A clear colourless liquad that can be spilt into two gasses into different properties
Which of the following is an incorrect representation for a neutral atom?
36Li
613C
3063Cu
1530P
This representation suggests that the element is phosphorus (P) with a mass number of 30, which is incorrect. The correct mass number for phosphorus is approximately 30.97. The incorrect representation for a neutral atom is 36Li
To determine the correct representation for a neutral atom, we need to consider the atomic number (Z) and mass number (A) of the element. The atomic number represents the number of protons in the nucleus, while the mass number represents the sum of protons and neutrons.
Let's analyze the given representations:
36Li:
This representation suggests that the element is lithium (Li) with a mass number of 36, which is incorrect. The correct mass number for lithium is approximately 6.94.
613C:
This representation suggests that the element is carbon (C) with a mass number of 13, which is correct. Carbon has different isotopes, and 13C represents one of its stable isotopes.
3063Cu:
This representation suggests that the element is copper (Cu) with a mass number of 63, which is correct. Copper has different isotopes, and 63Cu represents one of its stable isotopes.
1530P:
This representation suggests that the element is phosphorus (P) with a mass number of 30, which is incorrect. The correct mass number for phosphorus is approximately 30.97.
Therefore, the incorrect representation for a neutral atom is 36Li, as it does not match the known properties of lithium.
For more question on atom
https://brainly.com/question/26952570
#SPJ8
Which type of cell is shown in the following image?
Answer:
A prokaryotic cell is shown in the image
Explanation:
Prokaryotic cells are the most basic types. Since they are basic, they don't have a nucleus. All eukaryotic cells have it but prokaryotic cells don't have it. A nucleus contains organelles such as a mitochondria which the diagram doesn't show as well. Thus a prokaryotic cell is shown in the image.
An electrode has a negative electrode potential. Which statement is correct regarding the potential energy of an electron at this electrode?
A. An electron at this electrode has the same potential energy as it has at a standard hydrogen electrode.
B. An electron at this electrode has a lower potential energy than it has at a standard hydrogen electrode.
C. An electron at this electrode has a higher potential energy than it has at a standard hydrogen electrode.
Answer:
C. An electron at this electrode has a higher potential energy than it has at a standard hydrogen electrode.
Explanation:
The standard hydrogen electrode (SHE) is used to measure the electrode potential of substances. The standard hydrogen electrode is arbitrarily assigned an electrode potential of zero. Recall that electrode potentials are always measured as reduction potentials in electrochemical systems.
For an electrode that has a negative electrode potential, electrons at this electrode have a higher potential energy compared to electrons at the standard hydrogen electrode. Electrons flow from this electrode to the hydrogen electrode.
On the other hand, a positive electrode potential implies that an electron at this electrode has a lower potential energy than it has at a standard hydrogen electrode. Hence electrons will flow from the standard hydrogen electrode to this electrode.
Give the structures of the free‑radical intermediates in the peroxide‑initiated reaction of HBr
with the following alkene. Include all lone‑pair electrons and unpaired electrons. Hint: the radicals do not coexist in the same mechanistic step.
The peroxide addition would yield a product that is different from the antiperoxide addition
What is the structure?Markovnikov's rule states that when a protic acid HX is added to an alkene, the acid hydrogen (H) forms a bond with the carbon atom that has the greatest number of hydrogen atoms, while the halide (X) group forms a bond with the carbon atom that has the fewest hydrogen atoms.
This can be summed up with the phrases "the rich get richer" and "the poor get poorer" in terms of hydrogen. This fundamental principle of alkene chemistry aids in predicting the results of addition reactions.
Learn more about alkene:https://brainly.com/question/17017195
#SPJ1
Draw the Lewis structure for POCI_3 in the window below and then decide if the molecule is polar or nonpolar. Is POCI_3 polar or nonpolar?
The molecule is polar.
Since o is more electronegative it is on top and a being less electronegative is towards the bottom. Because the POCl3 molecule is nonsymmetric (o will pull the e from P and I will abo pull & from 1) so, it is Polar.
A molecule is non-polar if the arrangement is symmetrical and the arrows have the same length. A molecule is polar if the arrows are of different lengths and are not balanced. A molecule is polar if the configuration is asymmetric. When things are different at each end, we call them polar. Also, some molecules have positive and negative ends, and when they are present, we call them polar.
Learn more about A molecule here:- https://brainly.com/question/26044300
#SPJ4
Big assignment please help. Will do anything
Wine goes bad soon after opening because the ethanol (CH3CH2OH) dissolved in it reacts with oxygen (O2) gas to form water and aqueous acetic acid (CH3COOH), the main ingredient in vinegar. Calculate the moles of oxygen needed to produce 0.080 mol of water. Be sure your answer has a unit symbol, if necessary, and round it to 2 significant digits.
