses of Mg and Cl to moles:
Mg: 1.2g/24g/mole = 0.050 moles
Cl: 3.55g/35.5g/mole = 0.100 moles
The ratio of Cl to Mg is 2 to 1: (0.100 moles Cl/0.050 moles Mg), Therefore there must be 2 Cl for every Mg:
MgCl2
This is the empirical formula since all we know is the ratio. If could also be Mg2Cl4, Mg3Cl6, etc, [i.e., (MgCl2)n]
how many grams of Br2 are needed to completely convert 15.0g Al to Albr3?
Answer:
For, this question,
The balanced equation is; 2Al + 3 ----> 2Al
We can now, calculate how many grams of will be needed to completely convert 15 g of Al into Al.
Here, the reaction produces, 2 moles of Al
So, For 15.0 g of Al; we can calculate;
(15.0 g Al) X (1 mole Al / 26.98 g Al) X (3 moles / 2 moles Al) X (159.81 g / 1 mole )
= 133 g of will be needed.
Therefore, 133g of will be needed to completely convert 15 g of Al into Al.
Explanation:
the pka values of tert-butanol and phenol are determined by the stability of the conjugate base that is formed when a proton is removed from each molecule. the higher the stability of the conjugate base, the weaker the acid and the higher the pka. in the case of tert-butanol, the conjugate base (tert-butoxide ion) is stabilized by the electron-donating effect of the three alkyl groups attached to the central carbon atom. these alkyl groups increase the electron density on the oxygen atom, making it a better nucleophile and stabilizing the negative charge on the oxygen atom. as a result, the tert-butoxide ion is a relatively stable species, and the pka of tert-butanol is high (around 16). in contrast, the conjugate base of phenol (phenoxide ion) is less stable because the negative charge on the oxygen atom is delocalized over the aromatic ring. the pi electrons of the ring can partially stabilize the negative charge, but not to the same extent as the alkyl groups in tert-butanol. as a result, phenol is a stronger acid than tert-butanol, and its pka is lower (around 10). therefore, the difference in pka between tert-butanol and phenol can be explained by the difference in the electron-donating ability of the substituents attached to the central carbon atom in tert-butanol and the electron-withdrawing effect of the aromatic ring in phenol. regenerate response
The pKa values of tert-butanol and phenol are determined by the stability of their respective conjugate bases, which are formed when a proton is removed from each molecule. The higher the stability of the conjugate base, the weaker the acid and the higher the pKa.
In the case of tert-butanol, the conjugate base (tert-butoxide ion) is stabilized by the electron-donating effect of the three alkyl groups attached to the central carbon atom. These alkyl groups increase the electron density on the oxygen atom, making it a better nucleophile and stabilizing the negative charge on the oxygen atom. As a result, the tert-butoxide ion is a relatively stable species, and the pKa of tert-butanol is high (around 16).
In contrast, the conjugate base of phenol (phenoxide ion) is less stable because the negative charge on the oxygen atom is delocalized over the aromatic ring. The pi electrons of the ring can partially stabilize the negative charge, but not to the same extent as the alkyl groups in tert-butanol. As a result, phenol is a stronger acid than tert-butanol, and its pKa is lower (around 10).
Therefore, the difference in pKa between tert-butanol and phenol can be explained by the difference in the electron-donating ability of the substituents attached to the central carbon atom in tert-butanol and the electron-withdrawing effect of the aromatic ring in phenol.
To learn more about tert-butanol, visit here
https://brainly.com/question/11530806
#SPJ4
Provide the major organic product of the reaction below.
When cyclic ester is reacted with ethyl alcohol in presence of heat and acidic medium, ethyl hexanoate is formed. The structure of ethyl hexanoate is attached in image.
What do you mean by cyclic ester ?Lactones are the name for cyclic esters. The COOH and OH groups that unite to generate water in these instances are a component of the same molecule.
German chemist Leopold Gmelin likely abbreviated the word "ester" from the German Essigäther, "acetic ether," when he first used it in 1848.
First, carbonyl oxygen abstracts a proton. The production of an ester on one side of the chain and alcohol on the other follow the attack of the ethyl molecule on the carbonyl carbon.
Thus, ethyl hexanoate is formed as a product.
To learn more about cyclic ester, follow the link;
https://brainly.com/question/10840252
#SPJ2
Which aquatic organism would be least likely to survive in a <7 pH environment?
protozoa
worms
algae
bacteria
what happens when co2 dissolves in water
A headline for a newspaper in a small town reads: "Sheriff Killed by a Poison that has Killed More People Than Any
Other Poison." How was the sheriff poisoned?
thallium
cyanide
arsenic
strychnine
The sheriff was poisoned by the use of the arsenic poison.
How does arsenic poison work?Arsenic is a toxic substance that can be deadly if ingested or inhaled in high concentrations. It works by disrupting important cellular processes and functions within the body.
When arsenic is ingested, it is absorbed through the digestive system and enters the bloodstream. From there, it is transported to various organs and tissues throughout the body, including the liver, kidneys, and lungs.
Arsenic interferes with the enzymes and proteins that are essential for cellular metabolism, DNA synthesis, and other important cellular processes. This disruption can cause a range of symptoms, including abdominal pain, diarrhea, vomiting, and dehydration.
Arsenic can also cause damage to the nervous system, leading to neurological symptoms such as confusion, seizures, and numbness or tingling in the extremities.
Learn more about arsenic:https://brainly.com/question/493434
#SPJ1
1. What are the two properties a force have that make
it a vector quantity? (Identify the force )
Answer:
magnitude and direction
What is the function of a lyase enzyme?
a. To assist the substrate by binding to the enzyme, enabling substrate to active site engagement
b. To facilitate a reaction of one substrate to form two products with the use of water
c. To facilitate a reaction of one substrate to form two products without the use of water
d. To tell fibs
Answer:
c. To facilitate a reaction of one substrate to form two products without the use of water
Explanation:
A lyase is an enzyme that catalyzes - accelerates the chemical reaction - in which a substrate is broken into two molecules. The reaction does not involve hydrolysis or oxidation, so the water molecule is not included in the chemical reaction. Thus, the enzyme facilitates the reaction in which a molecule (substrate) is decomposed into two molecules with the elimination of chemical bonds.
Write the molecular formula for maltose by adding the correct subscripts. C H O
Answer:
The molecular formula of maltose is C12H22O11.
HOPE IT HELPS!!!!!!!Fill in the table with the volume of each sample. Use the periodic table to find the molar mass of each molecule. Then calculate the mass of the gas in each balloon.Periodic TableFirst, compare the two oxygen samples. Consider how volume relates to the number of moles. Now compare the two gases with the same volume. Is there a relationship between volume and mass?
1) First let's calculate the molar mass of O₂ and H₂:
O₂: (16x2) = 32 g/mol (for both oxygen 1 and 2)
H₂: (1x2) = 2 g/mol
2) Now let's calculate the mass of gas sample (g) of:
Oxygen 1:
mass = mole x molar mass
mass = 1 x 32 = 32 g
Mass of Oxygen 1: 32 g
Oxygen 2:
mass = mole x molar mass
mass = 2 x 32 = 64 g
Mass of Oxygen 2: 64 g
Hydrogen:
mass = mole x molar mass
mass = 1 x 2 = 2 g
Mass of Hydrogen: 2 g
For the two oxygen samples, if the number of moles double, the mass double and the volume also double.
But the two gases of the same volume have different masses (Hydrogen 2 g and
oxygen 32 g). So there is no relationship between volume and mass for different gases.
A) balance the equation B) if a bottle of nail polish remover contains 155g of acetone how much heat is released by its complete combustion =-1790kj/mol
a) Balance the equation
To balance the equation we must count the atoms of each element on both sides of the reaction. In the following figure, I will write the number of atoms of each element and I will update it as I explain it to you.
We see that we have three carbon atoms in the reactants, we must put the coefficient 3 in front of the CO2 molecule to have the same amount. I will update the figure.
Now we will balance the hydrogen, we have 6 hydrogens in the reactants. To have 6 in the products we place the coefficient 3 in front of H2O.
Finally, we balance the oxygen atoms. We have 9 oxygens in the reactants, we put the coefficient 4 in the molecule O2 to have 8 oxygen atoms, plus the oxygen of the C3H6O molecule we will have 9 in total.
Now we have the same number of atoms of each element on both sides of the reaction, the equation is balanced and will be equal to:
\(C_3H_6O_{(l)}+4O_{2(g)}\rightarrow3CO_{2(g)}+3H_2O_{(g)}\)b) Heat of the reaction
They give us the heat of reaction per mole of acetone that reacts. We must calculate the moles of acetone that are contained in 155g and multiply this value by the given heat. The molar mass of acetone is 58.08g/mol.
Moles of acetone:
\(\begin{gathered} MolC_3H_6O=GivengC_3H_6O\times\frac{1molC_3H_6O}{MolarMass,gC_3H_6O} \\ molC_3H_6O=155gC_3H_6O\times\frac{1molC_3H_6O}{58.08gC_3H_6O}=2.67molC_3H_6O \end{gathered}\)Heat of the reaction:
\(\begin{gathered} HeatReaction=-1790\frac{kJ}{mol}\times2.67molC_3H_6O \\ HeatReaction=-4777kJ \end{gathered}\)If react 155g of acetone the heat released will be -4777kJ
aqueous lead (ii) chloride reacts with aqueous sodium sulfate to produce a lead(ii) sulfate precipitate and aqueous sodium chloride
The equation of the reaction leading to the formation of the precipitate is; \(PbCl_{2}(aq) + Na_{2} SO_{4} (aq) ---- > PbSO_{4}(s) + 2NaCl(aq)\)
What is the precipitate?We define a precipitate as a compound that can be formed as a solid when we mix two aqueous solutions. An aqueous solution is a solution of a substance that have been dissolved in water.