The number of mole of oxygen needed is of 0.080 mole.
To solve this question, we'll begin by writing the balanced equation for the reaction. This is illustrated below:
CH₃COOH + 2O₂ —> CO₂ + 2H₂OFrom the balanced equation above,
2 moles of O₂ reacted to produce 2 moles of H₂O.
Finally, we shall determine the number of mole of O₂ needed to produce 0.080 mole of H₂O. This can be obtained as follow:
From the balanced equation above,
2 moles of O₂ reacted to produce 2 moles of H₂O.
Therefore,
0.080 mole of O₂ will also react to produce 0.080 mole of H₂O.
Thus, 0.080 mole of oxygen, O₂, is needed for the reaction.
Learn more: https://brainly.com/question/1563415
What is the molality of a solution prepared by dissolving 56.1 grams of NaCl in 60.0 mL of water?
The molality of a solution prepared by dissolving 56.1 grams of NaCl in 60.0 mL of water is 16mol/kg.
How to calculate molality?Molality is the concentration of a substance in solution, expressed as the number of moles of solute per kilogram of solvent.
This means that the molality can be calculated by dividing the number of moles of solute by mass in kilograms of solvent.
moles of NaCl = 56.1g ÷ 58.5g/mol = 0.96 moles
The mass of the solvent (water) can be calculated as follows:
Density = mass ÷ volume
1g/mL = mass ÷ 60mL
mass = 60g, which is equivalent to 0.06kg
Molality = 0.96mol ÷ 0.06kg = 16mol/kg
Learn more about molality at: https://brainly.com/question/26921570
#SPJ1
10. What are the upper and lower extremes of
the moisture content of wood?
In a chemical reaction is a new substance obtained? Explain your answer
Express the following in scientific notation:
1. 158000 km
2. 0.000009782 L
Answer:
1.58x10^5km
9.782x10^-6
Explanation:
Please Brainlist
Use this equation for the next question:
2NaOH + H2SO4 ® Na2SO4 + 2H20
If a reaction produces 0.75 moles Na2SO4, how many moles of NaOH were used?
0.75 moles NaOH
2 moles NaOH
.375 moles NaOH
1.5 moles NaOH
The graph shows five data points collected in an investigation of the relationship between the concentration of alcohol dissolved in water and its density. The relationship was expected to be linear. Which of the data points most likely resulted from an error in procedure? a 1 b 2 c 4 d 5
In comparison to modern, highly accurate density meters or pycnometers, hydrometers are far less accurate and temperature.
Thus, Although they require very large sample sizes, hydrometers are rather simple to operate. Usually, 300 to 500 ml per measurement are required. Hydrometers frequently require calibration off-site as well.
With measurements taken by eye, user error is a major issue, and temperature management is especially challenging. Inaccurately bringing and maintaining samples at temperature might take a long time, and once more, user perception of temperature levels is used to determine temperature levels.
Pycnometers and hydrometers have a further problem in that the findings of alcohol measurement are challenging to evaluate and record.
Thus, In comparison to modern, highly accurate density meters or pycnometers, hydrometers are far less accurate and temperature.
Learn more about Temperature, refer to the link:
https://brainly.com/question/7510619
#SPJ1
How many molecules are contained in 55.0g of co2??
Answer: 7.52*10^23 molecules.
Explanation: This is a classic Stoichiometry problem.
In one mole of any substance, there are 6.02*10^23 molecules. This number is called Avogadro's number. We are given 55 grams of Co2 so to convert that to moles, we divided by the molar mass of Co2. We find the molar mass by adding the molar masses of the elements that make up the compound.
There is one molecule of Carbon and two molecules of Oxygen in one molecule of Co2. From the periodic table, the molar mass of Carbon is 12.01 and 16.00 for Oxygen. 1(12.01)+2(16.00) gives us the molar mass. We then divided 55 grams by that mass to find the number of moles. We then multiply the number of moles by Avogadro's number (6.02*10^23) to find the total number of molecules.
You can use this method for solving any problem that asks you to find the number of atoms or molecules of some number of grams of a substance.
A compound contains only C, H, and N. Combustion of a 40.28 g sample of the compound produces 38.46 g of carbon dioxide, 47.25 g of water, and some nitrogen gas. A separate experiment determines the molecular mass of the compound to be 138.3 g/mol. Determine the empirical formula and molecular formula for the compound.
Answer:24435
Explanation w49439r chusb
Pretest Unit 1
Question 11 of 30
What is the change in the freezing point of water when 35.0 g of sucrose is
dissolved in 300.0 g of water?
K, of water = -1.86°C/mol
molar mass sucrose = 342.30 g/mol
ivalue of sugar = 1
ΔTf=−0.634°C
Explanation:
We're asked to find the freezing point depression of a solution.
To do this, we use the equation
ΔTf= i⋅m⋅Kf
where,
ΔTf is the change in freezing point temperature that we're trying to find.
i is the Van't Hoff factor, which is given as 1 (and usually is 1 in the case of nonelectrolytes)
m is the molality of the solution, which is
molality = mol solute /kg solvent
Convert the given mass of sucrose to moles using its molar mass:
35.0g sucrose(1lmol sucrose342.30g sucrose)=0.102 mol sucrose
The molality is thus
molality=0.120lmol sucrose/0.3000lkg water=0.341m
K f is the molal freezing point constant for the solvent (water), which is given as −1.86°C/m
Plugging in known values, we have
ΔTf=(1)(0.341m)(−1.86l°C/m)
=−0.634l°C
This represents how much the freezing point decreases. The new freezing point of the solution is found by adding this value from the normal freezing point of the solvent ( 0.0°Cfor water):
new f.p. = 0.0°C −0.634°C
= −0.6341°C
Learn more about The freezing point here:-https://brainly.com/question/24314907
#SPJ9
A chemist must dilute 41.6 mL of 3.13 M aqueous sodium thiosulfate (Na2S20,) solution until the concentration falls to 1.00 M. He'll do this by adding distilled water to the solution until it reaches a certain final volume. Calculate this final volume, in liters. Round your answer to 3 significant digits.
The final volume of the of the dilute solution is 0.13 L. This is calculated by using dilution equation.
Dilution is defined as the process of decreasing the concentration of a solute in a solution by mixing with more solvent like adding more water to the solution. Dilution means to add more solvent without the addition of more solute. Dilution decreases the concentration of the solute in the solution. According to the dilution equation,
M1V1 = M2V2
Here, M1 is the initial concentration, V1 is the initial volume, M2 is the concentration after mixing or diluting and V2 is the total final volume of the solution.
M1 = 3.13 M
V1 = 41.6 mL
M2 = 1.00 M
V2 = M1V1 / M2
V2 = 3.13 x 41.6 / 1.00
V2 = 130.21 mL
= 0.13 L
To learn more about Dilution Equation please visit:
https://brainly.com/question/11493179
#SPJ4
Why does understanding the Rock Cycle help us to plan living on the ocean? answer before it's too late!
Answer:
Learning the rock cycle and understanding the processes involved helps all of us. This is how soil forms, through the breakdown of rocks. We need soil to survive—imagine trying to grow vegetables without it. This is an immediate connection to the food chain
How many atoms are in 3.5 L of Neon at STP? Show your work
Answer:
0.1734
this is the answer to the question
(20 points) In the morning, you decide to make toasted bacon, lettuce, and tomato sandwich. Observe what happens in each stage of making the sandwich. Which parts involve only chemical changes happening?
I. The first thing you do is cut two slices of bread.
II. Then you put the slices in the toaster to cook. When the toaster is done, it pops the III. warm brown toast. You cook the bacon in a frying pan you put bacon, lettuce, and tomato on the bread, trimming the sides.
IV. You can smell the old bread in the garbage going moldy.
Steps I and II
Steps II and III
Steps II and IV
Steps III and IV
Answer:
C is the answer I did it and got it right
what is arcenic? Who can tell me!
Explanation:
Arsenic is a solid chemical element that is used especially in wood preservatives, alloys, and semiconductors and is extremely toxic in both pure and combined forms.
A poisonous trioxide As2O3 or As4O6 of arsenic is used especially as an insecticide or weed killer.
The answer choices for the first and second blank spaces are Element and compound The answer choices for the last blank space or element, compound, or mixture.
ANSWER
The element carbon combined with the element oxygen to form a compound carbon dioxide
EXPLANATION
Given information
\(\text{ C + O}_2\rightarrow CO_2\)The reaction above shows two reactants reacting to form a single products
Firstly, we will need to define the terms element and compound
Element is a substance that cannot be split into two simpler units by an ordinary chemical reaction.
The compound is defined as the combination of two or more elements that are chemically combined together
Therefore, from the given reaction, we can say that oxygen and carbon are elements, and they are reacting to give a product that is a compound (carbon dioxide).
Hence, the element carbon combined with the element oxygen to form a compound carbon dioxide
How many milliliters of a 12% (v/v) propyl alcohol solution would you need to obtain 7.5 mL of propyl alcohol? Answer to the tenth
\(\tt \dfrac{7.5}{12}\times 100=62.5~ml\)
deprotonate enolate enone
what do these terms mean?