Thus, when we have a mixture of two liquid reactants and then one of the products does separate itself out of the solution then we say that a precipitate has been formed.
In this case, we are to write down the equation of the reaction between aqueous lead (ii) chloride reacts with aqueous sodium sulfate to produce a lead(ii) sulfate. The solid would separate out of the system and we can see the white color of the lead(ii) sulfate.
Learn more about precipitate:https://brainly.com/question/16950193
#SPJ1
Balance the following half eqn. in alkaline medium. Mno-4___ Mno2
MnO4- + 4e- → MnO2 + 2H2O Now the half-equation is balanced in alkaline medium.
To balance the half-equation MnO4- → MnO2 in alkaline medium, we need to follow the steps for balancing redox reactions in basic solution. The goal is to balance the number of atoms and charges on both sides of the equation.
Start by balancing the atoms other than oxygen and hydrogen. In this case, we only have manganese (Mn) atoms. There is one Mn atom on both sides, so the Mn atoms are already balanced.
Balance the oxygen atoms by adding water (H2O) molecules to the side that lacks oxygen. Since there are four oxygen atoms on the left side (MnO4-) and only two on the right side (MnO2), we need to add two water molecules to the right side:
MnO4- → MnO2 + 2H2O
Next, balance the hydrogen atoms by adding hydrogen ions (H+) to the side that lacks hydrogen. In this case, the left side (MnO4-) already has sufficient hydrogen atoms, so no hydrogen ions need to be added.
Balance the charges by adding electrons (e-) to the side that has a higher charge. MnO4- has a charge of -1, while MnO2 has no charge. Since the left side has a higher charge, we need to add electrons to the right side:
MnO4- + 4e- → MnO2 + 2H2O
Now the half-equation is balanced in alkaline medium. The Mn atoms, oxygen atoms, hydrogen atoms, and charges are all balanced. The addition of water and hydrogen ions helps balance the oxygen and hydrogen atoms, while the addition of electrons balances the charges.
For more such questions on alkaline medium. visit:
https://brainly.com/question/27960992
#SPJ8
Chemical energy can be transformed into mechanical energy in a fan. However, what is the step that is missing from the diagram that shows how this transformation works?
Question 17 options:
A. magnetic energy
B. transformational energy
C. electrical energy
D. heat energy
Answer:
we can't see the diagram
Answer!! 50 points
Which statement describes the properties of lanthanoids and actinoids?(1 point)
A. They are malleable and lustrous, and they tend to conduct both electricity and thermal energy.
B. They are brittle and dull, and they tend to conduct both electricity and thermal energy.
C. They are brittle and dull, and they tend to be poor conductors of both electricity and thermal energy.
D. They are malleable and lustrous, and they tend to be poor conductors of both electricity and thermal energy.
Answer:
a i j took test and c was wrong
Explanation:
Answer:
the answer is a. c is wrong
Explanation:
What is the correct formula that would result from the combination of the two ionic species? Cu2+ and SO42-
Give an example that illustrates the importance of chirality in a named biological molecule.
Answer:
Chirality is a particularly important concept in biology, because cells are mostly composed of chiral molecules. Small chiral molecules such as amino acids and sugars (figure 1, top) are the building blocks of larger molecules, such as proteins and nucleic acids, which are also chiral
a multistep reaction can only occur as fast as its slowest step. therefore, it is the rate law of the slow step that determines the rate law for the overall reaction.
The rate law for the overall reaction is, \(k[A][B]\).
Rate law, It is defined as the expression which expresses the rate of the reaction in terms of molar concentration of the reactants with each term raised to the power their stoichiometric coefficient of that reactant in the balanced chemical equation.
As we are given the mechanism for the reaction :
Step 1 : \(A+B \rightarrow AB\) (slow)
Step 2 : \(A+AB \rightarrow A_2B\) (fast)
Overall reaction : \(2A+B \rightarrow A_2B\)
The rate law expression for overall reaction should be in terms of A and B.
As we know that the slow step is the rate determining step. So,
The slow step reaction is, \(A+B \rightarrow AB\).
The expression of rate law for this reaction will be, \(k[A][B]\)
Hence, the rate law for the overall reaction is \(k[A][B]\).
To know more about the rate law, here
brainly.com/question/29811504
#SPJ4