Deprotonation refers to the removal of a proton from a molecule, while an enolate is an anionic species formed by deprotonation of the α-carbon adjacent to a carbonyl group. An enone, on the other hand, is a molecule containing a carbon-carbon double bond and a carbonyl group.
"Deprotonate," "enolate," and "enone" are terms used in organic chemistry to describe specific reactions and functional groups. Let's break down each term:
Deprotonate: Deprotonation refers to the removal of a proton (H+) from a molecule. It is a process that involves the transfer of a proton from a molecule to a base. The resulting species is negatively charged and called an anion.
Deprotonation reactions are common in various organic reactions and play a crucial role in the formation of new bonds and the generation of reactive intermediates.
Enolate: An enolate is an anionic species that contains a carbon-carbon double bond and a negatively charged oxygen or nitrogen atom. Enolates are formed through deprotonation of the α-carbon adjacent to a carbonyl group (such as a ketone or aldehyde).
The formation of enolates is an important step in many organic reactions, such as aldol condensation and Michael addition, as enolates serve as nucleophiles or reactive intermediates.
Enone: An enone is a molecule that contains a carbon-carbon double bond (C=C) and a carbonyl group (C=O) adjacent to each other. Enones are carbonyl compounds that possess a conjugated double bond system. They exhibit unique reactivity due to the presence of both a double bond and a carbonyl group, making them valuable intermediates in organic synthesis.
Enones are involved in various reactions, including Michael additions, Diels-Alder reactions, and cycloadditions, to form complex organic compounds.
For more such question on Deprotonation. visit :
https://brainly.com/question/28480664
#SPJ8
Design a synthesis of isopropyl cyclopentylacetate from ethyl acetoacetate, diethyl malonate, and alkenes possessing five carbons or fewer.
Answer:
Hello your question is incomplete attached below is the complete question
answer : attached below
Explanation:
The design is attached below
The reagents are : H₂SO₄, H₂O, HBr, NaOCH₂CH₃
For the scheme = 1.NaOH,H2O 2. H₃O+3, heat, SOCl₂, Et3N
write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
What volume of concentrated 15M H2SO4 is required to prepare 0.75 liters of a 6.0M solution?
Answer:
30 ml
Explanation:
Question 1
Given the equation: Q = mcAT
Q = heat (in Joules)
m = mass (in grams)
C = 4.18 (specific heat capacity)
AT change in temperature (°C)
How many Joules of heat energy are absorbed when 200 grams of water are heated from 20 C to 60 C.
The amount of heat energy absorbed when 200 grams of water are heated from 20 C to 60 C is 33,440 Joules.
To find the amount of heat energy absorbed when 200 grams of water are heated from 20 C to 60 C, we can use the equation Q = mcAT.
First, we need to find the value of m, which is the mass of the water in grams. In this case, it is given as 200 grams.
Next, we need to find the value of AT, which is the change in temperature in degrees Celsius.
This can be calculated by subtracting the initial temperature from the final temperature, which gives us 60 C - 20 C = 40 C.
The specific heat capacity of water, C, is given as 4.18 Joules per gram per degree Celsius.
Now we can plug in the values into the equation:
Q = mcAT
Q = (200 g) x (4.18 J/g°C) x (40°C)
Q = 33,440 J
Therefore, the amount of heat energy absorbed when 200 grams of water are heated from 20 C to 60 C is 33,440 Joules.
for more such question on heat energy
https://brainly.com/question/25603269
#SPJ8
When 1604 J of heat energy is added to 48.9 g of hexane, C6H14, the temperature increases by 14.5 ∘C. Calculate the molar heat capacity of C6H14.
Answer:
THE MOLAR HEAT CAPACITY OF HEXANE IS 290.027 J/ C
Explanation:
1604 J of heat is added to 48.9 g of hexane
To calculate the molar heat capacity of hexane, it is important to note that the molar heat capacity of a substance is the measure of the amount of heat needed to raise 1 mole of a substance by 1 K.
Since 1604 J of heat = 48.9 g of hexane
Molar mass of hexane = 86 g/mol = 1 mole
then;
1604 J = 48.9 g
x = 86 g
x = 1604 * 86 / 48.9
x = 4205.4 J
Hence, 4205.4 J of heat will be added to 1 mole or 86 g of hexane to raise the temperature by 14.5 C.
In other words,
heat = molar heat capacity * temperature change
molar heat capacity = heat/ temperature change
Molar heat capacity = 4205.4 J / 14.5 C
Molar heat capacity = 290.027 J/C
The molar heat capacity of hexane is 290.027 J/ C